From 94f579e8e3345622c0936997b6eb0c356408373c Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 13:25:15 +0800
Subject: [PATCH 01/27] CompileAsset function from Asset manager is working

---
 .../src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp       | 2 ++
 1 file changed, 2 insertions(+)

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index 4983bd48..bc485b40 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -37,6 +37,7 @@ of DigiPen Institute of Technology is prohibited.
 #include "Assets/Asset Types/SHTextureAsset.h"
 #include "Graphics/MiddleEnd/Interface/SHMousePickSystem.h"
 #include "Graphics/MiddleEnd/Lights/SHLightingSubSystem.h"
+#include "Assets/SHAssetManager.h"
 
 namespace SHADE
 {
@@ -109,6 +110,7 @@ namespace SHADE
     transferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
     graphicsTexCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
 
+    SHAssetManager::CompileAsset("../../Assets/Shaders/DeferredComposite_CS.glsl");
 
     shaderModuleLibrary.ImportAllShaderSource(device);
     shaderModuleLibrary.ReflectAllShaderModules();

From fad9d37cd4ca683d27be892b26334046c62f64b5 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 14:17:36 +0800
Subject: [PATCH 02/27] Lighting data is now copied to CPU buffer and GPU
 buffer every frame

Since lighting will be done in view space, the camera's constant movement will make it so that the light data is often changing. Keeping track of these changes for optimization might prove to be counter productive. Copying data every frame might just be more ideal.
---
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |  2 +
 .../MiddleEnd/Interface/SHGraphicsSystem.h    |  6 +-
 .../MiddleEnd/Lights/SHLightComponent.cpp     | 82 +++++++++----------
 .../MiddleEnd/Lights/SHLightComponent.h       | 22 ++---
 .../MiddleEnd/Lights/SHLightingSubSystem.cpp  | 46 ++++++-----
 .../MiddleEnd/Lights/SHLightingSubSystem.h    |  8 +-
 6 files changed, 86 insertions(+), 80 deletions(-)

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index bc485b40..5deb83a9 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -110,6 +110,8 @@ namespace SHADE
     transferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
     graphicsTexCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
 
+    SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_VS.glsl");
+    SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_FS.glsl");
     SHAssetManager::CompileAsset("../../Assets/Shaders/DeferredComposite_CS.glsl");
 
     shaderModuleLibrary.ImportAllShaderSource(device);
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
index 0f9d602a..072a1d99 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
@@ -358,9 +358,9 @@ namespace SHADE
     Handle<SHPostOffscreenRenderSystem>                       postOffscreenRender;
     Handle<SHLightingSubSystem>                               lightingSubSystem;
 
-    uint32_t                                                  resizeWidth;
-    uint32_t                                                  resizeHeight;
-    bool restoredFromMinimize = false;
+    uint32_t                                                  resizeWidth = 1;
+    uint32_t                                                  resizeHeight = 1;
+    bool                                                      restoredFromMinimize = false;
 
   };
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.cpp
index fb8795fa..2ea6bc8b 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.cpp
@@ -9,9 +9,9 @@ namespace SHADE
   {
     lightData.Reset();
     SetType(SH_LIGHT_TYPE::DIRECTIONAL);
-    indexInBuffer = std::numeric_limits<uint32_t>::max();
+    //indexInBuffer = std::numeric_limits<uint32_t>::max();
     isActive = true;
-    Unbind();
+    //Unbind();
   }
 
 
@@ -23,28 +23,28 @@ namespace SHADE
   void SHLightComponent::SetPosition(SHVec3 const& position) noexcept
   {
     lightData.position = position;
-    MakeDirty();
+    //MakeDirty();
   }
 
 
   void SHLightComponent::SetType(SH_LIGHT_TYPE type) noexcept
   {
     lightData.type = type;
-    MakeDirty();
+    //MakeDirty();
   }
 
 
   void SHLightComponent::SetDirection(SHVec3 const& direction) noexcept
   {
     lightData.direction = direction;
-    MakeDirty();
+    //MakeDirty();
   }
 
 
   void SHLightComponent::SetColor(SHVec4 const& color) noexcept
   {
     lightData.color = color;
-    MakeDirty();
+    //MakeDirty();
   }
 
   void SHLightComponent::ModifyCullingMask(uint8_t layerIndex, bool value) noexcept
@@ -54,7 +54,7 @@ namespace SHADE
     else
       lightData.cullingMask &= ~(1u << layerIndex);
 
-    MakeDirty();
+    //MakeDirty();
   }
 
   void SHLightComponent::SetCullingMask(uint32_t const& value) noexcept
@@ -65,43 +65,43 @@ namespace SHADE
   void SHLightComponent::SetAllLayers(void) noexcept
   {
     lightData.cullingMask = std::numeric_limits<uint32_t>::max();
-    MakeDirty();
+    //MakeDirty();
   }
 
 
   void SHLightComponent::ClearAllLayers(void) noexcept
   {
     lightData.cullingMask = 0;
-    MakeDirty();
+    //MakeDirty();
   }
 
-  void SHLightComponent::MakeDirty(void) noexcept
-  {
-    dirty = true;
-  }
+  //void SHLightComponent::MakeDirty(void) noexcept
+  //{
+  //  dirty = true;
+  //}
 
-  void SHLightComponent::ClearDirtyFlag(void) noexcept
-  {
-    dirty = false;
-  }
+  //void SHLightComponent::ClearDirtyFlag(void) noexcept
+  //{
+  //  dirty = false;
+  //}
 
-  void SHLightComponent::Unbind(void) noexcept
-  {
-    bound = false;
-    MakeDirty();
-  }
-
-  void SHLightComponent::SetBound(uint32_t inIndexInBuffer) noexcept
-{
-    bound = true;
-    indexInBuffer = inIndexInBuffer;
-  }
+//  void SHLightComponent::Unbind(void) noexcept
+//  {
+//    bound = false;
+//    MakeDirty();
+//  }
+//
+//  void SHLightComponent::SetBound(uint32_t inIndexInBuffer) noexcept
+//{
+//    bound = true;
+//    indexInBuffer = inIndexInBuffer;
+//  }
 
 
   void SHLightComponent::SetStrength(float value) noexcept
   {
     lightData.strength = value;
-    MakeDirty(); 
+    //MakeDirty(); 
   }
 
   SHLightData const& SHLightComponent::GetLightData(void) const noexcept
@@ -135,20 +135,20 @@ namespace SHADE
   }
 
 
-  bool SHLightComponent::IsDirty(void) const noexcept
-  {
-    return dirty;
-  }
+  //bool SHLightComponent::IsDirty(void) const noexcept
+  //{
+  //  return dirty;
+  //}
 
-  bool SHLightComponent::GetBound(void) const noexcept
-  {
-    return bound;
-  }
+  //bool SHLightComponent::GetBound(void) const noexcept
+  //{
+  //  return bound;
+  //}
 
-  uint32_t SHLightComponent::GetIndexInBuffer(void) const noexcept
-  {
-    return indexInBuffer;
-  }
+  //uint32_t SHLightComponent::GetIndexInBuffer(void) const noexcept
+  //{
+  //  return indexInBuffer;
+  //}
 
   float SHLightComponent::GetStrength(void) const noexcept
   {
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.h b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.h
index 81eb80f5..6b35559c 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightComponent.h
@@ -17,13 +17,13 @@ namespace SHADE
     //! Since the lighting system is gonna be self contained and light weight, we store this
     //! so that we only write this to the CPU buffer when this light component change, we don't 
     //! rewrite everything. However we still write to the GPU buffer when everything changes.
-    uint32_t indexInBuffer;
+    //uint32_t indexInBuffer;
 
-    //! If the light component changed some value we mark this true.
-    bool dirty;
+    ////! If the light component changed some value we mark this true.
+    //bool dirty;
 
-    //! If the light's data is already in the buffers, this will be set to true.
-    bool bound;
+    ////! If the light's data is already in the buffers, this will be set to true.
+    //bool bound;
 
   	
   public:
@@ -44,10 +44,10 @@ namespace SHADE
     void SetCullingMask    (uint32_t const& value) noexcept;
     void SetAllLayers      (void) noexcept; // serialized
     void ClearAllLayers    (void) noexcept; // serialized
-    void MakeDirty         (void) noexcept; 
-    void ClearDirtyFlag    (void) noexcept;
-    void Unbind            (void) noexcept; 
-    void SetBound          (uint32_t inIndexInBuffer) noexcept;
+    //void MakeDirty         (void) noexcept; 
+    //void ClearDirtyFlag    (void) noexcept;
+    //void Unbind            (void) noexcept; 
+    //void SetBound          (uint32_t inIndexInBuffer) noexcept;
     void SetStrength       (float value) noexcept; // serialized
     
 
@@ -57,8 +57,8 @@ namespace SHADE
     SHVec3 const&      GetDirection     (void) const noexcept; // serialized
     SHVec4 const&      GetColor         (void) const noexcept; // serialized
     uint32_t const&    GetCullingMask   (void) const noexcept; // serialized
-    bool               IsDirty          (void) const noexcept;
-    bool               GetBound         (void) const noexcept;
+    //bool               IsDirty          (void) const noexcept;
+    //bool               GetBound         (void) const noexcept;
     uint32_t           GetIndexInBuffer (void) const noexcept;
     float              GetStrength      (void) const noexcept;
     RTTR_ENABLE()
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
index 5ca879c4..c4ba9fa1 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
@@ -240,7 +240,7 @@ namespace SHADE
 
   */
   /***************************************************************************/
-  void SHLightingSubSystem::PerTypeData::AddLight(Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool expanded) noexcept
+  void SHLightingSubSystem::PerTypeData::AddLight(Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool& expanded) noexcept
   {
     if (unboundLight)
     {
@@ -262,7 +262,7 @@ namespace SHADE
       WriteLightToAddress(writeLocation, unboundLight);
 
       // Set the light component to be bound to that location
-      unboundLight->SetBound(numLights);
+      //unboundLight->SetBound(numLights);
 
       // Increase light count
       ++numLights;
@@ -280,11 +280,11 @@ namespace SHADE
    
   */ 
   /***************************************************************************/
-  void SHLightingSubSystem::PerTypeData::ModifyLight(SHLightComponent* lightComp) noexcept
-  {
-    void* writeLocation = reinterpret_cast<uint8_t*>(intermediateData.get()) + (lightDataAlignedSize * lightComp->GetIndexInBuffer());
-    WriteLightToAddress(writeLocation, lightComp);
-  }
+  //void SHLightingSubSystem::PerTypeData::ModifyLight(SHLightComponent* lightComp) noexcept
+  //{
+  //  void* writeLocation = reinterpret_cast<uint8_t*>(intermediateData.get()) + (lightDataAlignedSize * lightComp->GetIndexInBuffer());
+  //  WriteLightToAddress(writeLocation, lightComp);
+  //}
 
   void SHLightingSubSystem::PerTypeData::WriteToGPU(uint32_t frameIndex) noexcept
   {
@@ -406,7 +406,7 @@ namespace SHADE
     	dynamicOffsets[i].resize(NUM_LIGHT_TYPES + 1); // +1 for the count
     }
 
-    numLightComponents = 0;
+    //numLightComponents = 0;
   }
 
   /***************************************************************************/
@@ -419,21 +419,25 @@ namespace SHADE
     
   */
   /***************************************************************************/
-  void SHLightingSubSystem::Run(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept
+  void SHLightingSubSystem::Run(Handle<SHVkCommandBuffer> cmdBuffer, /*SHMatrix const& viewMat,*/ uint32_t frameIndex) noexcept
   {
     static uint32_t constexpr NUM_LIGHT_TYPES = SHUtilities::ToUnderlying(SH_LIGHT_TYPE::NUM_TYPES);
 
     auto& lightComps = SHComponentManager::GetDense<SHLightComponent>();
     bool expanded = false;
-    bool rewrite = false;
 
-    if (numLightComponents > lightComps.size())
-    {
-      rewrite = true;
-      ResetNumLights();
-    }
+    // First we reset the number of lights. We do this every frame so that we can count how many lights we have
+    ResetNumLights();
 
-    numLightComponents = lightComps.size();
+    //bool rewrite = false;
+
+    //if (numLightComponents > lightComps.size())
+    //{
+    //  rewrite = true;
+    //  ResetNumLights();
+    //}
+
+    //numLightComponents = lightComps.size();
 
     for (auto& light : lightComps)
     {
@@ -441,22 +445,22 @@ namespace SHADE
 
       // First we want to make sure the light is already bound to the system. if it
       // isn't, we write it to the correct buffer.
-      if (!light.GetBound() || rewrite)
+      //if (!light.GetBound() || rewrite)
       {
         perTypeData[enumValue].AddLight(logicalDevice, &light, expanded);
 
-        //// add to light count
+        // add to light count
         //++lightCountsData[enumValue];
       }
 
       // if there was modification to the light data
-      if (light.IsDirty())
+      //if (light.IsDirty())
       {
         // Write the data to the CPU 
-        perTypeData[enumValue].ModifyLight(&light);
+        //perTypeData[enumValue].ModifyLight(&light);
 
         // Light is now updated in the container
-        light.ClearDirtyFlag();
+        //light.ClearDirtyFlag();
       }
     }
 
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
index fb7aa2de..4a667ec5 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
@@ -102,8 +102,8 @@ namespace SHADE
       /*-----------------------------------------------------------------------*/
       void InitializeData (Handle<SHVkLogicalDevice> logicalDevice, SH_LIGHT_TYPE type) noexcept;
       void Expand         (Handle<SHVkLogicalDevice> logicalDevice) noexcept;
-      void AddLight       (Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool expanded) noexcept;
-      void ModifyLight    (SHLightComponent* lightComp) noexcept;
+      void AddLight       (Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool& expanded) noexcept;
+      //void ModifyLight    (SHLightComponent* lightComp) noexcept;
       void WriteToGPU     (uint32_t frameIndex) noexcept;
       void ResetNumLights (void) noexcept;
 
@@ -144,7 +144,7 @@ namespace SHADE
     //! Number of SHLightComponents recorded. If at the beginning of the run function the size returned by the dense
     //! set is less than the size recorded, rewrite all light components into the its respective buffers. If its more,
     //! don't do anything.
-    uint32_t                                                                  numLightComponents;
+    //uint32_t                                                                  numLightComponents;
 
     /*-----------------------------------------------------------------------*/
     /* PRIVATE MEMBER FUNCTIONS                                              */
@@ -159,7 +159,7 @@ namespace SHADE
     /* PUBLIC MEMBER FUNCTIONS                                               */
     /*-----------------------------------------------------------------------*/
     void Init (Handle<SHVkLogicalDevice> device, Handle<SHVkDescriptorPool> descPool) noexcept;
-    void Run (Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept;
+    void Run (Handle<SHVkCommandBuffer> cmdBuffer, /*SHMatrix const& viewMat,*/ uint32_t frameIndex) noexcept;
     void Exit (void) noexcept;
 
   };

From 4711a131eb875fcb43706834c42960189e6e4fcf Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 16:35:55 +0800
Subject: [PATCH 03/27] Shifted the lighting system run outside the viewport
 loop.

- Since lighting is only calculated in the world render graph for now, this will do just fine
- Renderer takes in a view and projection matrix and does the transpose of the multiplication in the renderer
---
 Assets/Shaders/TestCube_VS.glsl               |   1 +
 Assets/Shaders/TestCube_VS.shshaderb          | Bin 3305 -> 3385 bytes
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |  16 ++++++++++---
 .../MiddleEnd/Interface/SHRenderer.cpp        |  17 ++++++++++----
 .../Graphics/MiddleEnd/Interface/SHRenderer.h |   8 ++++---
 .../MiddleEnd/Lights/SHLightingSubSystem.cpp  |  22 ++++++++++++------
 .../MiddleEnd/Lights/SHLightingSubSystem.h    |   8 ++++---
 7 files changed, 51 insertions(+), 21 deletions(-)

diff --git a/Assets/Shaders/TestCube_VS.glsl b/Assets/Shaders/TestCube_VS.glsl
index 49f107dd..44c6e956 100644
--- a/Assets/Shaders/TestCube_VS.glsl
+++ b/Assets/Shaders/TestCube_VS.glsl
@@ -33,6 +33,7 @@ layout(set = 2, binding = 0) uniform CameraData
 {
   vec4 position; 
   mat4 vpMat;
+  mat4 viewMat;
 } cameraData;
 
 void main()
diff --git a/Assets/Shaders/TestCube_VS.shshaderb b/Assets/Shaders/TestCube_VS.shshaderb
index 03e23af37451b6c4c0791110541c7b6e31d07bbe..2544abd58b576513f2e8185a0b84ef070e6a42fe 100644
GIT binary patch
delta 105
zcmaDUxl@Xn!GL!o^CKo<HU?IPcm@UrCLk`$OfC0KEZO{oDUeaugMkGu!3vc0KvJj-
a<Od*&ZPsFuWafsLqzIHy+w8?YpA`V4xDNgR

delta 35
rcmdlf^-_|V;Q`M^=0{AMe=-FyZf<1ZV`gVzh-YA6P~1F=eLgDy(DVu@

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index 5deb83a9..edf0be23 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -358,6 +358,17 @@ namespace SHADE
     auto cameraSystem = SHSystemManager::GetSystem<SHCameraSystem>();
     
 
+    {
+#ifdef SHEDITOR
+      auto editorSystem = SHSystemManager::GetSystem<SHEditor>();
+      if (editorSystem->editorState != SHEditor::State::PLAY)
+        lightingSubSystem->Run(cameraSystem->GetEditorCamera()->GetViewMatrix(), frameIndex);
+      else
+        lightingSubSystem->Run(worldRenderer->GetCameraDirector()->GetViewMatrix(), frameIndex);
+#else
+      lightingSubSystem->Run(worldRenderer->GetCameraDirector()->GetViewMatrix(), frameIndex);
+#endif
+    }
 
     // For every viewport 
     for (int vpIndex = 0; vpIndex < static_cast<int>(viewports.size()); ++vpIndex)
@@ -394,8 +405,7 @@ namespace SHADE
             currentCmdBuffer->BindIndexBuffer(buffer, 0);
         }
 
-        // Bind the descriptor set for lights
-        lightingSubSystem->Run(currentCmdBuffer, frameIndex);
+        lightingSubSystem->BindDescSet(currentCmdBuffer, frameIndex);
 
         // Bind textures
         auto textureDescSet = texLibrary.GetTextureDescriptorSetGroup();
@@ -419,7 +429,7 @@ namespace SHADE
         {
           auto editorSystem = SHSystemManager::GetSystem<SHEditor>();
           if (editorSystem->editorState != SHEditor::State::PLAY)
-            worldRenderer->UpdateDataAndBind(currentCmdBuffer, frameIndex, SHMatrix::Transpose(cameraSystem->GetEditorCamera()->GetProjMatrix() * cameraSystem->GetEditorCamera()->GetViewMatrix()));
+            worldRenderer->UpdateDataAndBind(currentCmdBuffer, frameIndex, cameraSystem->GetEditorCamera()->GetViewMatrix(), cameraSystem->GetEditorCamera()->GetProjMatrix());
           else
             renderers[renIndex]->UpdateDataAndBind(currentCmdBuffer, frameIndex);
         }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
index 962130be..a44e0661 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
@@ -83,13 +83,14 @@ namespace SHADE
   {
     if (camera && cameraDirector)
     {
-      UpdateDataAndBind(cmdBuffer, frameIndex, SHMatrix::Transpose(cameraDirector->GetVPMatrix()));
+      //UpdateDataAndBind(cmdBuffer, frameIndex, SHMatrix::Transpose(cameraDirector->GetVPMatrix()));
+      UpdateDataAndBind(cmdBuffer, frameIndex, cameraDirector->GetViewMatrix(), cameraDirector->GetProjMatrix());
     }
   }
 
-  void SHRenderer::UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix exteriorMatrix) noexcept
+  void SHRenderer::UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix viewMatrix, SHMatrix projMatrix) noexcept
   {
-    SetViewProjectionMatrix(exteriorMatrix);
+    SetViewProjectionMatrix(viewMatrix, projMatrix);
 
     //cpuCameraData.viewProjectionMatrix = camera->GetViewProjectionMatrix();
     cameraBuffer->WriteToMemory(&cpuCameraData, sizeof(SHShaderCameraData), 0, cameraDataAlignedSize * frameIndex);
@@ -103,10 +104,11 @@ namespace SHADE
   {
   }
 
-  void SHRenderer::SetViewProjectionMatrix(SHMatrix const& vpMatrix) noexcept
+  void SHRenderer::SetViewProjectionMatrix(SHMatrix viewMatrix, SHMatrix projMatrix) noexcept
   {
     //cpuCameraData.viewProjectionMatrix = camera->GetViewMatrix() * camera->GetProjectionMatrix();
-    cpuCameraData.viewProjectionMatrix = vpMatrix;
+    cpuCameraData.viewProjectionMatrix = SHMatrix::Transpose(projMatrix * viewMatrix);
+    cpuCameraData.viewMatrix = viewMatrix;
   }
 
   Handle<SHRenderGraph> SHRenderer::GetRenderGraph(void) const noexcept
@@ -119,4 +121,9 @@ namespace SHADE
     return commandBuffers[frameIndex];
   }
 
+  Handle<SHCameraDirector> SHRenderer::GetCameraDirector(void) const noexcept
+  {
+    return cameraDirector;
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
index 87cf8ee9..b7c6718c 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
@@ -46,6 +46,7 @@ namespace SHADE
     {
       SHVec4   cameraPosition;
       SHMatrix viewProjectionMatrix;
+      SHMatrix viewMatrix;
     };
 
     /*---------------------------------------------------------------------------------*/
@@ -79,15 +80,16 @@ namespace SHADE
         /*-----------------------------------------------------------------------------*/
         void Draw(uint32_t frameIndex, Handle<SHVkDescriptorPool> descPool) noexcept;
         void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept;
-        void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix exteriorMatrix) noexcept;
+        void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix viewMatrix, SHMatrix projMatrix) noexcept;
         void UpdateCameraDataToBuffer (void) noexcept;
-        void SetViewProjectionMatrix (SHMatrix const& vpMatrix) noexcept;
+        void SetViewProjectionMatrix (SHMatrix viewMatrix, SHMatrix projMatrix) noexcept;
 
         /*-----------------------------------------------------------------------------*/
         /* Setters and Getters                                                         */
         /*-----------------------------------------------------------------------------*/
-        Handle<SHRenderGraph> GetRenderGraph (void) const noexcept;
+        Handle<SHRenderGraph>     GetRenderGraph (void) const noexcept;
         Handle<SHVkCommandBuffer> GetCommandBuffer(uint32_t frameIndex) const noexcept;
+        Handle<SHCameraDirector>  GetCameraDirector (void) const noexcept;
 
       private:
         /*-----------------------------------------------------------------------------*/
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
index c4ba9fa1..ac7212bf 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
@@ -8,6 +8,7 @@
 #include "SHLightComponent.h"
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "SHLightComponent.h"
+#include "Math/Vector/SHVec4.h"
 
 namespace SHADE
 {
@@ -31,7 +32,7 @@ namespace SHADE
   
   */ 
   /***************************************************************************/
-  void SHLightingSubSystem::PerTypeData::WriteLightToAddress(void* address, SHLightComponent* lightComp) noexcept
+  void SHLightingSubSystem::PerTypeData::WriteLightToAddress(void* address, SHMatrix const& viewMat, SHLightComponent* lightComp) noexcept
   {
     auto const& lightData = lightComp->GetLightData();
     switch (lightData.type)
@@ -41,6 +42,7 @@ namespace SHADE
       SHDirectionalLightData* lightPtr = reinterpret_cast<SHDirectionalLightData*>(address);
 
       lightPtr->cullingMask = lightData.cullingMask;
+      //lightPtr->direction = viewMat * SHVec4 (lightData.direction[0], lightData.direction[1], lightData.direction[2], 0.0f);
       lightPtr->direction = lightData.direction;
       lightPtr->diffuseColor = lightData.color;
       lightPtr->active = lightComp->isActive;
@@ -240,7 +242,7 @@ namespace SHADE
 
   */
   /***************************************************************************/
-  void SHLightingSubSystem::PerTypeData::AddLight(Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool& expanded) noexcept
+  void SHLightingSubSystem::PerTypeData::AddLight(Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, SHMatrix const& viewMat, bool& expanded) noexcept
   {
     if (unboundLight)
     {
@@ -259,7 +261,7 @@ namespace SHADE
       void* writeLocation = reinterpret_cast<uint8_t*>(intermediateData.get()) + (lightDataAlignedSize * numLights);
 
       // Write the light data to address
-      WriteLightToAddress(writeLocation, unboundLight);
+      WriteLightToAddress(writeLocation, viewMat, unboundLight);
 
       // Set the light component to be bound to that location
       //unboundLight->SetBound(numLights);
@@ -419,7 +421,7 @@ namespace SHADE
     
   */
   /***************************************************************************/
-  void SHLightingSubSystem::Run(Handle<SHVkCommandBuffer> cmdBuffer, /*SHMatrix const& viewMat,*/ uint32_t frameIndex) noexcept
+  void SHLightingSubSystem::Run(SHMatrix const& viewMat, uint32_t frameIndex) noexcept
   {
     static uint32_t constexpr NUM_LIGHT_TYPES = SHUtilities::ToUnderlying(SH_LIGHT_TYPE::NUM_TYPES);
 
@@ -447,7 +449,7 @@ namespace SHADE
       // isn't, we write it to the correct buffer.
       //if (!light.GetBound() || rewrite)
       {
-        perTypeData[enumValue].AddLight(logicalDevice, &light, expanded);
+        perTypeData[enumValue].AddLight(logicalDevice, &light, viewMat, expanded);
 
         // add to light count
         //++lightCountsData[enumValue];
@@ -492,8 +494,6 @@ namespace SHADE
     // so we do it anyway. #NoteToSelf: if at any point it affects performance, do a check before computing.
     ComputeDynamicOffsets();
 
-    // Bind descriptor set (We bind at an offset because the buffer holds NUM_FRAME_BUFFERS sets of data).
-    cmdBuffer->BindDescriptorSet(lightingDataDescSet, SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::DYNAMIC_GLOBALS, {dynamicOffsets[frameIndex]});
 
   }
 
@@ -509,4 +509,12 @@ namespace SHADE
   {
 
   }
+
+  void SHLightingSubSystem::BindDescSet(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept
+  {
+    //Bind descriptor set(We bind at an offset because the buffer holds NUM_FRAME_BUFFERS sets of data).
+    cmdBuffer->BindDescriptorSet(lightingDataDescSet, SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::DYNAMIC_GLOBALS, { dynamicOffsets[frameIndex] });
+
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
index 4a667ec5..ae6caead 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.h
@@ -95,14 +95,14 @@ namespace SHADE
       //! to the GPU that stores NUM_FRAME_BUFFERS copies. 
       std::unique_ptr<uint8_t[]> intermediateData;
 
-      void WriteLightToAddress (void* address, SHLightComponent* lightComp) noexcept;
+      void WriteLightToAddress (void* address, SHMatrix const& viewMat, SHLightComponent* lightComp) noexcept;
     public:
       /*-----------------------------------------------------------------------*/
       /* PUBLIC MEMBER FUNCTIONS                                               */
       /*-----------------------------------------------------------------------*/
       void InitializeData (Handle<SHVkLogicalDevice> logicalDevice, SH_LIGHT_TYPE type) noexcept;
       void Expand         (Handle<SHVkLogicalDevice> logicalDevice) noexcept;
-      void AddLight       (Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, bool& expanded) noexcept;
+      void AddLight       (Handle<SHVkLogicalDevice> logicalDevice, SHLightComponent* unboundLight, SHMatrix const& viewMat, bool& expanded) noexcept;
       //void ModifyLight    (SHLightComponent* lightComp) noexcept;
       void WriteToGPU     (uint32_t frameIndex) noexcept;
       void ResetNumLights (void) noexcept;
@@ -159,8 +159,10 @@ namespace SHADE
     /* PUBLIC MEMBER FUNCTIONS                                               */
     /*-----------------------------------------------------------------------*/
     void Init (Handle<SHVkLogicalDevice> device, Handle<SHVkDescriptorPool> descPool) noexcept;
-    void Run (Handle<SHVkCommandBuffer> cmdBuffer, /*SHMatrix const& viewMat,*/ uint32_t frameIndex) noexcept;
+    void Run (SHMatrix const& viewMat, uint32_t frameIndex) noexcept;
     void Exit (void) noexcept;
 
+    void BindDescSet (Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept;
+
   };
 }

From 39b5ac0774081d9fb9336d6512a1a90b02eea1e7 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 16:52:40 +0800
Subject: [PATCH 04/27] LIGHTING NOW DONE IN VIEW SPACE

---
 Assets/Shaders/TestCube_VS.glsl               |  15 ++++++++++++---
 Assets/Shaders/TestCube_VS.shshaderb          | Bin 3385 -> 3525 bytes
 .../MiddleEnd/Interface/SHRenderer.cpp        |   2 +-
 .../MiddleEnd/Lights/SHLightingSubSystem.cpp  |   7 +++++--
 4 files changed, 18 insertions(+), 6 deletions(-)

diff --git a/Assets/Shaders/TestCube_VS.glsl b/Assets/Shaders/TestCube_VS.glsl
index 44c6e956..867b945f 100644
--- a/Assets/Shaders/TestCube_VS.glsl
+++ b/Assets/Shaders/TestCube_VS.glsl
@@ -38,14 +38,23 @@ layout(set = 2, binding = 0) uniform CameraData
 
 void main()
 {
-
   Out2.materialIndex = gl_InstanceIndex;
   Out2.eid             = integerData[0];
   Out2.lightLayerIndex = integerData[1];
 
-  Out.vertPos = worldTransform * vec4(aVertexPos, 1.0f);
+  // for transforming gBuffer position and normal data
+  mat4 modelViewMat = cameraData.viewMat * worldTransform;
+
+  // gBuffer position will be in view space
+  Out.vertPos = modelViewMat * vec4(aVertexPos, 1.0f);
+
+  // uvs for texturing in fragment shader
   Out.uv = aUV;
-  Out.normal.rgb = mat3(transpose(inverse(worldTransform))) * aNormal.rgb;
+
+  // normals are also in view space
+  Out.normal.rgb = mat3(transpose(inverse(modelViewMat))) * aNormal.rgb;
   Out.normal.rgb = normalize (Out.normal.rgb);
+
+  // clip space for rendering
   gl_Position = cameraData.vpMat * worldTransform * vec4 (aVertexPos, 1.0f);
 }
\ No newline at end of file
diff --git a/Assets/Shaders/TestCube_VS.shshaderb b/Assets/Shaders/TestCube_VS.shshaderb
index 2544abd58b576513f2e8185a0b84ef070e6a42fe..b7e1294bb1b2fcbe7f31212c0662330feff59f48 100644
GIT binary patch
literal 3525
zcmZ9MYj+c65XYb922!q4E-GTuqE)N)28beHY%#3{5^Sk=!<uZ<)y*buHU)g;SJ2Pn
zD?gQQJjefUcc<*>lQZX;`OkG{=860JgiBAkv~<L|Id{yRaI*|@XIx2$bMvm2-mUgl
zdv%%&R<B-r7n75&oLXXYN<U6TH1dK7{+NjH3!=9~?~AUBnxd{~Pn3wt`jvG5qd*mT
zwc5Q_r_*ZR?e!;<-ZXg{`n@oS{N5ml{eBYc``8^V*acBPoDGTwRaq2ksVc`&<>1uZ
zkpq6@C4L-u;bt`OpQJh>(+TJNU~phdePJ-%OWNL3KhCVl!8dkh37_Vwip%#7!`@~z
zO}wb@TUhC;X&-_p@rQoA?j@d(n!6(V(Rkp8JAwcBo<}=U+gEk3c_TmeQd3#h92jRZ
zo(4%UPJ3LFH8}O|PqF}pQS*Ktmi)_-`-Pa~XD*M&aX8qHy=b~Sjz{D#yL7<P5zF{}
zKTf*isjy0lk#n~H%!YiCB6wjIgQloAicn4G?(Ham|AY`}j;8e9!yWOJbRWF?nKO0m
zN~b<{{Wx=yC^W<2(ODaqC-&5n;%f3%@VmAon>9LWlWr{xChI{q8%4|f*kW|EFg(!F
z1NM_c{S3z2_M)L5r88>fv%f4He`IDqFIvgv1>NY`rwzrh`7KH2Y{<uES54(-v&81~
zAxsZ6$1*>@spyA{A8*U@ftg=Rm68vPdfA7?Lvlkh2R*w%{k$V&=84Qf<}DXx=84Q4
z&{GF8`KX6EaOe@oFzms&4Z{bF-WmoEmeo^E<Jq?`6mns6RvEz?l91ug$*ZQjE+P*y
zeL?12R(;F~8}Lk5anFe-2D+Q_LFUbat>iK7d+L&p3nxBtut#Puz|iwAi7$HdKO-Lf
z1?ivHO>Sz&{;Y0v;KV~_ufXuf_MC`={dwK!to|3olMmVQy(FIa=6^{%KIdgw*9}oi
zBj@S&Mahf0!H~(dq?@?l^pD*_j|^e+n(mSa9rYtG=NS6ebKdM%B+rSEu}5YP!KmpS
z-E|Q$$;p3HLj=xE%=dKj&FF}M%<h5_<Erj@E@OX9{G13Jdt`PSj2_i>-w-+X#~ti%
ziz8M;g#4*)Y^ec%<faG={hDs<(bLBb-Q)tZe7qI2-^z7$-8Q3d#PiLU<nQaQr#wB#
z{u3KHhAz`r+)z9@c17et-pet|n@A?_b@h_?%$9@Sze1|Iv0c)AMZ~;sNoIdfirDR@
ztWN1ZE#htP9&RfFGB)Vh%L}3f5&KFEVqFx0W5ce#C?W=Lf*8oySd5p&6N8<#7`%IM
zi}8whVzB4LK*k0=`}T%tS%jV#i@M(wft&occ=qlu`Ji7FVFOM~dI4tkABYD-X0{)S
z*r5mVuj~Fu1jaG!WAR}0->{oG#w@z(5Oe)Rgg^G^*~LE<7u_upxv}B<*v&g4_TA=y
zj2*SHgP)0-DOJ<mTo;eM^&A-+`?kB{`L^SlI=%Q@M9uK%w(}mg#G~U|sBKdO#_8xE
zl)ii+0*5%nDT&PIOY!)Cn@?LjIK(;Zb59sP#4(@y;=v(~`E>OSyuXf!T8NFU&Fz7B
z-Xi^_-mgU1f;Z*M+uRn>FZPFBruMq-ha&7b><D&X=C>o>{McXf`&vAH)QBH;VCMI&
zc=O|b!2G@wk00NSA9i522j7b~KfbRa`3DiW_36hP1Ls(um^I)3Q;sobY^|oAc#B=^
z!6V`LaHt8pM<Vm{#G7BS2R{q9T=-!JW`6yGU$F;++|PP|9hklKK>V_Z-L`%HMLf94
zzltxu^-wZ4;I<bd@x}KXNe1KCJjUX|=%Hbg9HTya&%cSsAA9u0_Z&+mKQ=bUsd)ak
P=SB1e8N2_K>4xZk$nOR#

literal 3385
zcmZ9NdwUaA5XMiNOOXPC$VEj=S}$m|Rs}?nOYJ2sh9=lj@5Dp0gw@R^PqGc*Uw#Gs
zNPa5+@p*WEyE|ncPoH_t%scPQnKL^lbt}hRx=OQ)bI#4UqwcsHW{^AOW`#I6@2ctE
zXzn(bCrNMl@|6`RCtN9I!g*PLtg>X_!x;Ujg!HdU-jQ6Ad?@)`vMG5WfmqVttoDDD
zsH~_)v(sp`8qJMPcQooul4nuSiNZMO^ulq_O~Ppa??{0c#@*<kS0q%#DArQZ8Ao&m
ztLo+s^?^@<ap<G%xEDN4ePpH+&IMubkV}10*ngZf{j*@4u{nb~whod{wYiG&a^HT`
z*^VcPkGp}Tm9LWaA&irtAB@+1;)RslB7s^}S*A~eanc@6gq2f_S`MZ!IMfmk#{(a6
zW-0BhYLH${d;DZLj(U4zA5R{M1*eks-R~=L@RZbP9N)p;-<MuazlYz+l9K0V`E-wV
zFwTNx3e9kIe8WkYgu__qT*{};6xStp!$0(uvR;#mn&n%I!qIw|_2w{+DZ+OUMTb7_
z#eA@+zoUK44}!5zTbI@X#u`~6(&-~OwM<8MeNw=vVHyTcK*{N4cMCbem`A_o<9-km
z>Kgesz9^kKvH8aHlBL{czVS0R_?dNV7B+K_%{*fB28w>Z12#3|=WSq9@0Mz!e=N>q
z83rGW-7sRnsMRoZu<ZO&n$L1u4;STUZHZ<5tEBdee!@BVKTJOwIhMtdw-|>_Tw6jt
z<OZ|2hAK6TyYo#Ja*o+`*(_|n553_|r<I9Zby?WxXT+&$uSw_&HfLe8E~*B;6CCi&
zS9UK+CkMXkioxb>gDvGbt^YOI$ApugJn*rZ3o!ir8WM}&;!jD(e@^~av~xB!!#}MZ
zA2|82nJX~j;hvGO;Gflw&+30oI_F{Ad2dK3zr|mWPRv;`YuXWNspmTLfxVF1#L}-t
z?Qp;|ZrQypo%8TfFE(=zc3$?o+ToIudf(GNBLRnx&AR~O%n!8JB*epC(vA-tJ~r<L
zjQiBIFH4;J^A`Ne(ul1~u&-)|OU=Y%^UlEVf1w>de(JrcowLB~yiMuG-_CtC?bgp7
z>GbG=;(yX!OLcmd{Z7_%3}5CiyI-Vp25*{kupi_Yz2+?tN1qUC{Z%{X;3EdxOTh3y
z%ysK6z2cqBNUka;JiY^qv;P&s8@(a4s{Mq7*<BUN-15emedhh9BCz4$XYS5Pm`&!9
z9L(H#2{;^P@pTC~n0azw!?7H1N+$<1X*qb;;FjYp>EvLJ$$<?AK6iaz!VF>a?LLw)
zBllE8P5Z|ZFqUB}(!uDBVV~p}eQN7Ab?y8^CmufjWyxR4i|;cDXTzaZX77rG`L~{7
z!=ttZ?bjsCAADx-O9_1I4>laT+jZ&O?U=q0cl}C2&E&$jm-pa?bbQ=}+HOg}SS|gU
z(U;p2aD+u3?rJfs(uo1Ln6IUSBP@Kym^InNfLYACbZ~@aF>T#}_q8FpEg?5t`)&>C
zn-cm<y;~Bv;H!$|?cI^kFJ^(cqxPEiZzS+p%m_R%i)%`^IA+b_?n)<)8i|7kW^pa)
z7Plka;@Z-Q<KD!<1G71}C*9(>UtRXM5^(F&ZjOPotWSJv?!T8~8`|MoP4}f+?qU!2
zg%iV~CU{^L_nmZ$EB4@f;dT~r@W3qYheBMj2S4U<)&qE8^x&cPuEa~2ZJXy_j+-6G
zz9jiuG0gWP2^?^ni@x;Ydwwh%jAh>=lnzD@4f`#}sL$T>@6w5fkH7eyBiWn}$G+o0
SI={>F5_*FT??0V%P4XNphWKOv

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
index a44e0661..655451ec 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
@@ -108,7 +108,7 @@ namespace SHADE
   {
     //cpuCameraData.viewProjectionMatrix = camera->GetViewMatrix() * camera->GetProjectionMatrix();
     cpuCameraData.viewProjectionMatrix = SHMatrix::Transpose(projMatrix * viewMatrix);
-    cpuCameraData.viewMatrix = viewMatrix;
+    cpuCameraData.viewMatrix = SHMatrix::Transpose(viewMatrix);
   }
 
   Handle<SHRenderGraph> SHRenderer::GetRenderGraph(void) const noexcept
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
index ac7212bf..35bcc72f 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
@@ -9,6 +9,7 @@
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "SHLightComponent.h"
 #include "Math/Vector/SHVec4.h"
+#include "Math/SHMatrix.h"
 
 namespace SHADE
 {
@@ -41,9 +42,11 @@ namespace SHADE
     {
       SHDirectionalLightData* lightPtr = reinterpret_cast<SHDirectionalLightData*>(address);
 
+      SHVec4 transformedDir = viewMat * SHVec4(lightData.direction[0], lightData.direction[1], lightData.direction[2], 0.0f);
+
       lightPtr->cullingMask = lightData.cullingMask;
-      //lightPtr->direction = viewMat * SHVec4 (lightData.direction[0], lightData.direction[1], lightData.direction[2], 0.0f);
-      lightPtr->direction = lightData.direction;
+      lightPtr->direction = SHVec3 (transformedDir.x, transformedDir.y, transformedDir.z);
+      //lightPtr->direction = lightData.direction;
       lightPtr->diffuseColor = lightData.color;
       lightPtr->active = lightComp->isActive;
       break;

From 647182241efad86d80d5ec63df6a83ea4e0036f3 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 19:21:02 +0800
Subject: [PATCH 05/27] Fixed a buy with view space lighting calculations

---
 Assets/Shaders/DeferredComposite_CS.glsl      |   6 +++---
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4665 -> 4665 bytes
 .../MiddleEnd/Interface/SHGraphicsConstants.h |  12 +++++++++++-
 .../MiddleEnd/Lights/SHLightingSubSystem.cpp  |   3 ++-
 .../RenderGraph/SHRenderGraphNodeCompute.cpp  |  14 +++++---------
 .../RenderGraph/SHRenderGraphNodeCompute.h    |  10 +++++++++-
 6 files changed, 30 insertions(+), 15 deletions(-)

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index c1caf0aa..5f586b9b 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -51,10 +51,10 @@ void main()
   vec3 pixelDiffuse = imageLoad (albedo, globalThread).rgb;
 
   // Get position of fragment in world space
-  vec3 positionWorld = imageLoad (positions, globalThread).rgb;
+  vec3 positionView = imageLoad (positions, globalThread).rgb;
 
   // normal of fragment
-  vec3 normalWorld = imageLoad(normals, globalThread).rgb;
+  vec3 normalView = imageLoad(normals, globalThread).rgb;
 
   vec3 fragColor = vec3 (0.0f);
 
@@ -64,7 +64,7 @@ void main()
     vec3 dLightNormalized = normalize (DirLightData.dLightData[i].direction);
 
     // Get diffuse strength
-    float diffuseStrength = max (0, dot (dLightNormalized, normalWorld));
+    float diffuseStrength = max (0, dot (dLightNormalized, normalView));
 
     // Calculate the fragment color
     fragColor += DirLightData.dLightData[i].diffuseColor.rgb * diffuseStrength.rrr * pixelDiffuse;
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index 889de5fb344289c281264b054407d97c317a7fff..aaaa5207fc09134d01b8cdfec1bc483a63024116 100644
GIT binary patch
delta 28
fcmdm~vQuS)FC%MMW@<UZ<RC^>2y1f<<6Z#(hieG|

delta 28
fcmdm~vQuS)FC%Mseo;=!<RC^>2y1f<<6Z#(krN5q

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
index a39ec10e..0257bf3b 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
@@ -70,7 +70,17 @@ namespace SHADE
       */
       /***************************************************************************/
       static constexpr uint32_t RENDERGRAPH_RESOURCE = 4;
-
+      /***************************************************************************/
+      /*!
+        \brief
+          DescriptorSet Index for render graph node compute resources. For data 
+          that we wish to pass to compute shaders in the render graph, this is
+          the set to use. Unlike the sets from 1 to 3, this set index does not have
+          hard coded bindings and is NOT part of the layouts included in the global
+          data.
+      */
+      /***************************************************************************/
+      static constexpr uint32_t RENDERGRAPH_NODE_COMPUTE_RESOURCE = 5;
 
     };
 
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
index 35bcc72f..485f859f 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Lights/SHLightingSubSystem.cpp
@@ -42,7 +42,8 @@ namespace SHADE
     {
       SHDirectionalLightData* lightPtr = reinterpret_cast<SHDirectionalLightData*>(address);
 
-      SHVec4 transformedDir = viewMat * SHVec4(lightData.direction[0], lightData.direction[1], lightData.direction[2], 0.0f);
+      // #NoteToSelf: NEED TO TRANSPOSE HERE BECAUSE MULTIPLICATION IS ROW MAJOR. 
+      SHVec4 transformedDir = SHMatrix::Transpose(viewMat) * SHVec4(lightData.direction[0], lightData.direction[1], lightData.direction[2], 0.0f);
 
       lightPtr->cullingMask = lightData.cullingMask;
       lightPtr->direction = SHVec3 (transformedDir.x, transformedDir.y, transformedDir.z);
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
index 5323d706..6a9b1c31 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
@@ -42,16 +42,12 @@ namespace SHADE
 
      //Get the descriptor set layouts required to allocate. We only want the ones for allocate because 
      //global descriptors are already bound in the main system. 
-    auto const& layouts = computePipeline->GetPipelineLayout()->GetDescriptorSetLayoutsAllocate();
-
-     //Variable counts for the descriptor sets (all should be 1).
-    std::vector<uint32_t> variableCounts{ static_cast<uint32_t>(layouts.size()) };
-    std::fill(variableCounts.begin(), variableCounts.end(), 0);
+    auto const& layouts = computePipeline->GetPipelineLayout()->GetDescriptorSetLayoutsPipeline()[SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE];
 
     // Allocate descriptor sets to hold the images for reading (STORAGE_IMAGE)
     for (uint32_t i = 0; i < SHGraphicsConstants::NUM_FRAME_BUFFERS; ++i)
     {
-      descSetGroups[i] = graphStorage->descriptorPool->Allocate(layouts, variableCounts);
+      graphResourceDescSets[i] = graphStorage->descriptorPool->Allocate({layouts}, { 1 });
     }
 
     HandleResize();
@@ -63,7 +59,7 @@ namespace SHADE
     cmdBuffer->BindPipeline(computePipeline);
     
     // bind descriptor sets
-    cmdBuffer->BindDescriptorSet(descSetGroups[frameIndex], SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, {});
+    cmdBuffer->BindDescriptorSet(graphResourceDescSets[frameIndex], SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, {});
 
     // dispatch compute
     cmdBuffer->ComputeDispatch(groupSizeX, groupSizeY, 1);
@@ -89,8 +85,8 @@ namespace SHADE
         uint32_t imageIndex = (resources[i]->resourceTypeFlags & static_cast<uint32_t>(SH_ATT_DESC_TYPE_FLAGS::COLOR_PRESENT)) ? frameIndex : 0;
 
         SHVkDescriptorSetGroup::viewSamplerLayout vsl = std::make_tuple(resources[i]->GetImageView(imageIndex), Handle<SHVkSampler>{}, vk::ImageLayout::eGeneral);
-        descSetGroups[frameIndex]->ModifyWriteDescImage(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, binding.BindPoint, { &vsl, 1 });
-        descSetGroups[frameIndex]->UpdateDescriptorSetImages(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, binding.BindPoint);
+        graphResourceDescSets[frameIndex]->ModifyWriteDescImage(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, binding.BindPoint, { &vsl, 1 });
+        graphResourceDescSets[frameIndex]->UpdateDescriptorSetImages(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, binding.BindPoint);
         ++i;
       }
     }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
index 2cd3c948..d7c29f49 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
@@ -19,12 +19,15 @@ namespace SHADE
   class SHVkShaderModule;
   class SHVkCommandBuffer;
 
+
   class SHRenderGraphNodeCompute
   {
   private:
     static constexpr uint32_t workGroupSizeX = 16;
     static constexpr uint32_t workGroupSizeY = 16;
 
+    using ExternalDescSetBindCommands = std::function<void(Handle<SHVkCommandBuffer>)>;
+
     //! To run the dispatch command
     Handle<SHVkPipeline>                       computePipeline;
 
@@ -32,7 +35,12 @@ namespace SHADE
     Handle<SHVkPipelineLayout>                 pipelineLayout;
 
     //! Descriptor set group to hold the images for reading (STORAGE_IMAGE)
-    std::array<Handle<SHVkDescriptorSetGroup>, SHGraphicsConstants::NUM_FRAME_BUFFERS> descSetGroups;
+    std::array<Handle<SHVkDescriptorSetGroup>, SHGraphicsConstants::NUM_FRAME_BUFFERS> graphResourceDescSets;
+
+    //! Sometimes we want to bind descriptor sets for a compute resource (buffers, images, etc). This container
+    //! helps store functions that call those bind functions. The reason why we dont just have a handle to descriptor
+    //! sets here is because we dont know how we want to bind the sets (different set each frame, dynamic offsets, etc).
+    std::vector<ExternalDescSetBindCommands> externalDescriptorSetBindCommands;
 
     //! vector of resources needed by the subpass compute
     std::vector<Handle<SHRenderGraphResource>> resources;

From 997ce3011a836053440156696817f67c6c95c402 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Sun, 30 Oct 2022 23:15:52 +0800
Subject: [PATCH 06/27] Screw you SPIRV-Reflect and screw you GLSL

- Pipeline layouts now have a parameter to decide if a binding with a buffer descriptor stores a dynamic type instead.
- SHRenderGraphNodeCompute has catered for this as well through its ctor params
---
 .../Descriptors/SHVkDescriptorSetLayout.cpp   | 12 ++++++
 .../Descriptors/SHVkDescriptorSetLayout.h     |  1 +
 .../MiddleEnd/PostProcessing/SHSSAO.cpp       |  7 ++++
 .../MiddleEnd/PostProcessing/SHSSAO.h         | 15 +++++++
 .../Pipeline/SHPipelineLayoutParams.h         |  8 ++++
 .../Graphics/Pipeline/SHVkPipelineLayout.cpp  | 23 +++++++++++
 .../Graphics/Pipeline/SHVkPipelineLayout.h    |  3 ++
 .../RenderGraph/SHRenderGraphNode.cpp         |  4 +-
 .../Graphics/RenderGraph/SHRenderGraphNode.h  |  2 +-
 .../RenderGraph/SHRenderGraphNodeCompute.cpp  | 39 +++++++++++++++++--
 .../RenderGraph/SHRenderGraphNodeCompute.h    | 22 ++++++++---
 11 files changed, 123 insertions(+), 13 deletions(-)
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h

diff --git a/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.cpp b/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.cpp
index 0943c489..4be8cc9e 100644
--- a/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.cpp
+++ b/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.cpp
@@ -119,6 +119,18 @@ namespace SHADE
       return setIndex;
     }
 
+    uint32_t SHVkDescriptorSetLayout::GetNumDynamicOffsetsRequired(void) const noexcept
+    {
+      uint32_t numDynamicBindings = 0;
+      for (auto& binding : layoutDesc)
+      {
+        if (binding.Type == vk::DescriptorType::eUniformBufferDynamic || binding.Type == vk::DescriptorType::eStorageBufferDynamic)
+          ++numDynamicBindings;
+      }
+
+      return numDynamicBindings;
+    }
+
     SHVkDescriptorSetLayout& SHVkDescriptorSetLayout::operator=(SHVkDescriptorSetLayout&& rhs) noexcept
     {
       if (&rhs == this)
diff --git a/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.h b/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.h
index 1639901d..caa3c057 100644
--- a/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.h
+++ b/SHADE_Engine/src/Graphics/Descriptors/SHVkDescriptorSetLayout.h
@@ -99,6 +99,7 @@ namespace SHADE
         inline const vk::DescriptorSetLayout& GetVkHandle() const { return setLayout; }
         std::vector<Binding> const&           GetBindings (void) const noexcept;
         SetIndex                              GetSetIndex (void) const noexcept;
+        uint32_t                              GetNumDynamicOffsetsRequired (void) const noexcept;
 
       private:
         /*-----------------------------------------------------------------------------*/
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
new file mode 100644
index 00000000..fb5ae824
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
@@ -0,0 +1,7 @@
+#include "SHpch.h"
+#include "SHSSAO.h"
+
+namespace SHADE
+{
+
+}
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
new file mode 100644
index 00000000..17df7200
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
@@ -0,0 +1,15 @@
+#pragma once
+
+#include "Resource/SHHandle.h"
+#include "Graphics/SHVulkanIncludes.h"
+
+namespace SHADE
+{
+
+  class SHSSAO
+  {
+  private:
+
+
+  };
+}
diff --git a/SHADE_Engine/src/Graphics/Pipeline/SHPipelineLayoutParams.h b/SHADE_Engine/src/Graphics/Pipeline/SHPipelineLayoutParams.h
index d696e4a3..010bed0e 100644
--- a/SHADE_Engine/src/Graphics/Pipeline/SHPipelineLayoutParams.h
+++ b/SHADE_Engine/src/Graphics/Pipeline/SHPipelineLayoutParams.h
@@ -2,8 +2,10 @@
 #define SH_PIPELINE_LAYOUT_PARAMS_H
 
 #include "Graphics/SHVulkanIncludes.h"
+#include "Graphics/SHVulkanDefines.h"
 #include "Resource/SHHandle.h"
 #include "Graphics/Descriptors/SHVkDescriptorSetLayout.h"
+#include <unordered_set>
 
 namespace SHADE
 {
@@ -24,6 +26,12 @@ namespace SHADE
     //! want to use the layout to initialize the pipeline layout but we do not
     //! want to use it for allocating descriptor sets.
     std::vector<Handle<SHVkDescriptorSetLayout>> const& globalDescSetLayouts = {};
+
+    //! Since both SPIRV-Reflect and GLSL don't provide ways to describe UBOs or
+    //! SSBOs as dynamic, we need to do it ourselves. This will store bindings
+    //! which we will use when parsing for descriptor set layouts. If a parsed
+    //! binding is in this container, we make that binding's descriptor dynamic.
+    std::unordered_set<BindingAndSetHash> dynamicBufferBindings;
   };
 
   struct SHPipelineLayoutParamsDummy
diff --git a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.cpp b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.cpp
index 37d00795..47b2e010 100644
--- a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.cpp
+++ b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.cpp
@@ -165,6 +165,28 @@ namespace SHADE
             newBinding.Stage = shaderModule->GetShaderStageFlagBits();
             newBinding.Type = descBindingInfo.ConvertFromReflectDescType(reflectedBinding->descriptor_type);
 
+            // Here we want to check if a binding is supposed to be dynamic. If it is, make it dynamic.
+            if (newBinding.Type == vk::DescriptorType::eUniformBuffer || newBinding.Type == vk::DescriptorType::eStorageBuffer)
+            {
+              for (auto& bsHash : dynamicBufferBindings)
+              {
+              	uint32_t set = static_cast<uint32_t>(bsHash >> 32);
+                uint32_t binding = static_cast<uint32_t>(bsHash & 0xFFFFFFFF);
+                if (set == CURRENT_SET && binding == newBinding.BindPoint)
+                {
+                  switch (newBinding.Type)
+                  {
+                  case vk::DescriptorType::eUniformBuffer:
+                    newBinding.Type = vk::DescriptorType::eUniformBufferDynamic;
+                    break;
+                  case vk::DescriptorType::eStorageBuffer:
+                    newBinding.Type = vk::DescriptorType::eStorageBufferDynamic;
+                    break;
+                  }
+                }
+              }
+            }
+
             // In reality, the check for variable descriptor sets do not exists in spirv-reflect. Fortunately, when a shader
             // defines a boundless descriptor binding in the shader, the information reflected makes the array dimensions
             // contain a 1 element of value 1. Knowing that having an array [1] doesn't make sense, we can use this to 
@@ -300,6 +322,7 @@ namespace SHADE
     , vkDescriptorSetLayoutsAllocate{}
     , descriptorSetLayoutsPipeline{}
     , vkDescriptorSetLayoutsPipeline{}
+    , dynamicBufferBindings{std::move (pipelineLayoutParams.dynamicBufferBindings)}
   {
     for (auto& mod : shaderModules)
     {
diff --git a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.h b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.h
index b4298e00..e2af02a9 100644
--- a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.h
+++ b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipelineLayout.h
@@ -29,6 +29,9 @@ namespace SHADE
     //! Push constant interface
     SHPushConstantInterface pushConstantInterface;
 
+    //! See SHPipelineLayoutParams for details
+    std::unordered_set<BindingAndSetHash> dynamicBufferBindings;
+
     //! Push constant ranges
     std::vector<vk::PushConstantRange> vkPcRanges;
 
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.cpp
index aa9c7944..12f0e246 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.cpp
@@ -263,7 +263,7 @@ namespace SHADE
     return subpass;
   }
 
-  Handle<SHRenderGraphNodeCompute> SHRenderGraphNode::AddNodeCompute(Handle<SHVkShaderModule> computeShaderModule, std::initializer_list<std::string> resources, float numWorkGroupScale/* = 1.0f*/) noexcept
+  Handle<SHRenderGraphNodeCompute> SHRenderGraphNode::AddNodeCompute(Handle<SHVkShaderModule> computeShaderModule, std::initializer_list<std::string> resources, std::unordered_set<BindingAndSetHash>&& dynamicBufferBindings, float numWorkGroupScale/* = 1.0f*/) noexcept
   {
     // Look for the required resources in the graph
     std::vector<Handle<SHRenderGraphResource>> nodeComputeResources{};
@@ -276,7 +276,7 @@ namespace SHADE
     }
 
     // Create the subpass compute with the resources
-    auto nodeCompute = graphStorage->resourceManager->Create<SHRenderGraphNodeCompute>(graphStorage, computeShaderModule, std::move(nodeComputeResources), nodeComputes.empty());
+    auto nodeCompute = graphStorage->resourceManager->Create<SHRenderGraphNodeCompute>(graphStorage, computeShaderModule, std::move(nodeComputeResources), std::move (dynamicBufferBindings), nodeComputes.empty());
     nodeComputes.push_back(nodeCompute);
 
     return nodeCompute;
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.h b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.h
index 16f3f914..695d1c31 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.h
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNode.h
@@ -100,7 +100,7 @@ namespace SHADE
     /* PUBLIC MEMBER FUNCTIONS                                               */
     /*-----------------------------------------------------------------------*/
     Handle<SHSubpass>    AddSubpass(std::string subpassName) noexcept;
-    Handle<SHRenderGraphNodeCompute> AddNodeCompute(Handle<SHVkShaderModule> computeShaderModule, std::initializer_list<std::string> resources, float numWorkGroupScale = 1.0f) noexcept;
+    Handle<SHRenderGraphNodeCompute> AddNodeCompute(Handle<SHVkShaderModule> computeShaderModule, std::initializer_list<std::string> resources, std::unordered_set<BindingAndSetHash>&& dynamicBufferBindings = {}, float numWorkGroupScale = 1.0f) noexcept;
     void AddDummySubpassIfNeeded (void) noexcept;
 
     // TODO: RemoveSubpass()
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
index 6a9b1c31..b5f6f7ab 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
@@ -13,7 +13,7 @@
 
 namespace SHADE
 {
-  SHRenderGraphNodeCompute::SHRenderGraphNodeCompute(Handle<SHRenderGraphStorage> graphStorage, Handle<SHVkShaderModule> computeShaderModule, std::vector<Handle<SHRenderGraphResource>>&& subpassComputeResources, bool followingEndRP, float inNumWorkGroupScale/* = 1.0f*/) noexcept
+  SHRenderGraphNodeCompute::SHRenderGraphNodeCompute(Handle<SHRenderGraphStorage> graphStorage, Handle<SHVkShaderModule> computeShaderModule, std::vector<Handle<SHRenderGraphResource>>&& subpassComputeResources, std::unordered_set<BindingAndSetHash>&& dynamicBufferBindings, bool followingEndRP, float inNumWorkGroupScale/* = 1.0f*/) noexcept
     : computePipeline{}
     , pipelineLayout{}
     , resources{}
@@ -21,11 +21,13 @@ namespace SHADE
     , groupSizeY{0}
     , followingEndRenderpass {followingEndRP}
     , numWorkGroupScale {std::clamp(inNumWorkGroupScale, 0.0f, 1.0f)}
+    , computeResource{}
   {
     SHPipelineLayoutParams pipelineLayoutParams
     {
       .shaderModules = {computeShaderModule},
-      .globalDescSetLayouts = SHGraphicsGlobalData::GetDescSetLayouts()
+      .globalDescSetLayouts = SHGraphicsGlobalData::GetDescSetLayouts(),
+      .dynamicBufferBindings = std::move(dynamicBufferBindings),
     };
 
     // Create pipeline layout from parameters
@@ -42,12 +44,31 @@ namespace SHADE
 
      //Get the descriptor set layouts required to allocate. We only want the ones for allocate because 
      //global descriptors are already bound in the main system. 
-    auto const& layouts = computePipeline->GetPipelineLayout()->GetDescriptorSetLayoutsPipeline()[SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE];
+    auto const& graphResourceLayout = computePipeline->GetPipelineLayout()->GetDescriptorSetLayoutsPipeline()[SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE];
 
     // Allocate descriptor sets to hold the images for reading (STORAGE_IMAGE)
     for (uint32_t i = 0; i < SHGraphicsConstants::NUM_FRAME_BUFFERS; ++i)
     {
-      graphResourceDescSets[i] = graphStorage->descriptorPool->Allocate({layouts}, { 1 });
+      graphResourceDescSets[i] = graphStorage->descriptorPool->Allocate({graphResourceLayout}, { 1 });
+    }
+
+
+    auto const& layouts = computePipeline->GetPipelineLayout()->GetDescriptorSetLayoutsPipeline();
+
+    if (layouts.size() == SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE + 1)
+    {
+      // create compute resources
+      computeResource = graphStorage->resourceManager->Create<ComputeResource>();
+      auto computeResourceLayout = layouts[SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE];
+      computeResource->descSet = graphStorage->descriptorPool->Allocate({ computeResourceLayout }, { 1 });
+
+      // Allocate for descriptor offsets
+      for (uint32_t i = 0; i < SHGraphicsConstants::NUM_FRAME_BUFFERS; ++i)
+        computeResource->dynamicOffsets[i].resize(computeResourceLayout->GetNumDynamicOffsetsRequired());
+
+      // 1st set all start at 0
+      for (auto& index : computeResource->dynamicOffsets[0])
+    	  index = 0;
     }
 
     HandleResize();
@@ -133,4 +154,14 @@ namespace SHADE
     }
   }
 
+  void SHRenderGraphNodeCompute::SetDynamicOffsets(std::span<uint32_t> perFrameSizes) noexcept
+  {
+    for (uint32_t i = 0; i < SHGraphicsConstants::NUM_FRAME_BUFFERS; ++i)
+    {
+      auto dynamicOffsets = computeResource->dynamicOffsets[i];
+    	for (uint32_t j = 0; j < perFrameSizes.size(); ++j)
+        dynamicOffsets[j] = perFrameSizes[j] * i;
+    }
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
index d7c29f49..1101e276 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
@@ -22,11 +22,22 @@ namespace SHADE
 
   class SHRenderGraphNodeCompute
   {
+  private:
+    // Binding of set SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE
+    struct ComputeResource
+    {
+      //! Descriptor set (initialized by parent class)
+      Handle<SHVkDescriptorSetGroup> descSet {};
+
+      //! Dynamic offsets into these resources (initialized from the outside).
+      std::array<std::vector<uint32_t>, SHGraphicsConstants::NUM_FRAME_BUFFERS> dynamicOffsets {};
+    };
+
   private:
     static constexpr uint32_t workGroupSizeX = 16;
     static constexpr uint32_t workGroupSizeY = 16;
 
-    using ExternalDescSetBindCommands = std::function<void(Handle<SHVkCommandBuffer>)>;
+    using ExternalDescSetBindCommands = std::function<void(Handle<SHVkCommandBuffer>, Handle<SHVkPipelineLayout>)>;
 
     //! To run the dispatch command
     Handle<SHVkPipeline>                       computePipeline;
@@ -37,10 +48,7 @@ namespace SHADE
     //! Descriptor set group to hold the images for reading (STORAGE_IMAGE)
     std::array<Handle<SHVkDescriptorSetGroup>, SHGraphicsConstants::NUM_FRAME_BUFFERS> graphResourceDescSets;
 
-    //! Sometimes we want to bind descriptor sets for a compute resource (buffers, images, etc). This container
-    //! helps store functions that call those bind functions. The reason why we dont just have a handle to descriptor
-    //! sets here is because we dont know how we want to bind the sets (different set each frame, dynamic offsets, etc).
-    std::vector<ExternalDescSetBindCommands> externalDescriptorSetBindCommands;
+    Handle<ComputeResource> computeResource;
 
     //! vector of resources needed by the subpass compute
     std::vector<Handle<SHRenderGraphResource>> resources;
@@ -58,11 +66,13 @@ namespace SHADE
     std::array<std::vector<vk::ImageMemoryBarrier>, SHGraphicsConstants::NUM_FRAME_BUFFERS> memoryBarriers;
 
   public:
-    SHRenderGraphNodeCompute(Handle<SHRenderGraphStorage> graphStorage, Handle<SHVkShaderModule> computeShaderModule, std::vector<Handle<SHRenderGraphResource>>&& subpassComputeResources, bool followingEndRP, float inNumWorkGroupScale = 1.0f) noexcept;
+    SHRenderGraphNodeCompute(Handle<SHRenderGraphStorage> graphStorage, Handle<SHVkShaderModule> computeShaderModule, std::vector<Handle<SHRenderGraphResource>>&& subpassComputeResources, std::unordered_set<BindingAndSetHash>&& dynamicBufferBindings, bool followingEndRP, float inNumWorkGroupScale = 1.0f) noexcept;
 
     void Execute (Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept;
     void HandleResize (void) noexcept;
 
+    void SetDynamicOffsets (std::span<uint32_t> perFrameSizes) noexcept;
+
     friend class SHRenderGraph;
     friend class SHRenderGraphNode;
   };

From 94a57219da3f1d8ccc53b9dd463758cb029aaa49 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Mon, 31 Oct 2022 10:32:32 +0800
Subject: [PATCH 07/27] Created CPU and GPU data for SSAO

Renderpass for SSAO not yet done (that's next)
---
 Assets/Shaders/SSAO_CS.glsl                   | 24 +++++++++
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  | 12 +++++
 .../MiddleEnd/Interface/SHGraphicsSystem.h    |  3 ++
 .../MiddleEnd/PostProcessing/SHSSAO.cpp       | 53 +++++++++++++++++++
 .../MiddleEnd/PostProcessing/SHSSAO.h         | 22 ++++++++
 .../src/Graphics/Queues/SHVkQueue.cpp         |  5 ++
 SHADE_Engine/src/Graphics/Queues/SHVkQueue.h  |  2 +
 .../RenderGraph/SHRenderGraphNodeCompute.cpp  |  5 ++
 .../RenderGraph/SHRenderGraphNodeCompute.h    |  6 ++-
 9 files changed, 130 insertions(+), 2 deletions(-)
 create mode 100644 Assets/Shaders/SSAO_CS.glsl

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
new file mode 100644
index 00000000..3759c4b4
--- /dev/null
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -0,0 +1,24 @@
+#version 450
+
+uint const NUM_SAMPLES = 64;
+uint const NUM_ROTATIONS = 16;
+
+layout(local_size_x = 16, local_size_y = 16) in;
+layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
+layout(set = 4, binding = 1, rgba32f) uniform image2D normals;
+layout(set = 4, binding = 2, rgba32f) uniform image2D outputImage;
+
+
+// SSAO data
+layout(std430, set = 5, binding = 0) buffer SSAOData
+{
+  vec3 samples[NUM_SAMPLES];
+  vec3 rotations[NUM_ROTATIONS];
+
+} ssaoData;
+
+void main()
+{ 
+  // store result into result image
+  imageStore(outputImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index edf0be23..d062b4d6 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -253,6 +253,18 @@ namespace SHADE
 
     lightingSubSystem = resourceManager.Create<SHLightingSubSystem>();
     lightingSubSystem->Init(device, descPool);
+
+    ssaoStorage = resourceManager.Create<SHSSAO>();
+
+    ssaoTransferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
+    ssaoTransferCmdBuffer->BeginRecording();
+    
+    ssaoStorage->Init(device, ssaoTransferCmdBuffer);
+
+    ssaoTransferCmdBuffer->EndRecording();
+    graphicsQueue->SubmitCommandBuffer({ssaoTransferCmdBuffer});
+
+    graphicsQueue->WaitIdle();
   }
 
 #ifdef SHEDITOR
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
index 072a1d99..9b95ebe4 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
@@ -32,6 +32,7 @@ of DigiPen Institute of Technology is prohibited.
 #include "../Textures/SHVkSamplerCache.h"
 #include "Graphics/MiddleEnd/Interface/SHPostOffscreenRenderSystem.h"
 #include "Graphics/MiddleEnd/Lights/SHLightingSubSystem.h"
+#include "Graphics/MiddleEnd/PostProcessing/SHSSAO.h"
 
 namespace SHADE
 {
@@ -313,6 +314,7 @@ namespace SHADE
     Handle<SHVkDescriptorPool>                                descPool;
     Handle<SHVkCommandPool>                                   graphicsCmdPool;
     Handle<SHVkCommandBuffer>                                 transferCmdBuffer;
+    Handle<SHVkCommandBuffer>                                 ssaoTransferCmdBuffer;
     Handle<SHVkCommandBuffer>                                 graphicsTexCmdBuffer;
     SHRenderContext                                           renderContext;
     std::array<Handle<SHVkSemaphore>, 2>                      graphSemaphores; 
@@ -357,6 +359,7 @@ namespace SHADE
     Handle<SHMousePickSystem>                                 mousePickSystem;
     Handle<SHPostOffscreenRenderSystem>                       postOffscreenRender;
     Handle<SHLightingSubSystem>                               lightingSubSystem;
+    Handle<SHSSAO>                                            ssaoStorage;
 
     uint32_t                                                  resizeWidth = 1;
     uint32_t                                                  resizeHeight = 1;
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
index fb5ae824..f2894786 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
@@ -1,7 +1,60 @@
 #include "SHpch.h"
 #include "SHSSAO.h"
+#include "Graphics/Devices/SHVkLogicalDevice.h"
+#include "Graphics/Buffers/SHVkBuffer.h"
+#include <random>
 
 namespace SHADE
 {
+  void SHSSAO::Init(Handle<SHVkLogicalDevice> logicalDevice, Handle<SHVkCommandBuffer> cmdBuffer) noexcept
+  {
+    // create memory on CPU side
+    ssaoData = std::make_unique<SamplesAndKernel>();
+
+    // Initialize a distribution to get values from 0 to 1
+    std::uniform_real_distribution<float> distrib{0.0f, 1.0f};
+
+    // generator for random number
+    std::default_random_engine generator;
+
+    // generate samples
+    auto& samples = ssaoData->samples;
+    for (uint32_t i = 0; i < NUM_SAMPLES; ++i)
+    {
+      samples[i] = SHVec4
+      {
+        distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+        distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+        distrib(generator),               //  0.0f - 1.0f so that sample space is a hemisphere
+        0.0f
+      };
+
+      // This makes sure that most points are closer to fragment's position
+      float scale = 1.0f / static_cast<float>(NUM_SAMPLES);
+      scale = std::lerp(0.1f, 1.0f, scale * scale);
+      samples[i] *= scale;
+    }
+
+    // generate rotation vector
+    auto& rotationVectors = ssaoData->rotatationVectors;
+    for (uint32_t i = 0; i < NUM_ROTATION_VECTORS; ++i)
+    {
+      samples[i] = SHVec4
+      {
+        distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+        distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+        0.0f,                             // we want to rotate about the z axis in tangent space
+        0.0f
+      };
+    }
+
+    // Get aligned size for buffer
+    uint32_t alignedSize = logicalDevice->PadSSBOSize(sizeof (SamplesAndKernel));
+
+    // Create buffer
+    ssaoDataBuffer = logicalDevice->CreateBuffer(alignedSize, ssaoData.get(), alignedSize, vk::BufferUsageFlagBits::eStorageBuffer | vk::BufferUsageFlagBits::eTransferDst, VMA_MEMORY_USAGE_AUTO, {});
+
+    ssaoDataBuffer->TransferToDeviceResource(cmdBuffer);
+  }
 
 }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
index 17df7200..32e8eb1a 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
@@ -2,14 +2,36 @@
 
 #include "Resource/SHHandle.h"
 #include "Graphics/SHVulkanIncludes.h"
+#include "Math/Vector/SHVec4.h"
 
 namespace SHADE
 {
+  class SHVkBuffer;
+  class SHVkLogicalDevice;
+  class SHVkCommandBuffer;
 
   class SHSSAO
   {
   private:
+    static constexpr uint32_t NUM_SAMPLES = 64;
+    static constexpr uint32_t NUM_ROTATION_VECTORS = 16;
 
+    struct SamplesAndKernel
+    {
+      //! distances from a pixel we want to sample
+      std::array<SHVec4, NUM_SAMPLES>         samples;
 
+      std::array<SHVec4, NUM_ROTATION_VECTORS> rotatationVectors;
+    };
+
+  private:
+    //! Samples and kernel on CPU side
+    std::unique_ptr<SamplesAndKernel> ssaoData;
+
+    //! For passing SSAO samples and kernel to GPU
+    Handle<SHVkBuffer> ssaoDataBuffer;
+
+  public:
+    void Init (Handle<SHVkLogicalDevice> logicalDevice, Handle<SHVkCommandBuffer> cmdBuffer) noexcept;
   };
 }
diff --git a/SHADE_Engine/src/Graphics/Queues/SHVkQueue.cpp b/SHADE_Engine/src/Graphics/Queues/SHVkQueue.cpp
index 828f2974..dcb3ff6a 100644
--- a/SHADE_Engine/src/Graphics/Queues/SHVkQueue.cpp
+++ b/SHADE_Engine/src/Graphics/Queues/SHVkQueue.cpp
@@ -129,4 +129,9 @@ namespace SHADE
     return vkQueue;
   }
 
+  void SHVkQueue::WaitIdle(void) const noexcept
+  {
+    vkQueue.waitIdle();
+  }
+
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/Queues/SHVkQueue.h b/SHADE_Engine/src/Graphics/Queues/SHVkQueue.h
index a647cb72..f27f3b0b 100644
--- a/SHADE_Engine/src/Graphics/Queues/SHVkQueue.h
+++ b/SHADE_Engine/src/Graphics/Queues/SHVkQueue.h
@@ -50,6 +50,8 @@ namespace SHADE
     void       SubmitCommandBuffer (std::initializer_list<Handle<SHVkCommandBuffer>> cmdBuffers, std::initializer_list<Handle<SHVkSemaphore>> signalSems = {}, std::initializer_list<Handle<SHVkSemaphore>> waitSems = {}, vk::PipelineStageFlags waitDstStageMask = {}, Handle<SHVkFence> const& fence = {}) noexcept;
     vk::Result Present             (Handle<SHVkSwapchain> const& swapchain, std::initializer_list<Handle<SHVkSemaphore>> waitSems, uint32_t frameIndex) noexcept;
     vk::Queue GetVkQueue() noexcept;
+
+    void WaitIdle (void) const noexcept;
   };
 }
 
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
index b5f6f7ab..60d76c49 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
@@ -164,4 +164,9 @@ namespace SHADE
     }
   }
 
+  void SHRenderGraphNodeCompute::ModifyWriteDescBufferComputeResource(uint32_t set, uint32_t binding, std::span<Handle<SHVkBuffer>> const& buffers, uint32_t offset, uint32_t range) noexcept
+  {
+    computeResource->descSet->ModifyWriteDescBuffer(set, binding, buffers, offset, range);
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
index 1101e276..d61eda33 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
@@ -18,6 +18,7 @@ namespace SHADE
   class SHRenderGraphResource;
   class SHVkShaderModule;
   class SHVkCommandBuffer;
+  class SHVkBuffer;
 
 
   class SHRenderGraphNodeCompute
@@ -37,8 +38,6 @@ namespace SHADE
     static constexpr uint32_t workGroupSizeX = 16;
     static constexpr uint32_t workGroupSizeY = 16;
 
-    using ExternalDescSetBindCommands = std::function<void(Handle<SHVkCommandBuffer>, Handle<SHVkPipelineLayout>)>;
-
     //! To run the dispatch command
     Handle<SHVkPipeline>                       computePipeline;
 
@@ -48,6 +47,7 @@ namespace SHADE
     //! Descriptor set group to hold the images for reading (STORAGE_IMAGE)
     std::array<Handle<SHVkDescriptorSetGroup>, SHGraphicsConstants::NUM_FRAME_BUFFERS> graphResourceDescSets;
 
+    //! Compute resources
     Handle<ComputeResource> computeResource;
 
     //! vector of resources needed by the subpass compute
@@ -73,6 +73,8 @@ namespace SHADE
 
     void SetDynamicOffsets (std::span<uint32_t> perFrameSizes) noexcept;
 
+    void ModifyWriteDescBufferComputeResource (uint32_t set, uint32_t binding, std::span<Handle<SHVkBuffer>> const& buffers, uint32_t offset, uint32_t range) noexcept;
+
     friend class SHRenderGraph;
     friend class SHRenderGraphNode;
   };

From 2bd3b45ba0a105815aba0c589fc556d4ae66e21b Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Mon, 31 Oct 2022 20:49:28 +0800
Subject: [PATCH 08/27] SSAO sort of working

---
 Assets/Shaders/DeferredComposite_CS.glsl      |   6 +-
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4665 -> 4801 bytes
 Assets/Shaders/SSAO_CS.glsl                   |  78 ++++++++++++++++--
 Assets/Shaders/SSAO_CS.shshaderb              | Bin 0 -> 6425 bytes
 Assets/Shaders/TestCube_VS.glsl               |   5 +-
 Assets/Shaders/TestCube_VS.shshaderb          | Bin 3525 -> 3689 bytes
 .../src/Graphics/Buffers/SHVkBuffer.cpp       |   5 ++
 .../src/Graphics/Buffers/SHVkBuffer.h         |   3 +-
 .../GlobalData/SHGraphicsGlobalData.cpp       |   2 +-
 .../MiddleEnd/Interface/SHGraphicsConstants.h |   1 +
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |  73 +++++++++++-----
 .../MiddleEnd/Interface/SHRenderer.cpp        |   6 +-
 .../Graphics/MiddleEnd/Interface/SHRenderer.h |   5 +-
 .../MiddleEnd/PostProcessing/SHSSAO.cpp       |   7 +-
 .../MiddleEnd/PostProcessing/SHSSAO.h         |   4 +
 .../RenderGraph/SHRenderGraphNodeCompute.cpp  |   6 ++
 .../Graphics/Shaders/SHShaderReflected.cpp    |  10 +++
 17 files changed, 174 insertions(+), 37 deletions(-)
 create mode 100644 Assets/Shaders/SSAO_CS.shshaderb

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index 5f586b9b..4607363b 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -21,7 +21,8 @@ layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
 layout(set = 4, binding = 1, rgba32f) uniform image2D normals;
 layout(set = 4, binding = 2, rgba8) uniform image2D albedo;
 layout(set = 4, binding = 3, r32ui) uniform uimage2D lightLayerData;
-layout(set = 4, binding = 4, rgba8) uniform image2D targetImage;
+layout(set = 4, binding = 4, rgba32f) uniform image2D ssaoImage;
+layout(set = 4, binding = 5, rgba8) uniform image2D targetImage;
 
 layout(set = 1, binding = 0) uniform LightCounts
 {
@@ -78,6 +79,7 @@ void main()
   }
 
   // store result into result image
-  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
+  //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
+  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(imageLoad(ssaoImage, globalThread).rgb, 1.0f));
 
 }
\ No newline at end of file
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index aaaa5207fc09134d01b8cdfec1bc483a63024116..d691c168b25040b5ef44acb3432711e65747ca18 100644
GIT binary patch
delta 458
zcmYk2y-EX75Jo4P{V^+oh*?Qt5u;U7OHf2og;dd6ETV{&TI2z=u~4H?qbBQH$TqPN
zd@#ZDExWJ-hna6??wz^!d-HcIa^@?RTG?p?W+e-4$v(fLy1VAtJ(b~baMimQoSzYU
z=3AWXxJORULw3zgTQ-Q@g02_z2k|1*vU-d!_Q%PO-z*>Ra)HvCC~Klu@#9q8>`RBl
zZ?FuxekU$Li_J7f<J2Qmt69aSlkKokouOn?&@|~dxeWWkwf21g4d0{0KiCK=aKfY4
z@sFS$<@>f^Rs0huFJxN8fkVz{`Daj%EYH0VE2rKp*Rj_uslx}1*T4zr0v%9YKXJ-(
NxA;3y{f}$f@DCT_Ft7js

delta 321
zcmX|+y9&ZU5Jhh`F~Nu+qJb0^8Z9IumV$+)m9N^;zYq%>3*V0z|3gz*`b+kLcS7RA
z;m+Kdo!NaiUUf%xiinS{JPXiZBai#TsT#V8Fd7*%)il^JfPpJDN8BV2sWp<;!{}rB
z`p~CQqP-))sxP_C=u8SE%`c2K(t;U}mGROeNX<nSL9npB@{O6Cfb=*`@-TYZV{2Jv
xxFu~eMJ8UnPdv)sJ0zYgO#6<Br>GNHs8CNt?n}Sa<r8zRTvInh>R&#)OMayWBWVBt

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index 3759c4b4..ac84cb81 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -1,7 +1,13 @@
 #version 450
 
-uint const NUM_SAMPLES = 64;
-uint const NUM_ROTATIONS = 16;
+const uint NUM_SAMPLES = 64;
+const uint NUM_ROTATIONS = 16;
+const int ROTATION_KERNEL_W = 4;
+const int ROTATION_KERNEL_H = 4;
+
+// can perhaps pass in as push constant.
+const float RADIUS = 0.5f;
+const float BIAS = 0.025f;
 
 layout(local_size_x = 16, local_size_y = 16) in;
 layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
@@ -12,13 +18,75 @@ layout(set = 4, binding = 2, rgba32f) uniform image2D outputImage;
 // SSAO data
 layout(std430, set = 5, binding = 0) buffer SSAOData
 {
-  vec3 samples[NUM_SAMPLES];
-  vec3 rotations[NUM_ROTATIONS];
+  vec4 samples[NUM_SAMPLES];
+  vec4 rotations[NUM_ROTATIONS];
 
 } ssaoData;
 
+layout(set = 2, binding = 0) uniform CameraData
+{
+  vec4 position;
+  mat4 vpMat;
+  mat4 viewMat;
+  mat4 projMat;
+
+} cameraData;
+
+shared vec4 sharedRotations[NUM_ROTATIONS];
+
 void main()
 { 
+  ivec2 size = imageSize (outputImage);
+
+  // load rotations into shared memory
+  uint localThreadIndex = gl_LocalInvocationIndex;
+  if (localThreadIndex < NUM_ROTATIONS)
+    sharedRotations[localThreadIndex] = ssaoData.rotations[localThreadIndex];
+
+  barrier();
+
+  ivec2 globalThread = ivec2 (gl_GlobalInvocationID.xy);
+
+  // load all the necessary variables
+  vec3 viewSpacePos     = imageLoad (positions, globalThread).rgb;
+  vec3 viewSpaceNormal  = normalize (imageLoad (normals, globalThread).rgb);
+
+  // Get random vector
+  uint randomVecXIndex = globalThread.x % ROTATION_KERNEL_W;
+  uint randomVecYIndex = globalThread.y % ROTATION_KERNEL_H;
+  vec3 randomVec        = (sharedRotations[randomVecYIndex * ROTATION_KERNEL_W + randomVecXIndex].rgb) * 2.0f - 1.0f;
+
+  // Gram schmidt
+  vec3 tangent = normalize (randomVec - (viewSpaceNormal * dot(viewSpaceNormal, randomVec)));
+  vec3 bitangent = cross (tangent, viewSpaceNormal);
+  mat3 TBN = mat3 (tangent, bitangent, viewSpaceNormal);
+
+  float occlusion = 0.0f;
+  for (int i = 0; i < NUM_SAMPLES; ++i)
+  {
+    // We want to get a position at an offset from the view space position. Offset scaled by radius.
+    vec3 samplePos = TBN * ssaoData.samples[i].rgb;
+    samplePos = viewSpacePos + samplePos * RADIUS;
+
+    // Now we take that offset position and bring it to clip space
+    vec4 offsetPos = vec4 (samplePos, 1.0f);
+    offsetPos = cameraData.projMat * offsetPos;
+
+    // then we do perspective division
+    offsetPos.xyz /= offsetPos.w;
+
+    // and bring it from [-1, 1] to screen coordinates
+    offsetPos.xyz = ((offsetPos.xyz * 0.5f) + 0.5f);
+    offsetPos.xy *= vec2(size.xy);
+
+    float sampleDepth = imageLoad (positions, ivec2 (offsetPos.xy)).z;
+
+    float rangeCheck = smoothstep (0.0f, 1.0f, RADIUS / abs (viewSpacePos.z - sampleDepth));
+    occlusion += (sampleDepth >= samplePos.z + BIAS ? 1.0f : 0.0f) * rangeCheck;
+  }
+
+  occlusion =  (occlusion / float(NUM_SAMPLES));
+
   // store result into result image
-  imageStore(outputImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
+  imageStore(outputImage, ivec2(gl_GlobalInvocationID.xy), vec4(occlusion.rrr, 0.0f));
 }
\ No newline at end of file
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
new file mode 100644
index 0000000000000000000000000000000000000000..78fd5087a76621f421742ffd5f2b9fa21528e843
GIT binary patch
literal 6425
zcmZ9P33Oa#6~`ZKlCD6Jttet!YAaF;$Rf5tleU;vLlbD(Tu7&rX)=(^#LP4-qO{T$
zq>4pxK}At&0Tso4M?}S~h%4?2?hEb;#dAEz-|x+L+jsJv^FR0A|6RWO-S@pW$)s6F
zW%-&s>DVb*c0e{gJ1~2)MP-L%lVGx3J{LJ7>&Wfyp0z!T8_j{mr<{7Cp$BD?6}j)=
zY)aOS-UdcW)tdZa;AAk1eECCiUAvVtnfyuU_p@0W9d!5fclY*o_nh5d9v$s(G_M@4
z^bc2SmHvV1Sf$*oj#rGET8OLG%EOxmiUI9J6noH~#vYC8Rb*%M*v?6_tiGu^x~aK(
zq%>H8nUXyPZn$194X+y-tCR*-*9IzAwBo1c=NKIB@6o-wHjZdk>$O%$J7;?afsLWk
zSY_b6dNcPm@_pvRuU*^KyRy_QS*rt9&ebT5j1E^Ca2+}4yvO!sxB6UQT%%NveD`wj
zgTwU=(I_TWr{;5}$L`!!XmVxl@5q)Q$E%gg*N&FTmA-nTmDipvMH#I(s-8&FJvx#5
zV%OBiMoPo*ZCMw5EjK-1N7ju!R;mruM=q$8FWNtk-Xec-@a@_8MIPOnWn{Bd8?4lt
z*zMUc_J(RO#!Sw};MOf)ll!-!*ULQh1`VU@-;S*2dV97L*_v(Zkk-5vuD)?&qte{Z
z?SflT8mWwxTGRD8$hl%3>OM1hpU?Q{Ii+TS^X@t)*@*Lv7#*u$D(Bw2vCD;h<Q{@+
z^|-P!+8oN`9)@F<gOwFSmGWg7vu(@o={)#05cXVj_tp0OngO1kY-2ls@0b2#3-&5@
znUC#~cLnF!a*mC<nWu4{!y4W}>-uhoZ4WMO-*0<3I@#W*V$a&e_^t_lZT$xT``Lwb
z?eDQ|-~8<%VvIM&vlcl%W{GR%Ijdrxwt0OZ^5iDwdH!Oawt3#K$dija=VtHLaxOmi
zc@u2U>C(R!>D>GbA4-;abE#oX^}~trS<V5T^+;^@lG8s2dn!^+96{#voVVt*ytcNv
z#bvIX`7@KlK9(liZ==ioo$VYAmhpbS<Gk93Vq42N^R>N`a>u9qBhmFAM%S~Ep2NFh
zZ(KL@w*3Ce8Ef5RlFxf>U2VUy#z)<`=$*j)dAV%eBW<5k)H?=yKDIIP)_*3_ImlaI
z+j}l&eP_H7cn;%_L+Z1p_9A4f_x=4WPBGEn3D{F9;CW9%cLqLN^ZiZ5mGkbe?Rz9=
z{3%G|-BbH?r1OgW=cD@^<jwav`kuMM?rNF)=Cvx>?!Ow{e9sx@?LjZjw-4KX;yf1?
z{PuDQV0G%(UaysHUN#$h6wThE-<PAipM1oRqr2>9D^kC8qMz%~T@imv%UovsJJ5~y
zdAQ&0Nw@!FIMuFX%LmMRFSaw)@0_%ECocBA13UV@Gx@Bc-)C}n^7~vKK)2_(H|mdq
z2lwnbBl>;}JIgjNUqoNtgT26eE}Zdcd}YkHcb9wbg=t6HqwlzXzj$74-$DOY30wb(
z1>3vfZ+-Z+I}5h?-4kqouZ!{iP8aR+1bet(`)vJvj`*$U+X}XKZF|ACpPdEUXX)>A
zG2h?EqU~>^_L-dDZ`DD-@6-^s{K1Jki|IKlZDW02hXcP!`kb3~_>MrAyN7AdMji#^
zd^S%I|1_lQztqzAR3PW`QI9%v(5(~pvy$D#Gd~Xf*<b-!2=p1}-8~-Y>tg>!$mamR
zb8~?GY8&$;`^CP>N67bkBTfL;^KP9A{EqZ86~7^;B~ISu`+POA&g^+Wzx#N9w5{WO
z&j3r4ZS0xAm<{x4-)8}1<a@cHzU#|?yl}af_uBg2NBvQMIeJ&Jt-k^k>#xK%Mn3AF
zjV>=-QGX^gcK;V7&N$(|ok)4->pgrSaGzDcUOJF30`fbE(LN_}eh;11EaaNRTeCaa
zQS)4EYxaStc^<la)Le@$SFE`XTi%+zNNw}o?*bsVm7cUOO5BCWh`AWuUN)zg7o!^|
zANT1c=-wxN=K1Vi3glz1FH4-fE9QD5b)9QJFy<1_mu6i;UthqrDRu*#@%la2`A9kU
zw$=cU3%i2eS+F-wum`b?znS{ekwd^3`RK2TZXJEm$EE1*r7!NsW$2#GyP@Cy{I1DI
zKO^XJVb{<*!A#y5`>z9Qcn6KuZympf`XaA^UaZr^HYWU=&^y7o>0Fnio8t=Z3UoR5
z3+~FqO)79#p<CY-aj!s^E9PFExMJ=r;q1i~xvxT(E9PF4ICJ9;Y(}?l`?Rm%x1igT
zJ-BD^uSR!2>swEL6nQP!49qjed5$6F)wdzXlfE5!9q@a2J<{*6@^S9h4agn9rT?`^
z{YvNVyZt&~jd-tbOk8~bUym&}7x>NBehsj;wbZR;-!}pKjM{HNw|0E<--x~d*snh0
zjz-=L^u_!4ro_p+oV#<rDZNu~&h;!a&Ux%a%304l`4+IGV80dJn0P<lhAwvt*ph0#
z9o;;AQBy8zz7yRVaVOq|F6RpFHgq}r4es5EYu%G6`FY<1XZ~$K|9aq_w<7iVt-2F=
z7uXH%0QPY^@_j%)X7_${^PG*d`~WaUK5EKYb1U+L!1%j?HKrp!1mvUUJ?O^7^Y}2j
zoN&eSh<p4IIBNv1XD^?_M}fKeWB-q#TYD9V8GRhxSeHE;BNsWJKsTokM9wGC&9N7A
zjFF3+PobN$7(~ve(arH$m}87woclBA#dCiaTTZy*+;NXS2WO1;C}#2bWXp*yX%_dQ
z8?Qfl`~tfB6=!iDwy`dIH0C}KIbTFKr#OrIvCWBD7$X-sUqUyhIEyc1n-jAzM$TDG
zL4E~H19j{NkY7z)%<5~{*7WZx{a*)i!euYpIJ>@Y0R7g8p1z4b@$7rxjCFZ-W8@;|
zLG+1d{}!A%adu<m>~jY4+hA$3eLubfihX}Kaq=$f)Y1&Thps>V#``|H_2lDD{QzA)
z=J*i0T=e`y^d-RA+mr9xkAQsGKSnpt-)j9o0mjJtTP^ofU~g?ezwem*&w%$#|4jbw
zl>0d__9QS4)&t|5>BC6<vG*^~-8=gICHhWK?Dr9D`7LSBU!luA3hsrQjr=vRmcF}E
z&%a6hdZc~Cp1(!65ATQl{tg%`A2Gj2-v(mOKcLGQ>pAqv`Mb6Q>2HzJ{0`(F!FJ%^
zg4%yd+(M-J`s9kgn>S#`{(nYykC^jc(B&QjvA>-0Gmw7;2PWIO{|%fB;{T4nCr;kw
z^NIgE{(-JP_Wmcjd&f8BU+8jyxO@MG)8`8AKj?DS5AN~Ac}M$rUwsdr0OlL7-{({2
PES|%D^#6}4r-T0kYfO5x

literal 0
HcmV?d00001

diff --git a/Assets/Shaders/TestCube_VS.glsl b/Assets/Shaders/TestCube_VS.glsl
index 867b945f..0e055395 100644
--- a/Assets/Shaders/TestCube_VS.glsl
+++ b/Assets/Shaders/TestCube_VS.glsl
@@ -34,6 +34,7 @@ layout(set = 2, binding = 0) uniform CameraData
   vec4 position; 
   mat4 vpMat;
   mat4 viewMat;
+  mat4 projMat;
 } cameraData;
 
 void main()
@@ -51,8 +52,10 @@ void main()
   // uvs for texturing in fragment shader
   Out.uv = aUV;
 
+  mat3 transposeInv = mat3 (transpose(inverse(modelViewMat)));
+
   // normals are also in view space
-  Out.normal.rgb = mat3(transpose(inverse(modelViewMat))) * aNormal.rgb;
+  Out.normal.rgb = transposeInv * aNormal.rgb;
   Out.normal.rgb = normalize (Out.normal.rgb);
 
   // clip space for rendering
diff --git a/Assets/Shaders/TestCube_VS.shshaderb b/Assets/Shaders/TestCube_VS.shshaderb
index b7e1294bb1b2fcbe7f31212c0662330feff59f48..fb2965a83900e01b2591230c1de83828ad72c658 100644
GIT binary patch
delta 1479
zcmYk6%T7~K6o&Wd<xpBR8Y2!$NTC{y*Th>$j3fl1pa#lC6j5odwH8ZHZHpywa1x(D
zJTr&Bfnn^(IC0<;I5KhI6F4&Q|4z>)?B>r}>tFxcd+oK`e#`zD9x|mPCS37Ye!v*V
zq|ITovpZB7To(OG=zV@ybB?+uX-+GO3$3=d8T@uWt-Ge6u-h&-J1wtMool{PC}F}-
zT%PyZTjhpg*VGl)8XLuGd$ro`R(H_35sy#K>(sk-uPJuG)PwJ_>@-!ees-!+Z{4nU
zy5(l2+E<9D8C6bgHyZo7q*&T!CH3hA=i*;4&Z;Ndeo~oPWo(>R{Qe*p{EENzxxt9Q
z`KalImFb&(&WSjz)lq|v{w#+Nmk<id*t-?P^u%!%n&UcA^?N@Po|AFICPzh&?Jc=^
z$DfvaEmG!GIU`@sX5eoszAj7WbVGhsmR)ngdBteg1v(s7{8Ba-`gG8Lr_qQb*Uu-+
zrhM%)61L4j5R944?ZLeumbyAfL|cWuOR2xk<gDCN!XfQGCOaoM0zSDF$?@+9<Q6q+
zI=CBgCis}XoFwZ6KhpW&OFHE*L^*D;U{c{kilI;3Uz|a{sB@XlqHs@`4>@Bd)H>f@
z_*?1$&5{5|%#>FIrn#%0i0=#1%!G+aZOnKd2v>xxa6;e$IoXE-1uPCj2WRWnf@bEV
z|40lf+C{Y{3ujf2<=fqPIJ^53`P6Ym>d?VW>huZOr-H5HI*fE9;_b*v#`qygf@NpM
zTXElV#4($aV4Hd--)?^J$`$d{uxJV$oUMB<-_{MwUo?TAas8@XdlY5J;B46o`L^uf
z3~EuGodG&HW^h)vA)FD83Cv(jc1wV_ag!Nb5b;4p2s{Ci68qnSmi!xn9sX<ia4gHU
z<-;*U%XK1-28;UbjmmZf>d})Q=ec%uILU2+1`yeo<Uf^P8h;*4hZx;I9W^fe2kUH&
AO8@`>

delta 1294
zcmYk5OKVe66ot>tqls-Ih|nMjl7~g1;=mUbF<7*wK4=r$##c3sF~(?`#PllCNx**)
z@7$jtNM@oV@o#kQ%%PKl-@3U+a>8Qoz4l&b@3SxYo%xlXH{X-SKjBazW{hKIP13v@
z%{Pvep<e;_>&KSk9Xg*EBSu_(tvA@McTCjGn3u$@POaP=RGS00`GF7?-a81Tt|;pS
z6}@)X-DvMOClxVY8Jgs7blUx!?LD{NZ8Xu6^Uj6SN%hu=@^igv_@`Hi^oN?@B#?HM
zjC$zIP0W8zeZ|SzI%&j(r#SiIBA`S@_o=P~<6_lIHOFD$$Je7hCl)meP`UB9nSwK1
z#l09*T}5>XUsI}cmUtt`WwDFIY}q^n>XISWO0vGMZj+tn0#3O}K4Mz<nnV+-k79Oo
z)F*9Y*V~U@82^a>afU18Pk{t?=CQYcW|FVmCU?j$0p%)eQ+;m-9LB7hxc|000k52n
z?$P{Ka~EIthz~U0-`RzzxR95hE3A~6LYrC#y6qlV1J{^B+p7R=ZNwCc?*r9}Uq-7f
zZh8la)Nl(=S)C$}-^7ZuRaN}+APq7=GiI?5fOMKsI@O7@x<~j{r|)BRkMX6`d(jn*
z3Pmn+aS{6jSfQSiBi;^pyTGRbx9xpNq)t2|(ir*-%GeQV{sVVlRH36mYuFuNtLpf+
z-}D2Y!`qvsQ=K@gYfR~;ANV5B1rHn=6^hgY&tTi&G&lzIz&!Rf5O3o*_-DZ<G|G2?
zYQ)=byo-Ms*v)qF#pzhCXWmap?Z=XRd=+ZKGJl{P_ASr_J)ry&7|~q00nh-dv0rHq
TpTCR$XV-QVtL~65u>}4BB{h1@

diff --git a/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.cpp b/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.cpp
index da4bc292..08481483 100644
--- a/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.cpp
+++ b/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.cpp
@@ -64,6 +64,11 @@ namespace SHADE
     return bufferUsageFlags;
   }
 
+  uint32_t SHVkBuffer::GetSizeStored(void) const noexcept
+  {
+    return sizeStored;
+  }
+
   /***************************************************************************/
   /*!
 
diff --git a/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.h b/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.h
index aeda7d18..eb24d161 100644
--- a/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.h
+++ b/SHADE_Engine/src/Graphics/Buffers/SHVkBuffer.h
@@ -102,8 +102,9 @@ namespace SHADE
     /*-----------------------------------------------------------------------*/
     /* SETTERS AND GETTERS                                                   */
     /*-----------------------------------------------------------------------*/
-    vk::Buffer GetVkBuffer (void) const noexcept;
+    vk::Buffer           GetVkBuffer (void) const noexcept;
     vk::BufferUsageFlags GetUsageBits(void) const noexcept;
+    uint32_t             GetSizeStored (void) const noexcept;
 
     template <typename T>
     T GetDataFromMappedPointer(uint32_t index) const noexcept
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/GlobalData/SHGraphicsGlobalData.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/GlobalData/SHGraphicsGlobalData.cpp
index d5fb81bd..9717889d 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/GlobalData/SHGraphicsGlobalData.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/GlobalData/SHGraphicsGlobalData.cpp
@@ -79,7 +79,7 @@ namespace SHADE
     SHVkDescriptorSetLayout::Binding cameraDataBinding
     {
       .Type = vk::DescriptorType::eUniformBufferDynamic,
-      .Stage = vk::ShaderStageFlagBits::eVertex,
+      .Stage = vk::ShaderStageFlagBits::eVertex | vk::ShaderStageFlagBits::eCompute,
       .BindPoint = SHGraphicsConstants::DescriptorSetBindings::CAMERA_DATA,
       .DescriptorCount = 1,
     };
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
index 0257bf3b..0a67cd9f 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsConstants.h
@@ -129,6 +129,7 @@ namespace SHADE
       */
       /***************************************************************************/
       static constexpr uint32_t BATCHED_PER_INST_DATA = 0;
+
     };
 
     struct VertexBufferBindings
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index d062b4d6..2a59a5d1 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -37,6 +37,7 @@ of DigiPen Institute of Technology is prohibited.
 #include "Assets/Asset Types/SHTextureAsset.h"
 #include "Graphics/MiddleEnd/Interface/SHMousePickSystem.h"
 #include "Graphics/MiddleEnd/Lights/SHLightingSubSystem.h"
+#include "Graphics/RenderGraph/SHRenderGraphNodeCompute.h"
 #include "Assets/SHAssetManager.h"
 
 namespace SHADE
@@ -113,6 +114,7 @@ namespace SHADE
     SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_VS.glsl");
     SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_FS.glsl");
     SHAssetManager::CompileAsset("../../Assets/Shaders/DeferredComposite_CS.glsl");
+    SHAssetManager::CompileAsset("../../Assets/Shaders/SSAO_CS.glsl");
 
     shaderModuleLibrary.ImportAllShaderSource(device);
     shaderModuleLibrary.ReflectAllShaderModules();
@@ -154,57 +156,95 @@ namespace SHADE
       renderContextCmdPools[i] = renderContext.GetFrameData(i).cmdPoolHdls[0];
     }
 
+    /*-----------------------------------------------------------------------*/
+    /* SCENE RENDER GRAPH RESOURCES                                          */
+    /*-----------------------------------------------------------------------*/
     // Initialize world render graph
     worldRenderGraph->Init(device, swapchain);
     worldRenderGraph->AddResource("Position",            { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32G32B32A32Sfloat);
     worldRenderGraph->AddResource("Normals",             { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32G32B32A32Sfloat);
+    //worldRenderGraph->AddResource("Tangents",            { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32G32B32A32Sfloat);
     worldRenderGraph->AddResource("Albedo",              { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second);
     worldRenderGraph->AddResource("Depth Buffer",        { SH_ATT_DESC_TYPE_FLAGS::DEPTH_STENCIL }, windowDims.first, windowDims.second, vk::Format::eD32SfloatS8Uint);
     worldRenderGraph->AddResource("Entity ID",           { SH_ATT_DESC_TYPE_FLAGS::COLOR }, windowDims.first, windowDims.second, vk::Format::eR32Uint, 1, vk::ImageUsageFlagBits::eTransferSrc);  
     worldRenderGraph->AddResource("Light Layer Indices", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32Uint, 1, vk::ImageUsageFlagBits::eTransferSrc);
     worldRenderGraph->AddResource("Scene",               { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second);
+    worldRenderGraph->AddResource("SSAO", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32G32B32A32Sfloat);
 
+    /*-----------------------------------------------------------------------*/
+    /* MAIN NODE                                                             */
+    /*-----------------------------------------------------------------------*/
     auto gBufferNode = worldRenderGraph->AddNode("G-Buffer", 
       {
         "Position",            
         "Entity ID",          
         "Light Layer Indices",
         "Normals",
+        //"Tangents",
         "Albedo",
         "Depth Buffer",       
-        "Scene"           
+        "Scene",
+        "SSAO"
       }, 
       {}); // no predecessors
 
+    /*-----------------------------------------------------------------------*/
+    /* G-BUFFER SUBPASS INIT                                                 */
+    /*-----------------------------------------------------------------------*/
     auto gBufferSubpass = gBufferNode->AddSubpass("G-Buffer Write");
     gBufferSubpass->AddColorOutput("Position");
     gBufferSubpass->AddColorOutput("Entity ID");
     gBufferSubpass->AddColorOutput("Light Layer Indices");
     gBufferSubpass->AddColorOutput("Normals");
+    //gBufferSubpass->AddColorOutput("Tangents");
     gBufferSubpass->AddColorOutput("Albedo");
     gBufferSubpass->AddDepthOutput("Depth Buffer", SH_ATT_DESC_TYPE_FLAGS::DEPTH_STENCIL);
 
-    //// kirsch
-    //auto kirschShader = shaderModuleLibrary.GetShaderModule("KirschCs.glsl");
-    //gBufferNode->AddNodeCompute(kirschShader, { "Position", "Scene" });
+    /*-----------------------------------------------------------------------*/
+    /* SSAO PASS AND DATA INIT                                               */
+    /*-----------------------------------------------------------------------*/
+    ssaoStorage = resourceManager.Create<SHSSAO>();
 
-    //// copy
-    //auto pureCopyShader = shaderModuleLibrary.GetShaderModule("PureCopyCs.glsl");
-    //gBufferNode->AddNodeCompute(pureCopyShader, { "Position", "Scene" });
+    ssaoTransferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
+    ssaoTransferCmdBuffer->BeginRecording();
 
-    // deferred composite
+    ssaoStorage->Init(device, ssaoTransferCmdBuffer);
+
+    ssaoTransferCmdBuffer->EndRecording();
+    graphicsQueue->SubmitCommandBuffer({ ssaoTransferCmdBuffer });
+
+    graphicsQueue->WaitIdle();
+
+    auto ssaoShader = shaderModuleLibrary.GetBuiltInShaderModule("SSAO_CS");
+    Handle<SHRenderGraphNodeCompute> ssaoPass = gBufferNode->AddNodeCompute(ssaoShader, {"Position", "Normals", "SSAO"});
+    auto ssaoDataBuffer = ssaoStorage->GetBuffer();
+    ssaoPass->ModifyWriteDescBufferComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_BINDING, {&ssaoDataBuffer, 1}, 0, ssaoStorage->GetBuffer()->GetSizeStored());
+
+
+    /*-----------------------------------------------------------------------*/
+    /* DEFERRED COMPOSITE SUBPASS INIT                                       */
+    /*-----------------------------------------------------------------------*/
     auto deferredCompositeShader = shaderModuleLibrary.GetBuiltInShaderModule("DeferredComposite_CS");
-    gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "Scene" });
-
+    gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "SSAO", "Scene" });
 
+    /*-----------------------------------------------------------------------*/
+    /* DUMMY SUBPASS TO TRANSITION SCENE FOR PRESENT USAGE                   */
+    /*-----------------------------------------------------------------------*/
+    // Dummy to transition scene to be used for shader read
     auto dummyNode = worldRenderGraph->AddNode("Dummy Pass", { "Scene" }, {"G-Buffer"}); // no predecessors
     auto dummySubpass = dummyNode->AddSubpass("Dummy Subpass");
     dummySubpass->AddInput("Scene");
 
-
+    /*-----------------------------------------------------------------------*/
+    /* GENERATE RENDER GRAPH                                                 */
+    /*-----------------------------------------------------------------------*/
     // Generate world render graph
     worldRenderGraph->Generate();
 
+
+    /*-----------------------------------------------------------------------*/
+    /* BIND RENDER GRAPH TO RENDERER                                         */
+    /*-----------------------------------------------------------------------*/
     // Add world renderer to default viewport
     worldRenderer = worldViewport->AddRenderer(resourceManager, swapchain->GetNumImages(), renderContextCmdPools, descPool, SHGraphicsGlobalData::GetDescSetLayouts()[SHGraphicsConstants::DescriptorSetIndex::HIGH_FREQUENCY_GLOBALS], worldRenderGraph);
     worldRenderer->SetCamera(worldCamera);
@@ -254,17 +294,6 @@ namespace SHADE
     lightingSubSystem = resourceManager.Create<SHLightingSubSystem>();
     lightingSubSystem->Init(device, descPool);
 
-    ssaoStorage = resourceManager.Create<SHSSAO>();
-
-    ssaoTransferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
-    ssaoTransferCmdBuffer->BeginRecording();
-    
-    ssaoStorage->Init(device, ssaoTransferCmdBuffer);
-
-    ssaoTransferCmdBuffer->EndRecording();
-    graphicsQueue->SubmitCommandBuffer({ssaoTransferCmdBuffer});
-
-    graphicsQueue->WaitIdle();
   }
 
 #ifdef SHEDITOR
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
index 655451ec..d0deb30c 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.cpp
@@ -88,7 +88,7 @@ namespace SHADE
     }
   }
 
-  void SHRenderer::UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix viewMatrix, SHMatrix projMatrix) noexcept
+  void SHRenderer::UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix const& viewMatrix, SHMatrix const& projMatrix) noexcept
   {
     SetViewProjectionMatrix(viewMatrix, projMatrix);
 
@@ -98,17 +98,19 @@ namespace SHADE
     std::array<uint32_t, 1> dynamicOffsets{ frameIndex * cameraDataAlignedSize };
 
     cmdBuffer->BindDescriptorSet(cameraDescriptorSet, SH_PIPELINE_TYPE::GRAPHICS, SHGraphicsConstants::DescriptorSetIndex::HIGH_FREQUENCY_GLOBALS, std::span{ dynamicOffsets.data(), 1 });
+    cmdBuffer->BindDescriptorSet(cameraDescriptorSet, SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::HIGH_FREQUENCY_GLOBALS, std::span{ dynamicOffsets.data(), 1 });
   }
 
   void SHRenderer::UpdateCameraDataToBuffer(void) noexcept
   {
   }
 
-  void SHRenderer::SetViewProjectionMatrix(SHMatrix viewMatrix, SHMatrix projMatrix) noexcept
+  void SHRenderer::SetViewProjectionMatrix(SHMatrix const& viewMatrix, SHMatrix const& projMatrix) noexcept
   {
     //cpuCameraData.viewProjectionMatrix = camera->GetViewMatrix() * camera->GetProjectionMatrix();
     cpuCameraData.viewProjectionMatrix = SHMatrix::Transpose(projMatrix * viewMatrix);
     cpuCameraData.viewMatrix = SHMatrix::Transpose(viewMatrix);
+    cpuCameraData.projectionMatrix = SHMatrix::Transpose(projMatrix);
   }
 
   Handle<SHRenderGraph> SHRenderer::GetRenderGraph(void) const noexcept
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
index b7c6718c..140cf53b 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHRenderer.h
@@ -47,6 +47,7 @@ namespace SHADE
       SHVec4   cameraPosition;
       SHMatrix viewProjectionMatrix;
       SHMatrix viewMatrix;
+      SHMatrix projectionMatrix;
     };
 
     /*---------------------------------------------------------------------------------*/
@@ -80,9 +81,9 @@ namespace SHADE
         /*-----------------------------------------------------------------------------*/
         void Draw(uint32_t frameIndex, Handle<SHVkDescriptorPool> descPool) noexcept;
         void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex) noexcept;
-        void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix viewMatrix, SHMatrix projMatrix) noexcept;
+        void UpdateDataAndBind(Handle<SHVkCommandBuffer> cmdBuffer, uint32_t frameIndex, SHMatrix const& viewMatrix, SHMatrix const& projMatrix) noexcept;
         void UpdateCameraDataToBuffer (void) noexcept;
-        void SetViewProjectionMatrix (SHMatrix viewMatrix, SHMatrix projMatrix) noexcept;
+        void SetViewProjectionMatrix (SHMatrix const& viewMatrix, SHMatrix const& projMatrix) noexcept;
 
         /*-----------------------------------------------------------------------------*/
         /* Setters and Getters                                                         */
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
index f2894786..c6aa1978 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
@@ -39,7 +39,7 @@ namespace SHADE
     auto& rotationVectors = ssaoData->rotatationVectors;
     for (uint32_t i = 0; i < NUM_ROTATION_VECTORS; ++i)
     {
-      samples[i] = SHVec4
+      rotationVectors[i] = SHVec4
       {
         distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
         distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
@@ -57,4 +57,9 @@ namespace SHADE
     ssaoDataBuffer->TransferToDeviceResource(cmdBuffer);
   }
 
+  Handle<SHVkBuffer> SHSSAO::GetBuffer(void) const noexcept
+  {
+    return ssaoDataBuffer;
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
index 32e8eb1a..040b4695 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
@@ -12,6 +12,9 @@ namespace SHADE
 
   class SHSSAO
   {
+  public:
+    static constexpr uint32_t DESC_SET_BINDING = 0;
+
   private:
     static constexpr uint32_t NUM_SAMPLES = 64;
     static constexpr uint32_t NUM_ROTATION_VECTORS = 16;
@@ -33,5 +36,6 @@ namespace SHADE
 
   public:
     void Init (Handle<SHVkLogicalDevice> logicalDevice, Handle<SHVkCommandBuffer> cmdBuffer) noexcept;
+    Handle<SHVkBuffer> GetBuffer (void) const noexcept;
   };
 }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
index 60d76c49..2c471c83 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
@@ -82,6 +82,11 @@ namespace SHADE
     // bind descriptor sets
     cmdBuffer->BindDescriptorSet(graphResourceDescSets[frameIndex], SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_RESOURCE, {});
 
+    if (computeResource)
+    {
+      cmdBuffer->BindDescriptorSet(computeResource->descSet, SH_PIPELINE_TYPE::COMPUTE, SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, computeResource->dynamicOffsets[frameIndex]);
+    }
+
     // dispatch compute
     cmdBuffer->ComputeDispatch(groupSizeX, groupSizeY, 1);
 
@@ -167,6 +172,7 @@ namespace SHADE
   void SHRenderGraphNodeCompute::ModifyWriteDescBufferComputeResource(uint32_t set, uint32_t binding, std::span<Handle<SHVkBuffer>> const& buffers, uint32_t offset, uint32_t range) noexcept
   {
     computeResource->descSet->ModifyWriteDescBuffer(set, binding, buffers, offset, range);
+    computeResource->descSet->UpdateDescriptorSetBuffer(set, binding);
   }
 
 }
diff --git a/SHADE_Engine/src/Graphics/Shaders/SHShaderReflected.cpp b/SHADE_Engine/src/Graphics/Shaders/SHShaderReflected.cpp
index f28561c5..96fa77ab 100644
--- a/SHADE_Engine/src/Graphics/Shaders/SHShaderReflected.cpp
+++ b/SHADE_Engine/src/Graphics/Shaders/SHShaderReflected.cpp
@@ -142,6 +142,16 @@ namespace SHADE
           case SpvOp::SpvOpTypeRuntimeArray:
             recurseForInfo(&member, interfaceHdl, member.offset, biggestAlignment, parentVarName + std::string(member.name) + ".");
             break;
+          case SpvOp::SpvOpTypeArray:
+            interfaceHdl->AddVariable(parentVarName + std::string (member.name),
+              SHShaderBlockInterface::Variable
+              (
+                parentOffset + member.offset,
+                SHShaderBlockInterface::Variable::Type::OTHER
+              )
+            );
+            biggestAlignment = std::max(biggestAlignment, member.size);
+            break;
         }
       }
     };

From 441207260b9cfd0b50c3cd87cb89bd9aae2cefe7 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Mon, 31 Oct 2022 20:49:49 +0800
Subject: [PATCH 09/27] shmeta

---
 Assets/Shaders/SSAO_CS.shshaderb.shmeta | 3 +++
 1 file changed, 3 insertions(+)
 create mode 100644 Assets/Shaders/SSAO_CS.shshaderb.shmeta

diff --git a/Assets/Shaders/SSAO_CS.shshaderb.shmeta b/Assets/Shaders/SSAO_CS.shshaderb.shmeta
new file mode 100644
index 00000000..a5b5b739
--- /dev/null
+++ b/Assets/Shaders/SSAO_CS.shshaderb.shmeta
@@ -0,0 +1,3 @@
+Name: SSAO_CS
+ID: 48941934
+Type: 2

From 53b9c8f746ad72b98d954d9f57ff41ffbcc7f62e Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Mon, 31 Oct 2022 23:28:46 +0800
Subject: [PATCH 10/27] SSAO WIP

---
 Assets/Shaders/SSAO_CS.glsl                   |  24 +++---
 Assets/Shaders/SSAO_CS.shshaderb              | Bin 6425 -> 6313 bytes
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |   7 +-
 .../MiddleEnd/PostProcessing/SHSSAO.cpp       |  70 ++++++++++++++++--
 .../MiddleEnd/PostProcessing/SHSSAO.h         |  32 +++++---
 .../RenderGraph/SHRenderGraphNodeCompute.cpp  |   7 ++
 .../RenderGraph/SHRenderGraphNodeCompute.h    |   4 +-
 7 files changed, 109 insertions(+), 35 deletions(-)

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index ac84cb81..9cc2de7b 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -19,10 +19,11 @@ layout(set = 4, binding = 2, rgba32f) uniform image2D outputImage;
 layout(std430, set = 5, binding = 0) buffer SSAOData
 {
   vec4 samples[NUM_SAMPLES];
-  vec4 rotations[NUM_ROTATIONS];
 
 } ssaoData;
 
+layout (set = 5, binding = 1) uniform sampler2D noiseTexture;
+
 layout(set = 2, binding = 0) uniform CameraData
 {
   vec4 position;
@@ -32,33 +33,28 @@ layout(set = 2, binding = 0) uniform CameraData
 
 } cameraData;
 
-shared vec4 sharedRotations[NUM_ROTATIONS];
 
 void main()
 { 
   ivec2 size = imageSize (outputImage);
 
-  // load rotations into shared memory
-  uint localThreadIndex = gl_LocalInvocationIndex;
-  if (localThreadIndex < NUM_ROTATIONS)
-    sharedRotations[localThreadIndex] = ssaoData.rotations[localThreadIndex];
-
-  barrier();
-
   ivec2 globalThread = ivec2 (gl_GlobalInvocationID.xy);
 
   // load all the necessary variables
   vec3 viewSpacePos     = imageLoad (positions, globalThread).rgb;
   vec3 viewSpaceNormal  = normalize (imageLoad (normals, globalThread).rgb);
 
-  // Get random vector
-  uint randomVecXIndex = globalThread.x % ROTATION_KERNEL_W;
-  uint randomVecYIndex = globalThread.y % ROTATION_KERNEL_H;
-  vec3 randomVec        = (sharedRotations[randomVecYIndex * ROTATION_KERNEL_W + randomVecXIndex].rgb) * 2.0f - 1.0f;
+  ivec2 noiseDim = textureSize(noiseTexture, 0);
+  vec2 threadUV = globalThread / size;
+  vec2 noiseUV = vec2 (float(size.x)/float(noiseDim.x), float(size.y) / float(noiseDim.y));
+  noiseUV *= threadUV;
+  vec3 randomVec = texture(noiseTexture, noiseUV).rgb * 2.0f - 1.0f;
 
   // Gram schmidt
   vec3 tangent = normalize (randomVec - (viewSpaceNormal * dot(viewSpaceNormal, randomVec)));
   vec3 bitangent = cross (tangent, viewSpaceNormal);
+
+  // matrix for tangent to view
   mat3 TBN = mat3 (tangent, bitangent, viewSpaceNormal);
 
   float occlusion = 0.0f;
@@ -85,7 +81,7 @@ void main()
     occlusion += (sampleDepth >= samplePos.z + BIAS ? 1.0f : 0.0f) * rangeCheck;
   }
 
-  occlusion =  (occlusion / float(NUM_SAMPLES));
+  occlusion = 1.0f - (occlusion / float(NUM_SAMPLES));
 
   // store result into result image
   imageStore(outputImage, ivec2(gl_GlobalInvocationID.xy), vec4(occlusion.rrr, 0.0f));
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index 78fd5087a76621f421742ffd5f2b9fa21528e843..9ba80c93e4334ef6e464462f7f9c384d0a450093 100644
GIT binary patch
literal 6313
zcmZvf36zy(8OJ{cW@J-CQ89?MO)*qLQ#4s^ppY3^jh69p=Q3QKxp$g-K?O=k2{R)t
zt!Q&XTWGbiz07P6Y@vOzY_n`%O*^M^`u)E9KA!K)={@H;&;R*9>-&E1_uZMc;VD_Z
zMz_s5Cd)=;<FjM4$68c2DQkntay=hCA?wKP&Q)ty&1*D!=PfwrEJKgWMyqn)@x-))
z#~=fxYE6DJ@&tIfNjcVT#g8Vp4SXMs#?ZZURZnMESLdpWd&+}@J&ooy{gs~nYOT`K
zTOF#Do7L?V<Hi=^s<m?ew%%euI}yeH+T-ZasO}&;W4?BFnPv5D&B1NWl>?=|3QR{n
zQ(u35bE$vb)}czNw-q}!pTDoar!#l0tZlECOU-J%wsLu1t0S9=-d?R-wRW&nu5{NM
zt-SVZ8ep*As2VJ3kJ-i8)%Br)Qa}8dYz}-aHyhaP*=f05ZB&+52Y`9*GlE-Jxw^S+
z=<&TQfN$m#uiwy$9h03Ou~63Q!X7Hsdg}ulDrK-eH=&!QT3@Bs%wyy?SA#KTbXJ91
zw{&&x-wCdlIqe1;0_)#}HpU+N(2df-V1GIUxf|iuu3gf#ywofK^V=ckYQ?tpdy{sf
zRF61w55U#8Y-v=QtwWU?hFew|s0@`_ksVZ&bH!PUy@kVQ@9*}(OG?cG=Y8{e$wr(v
zcyOqGg`9m3VwVej<PO8NW?o(yY;Mitj>2)SeU)WfE9EP*tdn!~Zuy+OgJI7C+gIE7
zVFKd)&{h}YwT*Y__ihyZ+WOs_e(#0;_JUpXzY@L!@ts>iRGhzcT%9~eInTg)K8s>K
z?U={>VQg3AuOMd_+j*QJVziBkzQbTSJ~WAI<+WiK^R&(DMxvJ7$UNsQ=4qREGZJ}n
zk>@^#v90Ak529y}uw$S4AI0Z$Iu$vQEc0ej!<yogi1A!!BJS%HY<tP+pNTydEvKAJ
z=J=eq=D57Jwz<V+uAKQ3lfyYKNVfOOWq-e?Gc{QDKLIW0jOL$+wwAp4+TK4o<4-~x
zZ%=La>P(UUM6k2VM}P09%lH{+<Gt(Qp96Ne$J5dOZ;$qOO{LRZv~kXRh9pbQdfMJ^
z*IaDR_RQRB_4jwl`f=XR1Us+1@$PLQ;<Ek)X#Lg+|1z-iXj^Ly;tG3x%Um4x#@yb$
zXbSOtV9zGbYb)6L^7h-2Z0kn9>%ohW$xOW$J&icuQO{D}bgJEmmb1pI(C$ypGtu^)
zj6Ls9*!-CBHZW_E`ELX`lYVEuJz<~ObWUP8+43Rgy&c;g!-##g4<d5*@eJ=kV()h*
zpEY8yhmt?+yHiZe`2hC)M~++=^&Y|=g@pfMaF*>}8u^c4`8|pFe}mn}8BF6H_nkFH
z@wuMM7s7dsaXIUwFzsmf<oh`e@qEIze%RiBf8UGt?1F9nX$9N+w_t>Qe!;e$zs1FR
zn?~5>g6(~(7Hsd6zr&I5ecn~Dt-r5e`|J-CZ1WF~u#YDD*__7&@NtOWn623MIX-b0
zaeAJWwy~b~$%x;RE+YMwoRT<sm(Oxnsxt+w-#VVLcJzD_*zbzAJ*OkaZ01SLK+i;s
zk?-QE`OeKkW+p-9y?oZz_nGOB`cDSWNw)Q$f)wjN726p3sQ)yuyy6;#SbrjS&HhhM
z+{I{P?d#o;x9?o^JjCx;FZSu^vl7?GzMSLi#Q9A#-@7Ci=Wq_#Im12|>@(Px@}C7Z
zM!rsu`RMZydFy!>wU-d@UAYi3e<5Pcj$F5R^Zia;l(@)Qgza3#oW<Dkk+TFWcLRN_
zu@te6eAHPEwzuzP^!DuJqt0`{a*@*sws$dS1-5+TtOUzN@8^Q8Bj3$Dp2_nNXVT}n
z_)f|>hyGQFXBGA(U}N^C{MBGN<04<qc%O4O;&YDtOTp$}##8qGu0@QIZ$s7~anII)
z^((HpXZz{xJ==g7vmWVAckeRr#)4dzVxJFZyng5OTO;RO)_MUV7xoLmvkUf%M%XXL
zHvU%X`&@evW8`DL%fZ&s7ju-r_PQL2_hmEKz4?6gJKrX>e9Y4emJ7QAcD{+6qw{Y;
ztl^z8R=;)1Xnm1)1-Mw}N^E1o-w(F#rD<OSU~^o-)xdK03$C8HwgNW@w!SOkUILaY
z<_;yUnA?DJ7FXmp!E(jiZHY5C?!b1ib33PV1%DOTnVi9%!CwuwpY^RL--o^iv6gwp
zc%D_Xym%+t`zqdrJ`;J2Tl`YAzoqI&xL?<zcOx$Sd(isTo_h!S<%l)>O_+qfE^&A9
z9QJ}=k+|#8{~<>EWr(${CAOAx-+(x0)P6PC+DquPAN?BSCd7I588-ucGomlvzgrR~
z@ABL|=UdV{^;)pKjPnfkq2;XSoqQcKwP4>0HYVPW*MsG5L-wSaZvdO8FKWs~%{PIq
z5qILvU^!QCZvo2{@5x&e*SaUIZ_nG{%r{>DM#P>6(E9w=-idw(auB%#agN*3??mL|
z?A`@7&$IC?-;Ed}A2sEyxdZ(k#P~yqHO8agi^xaK_koRx=kb29oZ^b-5%>55aMlR%
zyMHS72N84iNB_IP)?SFjxqS$1tjn2=k&B!UgUwlnM9xRR<~WNv#>hp^N5SUYjYQ7J
zz~=ZY%rQnT_Wg0NIkE3gfaMfd>^tt!C*h3o9>rOFD%o<%o^%$U1{<$GX8a7;e#Nu+
zEVi*OXEa7Ga_#|}Q#^~$VVe_YVT@el+zU3Rcov_>HYd*FUa*{JaSZxCWE|pe`h4^k
z5*KInMQm&Occ%U?A##e#S>m_)%V7Q1h?%|u9=Z3g!Wrvw@5abQ&ey;r_x^P_b7Jqt
z$T{Z(^burQvVA}9M~ZWQBXROB>(tU2d=soc{^tD_*n0ADr@jrAk8?Z>mW!Fc1D=X_
z_Ri${_FY6i?C*ii^S4_6_Yq^{{jHY!0pe_95dHDD)ephmGyN0!JKWeGA;zAKtU)#+
z#(Abk(fXtJkHPkid4B@lhZN`iDYpEcG~ds_at|Q)!0ko<9I=+ZLuuv*!SeQZj_COd
zuyc4nocEW=gNS^@{0h7iiJrd(%NgrF^vU_Vwj1qlk=pzY^ly+|$ZmRQ|2A<Cq0QGP
zSNz?)7CZX?4s4G&=ih_n9!BCh{Q>OW^u<ha)|i0)BXVrAPeA_(nT*8$W`9ncyvt`6
z|C{{<tUu=YE7*DBJM%ZNTu9u<zr*Qs1@{lIob`kIXX3oK-MquT8~;MgH(vi5q|9F2
Nhx6$FFICP%{s)bmR{a0~

literal 6425
zcmZ9P33Oa#6~`ZKlCD6Jttet!YAaF;$Rf5tleU;vLlbD(Tu7&rX)=(^#LP4-qO{T$
zq>4pxK}At&0Tso4M?}S~h%4?2?hEb;#dAEz-|x+L+jsJv^FR0A|6RWO-S@pW$)s6F
zW%-&s>DVb*c0e{gJ1~2)MP-L%lVGx3J{LJ7>&Wfyp0z!T8_j{mr<{7Cp$BD?6}j)=
zY)aOS-UdcW)tdZa;AAk1eECCiUAvVtnfyuU_p@0W9d!5fclY*o_nh5d9v$s(G_M@4
z^bc2SmHvV1Sf$*oj#rGET8OLG%EOxmiUI9J6noH~#vYC8Rb*%M*v?6_tiGu^x~aK(
zq%>H8nUXyPZn$194X+y-tCR*-*9IzAwBo1c=NKIB@6o-wHjZdk>$O%$J7;?afsLWk
zSY_b6dNcPm@_pvRuU*^KyRy_QS*rt9&ebT5j1E^Ca2+}4yvO!sxB6UQT%%NveD`wj
zgTwU=(I_TWr{;5}$L`!!XmVxl@5q)Q$E%gg*N&FTmA-nTmDipvMH#I(s-8&FJvx#5
zV%OBiMoPo*ZCMw5EjK-1N7ju!R;mruM=q$8FWNtk-Xec-@a@_8MIPOnWn{Bd8?4lt
z*zMUc_J(RO#!Sw};MOf)ll!-!*ULQh1`VU@-;S*2dV97L*_v(Zkk-5vuD)?&qte{Z
z?SflT8mWwxTGRD8$hl%3>OM1hpU?Q{Ii+TS^X@t)*@*Lv7#*u$D(Bw2vCD;h<Q{@+
z^|-P!+8oN`9)@F<gOwFSmGWg7vu(@o={)#05cXVj_tp0OngO1kY-2ls@0b2#3-&5@
znUC#~cLnF!a*mC<nWu4{!y4W}>-uhoZ4WMO-*0<3I@#W*V$a&e_^t_lZT$xT``Lwb
z?eDQ|-~8<%VvIM&vlcl%W{GR%Ijdrxwt0OZ^5iDwdH!Oawt3#K$dija=VtHLaxOmi
zc@u2U>C(R!>D>GbA4-;abE#oX^}~trS<V5T^+;^@lG8s2dn!^+96{#voVVt*ytcNv
z#bvIX`7@KlK9(liZ==ioo$VYAmhpbS<Gk93Vq42N^R>N`a>u9qBhmFAM%S~Ep2NFh
zZ(KL@w*3Ce8Ef5RlFxf>U2VUy#z)<`=$*j)dAV%eBW<5k)H?=yKDIIP)_*3_ImlaI
z+j}l&eP_H7cn;%_L+Z1p_9A4f_x=4WPBGEn3D{F9;CW9%cLqLN^ZiZ5mGkbe?Rz9=
z{3%G|-BbH?r1OgW=cD@^<jwav`kuMM?rNF)=Cvx>?!Ow{e9sx@?LjZjw-4KX;yf1?
z{PuDQV0G%(UaysHUN#$h6wThE-<PAipM1oRqr2>9D^kC8qMz%~T@imv%UovsJJ5~y
zdAQ&0Nw@!FIMuFX%LmMRFSaw)@0_%ECocBA13UV@Gx@Bc-)C}n^7~vKK)2_(H|mdq
z2lwnbBl>;}JIgjNUqoNtgT26eE}Zdcd}YkHcb9wbg=t6HqwlzXzj$74-$DOY30wb(
z1>3vfZ+-Z+I}5h?-4kqouZ!{iP8aR+1bet(`)vJvj`*$U+X}XKZF|ACpPdEUXX)>A
zG2h?EqU~>^_L-dDZ`DD-@6-^s{K1Jki|IKlZDW02hXcP!`kb3~_>MrAyN7AdMji#^
zd^S%I|1_lQztqzAR3PW`QI9%v(5(~pvy$D#Gd~Xf*<b-!2=p1}-8~-Y>tg>!$mamR
zb8~?GY8&$;`^CP>N67bkBTfL;^KP9A{EqZ86~7^;B~ISu`+POA&g^+Wzx#N9w5{WO
z&j3r4ZS0xAm<{x4-)8}1<a@cHzU#|?yl}af_uBg2NBvQMIeJ&Jt-k^k>#xK%Mn3AF
zjV>=-QGX^gcK;V7&N$(|ok)4->pgrSaGzDcUOJF30`fbE(LN_}eh;11EaaNRTeCaa
zQS)4EYxaStc^<la)Le@$SFE`XTi%+zNNw}o?*bsVm7cUOO5BCWh`AWuUN)zg7o!^|
zANT1c=-wxN=K1Vi3glz1FH4-fE9QD5b)9QJFy<1_mu6i;UthqrDRu*#@%la2`A9kU
zw$=cU3%i2eS+F-wum`b?znS{ekwd^3`RK2TZXJEm$EE1*r7!NsW$2#GyP@Cy{I1DI
zKO^XJVb{<*!A#y5`>z9Qcn6KuZympf`XaA^UaZr^HYWU=&^y7o>0Fnio8t=Z3UoR5
z3+~FqO)79#p<CY-aj!s^E9PFExMJ=r;q1i~xvxT(E9PF4ICJ9;Y(}?l`?Rm%x1igT
zJ-BD^uSR!2>swEL6nQP!49qjed5$6F)wdzXlfE5!9q@a2J<{*6@^S9h4agn9rT?`^
z{YvNVyZt&~jd-tbOk8~bUym&}7x>NBehsj;wbZR;-!}pKjM{HNw|0E<--x~d*snh0
zjz-=L^u_!4ro_p+oV#<rDZNu~&h;!a&Ux%a%304l`4+IGV80dJn0P<lhAwvt*ph0#
z9o;;AQBy8zz7yRVaVOq|F6RpFHgq}r4es5EYu%G6`FY<1XZ~$K|9aq_w<7iVt-2F=
z7uXH%0QPY^@_j%)X7_${^PG*d`~WaUK5EKYb1U+L!1%j?HKrp!1mvUUJ?O^7^Y}2j
zoN&eSh<p4IIBNv1XD^?_M}fKeWB-q#TYD9V8GRhxSeHE;BNsWJKsTokM9wGC&9N7A
zjFF3+PobN$7(~ve(arH$m}87woclBA#dCiaTTZy*+;NXS2WO1;C}#2bWXp*yX%_dQ
z8?Qfl`~tfB6=!iDwy`dIH0C}KIbTFKr#OrIvCWBD7$X-sUqUyhIEyc1n-jAzM$TDG
zL4E~H19j{NkY7z)%<5~{*7WZx{a*)i!euYpIJ>@Y0R7g8p1z4b@$7rxjCFZ-W8@;|
zLG+1d{}!A%adu<m>~jY4+hA$3eLubfihX}Kaq=$f)Y1&Thps>V#``|H_2lDD{QzA)
z=J*i0T=e`y^d-RA+mr9xkAQsGKSnpt-)j9o0mjJtTP^ofU~g?ezwem*&w%$#|4jbw
zl>0d__9QS4)&t|5>BC6<vG*^~-8=gICHhWK?Dr9D`7LSBU!luA3hsrQjr=vRmcF}E
z&%a6hdZc~Cp1(!65ATQl{tg%`A2Gj2-v(mOKcLGQ>pAqv`Mb6Q>2HzJ{0`(F!FJ%^
zg4%yd+(M-J`s9kgn>S#`{(nYykC^jc(B&QjvA>-0Gmw7;2PWIO{|%fB;{T4nCr;kw
z^NIgE{(-JP_Wmcjd&f8BU+8jyxO@MG)8`8AKj?DS5AN~Ac}M$rUwsdr0OlL7-{({2
PES|%D^#6}4r-T0kYfO5x

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index 2a59a5d1..6a3bd916 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -215,10 +215,15 @@ namespace SHADE
 
     graphicsQueue->WaitIdle();
 
+    ssaoStorage->PrepareRotationVectorsVkData(device);
+
     auto ssaoShader = shaderModuleLibrary.GetBuiltInShaderModule("SSAO_CS");
     Handle<SHRenderGraphNodeCompute> ssaoPass = gBufferNode->AddNodeCompute(ssaoShader, {"Position", "Normals", "SSAO"});
     auto ssaoDataBuffer = ssaoStorage->GetBuffer();
-    ssaoPass->ModifyWriteDescBufferComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_BINDING, {&ssaoDataBuffer, 1}, 0, ssaoStorage->GetBuffer()->GetSizeStored());
+    ssaoPass->ModifyWriteDescBufferComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_BUFFER_BINDING, { &ssaoDataBuffer, 1 }, 0, ssaoStorage->GetBuffer()->GetSizeStored());
+
+    auto viewSamplerLayout = ssaoStorage->GetViewSamplerLayout();
+    ssaoPass->ModifyWriteDescImageComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_IMAGE_BINDING, {&viewSamplerLayout, 1});
 
 
     /*-----------------------------------------------------------------------*/
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
index c6aa1978..b145902f 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
@@ -2,15 +2,14 @@
 #include "SHSSAO.h"
 #include "Graphics/Devices/SHVkLogicalDevice.h"
 #include "Graphics/Buffers/SHVkBuffer.h"
+#include "Graphics/Images/SHVkImage.h"
+#include "Graphics/Images/SHVkSampler.h"
 #include <random>
 
 namespace SHADE
 {
   void SHSSAO::Init(Handle<SHVkLogicalDevice> logicalDevice, Handle<SHVkCommandBuffer> cmdBuffer) noexcept
   {
-    // create memory on CPU side
-    ssaoData = std::make_unique<SamplesAndKernel>();
-
     // Initialize a distribution to get values from 0 to 1
     std::uniform_real_distribution<float> distrib{0.0f, 1.0f};
 
@@ -18,7 +17,6 @@ namespace SHADE
     std::default_random_engine generator;
 
     // generate samples
-    auto& samples = ssaoData->samples;
     for (uint32_t i = 0; i < NUM_SAMPLES; ++i)
     {
       samples[i] = SHVec4
@@ -36,7 +34,6 @@ namespace SHADE
     }
 
     // generate rotation vector
-    auto& rotationVectors = ssaoData->rotatationVectors;
     for (uint32_t i = 0; i < NUM_ROTATION_VECTORS; ++i)
     {
       rotationVectors[i] = SHVec4
@@ -48,15 +45,74 @@ namespace SHADE
       };
     }
 
+    SHImageCreateParams imageDetails =
+    {
+      .imageType = vk::ImageType::e2D,
+      .width = NUM_ROTATION_VECTORS_W,
+      .height = NUM_ROTATION_VECTORS_H,
+      .depth = 1,
+      .levels = 1,
+      .arrayLayers = 1,
+      .imageFormat = vk::Format::eR32G32B32A32Sfloat,
+      .usageFlags = vk::ImageUsageFlagBits::eSampled | vk::ImageUsageFlagBits::eTransferDst,
+      .createFlags = {}
+    };
+
+    uint32_t mipOffset = 0;
+    rotationVectorsImage = logicalDevice->CreateImage(imageDetails, reinterpret_cast<unsigned char*>( rotationVectors.data()), static_cast<uint32_t>(sizeof(rotationVectors)), {&mipOffset, 1}, VMA_MEMORY_USAGE_AUTO, {});
+
+    vk::ImageMemoryBarrier transferBarrier{};
+    rotationVectorsImage->PrepareImageTransitionInfo(vk::ImageLayout::eUndefined, vk::ImageLayout::eTransferDstOptimal, transferBarrier);
+
+    cmdBuffer->PipelineBarrier(vk::PipelineStageFlagBits::eTopOfPipe, vk::PipelineStageFlagBits::eTransfer, {}, {}, {}, {transferBarrier});
+
+    rotationVectorsImage->TransferToDeviceResource(cmdBuffer);
+
+    vk::ImageMemoryBarrier shaderReadBarrier{};
+    rotationVectorsImage->PrepareImageTransitionInfo(vk::ImageLayout::eTransferDstOptimal, vk::ImageLayout::eShaderReadOnlyOptimal, shaderReadBarrier);
+    cmdBuffer->PipelineBarrier(vk::PipelineStageFlagBits::eTransfer, vk::PipelineStageFlagBits::eComputeShader, {}, {}, {}, { shaderReadBarrier });
+
+
     // Get aligned size for buffer
-    uint32_t alignedSize = logicalDevice->PadSSBOSize(sizeof (SamplesAndKernel));
+    uint32_t alignedSize = logicalDevice->PadSSBOSize(sizeof (samples));
 
     // Create buffer
-    ssaoDataBuffer = logicalDevice->CreateBuffer(alignedSize, ssaoData.get(), alignedSize, vk::BufferUsageFlagBits::eStorageBuffer | vk::BufferUsageFlagBits::eTransferDst, VMA_MEMORY_USAGE_AUTO, {});
+    ssaoDataBuffer = logicalDevice->CreateBuffer(alignedSize, samples.data(), alignedSize, vk::BufferUsageFlagBits::eStorageBuffer | vk::BufferUsageFlagBits::eTransferDst, VMA_MEMORY_USAGE_AUTO, {});
 
     ssaoDataBuffer->TransferToDeviceResource(cmdBuffer);
   }
 
+  void SHSSAO::PrepareRotationVectorsVkData(Handle<SHVkLogicalDevice> logicalDevice) noexcept
+  {
+    SHImageViewDetails DETAILS =
+    {
+      .viewType = vk::ImageViewType::e2D,
+      .format = vk::Format::eR32G32B32A32Sfloat,
+      .imageAspectFlags = vk::ImageAspectFlagBits::eColor,
+      .baseMipLevel = 0,
+      .mipLevelCount = 1,
+      .baseArrayLayer = 0,
+      .layerCount = 1
+    };
+    rotationVectorsImageView = rotationVectorsImage->CreateImageView(logicalDevice, rotationVectorsImage, DETAILS);
+
+    SHVkSamplerParams samplerParams
+    {
+      .minFilter = vk::Filter::eNearest,
+      .magFilter = vk::Filter::eNearest,
+      .addressMode = vk::SamplerAddressMode::eRepeat,
+      .mipmapMode = vk::SamplerMipmapMode::eNearest,
+      .maxLod = 1u
+    };
+
+    rotationVectorsSampler = logicalDevice->CreateSampler(samplerParams);
+  }
+
+  SHVkDescriptorSetGroup::viewSamplerLayout SHSSAO::GetViewSamplerLayout(void) const noexcept
+  {
+    return std::make_tuple(rotationVectorsImageView, rotationVectorsSampler, vk::ImageLayout::eShaderReadOnlyOptimal);
+  }
+
   Handle<SHVkBuffer> SHSSAO::GetBuffer(void) const noexcept
   {
     return ssaoDataBuffer;
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
index 040b4695..c7c133c5 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.h
@@ -3,39 +3,47 @@
 #include "Resource/SHHandle.h"
 #include "Graphics/SHVulkanIncludes.h"
 #include "Math/Vector/SHVec4.h"
+#include "Graphics/Descriptors/SHVkDescriptorSetGroup.h"
 
 namespace SHADE
 {
   class SHVkBuffer;
   class SHVkLogicalDevice;
   class SHVkCommandBuffer;
+  class SHVkImage;
+  class SHVkImageView;
+  class SHVkSampler;
 
   class SHSSAO
   {
   public:
-    static constexpr uint32_t DESC_SET_BINDING = 0;
+    static constexpr uint32_t DESC_SET_BUFFER_BINDING = 0;
+    static constexpr uint32_t DESC_SET_IMAGE_BINDING = 1;
 
   private:
     static constexpr uint32_t NUM_SAMPLES = 64;
-    static constexpr uint32_t NUM_ROTATION_VECTORS = 16;
-
-    struct SamplesAndKernel
-    {
-      //! distances from a pixel we want to sample
-      std::array<SHVec4, NUM_SAMPLES>         samples;
-
-      std::array<SHVec4, NUM_ROTATION_VECTORS> rotatationVectors;
-    };
+    static constexpr uint32_t NUM_ROTATION_VECTORS_W = 4;
+    static constexpr uint32_t NUM_ROTATION_VECTORS_H = 4;
+    static constexpr uint32_t NUM_ROTATION_VECTORS = NUM_ROTATION_VECTORS_W * NUM_ROTATION_VECTORS_H;
 
   private:
-    //! Samples and kernel on CPU side
-    std::unique_ptr<SamplesAndKernel> ssaoData;
+    //! distances from a pixel we want to sample
+    std::array<SHVec4, NUM_SAMPLES>         samples;
 
     //! For passing SSAO samples and kernel to GPU
     Handle<SHVkBuffer> ssaoDataBuffer;
 
+    std::array<SHVec4, NUM_ROTATION_VECTORS> rotationVectors;
+
+    Handle<SHVkImage> rotationVectorsImage;
+    Handle<SHVkImageView> rotationVectorsImageView;
+    Handle<SHVkSampler> rotationVectorsSampler;
+
   public:
     void Init (Handle<SHVkLogicalDevice> logicalDevice, Handle<SHVkCommandBuffer> cmdBuffer) noexcept;
+    void PrepareRotationVectorsVkData (Handle<SHVkLogicalDevice> logicalDevice) noexcept;
+    SHVkDescriptorSetGroup::viewSamplerLayout GetViewSamplerLayout (void) const noexcept;
+    
     Handle<SHVkBuffer> GetBuffer (void) const noexcept;
   };
 }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
index 2c471c83..a86acbc7 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.cpp
@@ -175,4 +175,11 @@ namespace SHADE
     computeResource->descSet->UpdateDescriptorSetBuffer(set, binding);
   }
 
+  void SHRenderGraphNodeCompute::ModifyWriteDescImageComputeResource(uint32_t set, uint32_t binding, std::span<SHVkDescriptorSetGroup::viewSamplerLayout> const& viewSamplerLayouts) noexcept
+  {
+    computeResource->descSet->ModifyWriteDescImage(set, binding, viewSamplerLayouts);
+    computeResource->descSet->UpdateDescriptorSetImages(set, binding);
+
+  }
+
 }
diff --git a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
index d61eda33..81157dc2 100644
--- a/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
+++ b/SHADE_Engine/src/Graphics/RenderGraph/SHRenderGraphNodeCompute.h
@@ -2,6 +2,7 @@
 
 #include "Resource/SHHandle.h"
 #include "Graphics/MiddleEnd/Interface/SHGraphicsConstants.h"
+#include "Graphics/Descriptors/SHVkDescriptorSetGroup.h"
 #include "Graphics/SHVulkanIncludes.h"
 #include <initializer_list>
 #include <string>
@@ -10,7 +11,6 @@
 namespace SHADE
 {
   class SHVkPipeline;
-  class SHVkDescriptorSetGroup;
   class SHVkDescriptorPool;
   class SHVkLogicalDevice;
   class SHVkPipelineLayout;
@@ -74,6 +74,8 @@ namespace SHADE
     void SetDynamicOffsets (std::span<uint32_t> perFrameSizes) noexcept;
 
     void ModifyWriteDescBufferComputeResource (uint32_t set, uint32_t binding, std::span<Handle<SHVkBuffer>> const& buffers, uint32_t offset, uint32_t range) noexcept;
+    void ModifyWriteDescImageComputeResource(uint32_t set, uint32_t binding, std::span<SHVkDescriptorSetGroup::viewSamplerLayout> const& viewSamplerLayouts) noexcept;
+
 
     friend class SHRenderGraph;
     friend class SHRenderGraphNode;

From 54a36e147600c5847f66af73768cf2e9ae85abaa Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Tue, 1 Nov 2022 02:32:14 +0800
Subject: [PATCH 11/27] SSAO WIP

---
 Assets/Shaders/DeferredComposite_CS.glsl      |   3 ++-
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4801 -> 4817 bytes
 Assets/Shaders/SSAO_CS.glsl                   |  16 +++++++++-------
 Assets/Shaders/SSAO_CS.shshaderb              | Bin 6313 -> 6433 bytes
 4 files changed, 11 insertions(+), 8 deletions(-)

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index 4607363b..0d29d8e4 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -55,7 +55,7 @@ void main()
   vec3 positionView = imageLoad (positions, globalThread).rgb;
 
   // normal of fragment
-  vec3 normalView = imageLoad(normals, globalThread).rgb;
+  vec3 normalView = -imageLoad(normals, globalThread).rgb;
 
   vec3 fragColor = vec3 (0.0f);
 
@@ -79,6 +79,7 @@ void main()
   }
 
   // store result into result image
+  //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(normalView, 1.0f));
   //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
   imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(imageLoad(ssaoImage, globalThread).rgb, 1.0f));
 
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index d691c168b25040b5ef44acb3432711e65747ca18..cdf5baea792c275a0cb6a28f6bcb400ef788782f 100644
GIT binary patch
literal 4817
zcmZve`EwLi5XXmXPVO62zzukSAc6!$ks}aTA`1zEc)Lz^C!3MU?z#t;C_zP3JW%oe
zC;S`y$-l@_tE}?-nR&guO8KZxcYnKIcfWr9X6gB3Wst61&z6B8SP(1>mIS|MP_QEC
z5fTK8g8q~jisy<uTkXouk-fWcSsLV0Pkffir%$|BG#kb>3`<1Ig@dg~WpuIx+L=@I
zAoyKMud)`3rNYESp?JJhZZt}*_SGaRC2=h(RpMq;ZpW7*{02S0xK>U&72lyx9)A8l
z<sMRwYEqvHlk+ppD6B|Tor7s@)udENP2;so^>Wyb>$UN*)ZQPg6K}*<qGT+dp6;}i
zoqfH*gW_Q_6;<l!{Xt%Oquz?yd?Ai5OBLQ1Z1M1x!?udo>do0O$vla-t&6qNeNRcB
zZidxk^`zcR_vL~;;&CeX1<#8Y<LXTNSiMtgw^YGkiU|%}tLn8dNnOa>uYc^J=Z$(?
zYdeeK+(D~RH(1^SsXsRx&Q8TqcSm-vL&6g;f1mv6StX5oCOutzE$a69xNKwD6?W@7
z*KT&o?W{KJtZwa+sSTW(<JPFV{rfmImph5Zqk1}QT}*4npPDP#by@q=Q_YO<`8AA%
z?ND%<3p*=2LuTP_$AxKMdNT6|pTsxIqoYK%YI{a`azP|KyQhKRUCE<f|L&hTv&n4z
z?bgb<*~htC7Fe?3oO^yh@aNoqKe!X_-p_CK6AK$F^iIaPI>NNaL$f=-CA=Lrt5JJ=
zHmpYJoZb=EYK8R-$=<>*!V+eq7+#H<S;m59obSLQ(FPGZZ)mfq*VBh3b3W|69p8?Q
zorRq@<J-}()3=kVj(KOXk7XEkF!CBkPOw1_%Q<YZctPDIp4G<ulbcx7f=+H0F_}Y_
zpBv0_6Vv=GH{V3VEO%ZQ@lS~Ni}>K;W3y`UsSk{O_%pM9edyFje)cmjEZc9G)n~Qf
zXZ5X?Y<^bXdST?_8%2G25k59s7N7dStUhMUuMeI2Y!;X`?7oh@PeeZE&bOoc`+t<q
ztUVyYpPBUi(ebCARXSl$s`G1<op+7)*m)KRTPJ-$91P#QbY=w%!hd0k>yH-x<Od@r
z{@gjSzz;Z`H(~LYNhUu2YxS3Y=S9R?BaUvd)=JLua>k*6d%#XCe^DzvBtN}i;Y)sW
z-XMz{8^wu%KQV`${(mvSh)GXb_!1L+3xJmCyi3-0*@@2#vv%mToNKoT%!s&8OSgWr
zkG_nESevBr7U``|>^mroGh-(|I&TvU`(Y=uZ?({);>6=^Qj5i-7aP^>6XMu5NiK+^
z6X&EjF~P`#&Kt8lr<_bo{3paY59hb@T##({`Lbm8lGp5I$qPi($2-Kv{`)oN(szfA
z`gmWwL-Mu7i3dh~=pBb)zwTt>VP_V2b1Y`zwm5l+fqk?19TCg!@ouWk9Y)9Zd(m=d
zNB==Y{oFG%&zr;t!p4mKB#tkB{vz+Nh+2Pk27IXno%hSyr!NA&%q)w3{w0L(1irk{
zArZYt=iRKEr|0MCTj%NgU(EJ1mwP;&cw?T<Jx_W%{*luUDnET#D&pN=m(H7~XJBVl
zHFLhgVPaiurNijcr2MF7l?Y#Khjenz2}T~?_(LMzH#+_sMEFc;KeMz+gb(<HI<-dp
zVG%gQA|L%FK7GSZJnrTZ5pUh%KPuUe|CsXuxA>1s28URF{JeDR7XJy!+ni4Q+eLo-
z9n$duxA;#=28UP{|AuPjd^<(>a31a%9hp1c?PTtEMD({#zE_-ig8!))&xr3Av9LcY
zjvY?j+~0E|VsO9A_5p{Ds_%S%j)?dsk%K+>jEatkev{8p@na(Pf&U{P^nD`olMmVQ
zy&#!<qq^l&;ziN8i1^qn59dEE!oFCQqMs4bqvIlM^n!T?Cq6!BMPR1CD4E{fQ?0AT
z&x!B>U#uFy&WnhP-!2h8#O7^av)W&hY_-2E`4y4Xj_ra7U*`2y5q7)l*Bl1UA|JDg
zKQ+8ABHyGt>l+ROhi<8U&iAH>SlI21Z%Jm}&8H+8KXCJTTQYNV)5QrTgW+p41;(5(
zGu#`T{mjXfh_laWKYGPsWpVan1M}yQ`^UyNWyIO0#fc4PMrXuh5sSU=h+~Ia?u(L%
zVKbUY2D2HRmCTG<{})QGiNI|}>yp_A&Wxg0MdT+Rvh}JVnSNUSOOnaY%yRFSMI8}m
z!Uo5ed%q&WZufrGVc;ygce|@=!pMi8<$F)E<-0EVeUatEM$hqOZaxrUx4F6DFmTB7
z%t<B}cJ?w$H%0zTeCV(_ahnM+?u9#|PjIXABgxchGx4!xFq;W%VC=Vhr{C;fFaC+>
zmeUuBe=1rcnoyr_i+|=Ya2CB|2Kc^yF2YW%Vev0Scbty>OVN<Xem}mFj1Rco&DWB_
zA(q_@zissP8xcM%!@iXahOc4YIgIx_sp^=6dm{GZkNvKwtXerUwPXKRQTB`e1GX@<
AI{*Lx

literal 4801
zcmZveX?GM=5QdvfR<^K%3pgPzAc)8&iYzgKAs9%I#oe(p)0wn%X5vhTT?GxOxZr~8
zukfRv{ZStE9MAE6x^E5F951I*Rd3a;s#~{i4;{a)3bIw`80-mxMZw}=S@25^1uKIN
zAwjSt=+1a)?9AAXR$AS$XYWp2mIsB*6Q6$hbcuJ0X2Q6RVVP)!aIlq`j82w7I}3^)
z1iwq^RMyg1ximgr8arC9%+8iu>6IiZCviP0SL0?>N#lzVe!ZSwT(2Z^Ro|gY9)A8V
z<?d6CTGE&dle5#!D6C3VoxNFYwWM6iOr!OSjY^otjr!<FX73Kxi_gZFqhutWnwo1V
zJNr6=2gSo=GO9MvyMv<i*+wg7^Z7WsBvp7<FzDeehiwtBH<~kHl6w+wYa452`*uj5
zYKFDpM$%|z`wGD>@i>#af&=1Xacw#sZp_uwmMZAYFu{RqRihpznG1Ql^^ZODe6|tS
zQ)e-pJ7~=|43>9K=FiQBGm~-D-jSc{pzy@Y-zEQHVbv_|sqA#|)u`QP`Z<zcVY{v~
zX>+cU=CxsGwQHA5ZQ#@#w}#y9-^Z!BGM8vPYA3_ig{)@$skxe8m$gql?G26zUs%IP
zn1+J0T-aIp8FCAEdt8|IWhXO#@Ns<eJUU8Lucgz<QwXZU^Ly$EW+e}K{kwnW+$OX2
zw_PjeW*_HnSzyVAbMA%xz@Kyb{oqcR9Y4R-Pb_S#&^sCD(v`5sL-RYI7oLXAT9l5?
zgtaJ}(>uait+0_J`CIr|Si)?Kg;%0xp0T7E=R2@O^soq>H?&#Q>FEQKIUn{xao>)P
zorRq@<J-}()3@WQj(KOXk7XEkF!CBkPOx4ND>!VacuCzQp4G<ulbcx7f=+H0F-LOo
zKe@pyH!;o6a`R0z%yJin5&x)ow`ivbADdNbW>Fs)`|xLG{rb?UkNoUsURbu@FssjM
z!O!YjBia0{z74|2_ntWQ6-D^iY*~Ej1GD;=F~2@^>a$sxcXnUL&Tk9(m^=2H9o^sm
zgLG!?0TKSpr0<W8KlQBE2|43{G<4*(+GFQgBz?Vf{V--2_M&uV1q{M}afa)U7XIW1
zBPRabIkCVGIGs0P@%tr{6aRJkOTUXEVyzWNw^-{W=Xp6}U%)+JCzijcl^&6wUa;^b
zKRR!aMUIW)#K51J15W?Hm|(=*EY8B0nCOE5TBh?ZS=(eM{?nNj1lx65&c#fF84>px
z>DF)d(U;vK)+TAZMSANK`(6;nnX!`}owo^w{g9K{w?^oYIPpfrsm0>ai;e0w?+)80
z$;ZUeiBl3MCK!3pd1IF6gp-Mh|0!|K!};wz=Oo*Go|nvC@|t~8@*)xS@eb{N?$=nz
z-W@jT<9+cC$;WR#@xZ7LJ#`rNYfh#f?99Tvh{Y`27AFreux}Q>BVyS--p#Zdhtcu9
zCtBg`=--Q|pL=HJd6W1+*qE^&#qq_@U*sJSQR`36fG@S6^L|<T^hLmznPt(>KZWp}
zz?V1LC!+W0yc_;c=j+7<`j!Pc{}(fV=5m*(6K~klx#w|D$G__IgUU}ImWz1z*QNK1
z(=)Kss+u`p=`gW2w#s4jX+nO~vs#2NwnI8O=L91UZ~P$<?;9O|es}Si)P81ZlL#O1
zadnDWeMAHfvB*b%iBI3K6OX%jRK#1i_>W2U<3H|vz%Bk0lEERCAHOIayTyM}@>Zu)
z|2B~yf4g*iz%Bk$lEERCAD?^0&RMwAolfRHcZ>egN%x2|Kkz?v&VAy~idfk9i(`jV
zC-?Q7h#1@_v;4fnhSX=iH-|+BMdV-)K1W30zshGw{6!J_j)?x25Bgpa`N@ZD`9>v^
zZ%DU#Li{BW-yY&)vpn4Am<an)Rf>L6L{IpRVWSt!FF5h>nGk`Qep)iUyQf;$h`%ht
z2Yjh&06QZhE`EH+@gX*E0h`r+R<hN8Uh*p<s~y`p5x&glt0L@nx34)2oMm^5KQ+8A
zBHx5N>l+ROhi<8U&iAH>SlI21Z%Jmp&F5{&_<@^GSu%5T)5Up5G8n!#Q((*qGsC^X
z+0UGWBF=t8`_U^7n-ph1HZXq<xqobYL%3ILkvOs8%xFz~TExO0i(`jd?sp{<!)Ek?
zWH6i2L^3mK{bxpJMBp}~b;;}lXGYPdMC2zQvh}JVnSNUSImzT_X1Vu^qEy70u)*==
z-Y<!;+r3|Q7&y!B-R|m&F!JGN`L0T~eAgsj7g;`R^c-L2=6w-%o0|_D1`b)C4<(Ze
zJA0X>8zO%uZaNHKn+Y)Pg*&28aI5np$<%2x@v&qun+a@S{=L(0_HPisC7O5o67f$&
z%S7Yq^KJ1@9R|*#cg#SK_-7*Q#2OI)Ty)3j*uN0<iR|~{OUd|v+ueL68608}zeB`t
u8NK~lgb&NGZzO}^YuL9AWAB8jV-CI(u^)fzcSRM|%9*Jh`#*}ZU-U1Rim~hf

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index 9cc2de7b..a0fd0bc8 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -7,7 +7,7 @@ const int ROTATION_KERNEL_H = 4;
 
 // can perhaps pass in as push constant.
 const float RADIUS = 0.5f;
-const float BIAS = 0.025f;
+const float BIAS = 0.005f;
 
 layout(local_size_x = 16, local_size_y = 16) in;
 layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
@@ -43,19 +43,20 @@ void main()
   // load all the necessary variables
   vec3 viewSpacePos     = imageLoad (positions, globalThread).rgb;
   vec3 viewSpaceNormal  = normalize (imageLoad (normals, globalThread).rgb);
+  viewSpaceNormal = -viewSpaceNormal;
 
   ivec2 noiseDim = textureSize(noiseTexture, 0);
-  vec2 threadUV = globalThread / size;
-  vec2 noiseUV = vec2 (float(size.x)/float(noiseDim.x), float(size.y) / float(noiseDim.y));
-  noiseUV *= threadUV;
-  vec3 randomVec = texture(noiseTexture, noiseUV).rgb * 2.0f - 1.0f;
+  vec2 threadUV = (vec2(globalThread) + vec2 (0.5f)) / vec2(size);
+  vec2 noiseUVMult = vec2 (float(size.x)/float(noiseDim.x), float(size.y) / float(noiseDim.y));
+  noiseUVMult *= threadUV;
+  vec3 randomVec = texture(noiseTexture, noiseUVMult).rgb * 2.0f - 1.0f;
 
   // Gram schmidt
   vec3 tangent = normalize (randomVec - (viewSpaceNormal * dot(viewSpaceNormal, randomVec)));
-  vec3 bitangent = cross (tangent, viewSpaceNormal);
+  vec3 bitangent = cross (viewSpaceNormal, tangent);
 
   // matrix for tangent to view
-  mat3 TBN = mat3 (tangent, bitangent, viewSpaceNormal);
+  mat3 TBN = mat3(tangent, bitangent, viewSpaceNormal);
 
   float occlusion = 0.0f;
   for (int i = 0; i < NUM_SAMPLES; ++i)
@@ -74,6 +75,7 @@ void main()
     // and bring it from [-1, 1] to screen coordinates
     offsetPos.xyz = ((offsetPos.xyz * 0.5f) + 0.5f);
     offsetPos.xy *= vec2(size.xy);
+    //offsetPos.y = size.y - offsetPos.y;
 
     float sampleDepth = imageLoad (positions, ivec2 (offsetPos.xy)).z;
 
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index 9ba80c93e4334ef6e464462f7f9c384d0a450093..ba9a3defde1149ae2025d4b22048dda2dd16a008 100644
GIT binary patch
literal 6433
zcmZvf33Odm6^3uqCUgV}EmT`OI=2*x1%V1p+F}}Qn_vg4Sku>+*YrV>7xP}qAWBj!
zBDE-3$ErmUq&R@Hq9WovTPJWvaTdi90Y&}3_s(|RmE~FMU;E$x*?XUT&OP_Oq-oY;
zvica`wCJcT8<$Pare*(WNZItP2_>uBQ?XOBmb%}*ZsWS8)mqQe<)@uu=+W7DO?~bd
zVw&L-K!2e;pgsc}i>@}k&h;Dd<H>D;-^D@`SiOB+cY9}N`?_<xi-UvR)!HR}rS87+
zK&iW@JX9*y%DYR(P0YoW2a0{eJ^6rUBJ%6&PhyQ~`BJho`fFyFSymaY4Gz~j`U|}!
zl$Lr=y?vD(g}zO@hDwE=M(o6T|Gj<P?e(dSf!&p2p;oR8bgZe@YRP6}cb7{SZ5%8V
zOI?*}Bd<A|0~xGT%LXgD#=?B;hRRTXp$~mRwg`Qo?pE=ev&D74TrI6B_e1NsCx^DF
zba8EX=zn`T9lciXc=MJ<Y;(3UVmEJDKipTV*W8RYR2b-~^lvE@;jX(KTPqComIfLz
zW&9oGP>dO$RnRuA+EA}C3a=D7@hY2wJHH2Oo_+7fRtx=ued!?7UX8YKV_WB%LahL;
z-w-uNBet>U>-4LIO2nCa2(7YnXSGyo9IV<+XsZkTrJ+J2vW1FjjyP|*H&NX?ynAqc
zp_bFUb3QZGi1QW?4plBtbDf*<i@9~wj-WMqUQ-&Z?W)J!gT}e`mR9d76)()PcFxuN
z<+Ju4hQ9#ry86BoQ-F6wUz?BDH{RjA_ai^A@4S0+-n-$v?_T)%`B$O00N=Z{M8)}A
z$I;GnRPzkX_gUoY=|?~2$9YHoT5{s7?IB|9&zM*@V))o3t&!J+pU=}buM0#iwXu2j
zo6plX&%H#RTI9J;d$5-K^cgQ4<HtUo|2K0!CqI+NlV#olYFJY~lb9CleBfSB#CI(<
z=jY>3#HxuC$edi)tvRV)Ti@LLFjvj|scFJKRwUp1<#2t!sq=Lhu74a>%^uA^9&0Ui
z^Yy)dYR1pR8t<C=?$w?m|FLj;SC93*pAO^aVU72$$NVC=!#ys+{=YrCzGF5korE>c
zewQjT)U2oP{dO$I_iUHdy~g^>;nt7yJ`HZa>c%^FCSa^w!fjDM3#bWW+<z-@*h3rE
z8m<-d9dLV&np@$H@Xv3!t>JI0`y(r7QLi8F`Nf&~?X<qS>y0GeUSqwh;jLf>JKKky
zL!9ri=k45Fs(H`VtZ^;YGf?x~^nGvRTn;2|e)M<{&MGU-e=E$MoVVv26Zg5!<s@!O
zzIwpCcjCK-^RBD!d!^<&p5b8-d%q>kStIs(Ynl)L_7oF+-iJT=?i*G_z5DU=&*B06
zEE`!B`TxQ@7DW7`aQCr<ZhQ}XuZ<Bt*VDNd_G^s8ULQhf#=0lp;Yq;r3E%qR`;Pc`
zK;B=N^UYtJ^Sz_~Zb!WS%A9Y#&13xSWBhW?_dZo}{s??D=eNQ4<b3Pz&-p(4Lpgs0
zeq@aA@0|Uf&3X7OIvPv^yYSVIN!mG_o@b?Rtml0Km;pM8oQXX#Y3dH2<z=bPEV%R5
z@r?Cj&Bww0_UOCjTwu%&o|N}?J}^eTlc(l8w*bsfz|`0BSzF&{=6uwDJbY2|t^Wj&
zum41RW7MPmli=#YF%DRNDtFEGpPaOFvBtWtcSGHEjd==CyFB?%O<Kh28+#J=6mT-=
z!S|baYSMZ+1ABg2(w1S(_ui?+nLQouo+{+~Ej$CLjgqgwB57w~Bj*`#pK0Wr4OhD=
z<(vaIPu(@W+iGphw_#TS^IL&6{U)pi>eif$U6ZuP@x1K46-3T6;p&mo4p*}eYpey<
zQI9&$g1dGHh&s=Pt4E!6aJ9%;4|nZ+&IWw-$mxWu#oAqP>!^37b2$%gPtJKRzT;~4
z;aNWicvj(Wgd4Lr<!^$k85j9##(NjG0PjNNKNoKPR&Ijt!}EYK>P=uPh<p2dxbwmh
z_x2jr_D;S47;`@8N_Y8%@NGF<kz%{ijCbBX{dTF@m$eE&E&Ltug*m@C#_z#5{s8rT
zt|efMdi1vwZXM^Mk6yTIIT!EWF1UO1-Z*c6+p+4=&js*&KNsR}2U9sm`|ktR@NOCF
zymiW0=c3Lae0$D+5!{%VAA-Bid1+r&xH*o{YH&5z3vD=QO*w5h-1?4)y9ln9&%HQl
z`P@s;?8Onem%`QZxi3zdxp4<BgWI=#+E?f=f!mWkxMt`tg}a{ht*73Py&PD}JYzi1
z3RYb{iuJzA_h6TShq=X9VEt{@KFIyri@g#!oPRmid9CN(g1rh@!{3<c*jFU&HlD*i
z_$!lkHTDr=^j`+7Z7sRA?E4yEpHcfYaBH`*(gEyi!F9lXoilD8_I1Fyc>i9XG<ApP
z?m1tZ-l;dhUCTJnU_VyPdfv%5g4sF$O>kr4{dhB6?I0LUHQxd^&$+0n7B#PjTO;no
z+u&-B(B2Ne9^~)I4N0^AuJrAB2i$z)o!<sr^AOfKzqPku-vw?4hk<?Eh<!IukF$FZ
z+&s_5vwSZwMm=h(S#tz?8!-M>V2#Px_W|{&`F^-D@jN~NR}+qS9&wL9h-Qs|-+iCM
zhk&`x$NC?JTe}s+xqSp~tizs-QHz|9!p-Rbk@GRQIrd_XF=~<Xakx3RgUI;=+#H{U
zImW2PzCQ`i@B0pXHQ|VT$36NKnlWdBIEy=zuO>#*S$rC9{GA|rybJDntsr{*4BS|U
zJsP7HIiH1_lRt~k;hSTB<`|<EIiH7{lRt|u;F}X?VT_t*aTNB8U=r{*eL40^NsF`k
zGQKtayVd!x05##Tm-wyzD%^Q%L{DFXkKOy%(TsJt4`b9K=Ns^`d;cbyIk9(R)a-K#
z_FG_1^5<c{4f1_|Cu!;q>kOnb_%7V}_#66raO<hZ^ST?Z9_M%jt`<FiAMUrvv$rST
zw;urY@P7z5&);h2e*}zC_qST@$H3ku0O#XxtDnFR0_UglcfGMc1;#D|TfsJ9oM(Cu
z*7;cbUbt&VzdwWT2l;+~j;}tN`uhc3?LKe^+CJ<r!M(t_!>Q+A!PQ;gK4Q&Z!|lWS
zVZXlt#;QlmZ{eeLG-7@SS2NaqIH%_C+Lc&;i?rsqV1EzxfDzWv|3lL5$C~e)TK;!)
zFMh25N4RUmIsXZ+_5g_I^k=wxb1r&Pvxax?FJM~okHh{I%mDGf-rtg@?idH+f4#rM
zosWJVgxgPiXZ`_K3&eeV2+cW1Xb;2HtRLDVNo&H!@6tcv<{R(4&#cH^+=u-*|0q??
G0RIKoSZT`u

literal 6313
zcmZvf36zy(8OJ{cW@J-CQ89?MO)*qLQ#4s^ppY3^jh69p=Q3QKxp$g-K?O=k2{R)t
zt!Q&XTWGbiz07P6Y@vOzY_n`%O*^M^`u)E9KA!K)={@H;&;R*9>-&E1_uZMc;VD_Z
zMz_s5Cd)=;<FjM4$68c2DQkntay=hCA?wKP&Q)ty&1*D!=PfwrEJKgWMyqn)@x-))
z#~=fxYE6DJ@&tIfNjcVT#g8Vp4SXMs#?ZZURZnMESLdpWd&+}@J&ooy{gs~nYOT`K
zTOF#Do7L?V<Hi=^s<m?ew%%euI}yeH+T-ZasO}&;W4?BFnPv5D&B1NWl>?=|3QR{n
zQ(u35bE$vb)}czNw-q}!pTDoar!#l0tZlECOU-J%wsLu1t0S9=-d?R-wRW&nu5{NM
zt-SVZ8ep*As2VJ3kJ-i8)%Br)Qa}8dYz}-aHyhaP*=f05ZB&+52Y`9*GlE-Jxw^S+
z=<&TQfN$m#uiwy$9h03Ou~63Q!X7Hsdg}ulDrK-eH=&!QT3@Bs%wyy?SA#KTbXJ91
zw{&&x-wCdlIqe1;0_)#}HpU+N(2df-V1GIUxf|iuu3gf#ywofK^V=ckYQ?tpdy{sf
zRF61w55U#8Y-v=QtwWU?hFew|s0@`_ksVZ&bH!PUy@kVQ@9*}(OG?cG=Y8{e$wr(v
zcyOqGg`9m3VwVej<PO8NW?o(yY;Mitj>2)SeU)WfE9EP*tdn!~Zuy+OgJI7C+gIE7
zVFKd)&{h}YwT*Y__ihyZ+WOs_e(#0;_JUpXzY@L!@ts>iRGhzcT%9~eInTg)K8s>K
z?U={>VQg3AuOMd_+j*QJVziBkzQbTSJ~WAI<+WiK^R&(DMxvJ7$UNsQ=4qREGZJ}n
zk>@^#v90Ak529y}uw$S4AI0Z$Iu$vQEc0ej!<yogi1A!!BJS%HY<tP+pNTydEvKAJ
z=J=eq=D57Jwz<V+uAKQ3lfyYKNVfOOWq-e?Gc{QDKLIW0jOL$+wwAp4+TK4o<4-~x
zZ%=La>P(UUM6k2VM}P09%lH{+<Gt(Qp96Ne$J5dOZ;$qOO{LRZv~kXRh9pbQdfMJ^
z*IaDR_RQRB_4jwl`f=XR1Us+1@$PLQ;<Ek)X#Lg+|1z-iXj^Ly;tG3x%Um4x#@yb$
zXbSOtV9zGbYb)6L^7h-2Z0kn9>%ohW$xOW$J&icuQO{D}bgJEmmb1pI(C$ypGtu^)
zj6Ls9*!-CBHZW_E`ELX`lYVEuJz<~ObWUP8+43Rgy&c;g!-##g4<d5*@eJ=kV()h*
zpEY8yhmt?+yHiZe`2hC)M~++=^&Y|=g@pfMaF*>}8u^c4`8|pFe}mn}8BF6H_nkFH
z@wuMM7s7dsaXIUwFzsmf<oh`e@qEIze%RiBf8UGt?1F9nX$9N+w_t>Qe!;e$zs1FR
zn?~5>g6(~(7Hsd6zr&I5ecn~Dt-r5e`|J-CZ1WF~u#YDD*__7&@NtOWn623MIX-b0
zaeAJWwy~b~$%x;RE+YMwoRT<sm(Oxnsxt+w-#VVLcJzD_*zbzAJ*OkaZ01SLK+i;s
zk?-QE`OeKkW+p-9y?oZz_nGOB`cDSWNw)Q$f)wjN726p3sQ)yuyy6;#SbrjS&HhhM
z+{I{P?d#o;x9?o^JjCx;FZSu^vl7?GzMSLi#Q9A#-@7Ci=Wq_#Im12|>@(Px@}C7Z
zM!rsu`RMZydFy!>wU-d@UAYi3e<5Pcj$F5R^Zia;l(@)Qgza3#oW<Dkk+TFWcLRN_
zu@te6eAHPEwzuzP^!DuJqt0`{a*@*sws$dS1-5+TtOUzN@8^Q8Bj3$Dp2_nNXVT}n
z_)f|>hyGQFXBGA(U}N^C{MBGN<04<qc%O4O;&YDtOTp$}##8qGu0@QIZ$s7~anII)
z^((HpXZz{xJ==g7vmWVAckeRr#)4dzVxJFZyng5OTO;RO)_MUV7xoLmvkUf%M%XXL
zHvU%X`&@evW8`DL%fZ&s7ju-r_PQL2_hmEKz4?6gJKrX>e9Y4emJ7QAcD{+6qw{Y;
ztl^z8R=;)1Xnm1)1-Mw}N^E1o-w(F#rD<OSU~^o-)xdK03$C8HwgNW@w!SOkUILaY
z<_;yUnA?DJ7FXmp!E(jiZHY5C?!b1ib33PV1%DOTnVi9%!CwuwpY^RL--o^iv6gwp
zc%D_Xym%+t`zqdrJ`;J2Tl`YAzoqI&xL?<zcOx$Sd(isTo_h!S<%l)>O_+qfE^&A9
z9QJ}=k+|#8{~<>EWr(${CAOAx-+(x0)P6PC+DquPAN?BSCd7I588-ucGomlvzgrR~
z@ABL|=UdV{^;)pKjPnfkq2;XSoqQcKwP4>0HYVPW*MsG5L-wSaZvdO8FKWs~%{PIq
z5qILvU^!QCZvo2{@5x&e*SaUIZ_nG{%r{>DM#P>6(E9w=-idw(auB%#agN*3??mL|
z?A`@7&$IC?-;Ed}A2sEyxdZ(k#P~yqHO8agi^xaK_koRx=kb29oZ^b-5%>55aMlR%
zyMHS72N84iNB_IP)?SFjxqS$1tjn2=k&B!UgUwlnM9xRR<~WNv#>hp^N5SUYjYQ7J
zz~=ZY%rQnT_Wg0NIkE3gfaMfd>^tt!C*h3o9>rOFD%o<%o^%$U1{<$GX8a7;e#Nu+
zEVi*OXEa7Ga_#|}Q#^~$VVe_YVT@el+zU3Rcov_>HYd*FUa*{JaSZxCWE|pe`h4^k
z5*KInMQm&Occ%U?A##e#S>m_)%V7Q1h?%|u9=Z3g!Wrvw@5abQ&ey;r_x^P_b7Jqt
z$T{Z(^burQvVA}9M~ZWQBXROB>(tU2d=soc{^tD_*n0ADr@jrAk8?Z>mW!Fc1D=X_
z_Ri${_FY6i?C*ii^S4_6_Yq^{{jHY!0pe_95dHDD)ephmGyN0!JKWeGA;zAKtU)#+
z#(Abk(fXtJkHPkid4B@lhZN`iDYpEcG~ds_at|Q)!0ko<9I=+ZLuuv*!SeQZj_COd
zuyc4nocEW=gNS^@{0h7iiJrd(%NgrF^vU_Vwj1qlk=pzY^ly+|$ZmRQ|2A<Cq0QGP
zSNz?)7CZX?4s4G&=ih_n9!BCh{Q>OW^u<ha)|i0)BXVrAPeA_(nT*8$W`9ncyvt`6
z|C{{<tUu=YE7*DBJM%ZNTu9u<zr*Qs1@{lIob`kIXX3oK-MquT8~;MgH(vi5q|9F2
Nhx6$FFICP%{s)bmR{a0~


From 5852c409e6cdb693c034c69a4d06669e33892784 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Tue, 1 Nov 2022 11:57:08 +0800
Subject: [PATCH 12/27] SSAO WIP

---
 Assets/Shaders/DeferredComposite_CS.glsl      |   2 +-
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4817 -> 4789 bytes
 Assets/Shaders/SSAO_CS.glsl                   |  18 +++++++++---------
 Assets/Shaders/SSAO_CS.shshaderb              | Bin 6433 -> 6189 bytes
 .../MiddleEnd/PostProcessing/SHSSAO.cpp       |  17 +++++++++++++++++
 5 files changed, 27 insertions(+), 10 deletions(-)

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index 0d29d8e4..da13b1b4 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -81,6 +81,6 @@ void main()
   // store result into result image
   //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(normalView, 1.0f));
   //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
-  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(imageLoad(ssaoImage, globalThread).rgb, 1.0f));
+  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(imageLoad(ssaoImage, globalThread).rgba/*, 1.0f*/));
 
 }
\ No newline at end of file
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index cdf5baea792c275a0cb6a28f6bcb400ef788782f..525f3c4ced3b824db7ef716d0d4f39927b2b018e 100644
GIT binary patch
delta 300
zcmYj~u@1pt6ot?Kx7DafL}=2%K+}mGF&J&aGk6P&L1Hi{imGR@(0CB9VwX6#X%jd3
za{qJgz2|=iufWy!I<hjfZvzSrs<=JezNwOQYOZzr!f}OoWC9Zjdxw~XPCuowF?1+T
zq(-_NiarxXdMITP5+yr=%siA4M@z?VUa6#FGUB!9Bz-!ey_&;9gEAyLB2{>MzQvPI
n3h$76`p-M&p20qYjTU=EBvUfvMs^nbdc(dYGXFwZ7%=_^8D=Al

delta 328
zcmXw!yAA<i5QWcPSXLwmn<x~Bik?KF6phO>=)44pM4@oMuFf0C#ye=eieBQJjh*Dn
z%$b@0Wd3LEUGvOW4q;ek)d38+NaObKnzrEweS2<}&m5;nk#u3hXRZ)C(!nR*v3hyR
z4FP7II)^T+Bgv3RpI95Dfp};sYwZZlib&$JpSab+l}d3TZMsSO!QEXu(*Y7FP_D`9
z4^wDtGLI00j@c6JD5BnuwR$=t>h1qMy&b|qiTObEUi+HsV`HAN0J2z8XyHqn7Wo0{
C%O&Cf

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index a0fd0bc8..c035adcc 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -7,7 +7,7 @@ const int ROTATION_KERNEL_H = 4;
 
 // can perhaps pass in as push constant.
 const float RADIUS = 0.5f;
-const float BIAS = 0.005f;
+const float BIAS = 0.025f;
 
 layout(local_size_x = 16, local_size_y = 16) in;
 layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
@@ -43,17 +43,17 @@ void main()
   // load all the necessary variables
   vec3 viewSpacePos     = imageLoad (positions, globalThread).rgb;
   vec3 viewSpaceNormal  = normalize (imageLoad (normals, globalThread).rgb);
-  viewSpaceNormal = -viewSpaceNormal;
+  //viewSpaceNormal = -viewSpaceNormal;
 
-  ivec2 noiseDim = textureSize(noiseTexture, 0);
+  vec2 noiseDim = vec2 (textureSize(noiseTexture, 0));
   vec2 threadUV = (vec2(globalThread) + vec2 (0.5f)) / vec2(size);
-  vec2 noiseUVMult = vec2 (float(size.x)/float(noiseDim.x), float(size.y) / float(noiseDim.y));
+  vec2 noiseUVMult = vec2 ((vec2(size) / noiseDim);
   noiseUVMult *= threadUV;
-  vec3 randomVec = texture(noiseTexture, noiseUVMult).rgb * 2.0f - 1.0f;
+  vec3 randomVec = texture(noiseTexture, noiseUVMult).rgb;
 
   // Gram schmidt
   vec3 tangent = normalize (randomVec - (viewSpaceNormal * dot(viewSpaceNormal, randomVec)));
-  vec3 bitangent = cross (viewSpaceNormal, tangent);
+  vec3 bitangent = normalize (cross (tangent, viewSpaceNormal));
 
   // matrix for tangent to view
   mat3 TBN = mat3(tangent, bitangent, viewSpaceNormal);
@@ -75,16 +75,16 @@ void main()
     // and bring it from [-1, 1] to screen coordinates
     offsetPos.xyz = ((offsetPos.xyz * 0.5f) + 0.5f);
     offsetPos.xy *= vec2(size.xy);
-    //offsetPos.y = size.y - offsetPos.y;
 
     float sampleDepth = imageLoad (positions, ivec2 (offsetPos.xy)).z;
 
     float rangeCheck = smoothstep (0.0f, 1.0f, RADIUS / abs (viewSpacePos.z - sampleDepth));
-    occlusion += (sampleDepth >= samplePos.z + BIAS ? 1.0f : 0.0f) * rangeCheck;
+    occlusion += (sampleDepth <= samplePos.z + BIAS ? 1.0f : 0.0f) * rangeCheck;
+    //occlusion += (sampleDepth <= samplePos.z + BIAS ? 1.0f : 0.0f);
   }
 
   occlusion = 1.0f - (occlusion / float(NUM_SAMPLES));
 
   // store result into result image
-  imageStore(outputImage, ivec2(gl_GlobalInvocationID.xy), vec4(occlusion.rrr, 0.0f));
+  imageStore(outputImage, globalThread, vec4(occlusion.rrr, 1.0f));
 }
\ No newline at end of file
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index ba9a3defde1149ae2025d4b22048dda2dd16a008..e0103cd5dc849c1cf72aaf7c901a6e9fd6af7c0c 100644
GIT binary patch
literal 6189
zcmZ9Od30S>6^Acrl8y|OsoGjP-~g?KB4ClBBc_$MN$nuw5MGnl<U#UY%zFtGkv3Fo
zoe&Te1Qc<sqToECB5Ivl=K*I>oJah_rLN^#e&4-kv+l}SYp?U$zdfFP&%N)pojNDW
z*Oa!!Q?u--Y({o;_RoUKW@l|MS-zjeJ~Qjg^{$OuH!f?o`j?%3&Y8L%lTC5UZO7u%
z0d7ZzE48}(3CMBqa<g-+UieQTwhjCsh1#j!wXwIWySr=S#l3waBfZVm?xAY$P_16=
z?XQhi`&zZ}s(#Z-ezkhv&{%)jp#zU{ef8<oXx6SFI-|c1PMKwmvDU~~Yr}A5pbFEO
z_cSon*jX9cHaJ?X^cTL<^8N>gdb@JdhWdD;uhObD>KoSOxjM7C?BliSRa-|Yebt^u
zvxw`+<^e_;&6>`V)>u^b-P{-*t_;DqXN%$Mx!OeU$d=@Ktyx`H8wTdFX9TycdUb1T
z^zpNt1K-L!-oB&o?Z_?)-|ag#jSaQ(oR`3jR_gtY;T_dJuywbvw<`64YQ6Be41H%U
z7=5N>6}W9{Hs?87;6@)4Z*nNG_Hp)Fjytjm_GV>xWGD^7v%CUs>(<rX>nbf%<u^pm
zRrnTX-ml)QG{Vo=o8cO}b~UT5Vz6?z!L6+fS4S&_XD1ouTrqF4H&LFem5q;Vs@QvQ
z-Z`I{Y;fM<k<rE#a@M&Wy{}Y9?hstj^SbItYcTga0>@kjs%r<UeOG2#7jyM~`K;TK
z&=-QOtL{576Y-9yyO;gd^>=Caew6L%+C7_g?}m2Yz0k|{eej)#@7;R5V*ciFb@3eK
zrsTLi^I4ShsYgG?$GjtcJw3#%?IC>ZPoJn8K74EvSH!iUm*dop>p>!y+~hd>Eyt-F
zcOw#UauMe_?ZI5m$!EN1k{;*O{unl&(-V>7i85{>Im{_O5g+He0P(CRqgzW(`vUZ7
z>~hLUM9#>0b5755s~cNh#>yE#D;ezL{G@xoT-NuSx<G|x{U@-?*`x8tvztracy;fe
zoc<@W>u*hU&uUK*|0J-z%SV0hr%V4+*!B0WhkY^FrTsK^?J<wj!RC{9220ts+fR9g
zK9^3Ofk8jdvn)BuSx?>j?^=TH?3d?Sp__X}p|4!ZZL#ioiIX=*pUsGC4tg)U=ZzU$
z4z_3c@UMciZ0|~Y^82pcJnCafw-^1L?{&y3<OC+MhkYLWK6dA)Z9dg}2j$H1N_J-^
z=Q-8)Cr<l;gpF6fiQOL5J;SXD`&{NTmD`doA7b2F(XFH1I_ka`axu?4z%h$Elg%7)
zw!4!(^n>WG(C+~sRnqSTM}BAa5OU=3;R~YPBk19;{ZS;#_O6M1e@FA168`@Hd(Net
z(|i6HqK{(jb9wI8)5qmm{te@|!!!GiPDh+y=;jaIcfjBIvc9OKpAKF!N%wa-{I&a=
z9J=`~nWS%-q+eFjF9%mjy7$fBv&iRt^LIFO^G}p??}opnVK@HJB>hOzFJvBmYmPzu
z&J3a(cWmM=VtUR>U0>&Y65=<d8&AI{Cnrwc<+Hpt<(UK4ZXRc>9yOl~_S>Rv&H0Ev
zJ9$#YJ<l?I<hyxlzM~6~1xeWQT0U#@`^>aQ{!_t=lWzW}Am#i|Mb}3@@;?nMuedym
z`Dbz0tpD`HUCgepb-f$%*7ZAeCUOSSkM4Kuti%m)F8g?9;+C^F@bMdUcH+(F-BORa
zoC~(^@O>6oZi0NqJ{yrc4~dxb!9KT$xd1G8AjMn=HcsA}-e0+hUkNV9uR@pWN%5<}
zE0RPXYtUCA+RS5bYZ1>Ab=QIQlixxv-*;yz?+WfYU^(X>HM_w2YO`nGF}bL<9$cKG
zsJ$Wg%lMWSb9yeioPH56XS~mCBjR(5e4D`5xRj^nee6c`k#9r%4T*cxljFh%`1rlC
zj_<y9^LmG#hscG#6}+gVZ=0lVN7w(BG_M_CedKR|Gw1UW^Jv?bxJ$v-(iZpk1z>0D
z9JSk@-y-?w=Y?Ro&|d_$zgf(|S}#V-;q%c~d*pu!IP&Xfe!p$<k#8rsoWBoUpRo6X
ztrvG;7uXnAa06gDYXvu$xV92k1DoF!epi6y%CT1_t{giAXD_aZ9R|ylW9x}CwkLfj
z8esdjPx}gf1Z+?CV9nrP3bvm4%_rZ>K8l#jIDMRFg<W3UV)q`3$Jv)7|KWCC#qMvO
z`@gt%yV<WnT-sm8uHD_acd}oLn8R=PZ1$HY?mq6*9`N48UB~`keAKT-%xx~Qx$OIT
z#6BbUtH9=7O{D|uuSWJG_Nz@l-?7&q+Ty)>ZQ|rz&fPiRl<xTJz}C{w8BDOtna{iW
zdSq@%zX7aIyf<&iaq%tlJ7&y{h;iB?r(EQGBiI~qCvE}Dxq^EWSk8WfdvoH7ds2K;
z-U4U5{@SaEHE(9uwwj*qWPclSJ8}nNAGfl<9g&aO-32zz**MF0Ao|>eL{2$#Hrd~a
z=zlk2jv4IlLgXXoyTSUz^LP(fPH}m@;ylIg<9pG~5#o2>nZ6G(R(sTcKiJ#{k(kj3
z!1}uESs%HG`5@Ssdyt6v5ZD-dF-9M`h`A4J%)Lm&d>Cwuy&I#CT%7wOU}NIk9|g-P
zt~htxqmRMqvjT~C`r}ELQzp_ZJ^|KWd-V88u=UEb_!PRnE_>8RE@D0nHl{p_&!8I<
zv(QH_Vm=EtraX)L(T#~&=p*MWrm}wynU2JNiO(l4X7vShbNYYqH1-D&ImKl!@f-X_
z@B@fBqNfMJlh6JoIDK87T_3rK`7(I&*}np3jP;DsN6tQHvVRqsm-JKEzlN0i{(9o%
zUFNB$8GHk*J^q`16Kp>DxKoG0@-fFlV7ch|TVTIM&fcD8uzwqo5B)n}<NOWR{#`^L
zd4FT&zK7UbJEGlpO#b_b_e}dN{x8e@0MU0jvKgr&`Z=E??AoLD55d-set!g>K+668
z7`@<&nm<98dkDFoKK8Kx6fu{!gQ@4ACEoh>5jB4fwh!-z{r&>cS3Z1x32q@1$>&#K
zIek5cHaUOS{EhRs$ldr(_J@&iWH0gRzeXNL9zl%PCRhI5+>IXfe*?Bg%=x!qxkr(B
zPQL?tHf_<9oH@LEzekQv`c(EmAjc)$bN>;sMtnQ|lsI`M?%1Ef+FZf?1uW-t4(_js
e^Dg%AUV7jEh8VBEcKhw4KYOzu?f)ao3grLsf<q?&

literal 6433
zcmZvf33Odm6^3uqCUgV}EmT`OI=2*x1%V1p+F}}Qn_vg4Sku>+*YrV>7xP}qAWBj!
zBDE-3$ErmUq&R@Hq9WovTPJWvaTdi90Y&}3_s(|RmE~FMU;E$x*?XUT&OP_Oq-oY;
zvica`wCJcT8<$Pare*(WNZItP2_>uBQ?XOBmb%}*ZsWS8)mqQe<)@uu=+W7DO?~bd
zVw&L-K!2e;pgsc}i>@}k&h;Dd<H>D;-^D@`SiOB+cY9}N`?_<xi-UvR)!HR}rS87+
zK&iW@JX9*y%DYR(P0YoW2a0{eJ^6rUBJ%6&PhyQ~`BJho`fFyFSymaY4Gz~j`U|}!
zl$Lr=y?vD(g}zO@hDwE=M(o6T|Gj<P?e(dSf!&p2p;oR8bgZe@YRP6}cb7{SZ5%8V
zOI?*}Bd<A|0~xGT%LXgD#=?B;hRRTXp$~mRwg`Qo?pE=ev&D74TrI6B_e1NsCx^DF
zba8EX=zn`T9lciXc=MJ<Y;(3UVmEJDKipTV*W8RYR2b-~^lvE@;jX(KTPqComIfLz
zW&9oGP>dO$RnRuA+EA}C3a=D7@hY2wJHH2Oo_+7fRtx=ued!?7UX8YKV_WB%LahL;
z-w-uNBet>U>-4LIO2nCa2(7YnXSGyo9IV<+XsZkTrJ+J2vW1FjjyP|*H&NX?ynAqc
zp_bFUb3QZGi1QW?4plBtbDf*<i@9~wj-WMqUQ-&Z?W)J!gT}e`mR9d76)()PcFxuN
z<+Ju4hQ9#ry86BoQ-F6wUz?BDH{RjA_ai^A@4S0+-n-$v?_T)%`B$O00N=Z{M8)}A
z$I;GnRPzkX_gUoY=|?~2$9YHoT5{s7?IB|9&zM*@V))o3t&!J+pU=}buM0#iwXu2j
zo6plX&%H#RTI9J;d$5-K^cgQ4<HtUo|2K0!CqI+NlV#olYFJY~lb9CleBfSB#CI(<
z=jY>3#HxuC$edi)tvRV)Ti@LLFjvj|scFJKRwUp1<#2t!sq=Lhu74a>%^uA^9&0Ui
z^Yy)dYR1pR8t<C=?$w?m|FLj;SC93*pAO^aVU72$$NVC=!#ys+{=YrCzGF5korE>c
zewQjT)U2oP{dO$I_iUHdy~g^>;nt7yJ`HZa>c%^FCSa^w!fjDM3#bWW+<z-@*h3rE
z8m<-d9dLV&np@$H@Xv3!t>JI0`y(r7QLi8F`Nf&~?X<qS>y0GeUSqwh;jLf>JKKky
zL!9ri=k45Fs(H`VtZ^;YGf?x~^nGvRTn;2|e)M<{&MGU-e=E$MoVVv26Zg5!<s@!O
zzIwpCcjCK-^RBD!d!^<&p5b8-d%q>kStIs(Ynl)L_7oF+-iJT=?i*G_z5DU=&*B06
zEE`!B`TxQ@7DW7`aQCr<ZhQ}XuZ<Bt*VDNd_G^s8ULQhf#=0lp;Yq;r3E%qR`;Pc`
zK;B=N^UYtJ^Sz_~Zb!WS%A9Y#&13xSWBhW?_dZo}{s??D=eNQ4<b3Pz&-p(4Lpgs0
zeq@aA@0|Uf&3X7OIvPv^yYSVIN!mG_o@b?Rtml0Km;pM8oQXX#Y3dH2<z=bPEV%R5
z@r?Cj&Bww0_UOCjTwu%&o|N}?J}^eTlc(l8w*bsfz|`0BSzF&{=6uwDJbY2|t^Wj&
zum41RW7MPmli=#YF%DRNDtFEGpPaOFvBtWtcSGHEjd==CyFB?%O<Kh28+#J=6mT-=
z!S|baYSMZ+1ABg2(w1S(_ui?+nLQouo+{+~Ej$CLjgqgwB57w~Bj*`#pK0Wr4OhD=
z<(vaIPu(@W+iGphw_#TS^IL&6{U)pi>eif$U6ZuP@x1K46-3T6;p&mo4p*}eYpey<
zQI9&$g1dGHh&s=Pt4E!6aJ9%;4|nZ+&IWw-$mxWu#oAqP>!^37b2$%gPtJKRzT;~4
z;aNWicvj(Wgd4Lr<!^$k85j9##(NjG0PjNNKNoKPR&Ijt!}EYK>P=uPh<p2dxbwmh
z_x2jr_D;S47;`@8N_Y8%@NGF<kz%{ijCbBX{dTF@m$eE&E&Ltug*m@C#_z#5{s8rT
zt|efMdi1vwZXM^Mk6yTIIT!EWF1UO1-Z*c6+p+4=&js*&KNsR}2U9sm`|ktR@NOCF
zymiW0=c3Lae0$D+5!{%VAA-Bid1+r&xH*o{YH&5z3vD=QO*w5h-1?4)y9ln9&%HQl
z`P@s;?8Onem%`QZxi3zdxp4<BgWI=#+E?f=f!mWkxMt`tg}a{ht*73Py&PD}JYzi1
z3RYb{iuJzA_h6TShq=X9VEt{@KFIyri@g#!oPRmid9CN(g1rh@!{3<c*jFU&HlD*i
z_$!lkHTDr=^j`+7Z7sRA?E4yEpHcfYaBH`*(gEyi!F9lXoilD8_I1Fyc>i9XG<ApP
z?m1tZ-l;dhUCTJnU_VyPdfv%5g4sF$O>kr4{dhB6?I0LUHQxd^&$+0n7B#PjTO;no
z+u&-B(B2Ne9^~)I4N0^AuJrAB2i$z)o!<sr^AOfKzqPku-vw?4hk<?Eh<!IukF$FZ
z+&s_5vwSZwMm=h(S#tz?8!-M>V2#Px_W|{&`F^-D@jN~NR}+qS9&wL9h-Qs|-+iCM
zhk&`x$NC?JTe}s+xqSp~tizs-QHz|9!p-Rbk@GRQIrd_XF=~<Xakx3RgUI;=+#H{U
zImW2PzCQ`i@B0pXHQ|VT$36NKnlWdBIEy=zuO>#*S$rC9{GA|rybJDntsr{*4BS|U
zJsP7HIiH1_lRt~k;hSTB<`|<EIiH7{lRt|u;F}X?VT_t*aTNB8U=r{*eL40^NsF`k
zGQKtayVd!x05##Tm-wyzD%^Q%L{DFXkKOy%(TsJt4`b9K=Ns^`d;cbyIk9(R)a-K#
z_FG_1^5<c{4f1_|Cu!;q>kOnb_%7V}_#66raO<hZ^ST?Z9_M%jt`<FiAMUrvv$rST
zw;urY@P7z5&);h2e*}zC_qST@$H3ku0O#XxtDnFR0_UglcfGMc1;#D|TfsJ9oM(Cu
z*7;cbUbt&VzdwWT2l;+~j;}tN`uhc3?LKe^+CJ<r!M(t_!>Q+A!PQ;gK4Q&Z!|lWS
zVZXlt#;QlmZ{eeLG-7@SS2NaqIH%_C+Lc&;i?rsqV1EzxfDzWv|3lL5$C~e)TK;!)
zFMh25N4RUmIsXZ+_5g_I^k=wxb1r&Pvxax?FJM~okHh{I%mDGf-rtg@?idH+f4#rM
zosWJVgxgPiXZ`_K3&eeV2+cW1Xb;2HtRLDVNo&H!@6tcv<{R(4&#cH^+=u-*|0q??
G0RIKoSZT`u

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
index b145902f..2bf32fd8 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/PostProcessing/SHSSAO.cpp
@@ -19,6 +19,23 @@ namespace SHADE
     // generate samples
     for (uint32_t i = 0; i < NUM_SAMPLES; ++i)
     {
+      //SHVec3 temp
+      //{
+      //  distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+      //  distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f
+      //  distrib(generator),               //  0.0f - 1.0f so that sample space is a hemisphere
+      //};
+
+      //temp = SHVec3::Normalise(temp);
+      //temp *= distrib(generator);
+
+      //// This makes sure that most points are closer to fragment's position
+      //float scale = 1.0f / static_cast<float>(NUM_SAMPLES);
+      //scale = std::lerp(0.1f, 1.0f, scale * scale);
+      //temp *= scale;
+      //samples[i] = SHVec4 (temp.x, temp.y, temp.z, 0.0f);
+
+
       samples[i] = SHVec4
       {
         distrib(generator) * 2.0f - 1.0f, // -1.0f - 1.0f

From 53fc1fce953f58766116d2ffcb52fdda01aa32dc Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Tue, 1 Nov 2022 12:10:15 +0800
Subject: [PATCH 13/27] WIP

---
 Assets/Shaders/SSAO_CS.glsl | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index c035adcc..2f44763c 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -47,7 +47,7 @@ void main()
 
   vec2 noiseDim = vec2 (textureSize(noiseTexture, 0));
   vec2 threadUV = (vec2(globalThread) + vec2 (0.5f)) / vec2(size);
-  vec2 noiseUVMult = vec2 ((vec2(size) / noiseDim);
+  vec2 noiseUVMult = vec2 (vec2(size) / noiseDim);
   noiseUVMult *= threadUV;
   vec3 randomVec = texture(noiseTexture, noiseUVMult).rgb;
 

From 78545889da8ee22fd71924b002e927448de81bfa Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Tue, 1 Nov 2022 12:47:50 +0800
Subject: [PATCH 14/27] SHSHSHAO

---
 Assets/Shaders/SSAO_CS.glsl      |   5 ++++-
 Assets/Shaders/SSAO_CS.shshaderb | Bin 6189 -> 6237 bytes
 2 files changed, 4 insertions(+), 1 deletion(-)

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index 2f44763c..a359a3e8 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -78,8 +78,11 @@ void main()
 
     float sampleDepth = imageLoad (positions, ivec2 (offsetPos.xy)).z;
 
+    if (sampleDepth == 0.0f)
+      continue;
+
     float rangeCheck = smoothstep (0.0f, 1.0f, RADIUS / abs (viewSpacePos.z - sampleDepth));
-    occlusion += (sampleDepth <= samplePos.z + BIAS ? 1.0f : 0.0f) * rangeCheck;
+    occlusion += (sampleDepth <= samplePos.z - BIAS ? 1.0f : 0.0f) * rangeCheck;
     //occlusion += (sampleDepth <= samplePos.z + BIAS ? 1.0f : 0.0f);
   }
 
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index e0103cd5dc849c1cf72aaf7c901a6e9fd6af7c0c..a419165f53608005e3b2fbbadff33153e4be7f19 100644
GIT binary patch
literal 6237
zcmZ9O2b5f86~|vT*-fQHS~M}F*dP%I0tP9mxLMs~7gLM{H<Q`PW?*+_nVC%jCZ<rt
zhCvYxSg;}}ii#Z-G4|kzy<kB_vG;zC=lJ`*`L5@k{m!}P-uu7xyYId?)3ISzmY<0o
z3nypUglt-NO!oISl+DaKK(d^l4WFKM<$8DT`rb2|t-&+SIrl7GkIg2^a@%qEbRtiJ
zMoQJ1_=(W*;9@g#S-tH)k=PF82Pia&>fOBq-F<!Cy_XD>M@I*mt*eGB1H;u?Wni${
zsFYjP9Toki6#S~S^6=PT(V-KMVtw_g)M!?(COV_PPHvfH^|99ISgU8GG*kiU%6l3b
zu5T?3Z`j_blm^?rQ}X_Yh6lQHQ%`M2y<BQl>$RTMd9JQ(Hhf35vUB}tsa)x=H`{TY
z*&Kw?db6stpfwg0eb?0+Bc);RN!dd1TCO(HJF`W(UTs!ZS4R-@*fRs$P}$WQYyAH%
z=YqHLjyG;<`*vm*hwsKsYsZFLdCnfNMyWPfAK6qXBU`r*-YV6GDz&!HX7sJqK=hfI
z4S;P}xh~JqK(3dWc#}&ZYj44;x!jrUg*Qthqr+(s-sJ$;`t>XNR+m~O#C$`<JZ<0h
zov&4Img?bW>_M>lwr$Nyt36n;*MqGpjZ_+?wr3X^#XK=@Wj9gW9o{jzwq&1yxpO`<
z(ZJl|(MJ7pG3y*cFBj^F9R_Rnyt*>l+MfFz1!Jy5l~vm-<twtRo4LAQKI=(P=<|`S
ztL{579dbw1<wbvW{XN><kD^^&yLZ#>ZfN)23%zLH58eg&-mSsw0Ni69PdCp|%o!N(
zvnb|MH=oD&n0LglAtq*R58-2f`b6FE;bW7qc3cN~F;3mMekgK@jgPb6Vw}2h2cd`)
zi#YFT59acoKH~-B^th+?zhUz^Jr+8FDC6dn!<@<|;p1HALEiNgbZd!epNBpLE+(B!
z<g^?&=hQs6y0OJ$teEjLlEFSMNV@ywvA*Bbc`6+1KL##lkH((>H<!5a>h7PI{wKlp
zx2C#xwWo-G9J0NOM}7CxqyMRJ{oVDjFGTieKMk%u=5ac*`NW;UVz_quDW1@0)5%jY
z=;wXTNKRtbQ+NM8i_o3@l3Z)+=3d&?mn~*ntb2aK#EsFX7xK(PzYOkuV+JomwrBD1
zFC%B!zGe1wC6adYsQbNFw-^1L?`~*0bRv`31D^xFAMX6L&86A_xR^PvfjcuX@2T#4
zD5m}TBpa{(YPdDky~8a@_PNZZ6Zc-5c#v^#KsTp$>!=?}Sj_WQ^q9qM$!3nY+wI97
z`W@(=(C<Q?P|)v2wx)Jx_7L>oks}wXJF`ci@Ynt*lx6!?M!vtG`ArG`zao3j#YDU3
zzPI{F);^EtZasZG-sN8)emlIg@90#>`Gs!&(0vE|oiFMO3i|2Di^l2xE{DH%f0IKu
zU(Yz*-{PWub3u3i1`4|S)+p%iTdSa(e{Vr|H~c0>e&Y|1(~l<oBIe<@=2*z@%yx9+
zj!W3ZOwU=V>+8HvhWw`V;pz9}l!S?Ue3rXYo>|D+&Et&Kqvqq0{kEuEb1tOMR-Tl*
zI}g%FypN~mJ31elmk5^E@>!eTXQn;!KLL4R(#`)wsF?pr==z99{wE`gOP&dk`Dd_e
z)_+REE`jT7U3Wv=x_+n5g3g2n(fy8{ov<P9WgkyV*b;ahAHPxOB;0)NmU_(PJY@S0
z-=`ys?I)kH&w#|vha%<zWS?8aT!<`oLyEZw**I})y1!x(zYMt;zZ_jmyERup_8IwB
zA}@!;FQta>@hV8%6WD5GG3VN!dU2NeYO@#L9kHnOOyqWd?b_YBUzS~$;@6;y=@;>0
z#``>;1^GN8-?Ndev6-jgo~?!S5$}NfZHRqXhpb)l#6DQ32VJ{)-Hm=oEc8o}7Zmj8
zjMLYn>wj~a*9K&L#BT&M=SIjp+OA31CS+@Ai@kg<vb{Ms?e^CP7mt3Phb$KQ^O5au
z26M313m|j&9Q4&5`Co_}`Smlu-z@RSw*|SFzl5$&*ta5EFLq%Nc?;wTtb)7+vQ}W*
z64p_`hLFwg3BT>gV#U~M!iuq%gV~EGVy{3JE5;5d%-H_){*NHrw|&}I;5B4>vIlDh
zUPrc``OPPO8GIBnmvQ<y&jGl&as%!jD!1T%EB?)Pj=}vclmCOg+X>$Vd9+^z*DiPN
zUGS?RbNEf334d|I?qQ$yAipGGyW#)AM|}rmZgVM{%f9zP_8GaaLpJvcDqRnMDReDl
zzuNTk9lHV27Vp)|5+?3(?#}t9wBs*F-UsRD4EDms%;&DY0-9aWUx}<wyf?2x7F!DW
zoiye~$T)40Q!H}cglvx3iPs>Dc>;SavRH9XZcbQxPuky<*MS+YzxFa@&4X}lE9mJq
z_#2@^(5;Yt+yZ|SBp$PSGqQ2c##z1v(nmaUikb6D_*)_UZ->k=4gNMrJaWDrS)X_w
z??4ulJn=kYkKYMqjv&AL&h%Z7vD%~lyOGU(2NZL=6Iox6J?kSDG4DY(<}N5=-ivIE
zy%?j9Sj4;!*_gYbh<QJ<F+K}p^bw1D--B#S-1`H_Vv;BB9eeaaFn!#kn8k;ZE>_&H
zd(rjR9zA{-*?PrUd<0!zk3H%m7BL@1Hl{d>kD(hAv(QH@Vm^*+OmP;UKsP34p^uoe
zm<<0UG!=^f2=^r{X7wp_bNWB;H29|>G09^u@f-XZWbNjNp6*8;fA`OV>Fe?C_rt{^
z<^kmKcmEuiF>!Z&#O!lA{PWP9q@N1^0#xk#iwP6=n5ULz@FisJ@t^a{$mSD|o%#y0
zc+BxIvY7R!!M_TL-OD?%2Yw`Bz3_i>$FIRXep|IY2#NV^Rrb5RE9v4fi?1X5jq{mC
zt#2TUhyG1uYy028UcLqCBkpgv*ta3?JPFe7yDR=3$o<tmga6lJ--YyD0@;5V($8mg
z6s|pLe-GK((eL+>_d>;fe}FC?{rwPG>>=pBG_M~an@iiBsplUfi(B75qUKMK?ZdsZ
z--jW6#lz>P$PH+J^7$FE*u#+b&?Z)#yYn}`3;uJc1??kV{TB&)1a7=GvEuLXPV}h%
zOJr-roPUKZ_9zr{_%*V3(-u96nZup_4RlP>C&PaW9iMdX{X57S@lE=D!o;Q6-9I2}
q^91%sWHFy}V1G)OJKoRx?tAoS$awv=+i#iv?9G0(|CcOFq5lCYGEJEP

literal 6189
zcmZ9Od30S>6^Acrl8y|OsoGjP-~g?KB4ClBBc_$MN$nuw5MGnl<U#UY%zFtGkv3Fo
zoe&Te1Qc<sqToECB5Ivl=K*I>oJah_rLN^#e&4-kv+l}SYp?U$zdfFP&%N)pojNDW
z*Oa!!Q?u--Y({o;_RoUKW@l|MS-zjeJ~Qjg^{$OuH!f?o`j?%3&Y8L%lTC5UZO7u%
z0d7ZzE48}(3CMBqa<g-+UieQTwhjCsh1#j!wXwIWySr=S#l3waBfZVm?xAY$P_16=
z?XQhi`&zZ}s(#Z-ezkhv&{%)jp#zU{ef8<oXx6SFI-|c1PMKwmvDU~~Yr}A5pbFEO
z_cSon*jX9cHaJ?X^cTL<^8N>gdb@JdhWdD;uhObD>KoSOxjM7C?BliSRa-|Yebt^u
zvxw`+<^e_;&6>`V)>u^b-P{-*t_;DqXN%$Mx!OeU$d=@Ktyx`H8wTdFX9TycdUb1T
z^zpNt1K-L!-oB&o?Z_?)-|ag#jSaQ(oR`3jR_gtY;T_dJuywbvw<`64YQ6Be41H%U
z7=5N>6}W9{Hs?87;6@)4Z*nNG_Hp)Fjytjm_GV>xWGD^7v%CUs>(<rX>nbf%<u^pm
zRrnTX-ml)QG{Vo=o8cO}b~UT5Vz6?z!L6+fS4S&_XD1ouTrqF4H&LFem5q;Vs@QvQ
z-Z`I{Y;fM<k<rE#a@M&Wy{}Y9?hstj^SbItYcTga0>@kjs%r<UeOG2#7jyM~`K;TK
z&=-QOtL{576Y-9yyO;gd^>=Caew6L%+C7_g?}m2Yz0k|{eej)#@7;R5V*ciFb@3eK
zrsTLi^I4ShsYgG?$GjtcJw3#%?IC>ZPoJn8K74EvSH!iUm*dop>p>!y+~hd>Eyt-F
zcOw#UauMe_?ZI5m$!EN1k{;*O{unl&(-V>7i85{>Im{_O5g+He0P(CRqgzW(`vUZ7
z>~hLUM9#>0b5755s~cNh#>yE#D;ezL{G@xoT-NuSx<G|x{U@-?*`x8tvztracy;fe
zoc<@W>u*hU&uUK*|0J-z%SV0hr%V4+*!B0WhkY^FrTsK^?J<wj!RC{9220ts+fR9g
zK9^3Ofk8jdvn)BuSx?>j?^=TH?3d?Sp__X}p|4!ZZL#ioiIX=*pUsGC4tg)U=ZzU$
z4z_3c@UMciZ0|~Y^82pcJnCafw-^1L?{&y3<OC+MhkYLWK6dA)Z9dg}2j$H1N_J-^
z=Q-8)Cr<l;gpF6fiQOL5J;SXD`&{NTmD`doA7b2F(XFH1I_ka`axu?4z%h$Elg%7)
zw!4!(^n>WG(C+~sRnqSTM}BAa5OU=3;R~YPBk19;{ZS;#_O6M1e@FA168`@Hd(Net
z(|i6HqK{(jb9wI8)5qmm{te@|!!!GiPDh+y=;jaIcfjBIvc9OKpAKF!N%wa-{I&a=
z9J=`~nWS%-q+eFjF9%mjy7$fBv&iRt^LIFO^G}p??}opnVK@HJB>hOzFJvBmYmPzu
z&J3a(cWmM=VtUR>U0>&Y65=<d8&AI{Cnrwc<+Hpt<(UK4ZXRc>9yOl~_S>Rv&H0Ev
zJ9$#YJ<l?I<hyxlzM~6~1xeWQT0U#@`^>aQ{!_t=lWzW}Am#i|Mb}3@@;?nMuedym
z`Dbz0tpD`HUCgepb-f$%*7ZAeCUOSSkM4Kuti%m)F8g?9;+C^F@bMdUcH+(F-BORa
zoC~(^@O>6oZi0NqJ{yrc4~dxb!9KT$xd1G8AjMn=HcsA}-e0+hUkNV9uR@pWN%5<}
zE0RPXYtUCA+RS5bYZ1>Ab=QIQlixxv-*;yz?+WfYU^(X>HM_w2YO`nGF}bL<9$cKG
zsJ$Wg%lMWSb9yeioPH56XS~mCBjR(5e4D`5xRj^nee6c`k#9r%4T*cxljFh%`1rlC
zj_<y9^LmG#hscG#6}+gVZ=0lVN7w(BG_M_CedKR|Gw1UW^Jv?bxJ$v-(iZpk1z>0D
z9JSk@-y-?w=Y?Ro&|d_$zgf(|S}#V-;q%c~d*pu!IP&Xfe!p$<k#8rsoWBoUpRo6X
ztrvG;7uXnAa06gDYXvu$xV92k1DoF!epi6y%CT1_t{giAXD_aZ9R|ylW9x}CwkLfj
z8esdjPx}gf1Z+?CV9nrP3bvm4%_rZ>K8l#jIDMRFg<W3UV)q`3$Jv)7|KWCC#qMvO
z`@gt%yV<WnT-sm8uHD_acd}oLn8R=PZ1$HY?mq6*9`N48UB~`keAKT-%xx~Qx$OIT
z#6BbUtH9=7O{D|uuSWJG_Nz@l-?7&q+Ty)>ZQ|rz&fPiRl<xTJz}C{w8BDOtna{iW
zdSq@%zX7aIyf<&iaq%tlJ7&y{h;iB?r(EQGBiI~qCvE}Dxq^EWSk8WfdvoH7ds2K;
z-U4U5{@SaEHE(9uwwj*qWPclSJ8}nNAGfl<9g&aO-32zz**MF0Ao|>eL{2$#Hrd~a
z=zlk2jv4IlLgXXoyTSUz^LP(fPH}m@;ylIg<9pG~5#o2>nZ6G(R(sTcKiJ#{k(kj3
z!1}uESs%HG`5@Ssdyt6v5ZD-dF-9M`h`A4J%)Lm&d>Cwuy&I#CT%7wOU}NIk9|g-P
zt~htxqmRMqvjT~C`r}ELQzp_ZJ^|KWd-V88u=UEb_!PRnE_>8RE@D0nHl{p_&!8I<
zv(QH_Vm=EtraX)L(T#~&=p*MWrm}wynU2JNiO(l4X7vShbNYYqH1-D&ImKl!@f-X_
z@B@fBqNfMJlh6JoIDK87T_3rK`7(I&*}np3jP;DsN6tQHvVRqsm-JKEzlN0i{(9o%
zUFNB$8GHk*J^q`16Kp>DxKoG0@-fFlV7ch|TVTIM&fcD8uzwqo5B)n}<NOWR{#`^L
zd4FT&zK7UbJEGlpO#b_b_e}dN{x8e@0MU0jvKgr&`Z=E??AoLD55d-set!g>K+668
z7`@<&nm<98dkDFoKK8Kx6fu{!gQ@4ACEoh>5jB4fwh!-z{r&>cS3Z1x32q@1$>&#K
zIek5cHaUOS{EhRs$ldr(_J@&iWH0gRzeXNL9zl%PCRhI5+>IXfe*?Bg%=x!qxkr(B
zPQL?tHf_<9oH@LEzekQv`c(EmAjc)$bN>;sMtnQ|lsI`M?%1Ef+FZf?1uW-t4(_js
e^Dg%AUV7jEh8VBEcKhw4KYOzu?f)ao3grLsf<q?&


From b0d08d27fd1f5a7a3e43d17d2269c8766082408b Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Tue, 1 Nov 2022 20:10:59 +0800
Subject: [PATCH 15/27] SSAO is fully implemented

---
 Assets/Shaders/DeferredComposite_CS.glsl      |  12 ++--
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4789 -> 4997 bytes
 Assets/Shaders/SSAOBlur_CS.glsl               |  58 ++++++++++++++++++
 Assets/Shaders/SSAOBlur_CS.shshaderb          | Bin 0 -> 4669 bytes
 Assets/Shaders/SSAO_CS.glsl                   |  35 +++++++----
 Assets/Shaders/SSAO_CS.shshaderb              | Bin 6237 -> 6125 bytes
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |  12 +++-
 7 files changed, 97 insertions(+), 20 deletions(-)
 create mode 100644 Assets/Shaders/SSAOBlur_CS.glsl
 create mode 100644 Assets/Shaders/SSAOBlur_CS.shshaderb

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index da13b1b4..833180e7 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -21,7 +21,7 @@ layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
 layout(set = 4, binding = 1, rgba32f) uniform image2D normals;
 layout(set = 4, binding = 2, rgba8) uniform image2D albedo;
 layout(set = 4, binding = 3, r32ui) uniform uimage2D lightLayerData;
-layout(set = 4, binding = 4, rgba32f) uniform image2D ssaoImage;
+layout(set = 4, binding = 4, r8) uniform image2D ssaoBlurredImage;
 layout(set = 4, binding = 5, rgba8) uniform image2D targetImage;
 
 layout(set = 1, binding = 0) uniform LightCounts
@@ -55,7 +55,7 @@ void main()
   vec3 positionView = imageLoad (positions, globalThread).rgb;
 
   // normal of fragment
-  vec3 normalView = -imageLoad(normals, globalThread).rgb;
+  vec3 normalView = imageLoad(normals, globalThread).rgb;
 
   vec3 fragColor = vec3 (0.0f);
 
@@ -78,9 +78,11 @@ void main()
     fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (AmbLightData.aLightData[i].strength);
   }
 
+  float ssaoVal = imageLoad (ssaoBlurredImage, globalThread).r;
+  fragColor *= ssaoVal;
+
   // store result into result image
-  //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(normalView, 1.0f));
-  //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
-  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(imageLoad(ssaoImage, globalThread).rgba/*, 1.0f*/));
+  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor.rgb, 1.0f));
+  //imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(ssaoVal.rrr, 1.0f));
 
 }
\ No newline at end of file
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index 525f3c4ced3b824db7ef716d0d4f39927b2b018e..8d7a83271b3d684965b4a639eba7e74329c9469d 100644
GIT binary patch
literal 4997
zcmZve33n7l5XUFS=HL*JQw7`*4-kxzOB6Xm0!uKEAP{fkWOuU}ne4{h3AYLg;)#eT
z-h!XN&)|phsqguo|KChkX!B@ZQC0t{uBz^;o^11lr9rw{n!DSBpedLaEDV0jpkPVR
zEF?(z)8g}kwp1?+9UJOtB&D9M+j?=mFKB_Kwng&ENp2NQg;5oJp=hyiuqCOCp82<E
zZ?oh-l&DqN3qxat;o-v2{;}fp^jIS~8<)r8s9GK?MfGwqiB6UA>+t-dYB8QE`3^aG
z`1y0n-KiXvxHcZf$0zIMuq0J=cBHjc;;}+%8mykG6~iQ|RR;%Bdt0zld^$Q)jt8QN
ziJ6A7v#&LHP&|ys%cUB6TacGNU28;a9*xSUr3%jl-5%a>*n075tv(gTnJ4i!%wmmn
zUyt;OdRXbN#kG36uO-+l9;I?F*eN~~RVI`E+DtWRsDh3Z6CAj!s#U`{bs=w?{;`LC
zPS>Jp;w*;KgT{2tV0pKv{&Y5+8js4eJF;`_5*~Z`bMo&OR!ZX@NlzD@E6?6D_c@TY
zaJH^vNqwf6WVK;u&DJiN+Q6wfYV^78-^Ho9I1_6;Du=_y$+TwtskxN3%dSs%+7TQO
zKDUN}FbM^xxv;acGh`Nedr+A6r6)6g@L_zjJUU9bT1h6ArzI!}&-&CJOiS+b?(goI
zGn>qIzq7S+ZuW8Rh6R>vIOm>wANX@_|32smv*YKt`iX^&6?!M*Txtn>JT#m6%fcIt
zur?aTI%j)u)#>}<nR>lk8k`C%?tSEf>#`+by;4pxn7DU@#mvl5c(z>6Dk*68`991S
ztrns4w$_PSJ-tgZ=f>VG?%UC^v#|4)d^<Y!CecAv&O2bSk7XEkF!CBkPOuISYjM~D
z@q%uhcvc(lg51QS7Ibp6h&hmn|H}<#xru3hmV2>>S?;_r;_nx46ZMMNXERLAEb0Se
zAO6g;UmrU4k)Qp{5zF=)X7yPu_*s3+B%7brw@MiK-Vvw1ya*qgIg3wyU{)Wq=huf$
zeKrfs9Cly#?bqkn(Xr=5)bootv-W_~?}+>H(DA39r8*&J?2?9#yj(HtJWbM9O4lFG
z6vLjE&a8kz_|Hpm{ilUL`N4>ZKRqWF_)e$uCM^CU$>hX;h5qNh^CDs`7e}{PD<o%m
zIb&x)AFvb4U)0JSlApU^;Y)sW-XMz{Ys86xKQX(Uey^Bd#9SxN!k3un-2hsq^DbE%
zWheeqsTKsAbXv~U>o9PLxcm;W`(_{avPHyND~-3v-TK77=Y?@*?Bqx1ZGvIn?PT^X
z6WS+Eya91)v3T6Y8r?SU4%=GE2gK2dQxGR67<tfnW0vQTlZlD{5pmAL`RzO>BwIg6
zC9{{jW*?W_B%(gvq4no(jV<ZB!$y6)FWw>f_$@#@FzQ239ESb8lc|SZUlB(ppTCH~
zT(ajQXTX=3=vN&^&D8ao)3GyOyh|4IbweB<V&YG}TcRMixX1SYByF+C^q(bD6SKm*
z;a%ecVWak6#ff{b+Pj2P`)zR+zSMSG{EmpVU0)4qV(wY=<S!vPaeR5_og(^&&fDYn
zqOa%Y=<Da`{LV9fW_z=z6R+RXnU!Hr$G_z1*e^SMm+IkO?i2AXxgec>afe_>b&59e
zB@Ppt#qM_)_ckIw>RT$p7u#;#1m^}L58sW4M0_*Q@n0>%XI%T4&$S|az=w5n%>Tn8
zaEL`d?wk1BBX;6-i9aIZ`(g1PmF&lV%=v&@{KqAOLo7djUOIM*|AgcXPN)8jB0v5n
z>G*(K{3j)YLo7c&ea6mNdc=F3On<kC{?<viiZf5}KXuOS;?Ia!*msCyhf^p0dR9aX
z`pIlR=deEA^KQv|M7u=fU=KcfMc}{7r%!yJh<$rS|Hub@n~416L$-W_lF8Snt{xJ9
zLB#ir_}DBD{TvcuU!Y3S4~w{y{UU7K1@jC}e0)YkV5T3H%-!8ot$YVw6yXEDKsA6J
z6A>3b{x0A{Y~BVotNplSt9?}ROCqZs+X)fA%;(D@?AF^?90ty^-r`RUuZqYw;?DY-
z!@!{{s-N?{E+Q6oJL4OYnQ!xXQ!;+w<})Ulxw+)xyd@b7Uz;f~=7gD{Z*cZAC!vV5
zU(|l|qQl0;*^dp(pF{eOjc*El#a0$4Hk=u)h);@G*duZ5aLfI+WMbHio|Ft`Ga5@~
zM(zHY(J2wQ&1h9J`@oq|^a&C9$%kxrRg=tpTK*Zy<Y#8-`zcW(;!N1!_|o^&BJ9@p
zGY$i1S>LT!XN8duKg)McvgJE3`GUyuVdKv6Wp3UTVYj(?&tc$@<#}H+xv;aBS-L3l
zXX28>@U@u$qc8M`dxBe?A4sN7n~4u4gV{`A1M~aNeY5|H_{XBFPHz|gMARv=Z~Ui{
z@d4-W3+Me@1kR$y%i>^mA74lYvol_k%o(q_x&Jbig8)A}BN+ax#J>_<clvzsuSE+*
z!|MGF@tY0<XVFjQlKQ_9VYl4hN+!3}{+(nnmSNvZ1|yDPKRB#ed_<9%s~<(|#~=GG
RQBirRm%P~jRg@i~{{U;~#q$6F

literal 4789
zcmZve`EwLi5XXmXHV3ENsDK;r06`Q9h$2WJVTmjx2!i)I*_~`gCcEn%T%v%AsCbL#
z-{24a4gOJ<T4j~r&&=!PRmw+oy8GMxy8HF(H%s4dtAcdp`nC=R!J=Ssuq^mBgMyVo
zpO7F}5)7ogSUOYM)$UYxjqZI4m*qh&^~7g|eDdP`qWLhcV^}7-PdM1hR7NLDpq)8I
z4}w3W^ebzzR4z_U6-yK4O0!vRcdjH+If?60xf-{kN+-S;;Wy;@#q~<kt@;jmdHDJB
z$~~+cwWKi<CTHhbQCO9#I)~EQYDu}6nkMTP8<nsVH|mq)seK?=FW!tVN6C0RJKJq5
zJNx>B2gJi<CaN~j2ZDn1W}_Xm`CJ@bk}5nOZ1wQA!?uan8?E^;$vla-y@$2aeNRfC
zZH2X?jik{^_vL~;;&CeHgXhIdac!=1w9&11+NxkE#RLbgRgHR>q%Pzg&_DLj^JXKi
zcbvs=?x5Xl7%cC>)SsIT=V#)mw<9~(A>oOaKQDiJR!!rcN>3MGje32akZnA>!d_ix
zI<0P{lhuZu)vH}HwSiM}+#Ykce-EeTN;lDX)J}%&3u(>xQ*$-DE^D89s+keKu!ixl
z6ADgqVP|D$$SmCLq%iGEPiFq$)A(k2bd;!G>&z)nE{KF@_cR#1D|yW8-@P+uHkqxz
zy;?ap`#5*o0!ucWb1&=%{+!$I2Y15V`}wVYVqs&2-pM#uSD5yAXm;nfgm=PLE$U3p
zhqWl3(>uc2?XZy{*<1KUSi)?S!YffL%UINm^Bq_s+9*Qj4Q&zid-{lE&WD}1<J-}(
zv#|4Kd^<XJ`gUB^G4Cw)u?)iwMqb0n2{z<mIfpG3FRHu5v)Y({aubVM(8<jrCUeO0
zbAwrKVw#`j=9_4k<t_*#{xR_Z5g%N9Y*sBk^?|Vue`eON51snR&wl2GW%~`Y`m7fG
ztiCmp&ClxFAdGx`qo}VS!pCOI;!_`()yIta^`TRr%>uKA-Pf__MdV}dd^@_o|3~S}
z+WjK@nMvOt9e?UstrPa8I=@EQdDm)>ooA7-_0k8$!SF3eXI8)<{1>OV{%GM(elTL<
z&z%zs{D9MW6Bd7kWa8t$PJiilK}4*z;^-D@o#ZSpXB-Z=2kgZ17q!wu^3w|zzT`*e
z4YJ6wNt_t?6LZAr{}&UCnDmr|FEP=#0%)1eyJYQ<o%qZ!Yo|`jxps@djEMWRbn7?!
z=*y^xwOJZ(k>2{mzJtOzGj{T$^ESb-zu;u{tr2=eoOrxVYO#3qVw1XkOdQ*0$whH=
z;v5$zCK!3pd1IF6gp-Mh|CBiA;rw=<bCT^o&r4=6dCgvtyhucSyhCj4zgJ@}eRtTX
zkN3qpBwt6Icwp3r-gOxEYfdH}c4mP$$6^+4i<5^K*tdw^5wWNb+g%ag3DbX&OugJI
zGtL{t2g1fo{Upv_{QO0p5fQch><svl8=d#c+NUo7zRW0#{{1C{?*hKO$zc(_M(3TZ
zU!WHj=-U?P{NKy=GlzRTop|G(&b>~1I{uN<4=O)>ST5q7Uz5%or)OZNRW)<H(qUpf
zY?Z_4)3p4kXSE1lY=?Am&Iv{y-t>ba-ZMJ>8%6lcXg{;FS%eSxlsd(1J|qH%SmdL>
z#HVlAiO1bMEaGij{6{4F@gH?Q;1>Te$>0#nk6)0E-QqtkdArl8e}~AAzf(Fs;1>T0
z$>0#n;$K(IoNt#1AI`%)qa$<2yPeGaj*9-)$@hvgPw+n#;~DY&A{O>%#j(SwoBMlC
zL=5hi**@T~G4-AA&0!JWAabw=pE1#4(eLs(B7RiFKJb6!gT7Bhe)1t(z858vZ%ns*
zLcAoJ6cHbr<>CA%Mc9|BQuI?IdNd)zMlYCWaN^^0S_EeLOOol`UDdiq{EP@6@TIB&
z?5v2m`0*XbhuFLgY*zcrlCAdhl3x*7?byzV@MT_K6=Ao#e$8RvEb=j{_*28{BJxeU
zv%cXlaOjrm=X`I9h=twG_?Bem-F(WD@dG!Xw<R+-H(i`iG8n!#Q((*qGsC^X+0UHJ
zh&cNV?MJUVtRl{SY+(Kza{t))ri?n<tT?gZ%;=nWEMl?u9dYb%%Y8vIF>FQ?$zV34
z^OBiS>;GcObrHDDXhSmlz?o6>nuz@5L$+QuCDTvKe^D~|nOW}rlBg@<OxWP~a_^T#
z*zMl0I1HR+_ilG}RT%m3vwZJKwtUwlzb~?U*yuUF%*_WP>^3*o9R?0ro*R<Mg`K_3
z(oK;+6CXP4hPcfH827>*(I>do`H^Jmw3+x=GMLQ-HZb<vz0+^@ZxH`Pbj#^W#6J}+
z6HTelx5Ynm7&wdGF#~*GKNn#q)`<8QqB~B<{-tPGWWOI@NyZ19-!6LhwFsPL*f)~F
p$Yt2K4&%KV_MO9W;?t^#yZ>H9Ok%JHpNi_^oYaf`Uq#+8`VRpBvEcv!

diff --git a/Assets/Shaders/SSAOBlur_CS.glsl b/Assets/Shaders/SSAOBlur_CS.glsl
new file mode 100644
index 00000000..64066525
--- /dev/null
+++ b/Assets/Shaders/SSAOBlur_CS.glsl
@@ -0,0 +1,58 @@
+#version 450
+
+#define BLUR_WIDTH 5
+#define BLUR_HALF_WIDTH BLUR_WIDTH / 2
+#define SHM_WIDTH BLUR_WIDTH + 16 - 1
+
+layout(local_size_x = 16, local_size_y = 16) in;
+layout(set = 4, binding = 0, r8) uniform image2D ssaoImage;
+layout(set = 4, binding = 1, r8) uniform image2D ssaoBlurImage;
+
+
+float GetSSAOValue(ivec2 uv, ivec2 imageSize)
+{
+  if (uv.x >= 0 && uv.y >= 0 && uv.x < imageSize.x && uv.y < imageSize.y)
+  {
+    return imageLoad (ssaoImage, uv).r;
+  }
+
+  return 0.0f;
+}
+
+shared float sharedPixels[16 + BLUR_WIDTH - 1][16 + BLUR_WIDTH - 1];
+
+void main()
+{ 
+  ivec2 globalThread = ivec2 (gl_GlobalInvocationID.xy);
+  ivec2 localThread = ivec2 (gl_LocalInvocationID.xy);
+  ivec2 inputImageSize = imageSize(ssaoImage);
+
+  // Load color into shared memory
+  ivec2 start = ivec2 (gl_WorkGroupID) * ivec2 (gl_WorkGroupSize) - (BLUR_HALF_WIDTH);
+  for (int i = localThread.x; i < SHM_WIDTH; i += int (gl_WorkGroupSize.x))
+  {
+    for (int j = localThread.y; j < SHM_WIDTH; j += int (gl_WorkGroupSize.y))
+    {
+      float value = GetSSAOValue (start + ivec2 (i, j), inputImageSize);
+      sharedPixels[i][j] = value;
+    }
+  }
+  
+  // wait for all shared memory to load
+  barrier();
+
+  ivec2 shmStart = ivec2 (localThread + (BLUR_HALF_WIDTH));
+
+  float sum = 0;
+  for (int i = -BLUR_HALF_WIDTH; i <= BLUR_HALF_WIDTH; ++i)
+  {
+    for (int j = -BLUR_HALF_WIDTH; j <= BLUR_HALF_WIDTH; ++j)
+    {
+      float sharedVal = sharedPixels[shmStart.x + i][shmStart.y + j];
+      sum += sharedVal;
+    }
+  }
+
+  sum /= (BLUR_WIDTH * BLUR_WIDTH);
+  imageStore(ssaoBlurImage, globalThread, vec4(sum.rrr, 1.0f));
+}
\ No newline at end of file
diff --git a/Assets/Shaders/SSAOBlur_CS.shshaderb b/Assets/Shaders/SSAOBlur_CS.shshaderb
new file mode 100644
index 0000000000000000000000000000000000000000..680cb8d5f8bd787a251d73bf38d4d814202e13e0
GIT binary patch
literal 4669
zcmZ9O2X~ZJ5QaYj8={B^0*a!7y&@v09BUL^qtQfzy~HJ1VRcj7Y+_f$hF!7ug1uu$
z#jeMn;h(Ucqxd{u?sz_P&w0<xyfb(1+`0FDyDdv+W%-!gve(oso0M&vP0xNBr?Qz@
z3rv>F!;)NroR+obe7UoybJ0k%f6>xqi=DE4Hd&GTW@K$y34IC}sMH4Kj|V4%Gr$hy
z&^I&Jwa4d8CPxeUcPu=GYRa9x<*u%B=gGZ&!^6EJ&1>t`-g<4Y+S^}iRQsB>v8r)x
zg}B;aUwyQ{7*HajSVxKY>8w$%HhX&7yUwlDN2~jf)s`GB;7imn4LLfdUdpyZuMJdI
zS9@yLv0TpChmn!WP=|cZwPwd4SJ#JDRq89(G^&+;Ok&&eeXp+fmUCCf;Mh=KrCA#q
z>{yZeOPR6`8Pl9&pP17rJz)wtTeA-QwZY-hW?sN}VeYdNexzAxG?B*HYx0~o)VQ+T
z7#baRQTKPD^YfU=ne|_h>r=8}<d_XfHZ918D~-xPvakN1-J0EmJ+h|KsP=c)uBp~X
zFv(xa?#}svo>WS{=0kF$1G&BdJ=T93eSG~=wlSY)K8^+5J#3bv*C*CT8`1AFd-V+V
z1XDoR3(+0g-Z#&2ezNVU_O8jcH`==-+jWZhw9V%mFyD_z<L7}LxuxFIh4j)}uRe#E
zR^$TUoSm?FR5_=A0d^ZwPRwQIHaTye61P3eZDYi2vd%!7*Y~jiI1Wm-Z^vQYS;$yR
zzje&f$%uICwyt@s;)8W<?c%Ub*EFYZ-eK&~$+qVX_qGga4*TyK>dS#c|FKBxwm;@O
z4(WRG=F|3!<cvQ7X}mRr-!s!6wr3XcUFh!9{ITbi=;k<>e%g<7fSib!^Uz%*>^}6_
zz#4~;&T}vN&2=5nKOg&gq&_+A8<29^&c6|9Kjf`h+czSoe_hgx`PaimJ+5~bXk(L6
z-^1AdY~8vw><_SU=YI2i0<!GqcGvUFytfW}x&>)W^ho_{kY#I+kNy3CHQuw<{A|4E
za>6@v1iiFA_uw$sA221PYkF7x_Sv_vS4^-wCfI(bBHp`u;RL%{usxIEg6(>KmtwxQ
z-=(7M_a|)U`|Sza^)^hf{RV~K_>IXvmi>8O+ktnri>MQjCjvR)@H}oH)*L4R{m0QM
z`=T9rPC@rhN1igeoNyHLoQkdAJoZ!DJd2U1fhAx~TJ!Y88Edb#W6d+seK*$Eh3p1$
zXK{kQpR*E&_>Vg~an{qF-cnEQ&oX_tCGK2wdEZ&YosaGt6YEmk1?a}=vqsNft{wj@
z<VC<e&IHzNT^9p+<Gml+e{%0GL3;m`zY*JuybL(>SCIOZk!uyYIX1E03}io$>jQt0
zL;F%-F6XL8ZI`24n{OfVtwxu(Ht(voYp+2%UukXru3ZTn`u$DQuZ&#&wwfbq^Uso8
z)TUhn=5nsObEhJ&0`@X;HPGE>*#01!JI<zwZjAiebT*^t=F#VVd|Ps{#x>~PDSf^(
z?d6=%Hppwibl@C)#`sp{qlTN&i#4sqwkG}NxCJ<;ot*2Cw*tSJ&RYx2DQBELw4e4t
z8Ef2zZcg{)-MJmetpv{3Cs#Zp`>A~y(tOIucL%yPN4`7J<szRxIp@cH^zQt^p4KD9
zUBG;v(>-7Xh;z6XJ>E#1!+j}EU%bux(d8Y%J%BDZ2}HgJ(T&yTe(y%gsXv5Vp7agK
zhk<oJf^^?X@9Ja7$ALrt6G;8a=*yGn=J+tZqo>g2+>7r>`%z#n=c-$S-`808ndDQt
z?sLfJfx~rQKsr|$>%NF?j#&34bh%hp`&nQv=c>p1eHq<;6u&L6V9Q7TSJB;9ocC+!
z#>hvW*U`;055&AT(B;E^6Wux^&s*rm$jAMD8{PZu8v32<J9r1^vtJvN9lm$5<-&ds
z-E+N#b8znaK+d>0b2<BIZ|#XP>fD50tn))`xeq{`mz?wCyzH&Ecf@?k$oCO?v40<9
z%SAqYa?X!?=N*ate2VUV)~Ee^hA#IBi2cYJzZm&B*qm(N*B9WJWZRD~f%&@m8f-y+
zl{k6fTQcq&pwAK9x9D=dui(B*Tnn<B7rhMmJ@^I~um5Y%M}5|2J^KG9%Td7pP_8!}
zIJN~xa?WkYX$5^dbbGr!GVa}uDP|@z`aK(6{yp-}K+XknbHMN9-5KfdP3qeT$eCL`
za_@rf`o%lFE4F;(o{uhPZqG0BD1W6FuD=^_9qTsUHLPO~q{BLl*&WDPhkDep0Npx@
zdt8VuA2EBP+n-|0UfA-RQXlq4cb>ep##+j#bsuzVv3}#N!&>)4I;_>0eSw^{sz)9B
zqfhMF0dVpWb0E647W;Y-wtUojFuL>Ptu@wCMy-dSTZ{D@ZynZpDAHlA#w-GI)~X)w
q<Z$#Q$)1W_3aot<{qhbU0gRE4yMAQi5!pZF(>Aa9wU;Bk)Bghe^~S>h

literal 0
HcmV?d00001

diff --git a/Assets/Shaders/SSAO_CS.glsl b/Assets/Shaders/SSAO_CS.glsl
index a359a3e8..1a572521 100644
--- a/Assets/Shaders/SSAO_CS.glsl
+++ b/Assets/Shaders/SSAO_CS.glsl
@@ -36,37 +36,45 @@ layout(set = 2, binding = 0) uniform CameraData
 
 void main()
 { 
-  ivec2 size = imageSize (outputImage);
+  // image size of the SSAO image
+  ivec2 ssaoSize = imageSize (outputImage);
 
+  // global thread
   ivec2 globalThread = ivec2 (gl_GlobalInvocationID.xy);
 
   // load all the necessary variables
   vec3 viewSpacePos     = imageLoad (positions, globalThread).rgb;
   vec3 viewSpaceNormal  = normalize (imageLoad (normals, globalThread).rgb);
-  //viewSpaceNormal = -viewSpaceNormal;
 
+  // Get the noise dimension. This should be 4x4
   vec2 noiseDim = vec2 (textureSize(noiseTexture, 0));
-  vec2 threadUV = (vec2(globalThread) + vec2 (0.5f)) / vec2(size);
-  vec2 noiseUVMult = vec2 (vec2(size) / noiseDim);
+
+  // Get normlized thread UV coordinates
+  vec2 threadUV = (vec2(globalThread)) / vec2(ssaoSize);
+  vec2 noiseUVMult = vec2 (vec2(ssaoSize) / noiseDim);
   noiseUVMult *= threadUV;
+
+  // sample from the noise
   vec3 randomVec = texture(noiseTexture, noiseUVMult).rgb;
 
   // Gram schmidt
   vec3 tangent = normalize (randomVec - (viewSpaceNormal * dot(viewSpaceNormal, randomVec)));
   vec3 bitangent = normalize (cross (tangent, viewSpaceNormal));
 
-  // matrix for tangent to view
+  // matrix for tangent space to view space
   mat3 TBN = mat3(tangent, bitangent, viewSpaceNormal);
 
   float occlusion = 0.0f;
   for (int i = 0; i < NUM_SAMPLES; ++i)
   {
     // We want to get a position at an offset from the view space position. Offset scaled by radius.
-    vec3 samplePos = TBN * ssaoData.samples[i].rgb;
-    samplePos = viewSpacePos + samplePos * RADIUS;
+    vec3 displacementVector = TBN * ssaoData.samples[i].rgb;
+
+    // Why are we adding positions?
+    displacementVector = viewSpacePos + displacementVector * RADIUS;
 
     // Now we take that offset position and bring it to clip space
-    vec4 offsetPos = vec4 (samplePos, 1.0f);
+    vec4 offsetPos = vec4 (displacementVector, 1.0f);
     offsetPos = cameraData.projMat * offsetPos;
 
     // then we do perspective division
@@ -74,20 +82,23 @@ void main()
 
     // and bring it from [-1, 1] to screen coordinates
     offsetPos.xyz = ((offsetPos.xyz * 0.5f) + 0.5f);
-    offsetPos.xy *= vec2(size.xy);
+    offsetPos.xy *= vec2(ssaoSize.xy);
 
+    // Now we attempt to get a position at that point. 
     float sampleDepth = imageLoad (positions, ivec2 (offsetPos.xy)).z;
 
+    // skip checks
     if (sampleDepth == 0.0f)
       continue;
 
+    // if sampled fragment is in front of current fragment, just occlude
     float rangeCheck = smoothstep (0.0f, 1.0f, RADIUS / abs (viewSpacePos.z - sampleDepth));
-    occlusion += (sampleDepth <= samplePos.z - BIAS ? 1.0f : 0.0f) * rangeCheck;
-    //occlusion += (sampleDepth <= samplePos.z + BIAS ? 1.0f : 0.0f);
+    occlusion += (sampleDepth <= displacementVector.z - BIAS ? 1.0f : 0.0f) * rangeCheck;
   }
 
   occlusion = 1.0f - (occlusion / float(NUM_SAMPLES));
 
   // store result into result image
-  imageStore(outputImage, globalThread, vec4(occlusion.rrr, 1.0f));
+  imageStore(outputImage, globalThread, occlusion.rrrr);
+
 }
\ No newline at end of file
diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index a419165f53608005e3b2fbbadff33153e4be7f19..6bb4abcd8018cac584ecc8f8b59b86984eb528d7 100644
GIT binary patch
literal 6125
zcmZ9Od5~OH6^CCYnaK`B5*8C7iyI_FK!PY+Hkgb~GJ}&u#OS2c)0s5Pba$qE0*O&F
zMiiq)&?w-7xS${|sJP=6ca3pha76_7<v+J7tNgy#_gJsyR-L-P^E>N3@4naF@#v{p
zzNU68o1SG;vRT>O?C)(Vo0oOKWchwR`|PYM*SmWMdRI1ELn|*>b*`=_WK-R8+llye
zf~O&)rD{!nK5`Pg+`JsCxBaIQ+W|gGp=ng_?j7vz>+9~lVzAt33^rSPM=FCO)mmk6
zs5(|Dx2k(8`pqc#Rcqyu@u8waCmzN6opdyl8qH>@K2Y69h76{YlV(|cyww<Q^^BH=
zD==MoU&ABy9i@@YyT&S|p|<ag{0ze*gWb8Qr?#hFF14!lTF?4CS68->eNVM={XnBs
zuJqTN?YPct5uj0TR&|!N#?qqirux`uX#{>+whX?Ot4;LIY<aF%o0av|QD7eXwBR;Z
zZfK2<{r@bh;9GgeTeh}+JF|<!cgxm|<0Gv+=aq0{rP@$^bZeyywr($bt5h4V)Y?8<
z(05dW(PwJ54Q}(=O?i$wxL#)JO%4UtzMH+8<LTLc_MvLCF~TTDNlK+weN4a3>_%(@
z18e%$ms%xYep}>R&C+ONq|!e7ggVbF{ER&eSKqm_S!uNgEcZsZb*0hDSgGyVMMgPS
z%w6oQl=nXGX>2UD3Y_=PXD1te-sr|y{aQKe+=gB*)R8+1*Y0_JrP11z`yGd4zQdJu
zyDH`DvaFl=de403-pSCHfUT?U`!O5wuBf{g{nhn%Y4@HK?dsY+n|AMrcHhI$i}sho
zcOkxm8}N$xo5$77^OSQ2#!s*p^QoK9Wqiy#;x`Zzv$luunF7`)>V^*=p2W4|I?#)8
z>c;gWkxOoJoc$K#)Q!6Zi8#54^PKizF3;&RUOGvSb87z^HlNe!$jL+*w}c$#6feNX
zxh_UL>#6A0lGDBzeFnRnate{Na^9RX^W5sj7MHPd#?MIx`?xsi-Y=K+{k|?%VOjri
z>~i*K{K@R*k~d!6`zNRW0(SkasqR_rDdHawws-lc@BMV?e<r*B-u19A1G}`J#jZW(
zaW>d|^3GrdyLS62uFx0K$vGJG^E@k)lbrR`z5lM|=+6GUTx;v*?n(M-*slS5mN?%F
z!1g0=y#CvfEIV+y^=csP^6HJGTStFqw-;HB%;%K**cZY3&N&-xXHd=eOU@hz*qw)*
zXHcI&VnzoOHa>bf1ZL$uy%u0k+C9^egnb5QFahtlHu(_iz6sqL+O4bZJ0KUcyB!>}
zxg*)k5of(K*+ah@-4*&h;3)<DK5*oBh7Td%K6dPqsP_nZ_-lU*$+81$Bi~=p{C<T0
zU%{Sp1?Tim`;O|PSo=c02-efb<yrm(<9EU{`##P@oL}hX58eCjZ+lT+TF}o1FQ25Z
znxy+XT#UbRlHNN>-%`-MkJ}2m_s`$o$mjjrUC`}!e?j+d94_d_ADyHhPx__I!|%!o
z$XsL>x^+%W++|G9S*h#myiY;qBYk)-VE6B&oZ|9X?oWA618X;rGggn9PXPNJQMcw9
zh(0@bQr_Lgh(7XtJhju=mmrIiu;sOU*5>z_X^;F*1TRav`JaRo^FJ9~ANk1t6tKMF
znu3^r4tLG^Pfgqv?D|^QyCHAgbJ)*C{2mRVuV6nval@R;KAxU9zfpC3{0?4_c=LI;
z)MG9eg6%tep8=K&`$b@%QP`gemb;mH=6)7pjJ)~1t8x*43Ah-4DY~3?<1a((De_&O
z+uHn9)bO2MjmW!#TLYGJhW)9Rwcyo=Hhb|sk&9aE!1fpVdayn>rFiEqr(eX&>F?~j
z5oaIq8^Fe2&E&mP&qnl-??8Hxc=pc$Ygb(H?5*SbtKGcbgN=w>=$pVx3wqxqy&qlw
zBWYe&f%TC;3}?>gBIeO{FmVH5YiWx+xEXA3o?E;9`8|=3ezt<;LVq6E{^l?TYh8_)
z!&&O9J@P*v9QpM#zuzbM$oE2UG5?Fu^$GhR*m`jnN?>DL!R-LcSu415;yMc45ZL^#
z@T-93im^KrSBxEovlmyy?gGmdW2=cXwm-e=*MjZaKJ6>`>%jJ857rER1Z+L?n@|24
z_EE%K#_8icx3SBM>+Ie`vEOyS3;*VJj<Nf@<^B)uU5kAjacSSfuHD_acd=iOn8WYy
zJoXzBcR%-OANa+I+spnReAJtWxy>aumwmqkvCqi;GO)SVQ0XB1%aIAhezoc6J9ZPI
zE#9kFBu?Jt+@15S>5jh=Y%Tqq!G3l*^LbZqMiv(ISAq43_vY1LxkJcA%J~|waoQrM
zT;zNm*c@>uZUM`=g1Z$gSG*^$Pn`Ytr*Fy|z{cyZeLG^!!|dAD(9<34Z$@rIZb$6n
z2>V+Q`Iy~X!NxfoXZbcnANj~BXU-b?+Y$ZmM9eXZ{Vqg4a=rtsPdtxzg5?yK=WCy*
z{Tuf#^t%e;ci-pmZp2vaQU5()bKi}`+};b;*JaQ8$VJS(U}Nq<BIbQyW9-EkedHqM
z{a|D6Ln7t_U}Nmv7=7g8+#duR6X*UASWa=px#J$)52ug!DBkH0CtXgNNVE6|Sby!&
z<43{PE6(BpbbVd+sE=I4d<<+%aTXs(HzsDGk6grj0&Gli7N0~nCT5|JoU@qD{wZW8
z68{lCow%6QXVA^*f4Z~SA4KF7m%YSq@Mpo=%@I9)4m|nnpNG@e<=OR-i<mEfC!hU`
zaK^;h^^vpB+3a6J7A5^m_AevFzQ2+<d6#)=X$D^fYmfhzUjv&@KJL`l!SXT3qhLAf
z&tm@uBKH9IU?2N86W7E3PtJIZ-Q~Ac+qV!ozpY}w+kV5<<zp7#0WU;+rcvv=VENF$
z2e!8V4eaInh(7ZEcFX+$@yyc@?Y_J6KST~8+UM|JTJA@PzULwKza7!fXLX!id({3h
z*xJ$WPr&<;V!uB{myiB_29|pWc`(iE=U{VbyEpax3$Xll#6F_tFTwWVy|dq6A^OUP
z&#%FCWFq-I43^W^b7*@QDbC&b8{ftL8)P?ffOz%aChie-<F&~Ze~(+}QU6h}HDb=c
z1Is;z#2kJP-i~OCp5)9ioBa>S+@w!u|08lz(mnT|5NpKm&7Tt|A5tcld5qQmU!Lqm
G$o~MNH$(FP

literal 6237
zcmZ9O2b5f86~|vT*-fQHS~M}F*dP%I0tP9mxLMs~7gLM{H<Q`PW?*+_nVC%jCZ<rt
zhCvYxSg;}}ii#Z-G4|kzy<kB_vG;zC=lJ`*`L5@k{m!}P-uu7xyYId?)3ISzmY<0o
z3nypUglt-NO!oISl+DaKK(d^l4WFKM<$8DT`rb2|t-&+SIrl7GkIg2^a@%qEbRtiJ
zMoQJ1_=(W*;9@g#S-tH)k=PF82Pia&>fOBq-F<!Cy_XD>M@I*mt*eGB1H;u?Wni${
zsFYjP9Toki6#S~S^6=PT(V-KMVtw_g)M!?(COV_PPHvfH^|99ISgU8GG*kiU%6l3b
zu5T?3Z`j_blm^?rQ}X_Yh6lQHQ%`M2y<BQl>$RTMd9JQ(Hhf35vUB}tsa)x=H`{TY
z*&Kw?db6stpfwg0eb?0+Bc);RN!dd1TCO(HJF`W(UTs!ZS4R-@*fRs$P}$WQYyAH%
z=YqHLjyG;<`*vm*hwsKsYsZFLdCnfNMyWPfAK6qXBU`r*-YV6GDz&!HX7sJqK=hfI
z4S;P}xh~JqK(3dWc#}&ZYj44;x!jrUg*Qthqr+(s-sJ$;`t>XNR+m~O#C$`<JZ<0h
zov&4Img?bW>_M>lwr$Nyt36n;*MqGpjZ_+?wr3X^#XK=@Wj9gW9o{jzwq&1yxpO`<
z(ZJl|(MJ7pG3y*cFBj^F9R_Rnyt*>l+MfFz1!Jy5l~vm-<twtRo4LAQKI=(P=<|`S
ztL{579dbw1<wbvW{XN><kD^^&yLZ#>ZfN)23%zLH58eg&-mSsw0Ni69PdCp|%o!N(
zvnb|MH=oD&n0LglAtq*R58-2f`b6FE;bW7qc3cN~F;3mMekgK@jgPb6Vw}2h2cd`)
zi#YFT59acoKH~-B^th+?zhUz^Jr+8FDC6dn!<@<|;p1HALEiNgbZd!epNBpLE+(B!
z<g^?&=hQs6y0OJ$teEjLlEFSMNV@ywvA*Bbc`6+1KL##lkH((>H<!5a>h7PI{wKlp
zx2C#xwWo-G9J0NOM}7CxqyMRJ{oVDjFGTieKMk%u=5ac*`NW;UVz_quDW1@0)5%jY
z=;wXTNKRtbQ+NM8i_o3@l3Z)+=3d&?mn~*ntb2aK#EsFX7xK(PzYOkuV+JomwrBD1
zFC%B!zGe1wC6adYsQbNFw-^1L?`~*0bRv`31D^xFAMX6L&86A_xR^PvfjcuX@2T#4
zD5m}TBpa{(YPdDky~8a@_PNZZ6Zc-5c#v^#KsTp$>!=?}Sj_WQ^q9qM$!3nY+wI97
z`W@(=(C<Q?P|)v2wx)Jx_7L>oks}wXJF`ci@Ynt*lx6!?M!vtG`ArG`zao3j#YDU3
zzPI{F);^EtZasZG-sN8)emlIg@90#>`Gs!&(0vE|oiFMO3i|2Di^l2xE{DH%f0IKu
zU(Yz*-{PWub3u3i1`4|S)+p%iTdSa(e{Vr|H~c0>e&Y|1(~l<oBIe<@=2*z@%yx9+
zj!W3ZOwU=V>+8HvhWw`V;pz9}l!S?Ue3rXYo>|D+&Et&Kqvqq0{kEuEb1tOMR-Tl*
zI}g%FypN~mJ31elmk5^E@>!eTXQn;!KLL4R(#`)wsF?pr==z99{wE`gOP&dk`Dd_e
z)_+REE`jT7U3Wv=x_+n5g3g2n(fy8{ov<P9WgkyV*b;ahAHPxOB;0)NmU_(PJY@S0
z-=`ys?I)kH&w#|vha%<zWS?8aT!<`oLyEZw**I})y1!x(zYMt;zZ_jmyERup_8IwB
zA}@!;FQta>@hV8%6WD5GG3VN!dU2NeYO@#L9kHnOOyqWd?b_YBUzS~$;@6;y=@;>0
z#``>;1^GN8-?Ndev6-jgo~?!S5$}NfZHRqXhpb)l#6DQ32VJ{)-Hm=oEc8o}7Zmj8
zjMLYn>wj~a*9K&L#BT&M=SIjp+OA31CS+@Ai@kg<vb{Ms?e^CP7mt3Phb$KQ^O5au
z26M313m|j&9Q4&5`Co_}`Smlu-z@RSw*|SFzl5$&*ta5EFLq%Nc?;wTtb)7+vQ}W*
z64p_`hLFwg3BT>gV#U~M!iuq%gV~EGVy{3JE5;5d%-H_){*NHrw|&}I;5B4>vIlDh
zUPrc``OPPO8GIBnmvQ<y&jGl&as%!jD!1T%EB?)Pj=}vclmCOg+X>$Vd9+^z*DiPN
zUGS?RbNEf334d|I?qQ$yAipGGyW#)AM|}rmZgVM{%f9zP_8GaaLpJvcDqRnMDReDl
zzuNTk9lHV27Vp)|5+?3(?#}t9wBs*F-UsRD4EDms%;&DY0-9aWUx}<wyf?2x7F!DW
zoiye~$T)40Q!H}cglvx3iPs>Dc>;SavRH9XZcbQxPuky<*MS+YzxFa@&4X}lE9mJq
z_#2@^(5;Yt+yZ|SBp$PSGqQ2c##z1v(nmaUikb6D_*)_UZ->k=4gNMrJaWDrS)X_w
z??4ulJn=kYkKYMqjv&AL&h%Z7vD%~lyOGU(2NZL=6Iox6J?kSDG4DY(<}N5=-ivIE
zy%?j9Sj4;!*_gYbh<QJ<F+K}p^bw1D--B#S-1`H_Vv;BB9eeaaFn!#kn8k;ZE>_&H
zd(rjR9zA{-*?PrUd<0!zk3H%m7BL@1Hl{d>kD(hAv(QH@Vm^*+OmP;UKsP34p^uoe
zm<<0UG!=^f2=^r{X7wp_bNWB;H29|>G09^u@f-XZWbNjNp6*8;fA`OV>Fe?C_rt{^
z<^kmKcmEuiF>!Z&#O!lA{PWP9q@N1^0#xk#iwP6=n5ULz@FisJ@t^a{$mSD|o%#y0
zc+BxIvY7R!!M_TL-OD?%2Yw`Bz3_i>$FIRXep|IY2#NV^Rrb5RE9v4fi?1X5jq{mC
zt#2TUhyG1uYy028UcLqCBkpgv*ta3?JPFe7yDR=3$o<tmga6lJ--YyD0@;5V($8mg
z6s|pLe-GK((eL+>_d>;fe}FC?{rwPG>>=pBG_M~an@iiBsplUfi(B75qUKMK?ZdsZ
z--jW6#lz>P$PH+J^7$FE*u#+b&?Z)#yYn}`3;uJc1??kV{TB&)1a7=GvEuLXPV}h%
zOJr-roPUKZ_9zr{_%*V3(-u96nZup_4RlP>C&PaW9iMdX{X57S@lE=D!o;Q6-9I2}
q^91%sWHFy}V1G)OJKoRx?tAoS$awv=+i#iv?9G0(|CcOFq5lCYGEJEP

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index 6a3bd916..af3b46e1 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -115,6 +115,7 @@ namespace SHADE
     SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_FS.glsl");
     SHAssetManager::CompileAsset("../../Assets/Shaders/DeferredComposite_CS.glsl");
     SHAssetManager::CompileAsset("../../Assets/Shaders/SSAO_CS.glsl");
+    SHAssetManager::CompileAsset("../../Assets/Shaders/SSAOBlur_CS.glsl");
 
     shaderModuleLibrary.ImportAllShaderSource(device);
     shaderModuleLibrary.ReflectAllShaderModules();
@@ -169,7 +170,8 @@ namespace SHADE
     worldRenderGraph->AddResource("Entity ID",           { SH_ATT_DESC_TYPE_FLAGS::COLOR }, windowDims.first, windowDims.second, vk::Format::eR32Uint, 1, vk::ImageUsageFlagBits::eTransferSrc);  
     worldRenderGraph->AddResource("Light Layer Indices", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32Uint, 1, vk::ImageUsageFlagBits::eTransferSrc);
     worldRenderGraph->AddResource("Scene",               { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second);
-    worldRenderGraph->AddResource("SSAO", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR32G32B32A32Sfloat);
+    worldRenderGraph->AddResource("SSAO", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR8Unorm);
+    worldRenderGraph->AddResource("SSAO Blur", { SH_ATT_DESC_TYPE_FLAGS::COLOR, SH_ATT_DESC_TYPE_FLAGS::INPUT, SH_ATT_DESC_TYPE_FLAGS::STORAGE }, windowDims.first, windowDims.second, vk::Format::eR8Unorm);
 
     /*-----------------------------------------------------------------------*/
     /* MAIN NODE                                                             */
@@ -184,7 +186,8 @@ namespace SHADE
         "Albedo",
         "Depth Buffer",       
         "Scene",
-        "SSAO"
+        "SSAO",
+        "SSAO Blur"
       }, 
       {}); // no predecessors
 
@@ -225,12 +228,15 @@ namespace SHADE
     auto viewSamplerLayout = ssaoStorage->GetViewSamplerLayout();
     ssaoPass->ModifyWriteDescImageComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_IMAGE_BINDING, {&viewSamplerLayout, 1});
 
+    auto ssaoBlurShader = shaderModuleLibrary.GetBuiltInShaderModule("SSAOBlur_CS");
+    Handle<SHRenderGraphNodeCompute> ssaoBlurPass = gBufferNode->AddNodeCompute(ssaoBlurShader, { "SSAO", "SSAO Blur"});
+
 
     /*-----------------------------------------------------------------------*/
     /* DEFERRED COMPOSITE SUBPASS INIT                                       */
     /*-----------------------------------------------------------------------*/
     auto deferredCompositeShader = shaderModuleLibrary.GetBuiltInShaderModule("DeferredComposite_CS");
-    gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "SSAO", "Scene" });
+    gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "SSAO Blur", "Scene" });
 
     /*-----------------------------------------------------------------------*/
     /* DUMMY SUBPASS TO TRANSITION SCENE FOR PRESENT USAGE                   */

From 674b4d5155e70751f54dbba888649de5a4473e01 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Tue, 1 Nov 2022 20:29:03 +0800
Subject: [PATCH 16/27] Fixed extra # appearing on all names of script
 variables

---
 SHADE_Engine/src/Editor/SHEditorUI.cpp | 16 ++++++++--------
 1 file changed, 8 insertions(+), 8 deletions(-)

diff --git a/SHADE_Engine/src/Editor/SHEditorUI.cpp b/SHADE_Engine/src/Editor/SHEditorUI.cpp
index f3760b4d..cc63c565 100644
--- a/SHADE_Engine/src/Editor/SHEditorUI.cpp
+++ b/SHADE_Engine/src/Editor/SHEditorUI.cpp
@@ -157,7 +157,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::Checkbox("#", &value);
+    return ImGui::Checkbox("##", &value);
   }
   bool SHEditorUI::InputInt(const std::string& label, int& value, bool* isHovered)
   {
@@ -165,7 +165,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputInt("#", &value,
+    return ImGui::InputInt("##", &value,
                            1, 10,
                            ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -176,7 +176,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    const bool CHANGED = InputInt("#", signedVal);
+    const bool CHANGED = InputInt("##", signedVal);
     if (CHANGED)
     {
       signedVal = std::clamp(signedVal, 0, std::numeric_limits<int>::max());
@@ -190,7 +190,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputFloat("#", &value,
+    return ImGui::InputFloat("##", &value,
                              0.1f, 1.0f, "%.3f", 
                              ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -200,7 +200,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputDouble("#", &value,
+    return ImGui::InputDouble("##", &value,
                               0.1, 1.0, "%.3f", 
                               ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -210,7 +210,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputDouble("#", &value,
+    return ImGui::InputDouble("##", &value,
                               1.0, 45.0, "%.3f", 
                               ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -280,7 +280,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    const bool CHANGED = ImGui::InputText("#", &buffer[0], TEXT_FIELD_MAX_LENGTH);
+    const bool CHANGED = ImGui::InputText("##", &buffer[0], TEXT_FIELD_MAX_LENGTH);
     if (CHANGED)
     {
       value = std::string(buffer.data(), buffer.data() + TEXT_FIELD_MAX_LENGTH);
@@ -327,7 +327,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    if (ImGui::BeginCombo("#", INITIAL_NAME.c_str(), ImGuiComboFlags_None))
+    if (ImGui::BeginCombo("##", INITIAL_NAME.c_str(), ImGuiComboFlags_None))
     {
       for (int i = 0; i < enumNames.size(); ++i)
       {

From 1371302a40602daba1c94f10a4e819521b6fd192 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 09:34:36 +0800
Subject: [PATCH 17/27] Generalised Draw functions in SHDebugDrawSystem for
 potentially any number of draw queues

---
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp | 89 ++++++++++++-------
 .../MiddleEnd/Interface/SHDebugDrawSystem.h   | 11 +++
 .../MiddleEnd/Interface/SHDebugDrawSystem.hpp | 13 ++-
 3 files changed, 77 insertions(+), 36 deletions(-)

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
index 08019665..715b7d69 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -117,54 +117,75 @@ namespace SHADE
     /*---------------------------------------------------------------------------------*/
     void SHDebugDrawSystem::DrawLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
     {
-        if (points.size() > MAX_POINTS)
+        drawLine(points, color, startPt, endPt);
+    }
+
+    void SHDebugDrawSystem::DrawTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+    {
+        drawPoly(points, color, { pt1, pt2, pt3 });
+    }
+
+    void SHDebugDrawSystem::DrawQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+    {
+        drawPoly(points, color, { pt1, pt2, pt3, pt4 });
+    }
+
+    void SHDebugDrawSystem::DrawPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
+    {
+        drawPoly(points, color, pointList.begin(), pointList.end());
+    }
+
+    void SHDebugDrawSystem::DrawCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
+    {
+        drawCube(points, color, pos, size);
+    }
+
+    void SHDebugDrawSystem::DrawSphere(const SHVec4& color, const SHVec3& pos, double radius)
+    {
+        drawSphere(points, color, pos, radius);
+    }
+
+    void SHDebugDrawSystem::drawLine(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
+    {
+        if (storage.size() > MAX_POINTS)
         {
             SHLOG_WARNING("[DebugDraw] Exceeded maximum size of drawable debug elements.");
             return;
         }
 
-        points.emplace_back(PointVertex{ startPt, color });
-        points.emplace_back(PointVertex{ endPt, color });
+        storage.emplace_back(PointVertex{ startPt, color });
+        storage.emplace_back(PointVertex{ endPt, color });
     }
 
-    void SHDebugDrawSystem::DrawTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+    void SHDebugDrawSystem::drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList)
     {
-        DrawPoly(color, { pt1, pt2, pt3 });
+        drawPoly(storage, color, pointList.begin(), pointList.end());
     }
 
-    void SHDebugDrawSystem::DrawQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+    void SHDebugDrawSystem::drawCube(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, const SHVec3& size)
     {
-        DrawPoly(color, { pt1, pt2, pt3, pt4 });
-    }
+        static const SHVec3 EXTENTS = SHVec3{ 0.5f, 0.5f, 0.5f };
+        static const SHVec3 UNIT_BOT_LEFT_FRONT = SHVec3{ pos - EXTENTS };
+        static const SHVec3 UNIT_BOT_RIGHT_FRONT = SHVec3{ pos + SHVec3 {  EXTENTS.x, -EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_BOT_RIGHT_BACK = SHVec3{ pos + SHVec3 {  EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_BOT_LEFT_BACK = SHVec3{ pos + SHVec3 { -EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_LEFT_BACK = SHVec3{ pos + SHVec3 { -EXTENTS.x,  EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_RIGHT_FRONT = SHVec3{ pos + SHVec3 {  EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_LEFT_FRONT = SHVec3{ pos + SHVec3 { -EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_RIGHT_BACK = SHVec3{ pos + EXTENTS };
 
-    void SHDebugDrawSystem::DrawPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
-    {
-        DrawPoly(color, pointList.begin(), pointList.end());
-    }
-
-    void SHDebugDrawSystem::DrawCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
-    {
-        static const SHVec3 EXTENTS = SHVec3 { 0.5f, 0.5f, 0.5f };
-        static const SHVec3 UNIT_BOT_LEFT_FRONT  = SHVec3 { pos - EXTENTS };
-        static const SHVec3 UNIT_BOT_RIGHT_FRONT = SHVec3 { pos + SHVec3 {  EXTENTS.x, -EXTENTS.y, -EXTENTS.z } };
-        static const SHVec3 UNIT_BOT_RIGHT_BACK  = SHVec3 { pos + SHVec3 {  EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
-        static const SHVec3 UNIT_BOT_LEFT_BACK   = SHVec3 { pos + SHVec3 { -EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
-        static const SHVec3 UNIT_TOP_LEFT_BACK   = SHVec3 { pos + SHVec3 { -EXTENTS.x,  EXTENTS.y,  EXTENTS.z } };
-        static const SHVec3 UNIT_TOP_RIGHT_FRONT = SHVec3 { pos + SHVec3 {  EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
-        static const SHVec3 UNIT_TOP_LEFT_FRONT  = SHVec3 { pos + SHVec3 { -EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
-        static const SHVec3 UNIT_TOP_RIGHT_BACK  = SHVec3 { pos + EXTENTS };
-        
-        const SHVec3 BOT_LEFT_BACK   = UNIT_BOT_LEFT_BACK   * size;
-        const SHVec3 BOT_RIGHT_BACK  = UNIT_BOT_RIGHT_BACK  * size;
-        const SHVec3 BOT_LEFT_FRONT  = UNIT_BOT_LEFT_FRONT  * size;
+        const SHVec3 BOT_LEFT_BACK = UNIT_BOT_LEFT_BACK * size;
+        const SHVec3 BOT_RIGHT_BACK = UNIT_BOT_RIGHT_BACK * size;
+        const SHVec3 BOT_LEFT_FRONT = UNIT_BOT_LEFT_FRONT * size;
         const SHVec3 BOT_RIGHT_FRONT = UNIT_BOT_RIGHT_FRONT * size;
-        const SHVec3 TOP_LEFT_BACK   = UNIT_TOP_LEFT_BACK   * size;
-        const SHVec3 TOP_RIGHT_BACK  = UNIT_TOP_RIGHT_BACK  * size;
-        const SHVec3 TOP_LEFT_FRONT  = UNIT_TOP_LEFT_FRONT  * size;
+        const SHVec3 TOP_LEFT_BACK = UNIT_TOP_LEFT_BACK * size;
+        const SHVec3 TOP_RIGHT_BACK = UNIT_TOP_RIGHT_BACK * size;
+        const SHVec3 TOP_LEFT_FRONT = UNIT_TOP_LEFT_FRONT * size;
         const SHVec3 TOP_RIGHT_FRONT = UNIT_TOP_RIGHT_FRONT * size;
 
-        DrawPoly
+        drawPoly
         (
+            storage,
             color,
             {
                 // Bottom Square
@@ -186,7 +207,7 @@ namespace SHADE
         );
     }
 
-    void SHDebugDrawSystem::DrawSphere(const SHVec4& color, const SHVec3& pos, double radius)
+    void SHDebugDrawSystem::drawSphere(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, double radius)
     {
         if (spherePoints.empty())
         {
@@ -197,6 +218,6 @@ namespace SHADE
                 spherePoints.emplace_back(SPHERE.VertexPositions[idx]);
             }
         }
-        DrawPoly(color, spherePoints.begin(), spherePoints.end());
+        drawPoly(storage, color, spherePoints.begin(), spherePoints.end());
     }
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
index 4b83958d..41a0dd77 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
@@ -148,11 +148,22 @@ namespace SHADE
     /*---------------------------------------------------------------------------------*/
     // CPU Buffers
     std::vector<PointVertex> points;
+    std::vector<PointVertex> persistentPoints;
     // GPU Buffers
     TripleBuffer vertexBuffers;
     TripleUInt   numPoints;
     // Cached Points for polygon drawing
     std::vector<SHVec3> spherePoints;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Helper Draw Functions                                                           */
+    /*---------------------------------------------------------------------------------*/
+    void drawLine(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    void drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    template<typename IterType>
+    void drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
+    void drawCube(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, const SHVec3& size);
+    void drawSphere(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, double radius);
   };
 }
 
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
index 14fbb42f..953b1cb3 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
@@ -20,12 +20,21 @@ namespace SHADE
   /*-----------------------------------------------------------------------------------*/
   template<typename IterType>
   void SHDebugDrawSystem::DrawPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
+  {
+    drawPoly(points, color, pointListBegin, pointListEnd);
+  }
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Helper Draw Functions                                                             */
+  /*-----------------------------------------------------------------------------------*/
+  template<typename IterType>
+  void SHDebugDrawSystem::drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
   {
     // Ensure dereferenced type is SHVec3
     static_assert(std::is_same_v<SHVec3, std::remove_cvref_t<decltype(*pointListBegin)>>, "Parameters to DrawPoly must be SHVec3.");
 
     // Check if points exceeded max
-    if (points.size() > MAX_POINTS)
+    if (storage.size() > MAX_POINTS)
     {
       SHLOG_WARNING("[DebugDraw] Exceeded maximum size of drawable debug elements.");
       return;
@@ -42,7 +51,7 @@ namespace SHADE
     const size_t POINTS_ROUNDED_COUNT = POINTS_COUNT / 2 * 2;
     for (auto pointIter = pointListBegin; pointIter != (pointListBegin + POINTS_ROUNDED_COUNT); ++pointIter)
     {
-      points.emplace_back(PointVertex{ *pointIter, color });
+      storage.emplace_back(PointVertex{ *pointIter, color });
     }
   }
 }
\ No newline at end of file

From 41e1f01f29174fbfaa8cc700bbef9e79b07e5173 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 10:06:39 +0800
Subject: [PATCH 18/27] Added support for persistent debug draw

---
 .../src/Application/SBApplication.cpp         |   4 +
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp | 126 +++++++++++++++---
 .../MiddleEnd/Interface/SHDebugDrawSystem.h   |  85 +++++++++++-
 SHADE_Engine/src/Tools/SHDebugDraw.cpp        |  38 +++++-
 SHADE_Engine/src/Tools/SHDebugDraw.h          |  58 ++++++++
 5 files changed, 291 insertions(+), 20 deletions(-)

diff --git a/SHADE_Application/src/Application/SBApplication.cpp b/SHADE_Application/src/Application/SBApplication.cpp
index b865f028..8b437584 100644
--- a/SHADE_Application/src/Application/SBApplication.cpp
+++ b/SHADE_Application/src/Application/SBApplication.cpp
@@ -146,6 +146,10 @@ namespace Sandbox
       if(editor->editorState == SHEditor::State::PLAY)
         SHSceneManager::SceneUpdate(0.016f);
 #endif
+      SHDebugDraw::Line(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), SHVec3(-5.0f, 0.0f, 0.0f), SHVec3(5.0f, 0.0f, 0.0f));
+      SHDebugDraw::Line(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), SHVec3(-5.0f, 1.0f, 0.0f), SHVec3(5.0f, 1.0f, 0.0f));
+      SHDebugDraw::Cube(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), {}, SHVec3(1.0f, 1.0f, 1.0f));
+      SHDebugDraw::Sphere(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), {}, 3.0f);
       SHSystemManager::RunRoutines(editor->editorState != SHEditor::State::PLAY, 0.016f);
       editor->PollPicking();
     }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
index 715b7d69..16069564 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -43,20 +43,41 @@ namespace SHADE
             return;
         }
 
+        // Get the system
+        SHDebugDrawSystem* system = static_cast<SHDebugDrawSystem*>(GetSystem());
+
         // Get current frame index
         const uint32_t FRAME_IDX = gfxSys->GetCurrentFrameIndex();
 
-        // Create the buffer if it doesn't exist or just update it
-        SHDebugDrawSystem* system = static_cast<SHDebugDrawSystem*>(GetSystem());
+        /* Non-Persistent Buffer */
+        // Update the buffer
         system->numPoints[FRAME_IDX] = system->points.size();
         const uint32_t DATA_SIZE = sizeof(PointVertex) * system->points.size();
         if (DATA_SIZE > 0)
         {
-          system->vertexBuffers[FRAME_IDX]->WriteToMemory(system->points.data(), DATA_SIZE, 0, 0);
+            system->vertexBuffers[FRAME_IDX]->WriteToMemory(system->points.data(), DATA_SIZE, 0, 0);
         }
 
         // Reset for next frame
         system->points.clear();
+
+        /* Persistent Buffer */
+        // Check if there are changes
+        if (system->persistentBuffersCleared[FRAME_IDX]
+            ||
+            system->numPersistentPoints[FRAME_IDX] != system->persistentPoints.size())
+        {
+            // Update Buffer
+            system->numPersistentPoints[FRAME_IDX] = system->persistentPoints.size();
+            const uint32_t DATA_SIZE = sizeof(PointVertex) * system->persistentPoints.size();
+            if (DATA_SIZE > 0)
+            {
+                system->persistentVertexBuffers[FRAME_IDX]->WriteToMemory(system->persistentPoints.data(), DATA_SIZE, 0, 0);
+            }
+
+            // Reset Flag
+            system->persistentBuffersCleared[FRAME_IDX] = false;
+        }
     }
     
     /*---------------------------------------------------------------------------------*/
@@ -74,32 +95,56 @@ namespace SHADE
             // Get Current frame index
             const uint32_t FRAME_IDX = GFX_SYSTEM->GetCurrentFrameIndex();
 
-            // Don't draw if no points
-            if (numPoints[FRAME_IDX] <= 0)
-              return;
-
+            // Set Pipeline
             cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawPipeline());
             cmdBuffer->SetLineWidth(LineWidth);
-            cmdBuffer->BindVertexBuffer(0, vertexBuffers[FRAME_IDX], 0);
-            cmdBuffer->DrawArrays(numPoints[FRAME_IDX], 1, 0, 0);
+
+            // Don't draw if no points
+            if (numPoints[FRAME_IDX] > 0)
+            {
+                cmdBuffer->BindVertexBuffer(0, vertexBuffers[FRAME_IDX], 0);
+                cmdBuffer->DrawArrays(numPoints[FRAME_IDX], 1, 0, 0);
+            }
+            if (numPersistentPoints[FRAME_IDX] > 0)
+            {
+                cmdBuffer->BindVertexBuffer(0, persistentVertexBuffers[FRAME_IDX], 0);
+                cmdBuffer->DrawArrays(numPersistentPoints[FRAME_IDX], 1, 0, 0);
+            }
         });
 
         // Reset trackers
         std::fill_n(numPoints.begin(), numPoints.size(), 0);
+        std::fill_n(numPersistentPoints.begin(), numPersistentPoints.size(), 0);
+        for (bool& cleared : persistentBuffersCleared)
+          cleared = true;
 
         // Allocate buffers
+        // - Non-Persistent Draws
         static constexpr uint32_t BUFFER_SIZE = MAX_POINTS * sizeof(PointVertex);
         for (Handle<SHVkBuffer>& bufHandle : vertexBuffers)
         {
-          bufHandle = GFX_SYSTEM->GetDevice()->CreateBuffer
-          (
-            BUFFER_SIZE,
-            nullptr,
-            0,
-            vk::BufferUsageFlagBits::eVertexBuffer,
-            VmaMemoryUsage::VMA_MEMORY_USAGE_AUTO,
-            VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_HOST_ACCESS_SEQUENTIAL_WRITE_BIT | VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_MAPPED_BIT
-          );
+            bufHandle = GFX_SYSTEM->GetDevice()->CreateBuffer
+            (
+                BUFFER_SIZE,
+                nullptr,
+                0,
+                vk::BufferUsageFlagBits::eVertexBuffer,
+                VmaMemoryUsage::VMA_MEMORY_USAGE_AUTO,
+                VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_HOST_ACCESS_SEQUENTIAL_WRITE_BIT | VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_MAPPED_BIT
+            );
+        }
+        // - Persistent Draws
+        for (Handle<SHVkBuffer>& bufHandle : persistentVertexBuffers)
+        {
+            bufHandle = GFX_SYSTEM->GetDevice()->CreateBuffer
+            (
+                BUFFER_SIZE,
+                nullptr,
+                0,
+                vk::BufferUsageFlagBits::eVertexBuffer,
+                VmaMemoryUsage::VMA_MEMORY_USAGE_AUTO,
+                VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_HOST_ACCESS_SEQUENTIAL_WRITE_BIT | VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_MAPPED_BIT
+            );
         }
     }
 
@@ -110,6 +155,11 @@ namespace SHADE
             if (vertexBuffer)
                 vertexBuffer.Free();
         }
+        for (auto vertexBuffer : persistentVertexBuffers)
+        {
+          if (vertexBuffer)
+            vertexBuffer.Free();
+        }
     }
 
     /*---------------------------------------------------------------------------------*/
@@ -145,6 +195,46 @@ namespace SHADE
         drawSphere(points, color, pos, radius);
     }
 
+    /*---------------------------------------------------------------------------------*/
+    /* Persistent Draw Functions                                                       */
+    /*---------------------------------------------------------------------------------*/
+    void SHDebugDrawSystem::DrawPersistentLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
+    {
+        drawLine(persistentPoints, color, startPt, endPt);
+    }
+
+    void SHDebugDrawSystem::DrawPersistentTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+    {
+        drawPoly(persistentPoints, color, { pt1, pt2, pt3 });
+    }
+
+    void SHDebugDrawSystem::DrawPersistentQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+    {
+        drawPoly(persistentPoints, color, { pt1, pt2, pt3, pt4 });
+    }
+
+    void SHDebugDrawSystem::DrawPersistentPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
+    {
+        drawPoly(persistentPoints, color, pointList.begin(), pointList.end());
+    }
+
+    void SHDebugDrawSystem::DrawPersistentCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
+    {
+        drawCube(persistentPoints, color, pos, size);
+    }
+
+    void SHDebugDrawSystem::DrawPersistentSphere(const SHVec4& color, const SHVec3& pos, double radius)
+    {
+        drawSphere(persistentPoints, color, pos, radius);
+    }
+
+    void SHDebugDrawSystem::ClearPersistentDraws()
+    {
+        persistentPoints.clear();
+        for (bool& cleared : persistentBuffersCleared)
+          cleared = true;
+    }
+
     void SHDebugDrawSystem::drawLine(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
     {
         if (storage.size() > MAX_POINTS)
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
index 41a0dd77..7c9e7c81 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
@@ -126,6 +126,78 @@ namespace SHADE
     /// <param name="size">Size of the rendered sphere.</param>
     void DrawSphere(const SHVec4& color, const SHVec3& pos, double radius);
 
+    /*---------------------------------------------------------------------------------*/
+    /* Persistent Draw Functions                                                       */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Renders a line between two points in world space that will persist until
+    /// ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the line.</param>
+    /// <param name="startPt">First point of the line.</param>
+    /// <param name="endPt">Second point of the line.</param>
+    void DrawPersistentLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    /// <summary>
+    /// Renders a triangle indicated by three points in world space that will persist 
+    /// until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the triangle.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the triangle.</param>
+    /// <param name="pt3">Third point of the triangle.</param>
+    void DrawPersistentTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3);
+    /// <summary>
+    /// Renders a quadrilateral indicated by four points in world space that will persist
+    /// until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the quadrilateral.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the quadrilateral.</param>
+    /// <param name="pt3">Third point of the quadrilateral.</param>
+    /// <param name="pt4">Third point of the quadrilateral.</param>
+    void DrawPersistentQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space that 
+    /// will persist until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointList">List of points for the polygon.</param>
+    void DrawPersistentPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space that 
+    /// will persist until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <typeparam name="IterType">Iterator for a STL-like container.</typeparam>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointListBegin">
+    /// Iterator to the first point of the point container.
+    /// </param>
+    /// <param name="pointListEnd">
+    /// One past last iterator of the point container.
+    /// </param>
+    template<typename IterType>
+    void DrawPersistentPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
+    /// <summary>
+    /// Renders a wireframe cube centered around the position specified in world space
+    /// that will persist until  ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the cube.</param>
+    /// <param name="pos">Position where the cube wil be centered at.</param>
+    /// <param name="size">Size of the rendered cube.</param>
+    void DrawPersistentCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size);
+    /// <summary>
+    /// Renders a wireframe sphere centered around the position specified in world space 
+    /// that will persist until  ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the sphere.</param>
+    /// <param name="pos">Position where the sphere wil be centered at.</param>
+    /// <param name="size">Size of the rendered sphere.</param>
+    void DrawPersistentSphere(const SHVec4& color, const SHVec3& pos, double radius);
+    /// <summary>
+    /// Clears any persistent drawn debug primitives.
+    /// </summary>
+    void ClearPersistentDraws();
+
     private:
     /*---------------------------------------------------------------------------------*/
     /* Type Definitions                                                                */
@@ -136,7 +208,8 @@ namespace SHADE
         SHVec4 Color;
     };
     using TripleBuffer = std::array<Handle<SHVkBuffer>, SHGraphicsConstants::NUM_FRAME_BUFFERS>;
-    using TripleUInt = std::array<uint32_t, SHGraphicsConstants::NUM_FRAME_BUFFERS>;
+    using TripleUInt   = std::array<uint32_t          , SHGraphicsConstants::NUM_FRAME_BUFFERS>;
+    using TripleBool   = std::array<bool              , SHGraphicsConstants::NUM_FRAME_BUFFERS>;
 
     /*---------------------------------------------------------------------------------*/
     /* Constants                                                                       */
@@ -152,6 +225,9 @@ namespace SHADE
     // GPU Buffers
     TripleBuffer vertexBuffers;
     TripleUInt   numPoints;
+    TripleBuffer persistentVertexBuffers;
+    TripleUInt   numPersistentPoints;
+    TripleBool   persistentBuffersCleared;
     // Cached Points for polygon drawing
     std::vector<SHVec3> spherePoints;
 
@@ -165,6 +241,13 @@ namespace SHADE
     void drawCube(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, const SHVec3& size);
     void drawSphere(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, double radius);
   };
+
+  template<typename IterType>
+  void SHADE::SHDebugDrawSystem::DrawPersistentPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
+  {
+
+  }
+
 }
 
 #include "SHDebugDrawSystem.hpp"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Tools/SHDebugDraw.cpp b/SHADE_Engine/src/Tools/SHDebugDraw.cpp
index a5b86c42..b8aa8b0e 100644
--- a/SHADE_Engine/src/Tools/SHDebugDraw.cpp
+++ b/SHADE_Engine/src/Tools/SHDebugDraw.cpp
@@ -25,7 +25,7 @@ namespace SHADE
   /* Static Member Definitions                                                         */
   /*-----------------------------------------------------------------------------------*/
   SHDebugDrawSystem* SHDebugDraw::dbgDrawSys = nullptr;
-  
+
   /*-----------------------------------------------------------------------------------*/
   /* Lifecycle Functions                                                               */
   /*-----------------------------------------------------------------------------------*/
@@ -70,4 +70,40 @@ namespace SHADE
   {
     dbgDrawSys->DrawSphere(color, pos, radius);
   }
+
+  void SHDebugDraw::PersistentLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
+  {
+    dbgDrawSys->DrawPersistentLine(color, startPt, endPt);
+  }
+
+  void SHDebugDraw::PersistentTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+  {
+    dbgDrawSys->DrawPersistentTri(color, pt1, pt2, pt3);
+  }
+
+  void SHDebugDraw::PersistentQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+  {
+    dbgDrawSys->DrawPersistentQuad(color, pt1, pt2, pt3, pt4);
+  }
+
+  void SHDebugDraw::PersistentPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
+  {
+    dbgDrawSys->DrawPersistentPoly(color, pointList);
+  }
+
+  void SHDebugDraw::PersistentCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
+  {
+    dbgDrawSys->DrawPersistentCube(color, pos, size);
+  }
+
+  void SHDebugDraw::PersistentSphere(const SHVec4& color, const SHVec3& pos, double radius)
+  {
+    dbgDrawSys->DrawPersistentSphere(color, pos, radius);
+  }
+
+  void SHDebugDraw::ClearPersistentDraws()
+  {
+    dbgDrawSys->ClearPersistentDraws();
+  }
+
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Tools/SHDebugDraw.h b/SHADE_Engine/src/Tools/SHDebugDraw.h
index 7ce44ec2..04504c3a 100644
--- a/SHADE_Engine/src/Tools/SHDebugDraw.h
+++ b/SHADE_Engine/src/Tools/SHDebugDraw.h
@@ -92,6 +92,64 @@ namespace SHADE
     /// <param name="size">Size of the rendered sphere.</param>
     static void Sphere(const SHVec4& color, const SHVec3& pos, double radius);
 
+    /*---------------------------------------------------------------------------------*/
+    /* Persistent Draw Functions                                                       */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Renders a line between two points in world space that will persist until
+    /// ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the line.</param>
+    /// <param name="startPt">First point of the line.</param>
+    /// <param name="endPt">Second point of the line.</param>
+    static void PersistentLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    /// <summary>
+    /// Renders a triangle indicated by three points in world space that will persist 
+    /// until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the triangle.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the triangle.</param>
+    /// <param name="pt3">Third point of the triangle.</param>
+    static void PersistentTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3);
+    /// <summary>
+    /// Renders a quadrilateral indicated by four points in world space that will persist
+    /// until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the quadrilateral.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the quadrilateral.</param>
+    /// <param name="pt3">Third point of the quadrilateral.</param>
+    /// <param name="pt4">Third point of the quadrilateral.</param>
+    static void PersistentQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space that 
+    /// will persist until ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointList">List of points for the polygon.</param>
+    static void PersistentPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    /// <summary>
+    /// Renders a wireframe cube centered around the position specified in world space
+    /// that will persist until  ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the cube.</param>
+    /// <param name="pos">Position where the cube wil be centered at.</param>
+    /// <param name="size">Size of the rendered cube.</param>
+    static void PersistentCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size);
+    /// <summary>
+    /// Renders a wireframe sphere centered around the position specified in world space 
+    /// that will persist until  ClearPersistentDraws() is called.
+    /// </summary>
+    /// <param name="color">Colour of the sphere.</param>
+    /// <param name="pos">Position where the sphere wil be centered at.</param>
+    /// <param name="size">Size of the rendered sphere.</param>
+    static void PersistentSphere(const SHVec4& color, const SHVec3& pos, double radius);
+    /// <summary>
+    /// Clears any persistent drawn debug primitives.
+    /// </summary>
+    static void ClearPersistentDraws();
+
     private:
     /*---------------------------------------------------------------------------------*/
     /* Static Data Members                                                             */

From 82e0e4df5ce8ec81619bd1463e3ec94dce216c71 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 10:33:17 +0800
Subject: [PATCH 19/27] Added editor gridlines and cardinal axes

---
 .../src/Application/SBApplication.cpp         |  10 +-
 SHADE_Engine/src/Editor/SHEditor.cpp          | 104 +++++++++++++++++-
 SHADE_Engine/src/Editor/SHEditor.h            |   9 +-
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp |   2 +-
 4 files changed, 114 insertions(+), 11 deletions(-)

diff --git a/SHADE_Application/src/Application/SBApplication.cpp b/SHADE_Application/src/Application/SBApplication.cpp
index 8b437584..10cc09b3 100644
--- a/SHADE_Application/src/Application/SBApplication.cpp
+++ b/SHADE_Application/src/Application/SBApplication.cpp
@@ -72,6 +72,9 @@ namespace Sandbox
     SHSystemManager::CreateSystem<SHAudioSystem>();
     SHSystemManager::CreateSystem<SHCameraSystem>();
     SHSystemManager::CreateSystem<SHDebugDrawSystem>();
+
+    // Link up SHDebugDraw
+    SHDebugDraw::Init(SHSystemManager::GetSystem<SHDebugDrawSystem>());
     
 #ifdef SHEDITOR
     SDL_Init(SDL_INIT_VIDEO);
@@ -127,9 +130,6 @@ namespace Sandbox
     SHSceneManager::InitSceneManager<SBTestScene>("TestScene");
     
     SHFrameRateController::UpdateFRC();
-
-    // Link up SHDebugDraw
-    SHDebugDraw::Init(SHSystemManager::GetSystem<SHDebugDrawSystem>());
   }
 
   void SBApplication::Update(void)
@@ -146,10 +146,6 @@ namespace Sandbox
       if(editor->editorState == SHEditor::State::PLAY)
         SHSceneManager::SceneUpdate(0.016f);
 #endif
-      SHDebugDraw::Line(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), SHVec3(-5.0f, 0.0f, 0.0f), SHVec3(5.0f, 0.0f, 0.0f));
-      SHDebugDraw::Line(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), SHVec3(-5.0f, 1.0f, 0.0f), SHVec3(5.0f, 1.0f, 0.0f));
-      SHDebugDraw::Cube(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), {}, SHVec3(1.0f, 1.0f, 1.0f));
-      SHDebugDraw::Sphere(SHVec4(1.0f, 1.0f, 1.0f, 1.0f), {}, 3.0f);
       SHSystemManager::RunRoutines(editor->editorState != SHEditor::State::PLAY, 0.016f);
       editor->PollPicking();
     }
diff --git a/SHADE_Engine/src/Editor/SHEditor.cpp b/SHADE_Engine/src/Editor/SHEditor.cpp
index cf5056a5..6259a7c6 100644
--- a/SHADE_Engine/src/Editor/SHEditor.cpp
+++ b/SHADE_Engine/src/Editor/SHEditor.cpp
@@ -46,6 +46,7 @@
 #include <backends/imgui_impl_vulkan.h>
 
 #include "Graphics/MiddleEnd/Interface/SHMousePickSystem.h"
+#include "Tools/SHDebugDraw.h"
 
 RTTR_REGISTRATION
 {
@@ -77,7 +78,6 @@ namespace SHADE
   //#==============================================================#
   void SHEditor::Init()
   {
-
     IMGUI_CHECKVERSION();
     if(auto context = ImGui::CreateContext())
     {
@@ -120,6 +120,17 @@ namespace SHADE
       window->Init();
     }
 
+    /* Editor View Gridlines */
+    SetUpGridLines(true, true);
+    // Handle state changes so that we only show in edit mode
+    std::shared_ptr<SHEventReceiverSpec<SHEditor>> stateChangeEventReceiver
+    {
+      std::make_shared<SHEventReceiverSpec<SHEditor>>(this, &SHEditor::onEditorStateChanged)
+    };
+    SHEventManager::SubscribeTo(SH_EDITOR_ON_PLAY_EVENT, std::dynamic_pointer_cast<SHEventReceiver>(stateChangeEventReceiver));
+    SHEventManager::SubscribeTo(SH_EDITOR_ON_PAUSE_EVENT, std::dynamic_pointer_cast<SHEventReceiver>(stateChangeEventReceiver));
+    SHEventManager::SubscribeTo(SH_EDITOR_ON_STOP_EVENT, std::dynamic_pointer_cast<SHEventReceiver>(stateChangeEventReceiver));
+
     SHLOG_INFO("Successfully initialised SHADE Engine Editor")
   }
 
@@ -180,6 +191,97 @@ namespace SHADE
     io->Fonts->Build();
   }
 
+  void SHEditor::SetUpGridLines(bool drawGrid, bool drawAxes)
+  {
+    // Clear existing lines
+    SHDebugDraw::ClearPersistentDraws();
+
+    static constexpr float DELTA = 1.0f;
+    static constexpr int   EXTENT_COUNT = static_cast<int>(500.0f /* TODO: Remove hard code */ / DELTA);
+    static constexpr float LINE_HALF_LENGTH = (DELTA * static_cast<float>(EXTENT_COUNT)) * 0.5f;
+
+    // Render Grid
+    static const SHColour GRID_COL = { 0.2f, 0.2f, 0.2f, 1.0f };
+    if (drawGrid)
+    {
+      for (int i = 1; i < EXTENT_COUNT; ++i)
+      {
+        // X-Axis Lines
+        SHDebugDraw::PersistentLine
+        (
+          GRID_COL,
+          SHVec3 { -LINE_HALF_LENGTH, 0.0f, i * DELTA },
+          SHVec3 {  LINE_HALF_LENGTH, 0.0f, i * DELTA }
+        );
+        SHDebugDraw::PersistentLine
+        (
+          GRID_COL,
+          SHVec3 { -LINE_HALF_LENGTH, 0.0f, i * -DELTA }, 
+          SHVec3 {  LINE_HALF_LENGTH, 0.0f, i * -DELTA }
+        );
+        // Y-Axis Lines
+        SHDebugDraw::PersistentLine
+        (
+          GRID_COL,
+          SHVec3 { i * DELTA, 0.0f, -LINE_HALF_LENGTH },
+          SHVec3 { i * DELTA, 0.0f,  LINE_HALF_LENGTH }
+        );
+        SHDebugDraw::PersistentLine
+        (
+          GRID_COL,
+          SHVec3 { -i * DELTA, 0.0f, -LINE_HALF_LENGTH },
+          SHVec3 { -i * DELTA, 0.0f,  LINE_HALF_LENGTH }
+        );
+      }
+    }
+
+    // Render World Axes
+    if (drawAxes || drawGrid)
+    {
+      const SHColour X_AXIS_COL = drawAxes ? SHColour::RED : GRID_COL;
+      const SHColour Y_AXIS_COL = drawAxes ? SHColour::GREEN : GRID_COL;
+      const SHColour Z_AXIS_COL = drawAxes ? SHColour::BLUE : GRID_COL;
+      // X
+      SHDebugDraw::PersistentLine
+      (
+        X_AXIS_COL,
+        SHVec3 { -LINE_HALF_LENGTH, 0.0f, 0.0f },
+        SHVec3 {  LINE_HALF_LENGTH, 0.0f, 0.0f }
+      );
+      // Y
+      SHDebugDraw::PersistentLine
+      (
+        Y_AXIS_COL,
+        SHVec3 { 0.0f, -LINE_HALF_LENGTH, 0.0f },
+        SHVec3 { 0.0f,  LINE_HALF_LENGTH, 0.0f }
+      );
+      // Z
+      SHDebugDraw::PersistentLine
+      (
+        Z_AXIS_COL,
+        SHVec3 { 0.0f, 0.0f, -LINE_HALF_LENGTH },
+        SHVec3 { 0.0f, 0.0f,  LINE_HALF_LENGTH }
+      );
+    }
+  }
+
+  SHEventHandle SHEditor::onEditorStateChanged(SHEventPtr eventPtr)
+  {
+    auto eventData = reinterpret_cast<const SHEventSpec<SHEditorStateChangeEvent>*>(eventPtr.get());
+    switch (editorState)
+    {
+      case State::PAUSE:
+      case State::STOP:
+        SetUpGridLines(true, true);
+        break;
+      case State::PLAY:
+      default:
+        SHDebugDraw::ClearPersistentDraws();
+        break;
+    }
+    return eventData->handle;
+  }
+
   void SHEditor::Exit()
   {
     for (const auto& window : SHEditorWindowManager::editorWindows | std::views::values)
diff --git a/SHADE_Engine/src/Editor/SHEditor.h b/SHADE_Engine/src/Editor/SHEditor.h
index 624069db..6e0ef5ae 100644
--- a/SHADE_Engine/src/Editor/SHEditor.h
+++ b/SHADE_Engine/src/Editor/SHEditor.h
@@ -16,8 +16,9 @@
 #include "Resource/SHHandle.h"
 #include "EditorWindow/SHEditorWindow.h"
 #include "Tools/SHLog.h"
-#include "Gizmos/SHTransformGizmo.h"
-
+#include "Gizmos/SHTransformGizmo.h"`
+#include "Events/SHEventDefines.h"
+#include "Events/SHEvent.h"
 
 //#==============================================================#
 //||                      Library Includes                      ||
@@ -194,6 +195,10 @@ namespace SHADE
 
     void InitFonts() noexcept;
 
+    void SetUpGridLines(bool drawGrid, bool drawAxes);
+
+    SHEventHandle onEditorStateChanged(SHEventPtr eventPtr);
+
     // Handle to command pool used for ImGui Vulkan Backend
     Handle<SHVkCommandPool> imguiCommandPool;
     // Handle to command buffer used for ImGui Vulkan Backend
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
index 16069564..90fe51d5 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -95,7 +95,7 @@ namespace SHADE
             // Get Current frame index
             const uint32_t FRAME_IDX = GFX_SYSTEM->GetCurrentFrameIndex();
 
-            // Set Pipeline
+            // Set Pipelin
             cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawPipeline());
             cmdBuffer->SetLineWidth(LineWidth);
 

From 7bda8b39986d3807f30bf0ebdc173a551b106402 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 13:48:53 +0800
Subject: [PATCH 20/27] Added IsInterpolating to RigidBody in C#

---
 SHADE_Managed/src/Components/RigidBody.cxx | 8 ++++++++
 SHADE_Managed/src/Components/RigidBody.hxx | 5 +++++
 2 files changed, 13 insertions(+)

diff --git a/SHADE_Managed/src/Components/RigidBody.cxx b/SHADE_Managed/src/Components/RigidBody.cxx
index 172b928b..12861600 100644
--- a/SHADE_Managed/src/Components/RigidBody.cxx
+++ b/SHADE_Managed/src/Components/RigidBody.cxx
@@ -148,6 +148,14 @@ namespace SHADE
     {
         return Convert::ToCLI(GetNativeComponent()->GetTorque());
     }
+    bool RigidBody::Interpolating::get()
+    {
+        return GetNativeComponent()->IsInterpolating();
+    }
+    void RigidBody::Interpolating::set(bool value)
+    {
+        GetNativeComponent()->SetInterpolate(value);
+    }
     
     /*---------------------------------------------------------------------------------*/
     /* Force Functions                                                                 */
diff --git a/SHADE_Managed/src/Components/RigidBody.hxx b/SHADE_Managed/src/Components/RigidBody.hxx
index b3e031ba..d3a30612 100644
--- a/SHADE_Managed/src/Components/RigidBody.hxx
+++ b/SHADE_Managed/src/Components/RigidBody.hxx
@@ -129,6 +129,11 @@ namespace SHADE
         {
             Vector3 get();
         }
+        property bool Interpolating
+        {
+            bool get();
+            void set(bool value);
+        }
         
         /*-----------------------------------------------------------------------------*/
         /* Force Functions                                                             */

From eb569a4263a267140aabdbdc8e73f411e27156b8 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Wed, 2 Nov 2022 14:21:27 +0800
Subject: [PATCH 21/27] Shader updates

---
 Assets/Shaders/DeferredComposite_CS.glsl      |  27 ++++++++++++------
 Assets/Shaders/DeferredComposite_CS.shshaderb | Bin 4997 -> 5501 bytes
 2 files changed, 18 insertions(+), 9 deletions(-)

diff --git a/Assets/Shaders/DeferredComposite_CS.glsl b/Assets/Shaders/DeferredComposite_CS.glsl
index 833180e7..5af585ba 100644
--- a/Assets/Shaders/DeferredComposite_CS.glsl
+++ b/Assets/Shaders/DeferredComposite_CS.glsl
@@ -57,25 +57,34 @@ void main()
   // normal of fragment
   vec3 normalView = imageLoad(normals, globalThread).rgb;
 
+  // light layer index
+  uint lightLayer = imageLoad (lightLayerData, globalThread).r;
+
   vec3 fragColor = vec3 (0.0f);
 
   for (int i = 0; i < lightCounts.directionalLights; ++i)
   {
-    // get normalized direction of light 
-    vec3 dLightNormalized = normalize (DirLightData.dLightData[i].direction);
+    if ((lightLayer & DirLightData.dLightData[i].cullingMask) != 0)
+    {
+      // get normalized direction of light 
+      vec3 dLightNormalized = normalize (DirLightData.dLightData[i].direction);
 
-    // Get diffuse strength
-    float diffuseStrength = max (0, dot (dLightNormalized, normalView));
+      // Get diffuse strength
+      float diffuseStrength = max (0, dot (dLightNormalized, normalView));
 
-    // Calculate the fragment color
-    fragColor += DirLightData.dLightData[i].diffuseColor.rgb * diffuseStrength.rrr * pixelDiffuse;
+      // Calculate the fragment color
+      fragColor += DirLightData.dLightData[i].diffuseColor.rgb * diffuseStrength.rrr * pixelDiffuse;
+    }
   }
 
   for (int i = 0; i < lightCounts.ambientLights; ++i)
   {
-    // Just do some add
-    //fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (0.5f);
-    fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (AmbLightData.aLightData[i].strength);
+    if ((lightLayer & AmbLightData.aLightData[i].cullingMask) != 0)
+    {
+      // Just do some add
+      //fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (0.5f);
+      fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (AmbLightData.aLightData[i].strength);
+    }
   }
 
   float ssaoVal = imageLoad (ssaoBlurredImage, globalThread).r;
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index 8d7a83271b3d684965b4a639eba7e74329c9469d..6e0ff2a40f9907e1126db4f89f94de2523310b2a 100644
GIT binary patch
literal 5501
zcmZve`IlT(5yxL<4@rPXAgClx7#9!>iv);BaLB-9bYKR9ac6kb)9Jj>(>-?ggalE8
zLc|R>6nBGhk0|1bKl+RRk=r?*<LC3<t;sXTn^RL&->O?xw{G3n85&%fm1}rtYCOv}
zWtU{zvcFVNwmlmH$x40;d`mV~>a+8Q=lAvpD|>I-ceAdSX2Y`5b{RgS$Rp5dUUbB_
zL6?JzZ7*f@%72)>L&$$6(FoaR=a*&|7G~$~TWYMWE%gVd+RdeQ(P=KN6uo9+P@HJ$
zH&OE|I*s=FO5I@;k9z)5a&IO_tKD7B+YcY>HS-lz>YONRYqghVOVeEEM7NO-if(6a
zrnHY`JK<}^$!2?|IC^xwPj>f>WUqtg?d9f5SA8s-L|^On3pXDrnvbJ`k7iRfyq~b^
z;GJ%7HE&m*#=Cw4>zDg(LT?wXV}tqpRI^v*xb=UqnS78}Irf7e?d7e5-F6pO_77)w
z!;4ZL&F+WK8|z?qy))=j?L>(IXQ{2-PTnqEtZ|Hg?(y!|x<zM@EP;Dp{k3kuc#oI<
zPC>r9Tr@X!RP`MKFVB+l+xG>qnd(Y6avvV_)*FK=zjoI~eaPk)x2~c;ou=UeZe5M_
zHsjKIAn!j`)}_C7tyI?+Euu#g*+bwL*HCq}imBbTQl3BhJ(e8?V_yyRoa5O?Hhdo}
zZ?|}&ndWRPYiO%#;F!%$YjCW*r<35-J&k8iBTv`*ccCAZ4RiE&;~e(HefFdufsq5Z
zCl~ihe|u8zmGz$itLLxxLYphEo!Ys77K}YL)Lx8aXTkgZyn7^Xm%TZc^n2Uuy<T%=
zZZ&VEw=|la$2Q1&t>&PDXW8#JV+(W*r0#pW78<GPdyqY!_9=MXuCCps-S<_ut82G!
z+I?GfySjG!bchr99$dzC1?GM+>k7=8#3pK(am2PlvqUwXe&+Ulm^*4wH@C}}@fO_g
z3M_IPGqA|*_cgG{Jqc#MMfe!x$6KG6^N4SKV(!!5d9T-}Zhhu=zw_jZ{eeY&QHy?2
z-wx#Pi~6nxGv70C>zjo1IRke^eCrd7`kcXfed^X1vvMxk>w4Yp{JB5u>e@#k>v<LK
zEWQ@Hf)jX#J!Ch(@|E~Ry_?W?qVr=~V%jIsC*Wd|{+E<Ee^~k(U(A^Ld#A<{zbom!
ziHLt0vN`p?iof=A5;B%Q>FN>dD&#7!XV{$CXYIzSFKe|2=J%{Fea)}#8+4gt7u*>7
z8*@+6|6fcoV_pk)>1#~&DFIgKzDt+>d*Rk?U(DgWDjTo9tlOCGxg{C&HKw|6*=61P
z;Ks1-8~Cey2jo)sOz$YQEW42o+snHWCN7!hop5XO4%{a{0J(Of-48c*o!mDIX1&_2
zPu=$}rhP8S?%M%64>z9Q0BebO_J0>Qya?B}8`(FjZk+eRjVWdxb>FR6)cd}q>;FiS
z&7r;w_k8vv{0romspH7TvW~EyK;8sd@6*ZV{tGn^mv38}^`3$I*3I`>xbeiSSKW6k
zru~H^8_!vI5w2{$`qJOG;hrBQgTBU8KbJ6dXWF;!ayDLqTdOfVlks1Hvh4Id>e~JU
zT@Ho*XJl(|R(z|kLi$MBZs#jvJm<}2|NaT$x5XO#E^LPEwYqP0=SBMDMf!C$-8XVm
zO?UtPn(mzXf5Ccu|DO{2GIFD)>wmJQYd@RxyQ$AJUJCgwdJ^4U+YhmaIMo<@d%|EF
z*lQAIuNLt${}qtF+78ee`ygf>zdNso{N||Ze+{J1GW(so-H<-w3v|-ieFG#exy)z(
zjc;GI8*dN%jnGumjsGU79{<hg`iMvTw;+p4u6q1QbnOxUt;p9W-S{^^_4qfU>mwfV
z--awMx$5z~ckRZ%8UA+Y)}$N%HYnonL%to-N8Gz{e(!|DUG~J;5mR<<{MIQuGY6o5
z(Y<@%&aC|J<erA#3%Rr(glm^un=>#|%GHdR_r8QpQ^y?gyP-pnIozYqdm!<b@$tL&
z0OUULf8(S6F39}mQ;xk4B72s||8ObmJ6`5Hf_@k>pEkdJvG@JR+W(e%^Z{h!iJwok
zd=Odu4(K2B=fiN9b!qz$BxYU8QO8G1xvJw4<RvKT&=%)+b{~bbZ>59kIpqD@gGV9n
z#kVVNe0^3RvCx~y&dKxCy#sy}(nowNy%1|b#?{Z?GkuKRfNP7|kCk#&`*GyQpr~D2
zQQE8j3$&9x=6DrdOmdmecW7*D=s@OMOlR#TOk8?~`aRzoWGwA*#*ZQUmcyrqte<%J
z^pTzCr&62&vY5Ux>tfDt+?!n8+4dgg(Tnv`&a%_QbG{#k#7;o*Uc~C}WjfhTmb|i^
zLN>PCxAbxNlaR~3pMYzZNA6D|8^iCd@8naESiGgv$cLb~4}G43PDAmQK8@@?ac5Tj
z3CR5BQ#PM_KLgd@(&y04A8+aN$j?H~uC{vKFQ99WxAaA1<B7*x`Vz8uyrnNAyR1vw
zbC8&IDaW0D1=)L#zI+uq>N<}6H7M%R7H?}8^4F6+=JWZ4iMwJxW2U|VW<LEQ-#3vX
z-wVj!f+C+bXF=Z`@NYxfW4^zWFmWmJd>7eV+T)zxL*5U??0z3vOy8JYG3O=vBv*Hq
z?3+C5{sFRe$L#(PSuAE(o0$7g!QJm%xc^1?kD+r(_jl$e&}JxphkuH!kGQ`xp8sc%
zxXYT)!o{LLKSvgeGyekFGe4K!>o1YT^oui#>3=o+SJ3&SZ-M_B+6FD~je80Hn}mtG
zykFms^}h^hkKDgSHh0wiJ7h6eV82HeGfrTCNZ1g3k;u;3A0hYaul*IML0;=MulD~C
H<xc3o9jyu;

literal 4997
zcmZve33n7l5XUFS=HL*JQw7`*4-kxzOB6Xm0!uKEAP{fkWOuU}ne4{h3AYLg;)#eT
z-h!XN&)|phsqguo|KChkX!B@ZQC0t{uBz^;o^11lr9rw{n!DSBpedLaEDV0jpkPVR
zEF?(z)8g}kwp1?+9UJOtB&D9M+j?=mFKB_Kwng&ENp2NQg;5oJp=hyiuqCOCp82<E
zZ?oh-l&DqN3qxat;o-v2{;}fp^jIS~8<)r8s9GK?MfGwqiB6UA>+t-dYB8QE`3^aG
z`1y0n-KiXvxHcZf$0zIMuq0J=cBHjc;;}+%8mykG6~iQ|RR;%Bdt0zld^$Q)jt8QN
ziJ6A7v#&LHP&|ys%cUB6TacGNU28;a9*xSUr3%jl-5%a>*n075tv(gTnJ4i!%wmmn
zUyt;OdRXbN#kG36uO-+l9;I?F*eN~~RVI`E+DtWRsDh3Z6CAj!s#U`{bs=w?{;`LC
zPS>Jp;w*;KgT{2tV0pKv{&Y5+8js4eJF;`_5*~Z`bMo&OR!ZX@NlzD@E6?6D_c@TY
zaJH^vNqwf6WVK;u&DJiN+Q6wfYV^78-^Ho9I1_6;Du=_y$+TwtskxN3%dSs%+7TQO
zKDUN}FbM^xxv;acGh`Nedr+A6r6)6g@L_zjJUU9bT1h6ArzI!}&-&CJOiS+b?(goI
zGn>qIzq7S+ZuW8Rh6R>vIOm>wANX@_|32smv*YKt`iX^&6?!M*Txtn>JT#m6%fcIt
zur?aTI%j)u)#>}<nR>lk8k`C%?tSEf>#`+by;4pxn7DU@#mvl5c(z>6Dk*68`991S
ztrns4w$_PSJ-tgZ=f>VG?%UC^v#|4)d^<Y!CecAv&O2bSk7XEkF!CBkPOuISYjM~D
z@q%uhcvc(lg51QS7Ibp6h&hmn|H}<#xru3hmV2>>S?;_r;_nx46ZMMNXERLAEb0Se
zAO6g;UmrU4k)Qp{5zF=)X7yPu_*s3+B%7brw@MiK-Vvw1ya*qgIg3wyU{)Wq=huf$
zeKrfs9Cly#?bqkn(Xr=5)bootv-W_~?}+>H(DA39r8*&J?2?9#yj(HtJWbM9O4lFG
z6vLjE&a8kz_|Hpm{ilUL`N4>ZKRqWF_)e$uCM^CU$>hX;h5qNh^CDs`7e}{PD<o%m
zIb&x)AFvb4U)0JSlApU^;Y)sW-XMz{Ys86xKQX(Uey^Bd#9SxN!k3un-2hsq^DbE%
zWheeqsTKsAbXv~U>o9PLxcm;W`(_{avPHyND~-3v-TK77=Y?@*?Bqx1ZGvIn?PT^X
z6WS+Eya91)v3T6Y8r?SU4%=GE2gK2dQxGR67<tfnW0vQTlZlD{5pmAL`RzO>BwIg6
zC9{{jW*?W_B%(gvq4no(jV<ZB!$y6)FWw>f_$@#@FzQ239ESb8lc|SZUlB(ppTCH~
zT(ajQXTX=3=vN&^&D8ao)3GyOyh|4IbweB<V&YG}TcRMixX1SYByF+C^q(bD6SKm*
z;a%ecVWak6#ff{b+Pj2P`)zR+zSMSG{EmpVU0)4qV(wY=<S!vPaeR5_og(^&&fDYn
zqOa%Y=<Da`{LV9fW_z=z6R+RXnU!Hr$G_z1*e^SMm+IkO?i2AXxgec>afe_>b&59e
zB@Ppt#qM_)_ckIw>RT$p7u#;#1m^}L58sW4M0_*Q@n0>%XI%T4&$S|az=w5n%>Tn8
zaEL`d?wk1BBX;6-i9aIZ`(g1PmF&lV%=v&@{KqAOLo7djUOIM*|AgcXPN)8jB0v5n
z>G*(K{3j)YLo7c&ea6mNdc=F3On<kC{?<viiZf5}KXuOS;?Ia!*msCyhf^p0dR9aX
z`pIlR=deEA^KQv|M7u=fU=KcfMc}{7r%!yJh<$rS|Hub@n~416L$-W_lF8Snt{xJ9
zLB#ir_}DBD{TvcuU!Y3S4~w{y{UU7K1@jC}e0)YkV5T3H%-!8ot$YVw6yXEDKsA6J
z6A>3b{x0A{Y~BVotNplSt9?}ROCqZs+X)fA%;(D@?AF^?90ty^-r`RUuZqYw;?DY-
z!@!{{s-N?{E+Q6oJL4OYnQ!xXQ!;+w<})Ulxw+)xyd@b7Uz;f~=7gD{Z*cZAC!vV5
zU(|l|qQl0;*^dp(pF{eOjc*El#a0$4Hk=u)h);@G*duZ5aLfI+WMbHio|Ft`Ga5@~
zM(zHY(J2wQ&1h9J`@oq|^a&C9$%kxrRg=tpTK*Zy<Y#8-`zcW(;!N1!_|o^&BJ9@p
zGY$i1S>LT!XN8duKg)McvgJE3`GUyuVdKv6Wp3UTVYj(?&tc$@<#}H+xv;aBS-L3l
zXX28>@U@u$qc8M`dxBe?A4sN7n~4u4gV{`A1M~aNeY5|H_{XBFPHz|gMARv=Z~Ui{
z@d4-W3+Me@1kR$y%i>^mA74lYvol_k%o(q_x&Jbig8)A}BN+ax#J>_<clvzsuSE+*
z!|MGF@tY0<XVFjQlKQ_9VYl4hN+!3}{+(nnmSNvZ1|yDPKRB#ed_<9%s~<(|#~=GG
RQBirRm%P~jRg@i~{{U;~#q$6F


From 73be299aaeee7632f3649d8da4d1c1d7797f0624 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Wed, 2 Nov 2022 15:05:34 +0800
Subject: [PATCH 22/27] new SHMETA

---
 Assets/Shaders/SSAOBlur_CS.shshaderb.shmeta | 3 +++
 Assets/Shaders/SSAO_CS.shshaderb.shmeta     | 2 +-
 2 files changed, 4 insertions(+), 1 deletion(-)
 create mode 100644 Assets/Shaders/SSAOBlur_CS.shshaderb.shmeta

diff --git a/Assets/Shaders/SSAOBlur_CS.shshaderb.shmeta b/Assets/Shaders/SSAOBlur_CS.shshaderb.shmeta
new file mode 100644
index 00000000..57bdb72b
--- /dev/null
+++ b/Assets/Shaders/SSAOBlur_CS.shshaderb.shmeta
@@ -0,0 +1,3 @@
+Name: SSAOBlur_CS
+ID: 39760835
+Type: 2
diff --git a/Assets/Shaders/SSAO_CS.shshaderb.shmeta b/Assets/Shaders/SSAO_CS.shshaderb.shmeta
index a5b5b739..9a477b24 100644
--- a/Assets/Shaders/SSAO_CS.shshaderb.shmeta
+++ b/Assets/Shaders/SSAO_CS.shshaderb.shmeta
@@ -1,3 +1,3 @@
 Name: SSAO_CS
-ID: 48941934
+ID: 38430899
 Type: 2

From f0ef9fc0cf411b494ec1e44c380fc3a48c89e138 Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 15:13:12 +0800
Subject: [PATCH 23/27] Fixed validation errors due to debug draw

---
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp |  16 ++-
 .../MiddleEnd/Interface/SHDebugDrawSystem.h   |  25 ++--
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  | 113 ++++++++++--------
 .../MiddleEnd/Interface/SHGraphicsSystem.h    |   6 +
 4 files changed, 92 insertions(+), 68 deletions(-)

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
index 90fe51d5..74effb6d 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -95,18 +95,26 @@ namespace SHADE
             // Get Current frame index
             const uint32_t FRAME_IDX = GFX_SYSTEM->GetCurrentFrameIndex();
 
-            // Set Pipelin
-            cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawPipeline());
-            cmdBuffer->SetLineWidth(LineWidth);
-
             // Don't draw if no points
             if (numPoints[FRAME_IDX] > 0)
             {
+                cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawPipeline());
+                cmdBuffer->SetLineWidth(LineWidth);
                 cmdBuffer->BindVertexBuffer(0, vertexBuffers[FRAME_IDX], 0);
                 cmdBuffer->DrawArrays(numPoints[FRAME_IDX], 1, 0, 0);
             }
+        });
+        auto subPassWithDepth = renderGraph->GetNode("Debug Draw with Depth")->GetSubpass("Debug Draw with Depth");
+        subPassWithDepth->AddExteriorDrawCalls([this, GFX_SYSTEM](Handle<SHVkCommandBuffer>& cmdBuffer)
+        {
+            // Get Current frame index
+            const uint32_t FRAME_IDX = GFX_SYSTEM->GetCurrentFrameIndex();
+
+            // Don't draw if no points
             if (numPersistentPoints[FRAME_IDX] > 0)
             {
+                cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawDepthPipeline());
+                cmdBuffer->SetLineWidth(LineWidth);
                 cmdBuffer->BindVertexBuffer(0, persistentVertexBuffers[FRAME_IDX], 0);
                 cmdBuffer->DrawArrays(numPersistentPoints[FRAME_IDX], 1, 0, 0);
             }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
index 7c9e7c81..2a9709ed 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
@@ -131,7 +131,7 @@ namespace SHADE
     /*---------------------------------------------------------------------------------*/
     /// <summary>
     /// Renders a line between two points in world space that will persist until
-    /// ClearPersistentDraws() is called.
+    /// ClearPersistentDraws() is called. These lines are depth tested.
     /// </summary>
     /// <param name="color">Colour of the line.</param>
     /// <param name="startPt">First point of the line.</param>
@@ -139,7 +139,7 @@ namespace SHADE
     void DrawPersistentLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
     /// <summary>
     /// Renders a triangle indicated by three points in world space that will persist 
-    /// until ClearPersistentDraws() is called.
+    /// until ClearPersistentDraws() is called. These lines are depth tested.
     /// </summary>
     /// <param name="color">Colour of the triangle.</param>
     /// <param name="pt1">First point of the triangle.</param>
@@ -148,7 +148,7 @@ namespace SHADE
     void DrawPersistentTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3);
     /// <summary>
     /// Renders a quadrilateral indicated by four points in world space that will persist
-    /// until ClearPersistentDraws() is called.
+    /// until ClearPersistentDraws() is called. These lines are depth tested.
     /// </summary>
     /// <param name="color">Colour of the quadrilateral.</param>
     /// <param name="pt1">First point of the triangle.</param>
@@ -158,14 +158,16 @@ namespace SHADE
     void DrawPersistentQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4);
     /// <summary>
     /// Renders a polygon indicated by the specified set of points in world space that 
-    /// will persist until ClearPersistentDraws() is called.
+    /// will persist until ClearPersistentDraws() is called. These lines are depth 
+    /// tested.
     /// </summary>
     /// <param name="color">Colour of the polygon.</param>
     /// <param name="pointList">List of points for the polygon.</param>
     void DrawPersistentPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList);
     /// <summary>
     /// Renders a polygon indicated by the specified set of points in world space that 
-    /// will persist until ClearPersistentDraws() is called.
+    /// will persist until ClearPersistentDraws() is called. These lines are depth 
+    /// tested.
     /// </summary>
     /// <typeparam name="IterType">Iterator for a STL-like container.</typeparam>
     /// <param name="color">Colour of the polygon.</param>
@@ -179,7 +181,8 @@ namespace SHADE
     void DrawPersistentPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
     /// <summary>
     /// Renders a wireframe cube centered around the position specified in world space
-    /// that will persist until  ClearPersistentDraws() is called.
+    /// that will persist until  ClearPersistentDraws() is called. These lines are depth
+    /// tested.
     /// </summary>
     /// <param name="color">Colour of the cube.</param>
     /// <param name="pos">Position where the cube wil be centered at.</param>
@@ -187,7 +190,8 @@ namespace SHADE
     void DrawPersistentCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size);
     /// <summary>
     /// Renders a wireframe sphere centered around the position specified in world space 
-    /// that will persist until  ClearPersistentDraws() is called.
+    /// that will persist until  ClearPersistentDraws() is called. These lines are depth 
+    /// tested.
     /// </summary>
     /// <param name="color">Colour of the sphere.</param>
     /// <param name="pos">Position where the sphere wil be centered at.</param>
@@ -241,13 +245,6 @@ namespace SHADE
     void drawCube(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, const SHVec3& size);
     void drawSphere(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& pos, double radius);
   };
-
-  template<typename IterType>
-  void SHADE::SHDebugDrawSystem::DrawPersistentPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
-  {
-
-  }
-
 }
 
 #include "SHDebugDrawSystem.hpp"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index 2bc2b7de..4d551cee 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -171,7 +171,7 @@ namespace SHADE
         "Normals",
         "Albedo",
         "Depth Buffer",       
-        "Scene"           
+        "Scene"
       }, 
       {}); // no predecessors
 
@@ -186,8 +186,14 @@ namespace SHADE
     // deferred composite
     gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "Scene" });
 
-    // Set up Debug Draw Pass
-    auto debugDrawNode = worldRenderGraph->AddNode("Debug Draw", { "Scene" }, {"G-Buffer"});
+    // Set up Debug Draw Passes
+    // - Depth Tested
+    auto debugDrawNodeDepth = worldRenderGraph->AddNode("Debug Draw with Depth", { "Scene", "Depth Buffer" }, {"G-Buffer"});
+    auto debugDrawDepthSubpass = debugDrawNodeDepth->AddSubpass("Debug Draw with Depth");
+    debugDrawDepthSubpass->AddColorOutput("Scene");
+    debugDrawDepthSubpass->AddDepthOutput("Depth Buffer");
+    // - No Depth Test
+    auto debugDrawNode = worldRenderGraph->AddNode("Debug Draw", { "Scene" }, { "Debug Draw with Depth" });
     auto debugDrawSubpass = debugDrawNode->AddSubpass("Debug Draw");
     debugDrawSubpass->AddColorOutput("Scene");
 
@@ -209,53 +215,8 @@ namespace SHADE
     defaultMaterial = AddMaterial(defaultVertShader, defaultFragShader, gBufferSubpass);
 
     // Create debug draw pipeline
-    auto debugDrawPipelineLayout = resourceManager.Create<SHVkPipelineLayout>
-    (
-      device, SHPipelineLayoutParams
-      {
-        .shaderModules = { debugVertShader, debugFragShader },
-        .globalDescSetLayouts = SHGraphicsGlobalData::GetDescSetLayouts()
-      }
-    );
-    debugDrawPipeline = resourceManager.Create<SHVkPipeline>(device, debugDrawPipelineLayout, nullptr, debugDrawNode->GetRenderpass(), debugDrawSubpass);
-    debugDrawPipeline->GetPipelineState().SetRasterizationState(SHRasterizationState
-    {
-      .polygonMode = vk::PolygonMode::eLine,
-      .cull_mode = vk::CullModeFlagBits::eNone
-    });
-    debugDrawPipeline->GetPipelineState().SetInputAssemblyState(SHInputAssemblyState
-    {
-      .topology = vk::PrimitiveTopology::eLineList
-    });
-
-    SHVertexInputState debugDrawVertexInputState;
-    debugDrawVertexInputState.AddBinding(false, true, { SHVertexAttribute(SHAttribFormat::FLOAT_4D), SHVertexAttribute(SHAttribFormat::FLOAT_4D) });
-    debugDrawPipeline->GetPipelineState().SetVertexInputState(debugDrawVertexInputState);
-    SHColorBlendState colorBlendState{};
-    colorBlendState.logic_op_enable = VK_FALSE;
-    colorBlendState.logic_op = vk::LogicOp::eCopy;
-
-    auto const& subpassColorReferences = debugDrawSubpass->GetColorAttachmentReferences();
-    colorBlendState.attachments.reserve(subpassColorReferences.size());
-
-    for (auto& att : subpassColorReferences)
-    {
-      colorBlendState.attachments.push_back(vk::PipelineColorBlendAttachmentState
-        {
-          .blendEnable = SHVkUtil::IsBlendCompatible(debugDrawSubpass->GetFormatFromAttachmentReference(att.attachment)),
-          .srcColorBlendFactor = vk::BlendFactor::eSrcAlpha,
-          .dstColorBlendFactor = vk::BlendFactor::eOneMinusSrcAlpha,
-          .colorBlendOp = vk::BlendOp::eAdd,
-          .srcAlphaBlendFactor = vk::BlendFactor::eOne,
-          .dstAlphaBlendFactor = vk::BlendFactor::eZero,
-          .alphaBlendOp = vk::BlendOp::eAdd,
-          .colorWriteMask = vk::ColorComponentFlagBits::eR | vk::ColorComponentFlagBits::eG | vk::ColorComponentFlagBits::eB | vk::ColorComponentFlagBits::eA,
-        }
-      );
-    }
-
-    debugDrawPipeline->GetPipelineState().SetColorBlenState(colorBlendState);
-    debugDrawPipeline->ConstructPipeline();
+    debugDrawPipeline      = createDebugDrawPipeline(debugDrawNode->GetRenderpass(), debugDrawSubpass);
+    debugDrawDepthPipeline = createDebugDrawPipeline(debugDrawNodeDepth->GetRenderpass(), debugDrawDepthSubpass);
   }
 
   void SHGraphicsSystem::InitMiddleEnd(void) noexcept
@@ -867,5 +828,57 @@ namespace SHADE
     return worldRenderGraph->GetNode(G_BUFFER_RENDER_GRAPH_NODE_NAME.data());
   }
 
+  Handle<SHVkPipeline> SHGraphicsSystem::createDebugDrawPipeline(Handle<SHVkRenderpass> renderPass, Handle<SHSubpass> subpass)
+  {
+    auto pipelineLayout = resourceManager.Create<SHVkPipelineLayout>
+    (
+      device, SHPipelineLayoutParams
+      {
+        .shaderModules = { debugVertShader, debugFragShader },
+        .globalDescSetLayouts = SHGraphicsGlobalData::GetDescSetLayouts()
+      }
+    );
+    auto pipeline = resourceManager.Create<SHVkPipeline>(device, pipelineLayout, nullptr, renderPass, subpass);
+    pipeline->GetPipelineState().SetRasterizationState(SHRasterizationState
+    {
+      .polygonMode = vk::PolygonMode::eLine,
+      .cull_mode = vk::CullModeFlagBits::eNone
+    });
+    pipeline->GetPipelineState().SetInputAssemblyState(SHInputAssemblyState
+    {
+      .topology = vk::PrimitiveTopology::eLineList
+    });
+
+    SHVertexInputState debugDrawVertexInputState;
+    debugDrawVertexInputState.AddBinding(false, true, { SHVertexAttribute(SHAttribFormat::FLOAT_4D), SHVertexAttribute(SHAttribFormat::FLOAT_4D) });
+    pipeline->GetPipelineState().SetVertexInputState(debugDrawVertexInputState);
+    SHColorBlendState colorBlendState{};
+    colorBlendState.logic_op_enable = VK_FALSE;
+    colorBlendState.logic_op = vk::LogicOp::eCopy;
+
+    auto const& subpassColorReferences = subpass->GetColorAttachmentReferences();
+    colorBlendState.attachments.reserve(subpassColorReferences.size());
+
+    for (auto& att : subpassColorReferences)
+    {
+      colorBlendState.attachments.push_back(vk::PipelineColorBlendAttachmentState
+      {
+        .blendEnable = SHVkUtil::IsBlendCompatible(subpass->GetFormatFromAttachmentReference(att.attachment)),
+        .srcColorBlendFactor = vk::BlendFactor::eSrcAlpha,
+        .dstColorBlendFactor = vk::BlendFactor::eOneMinusSrcAlpha,
+        .colorBlendOp = vk::BlendOp::eAdd,
+        .srcAlphaBlendFactor = vk::BlendFactor::eOne,
+        .dstAlphaBlendFactor = vk::BlendFactor::eZero,
+        .alphaBlendOp = vk::BlendOp::eAdd,
+        .colorWriteMask = vk::ColorComponentFlagBits::eR | vk::ColorComponentFlagBits::eG | vk::ColorComponentFlagBits::eB | vk::ColorComponentFlagBits::eA,
+      });
+    }
+
+    pipeline->GetPipelineState().SetColorBlenState(colorBlendState);
+    pipeline->ConstructPipeline();
+
+    return pipeline;
+  }
+
 #pragma endregion MISC
 }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
index b307dc92..07e5fbab 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
@@ -289,6 +289,7 @@ namespace SHADE
     Handle<SHPostOffscreenRenderSystem> GetPostOffscreenRenderSystem(void) const noexcept {return postOffscreenRender;};
     Handle<SHRenderGraphNode>           GetPrimaryRenderpass() const noexcept;
     Handle<SHVkPipeline>                GetDebugDrawPipeline(void) const noexcept { return debugDrawPipeline; }
+    Handle<SHVkPipeline>                GetDebugDrawDepthPipeline(void) const noexcept { return debugDrawDepthPipeline; }
     uint32_t                            GetCurrentFrameIndex(void) const noexcept { return renderContext.GetCurrentFrame(); }
 
     /*-----------------------------------------------------------------------------*/
@@ -355,6 +356,7 @@ namespace SHADE
     // Built-In Materials
     Handle<SHMaterial>                                        defaultMaterial;
     Handle<SHVkPipeline>                                      debugDrawPipeline;
+    Handle<SHVkPipeline>                                      debugDrawDepthPipeline;
 
     Handle<SHRenderGraph>                                     worldRenderGraph;
 
@@ -367,5 +369,9 @@ namespace SHADE
     uint32_t                                                  resizeHeight;
     bool restoredFromMinimize = false;
 
+    /*---------------------------------------------------------------------------------*/
+    /* Helper Functions                                                                */
+    /*---------------------------------------------------------------------------------*/
+    Handle<SHVkPipeline> createDebugDrawPipeline(Handle<SHVkRenderpass> renderPass, Handle<SHSubpass> subpass);
   };
 }
\ No newline at end of file

From d818adf2a20a87ec374ba2f81bba58953e53987b Mon Sep 17 00:00:00 2001
From: Kah Wei <msntkw@msn.com>
Date: Wed, 2 Nov 2022 15:34:35 +0800
Subject: [PATCH 24/27] Fixed DrawPoly()

---
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp |  9 +++--
 .../MiddleEnd/Interface/SHDebugDrawSystem.h   |  3 ++
 .../MiddleEnd/Interface/SHDebugDrawSystem.hpp | 34 ++++++++++++++++++-
 3 files changed, 43 insertions(+), 3 deletions(-)

diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
index 74effb6d..37d15808 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -255,6 +255,11 @@ namespace SHADE
         storage.emplace_back(PointVertex{ endPt, color });
     }
 
+    void SHDebugDrawSystem::drawLineSet(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList)
+    {
+        drawLineSet(storage, color, pointList.begin(), pointList.end());
+    }
+
     void SHDebugDrawSystem::drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList)
     {
         drawPoly(storage, color, pointList.begin(), pointList.end());
@@ -281,7 +286,7 @@ namespace SHADE
         const SHVec3 TOP_LEFT_FRONT = UNIT_TOP_LEFT_FRONT * size;
         const SHVec3 TOP_RIGHT_FRONT = UNIT_TOP_RIGHT_FRONT * size;
 
-        drawPoly
+        drawLineSet
         (
             storage,
             color,
@@ -316,6 +321,6 @@ namespace SHADE
                 spherePoints.emplace_back(SPHERE.VertexPositions[idx]);
             }
         }
-        drawPoly(storage, color, spherePoints.begin(), spherePoints.end());
+        drawLineSet(storage, color, spherePoints.begin(), spherePoints.end());
     }
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
index 2a9709ed..20ddcd42 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
@@ -239,6 +239,9 @@ namespace SHADE
     /* Helper Draw Functions                                                           */
     /*---------------------------------------------------------------------------------*/
     void drawLine(std::vector<PointVertex>& storage, const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    void drawLineSet(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    template<typename IterType>
+    void drawLineSet(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
     void drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, std::initializer_list<SHVec3> pointList);
     template<typename IterType>
     void drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
index 953b1cb3..2a171e73 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
@@ -28,7 +28,7 @@ namespace SHADE
   /* Helper Draw Functions                                                             */
   /*-----------------------------------------------------------------------------------*/
   template<typename IterType>
-  void SHDebugDrawSystem::drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
+  void SHDebugDrawSystem::drawLineSet(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
   {
     // Ensure dereferenced type is SHVec3
     static_assert(std::is_same_v<SHVec3, std::remove_cvref_t<decltype(*pointListBegin)>>, "Parameters to DrawPoly must be SHVec3.");
@@ -54,4 +54,36 @@ namespace SHADE
       storage.emplace_back(PointVertex{ *pointIter, color });
     }
   }
+  template<typename IterType>
+  void SHDebugDrawSystem::drawPoly(std::vector<PointVertex>& storage, const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
+  {
+    // Ensure dereferenced type is SHVec3
+    static_assert(std::is_same_v<SHVec3, std::remove_cvref_t<decltype(*pointListBegin)>>, "Parameters to DrawPoly must be SHVec3.");
+
+    // Check if points exceeded max
+    if (storage.size() > MAX_POINTS)
+    {
+      SHLOG_WARNING("[DebugDraw] Exceeded maximum size of drawable debug elements.");
+      return;
+    }
+
+    const size_t POINTS_COUNT = pointListEnd - pointListBegin;
+    // Invalid polygon
+    if (POINTS_COUNT < 2)
+    {
+      SHLOG_WARNING("[SHDebugDraw] Invalid polygon provided to DrawPoly().");
+      return;
+    }
+
+    // Trace the polygon
+    for (auto pointIter = pointListBegin + 1; pointIter != pointListEnd; ++pointIter)
+    {
+      storage.emplace_back(PointVertex{ *(pointIter - 1), color });
+      storage.emplace_back(PointVertex{ *pointIter      , color });
+    }
+
+    // Close the line loop
+    storage.emplace_back(PointVertex{ *(pointListEnd - 1), color });
+    storage.emplace_back(PointVertex{ *pointListBegin    , color });
+  }
 }
\ No newline at end of file

From 02c79b4cc48f5d606c9ed6fcaaf75be1fc5718da Mon Sep 17 00:00:00 2001
From: Diren D Bharwani <diren.bharwani@gmail.com>
Date: Wed, 2 Nov 2022 15:44:24 +0800
Subject: [PATCH 25/27] Added Debug Drawing for Colliders (wonk) and Trigger
 checkbox to Colldiers

Press space to toggle debug draw. Does not work until you press play, then it can be toggled on and off.
---
 .../src/Application/SBApplication.cpp         |   8 +
 .../Inspector/SHEditorComponentView.hpp       |   4 +
 SHADE_Engine/src/Math/SHColour.cpp            |  11 ++
 SHADE_Engine/src/Math/SHColour.h              |   7 +
 SHADE_Engine/src/Physics/SHPhysicsSystem.cpp  | 162 +++++++++++++++++-
 SHADE_Engine/src/Physics/SHPhysicsSystem.h    |  52 +++---
 SHADE_Engine/src/Tools/SHUtilities.h          |   2 +-
 7 files changed, 220 insertions(+), 26 deletions(-)

diff --git a/SHADE_Application/src/Application/SBApplication.cpp b/SHADE_Application/src/Application/SBApplication.cpp
index b865f028..81926359 100644
--- a/SHADE_Application/src/Application/SBApplication.cpp
+++ b/SHADE_Application/src/Application/SBApplication.cpp
@@ -91,6 +91,7 @@ namespace Sandbox
     SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsPreUpdate>();
     SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsFixedUpdate>();
     SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsPostUpdate>();
+    SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsDebugDraw>();
 
     SHSystemManager::RegisterRoutine<SHTransformSystem, SHTransformSystem::TransformPostPhysicsUpdate>();
     SHSystemManager::RegisterRoutine<SHDebugDrawSystem, SHDebugDrawSystem::ProcessPointsRoutine>();
@@ -148,6 +149,13 @@ namespace Sandbox
 #endif
       SHSystemManager::RunRoutines(editor->editorState != SHEditor::State::PLAY, 0.016f);
       editor->PollPicking();
+
+      static bool drawColliders = false;
+      if (SHInputManager::GetKeyDown(SHInputManager::SH_KEYCODE::SPACE))
+      {
+        drawColliders = !drawColliders;
+        SHSystemManager::GetSystem<SHPhysicsSystem>()->SetDrawColliders(drawColliders);
+      }
     }
     // Finish all graphics jobs first
     graphicsSystem->AwaitGraphicsExecution();
diff --git a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
index 4777fc6a..6f03a55e 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
@@ -273,6 +273,7 @@ namespace SHADE
         {
 
         }
+
         {
           SHEditorWidgets::BeginPanel("Offsets",{ ImGui::GetContentRegionAvail().x, 30.0f });
           SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [&collider] {return collider->GetPositionOffset(); }, [&collider](SHVec3 const& vec) {collider->SetPositionOffset(vec); });
@@ -297,6 +298,9 @@ namespace SHADE
           });
           SHEditorWidgets::EndPanel();
         }
+
+        SHEditorWidgets::CheckBox("Is Trigger", [collider] { return collider->IsTrigger(); }, [collider](bool value) { collider->SetIsTrigger(value); });
+
         if (ImGui::Button(std::format("{} Remove Collider #{}", ICON_MD_REMOVE, i).data()))
         {
           colliderToDelete = i;
diff --git a/SHADE_Engine/src/Math/SHColour.cpp b/SHADE_Engine/src/Math/SHColour.cpp
index 944c37cb..fc2f2a08 100644
--- a/SHADE_Engine/src/Math/SHColour.cpp
+++ b/SHADE_Engine/src/Math/SHColour.cpp
@@ -118,6 +118,17 @@ namespace SHADE
   }
   {}
 
+  SHColour::SHColour(uint32_t rgba) noexcept
+  : XMFLOAT4 { 0.0f, 0.0f, 0.0f, 1.0f }
+  {
+    const SHColour32 TMP { ._32bitValue = rgba };
+
+    x = static_cast<float>(TMP._8bitValues[0]) / 255.0f;
+    y = static_cast<float>(TMP._8bitValues[1]) / 255.0f;
+    z = static_cast<float>(TMP._8bitValues[2]) / 255.0f;
+    w = static_cast<float>(TMP._8bitValues[3]) / 255.0f;
+  }
+
   SHColour::SHColour(const SHVec3& rgb) noexcept
   : XMFLOAT4 { rgb.x, rgb.y, rgb.z, 1.0f }
   {}
diff --git a/SHADE_Engine/src/Math/SHColour.h b/SHADE_Engine/src/Math/SHColour.h
index a6adf7bb..5dac0edd 100644
--- a/SHADE_Engine/src/Math/SHColour.h
+++ b/SHADE_Engine/src/Math/SHColour.h
@@ -34,6 +34,12 @@ namespace SHADE
     float v = 0.0f;
   };
 
+  union SH_API SHColour32
+  {
+    uint32_t _32bitValue;
+    uint8_t  _8bitValues[4];
+  };
+
   class SH_API SHColour : public DirectX::XMFLOAT4
   {
   public:
@@ -46,6 +52,7 @@ namespace SHADE
     SHColour  (float r, float g, float b, float a)          noexcept;
     SHColour  (uint8_t r, uint8_t g, uint8_t b)             noexcept;
     SHColour  (uint8_t r, uint8_t g, uint8_t b, uint8_t a)  noexcept;
+    SHColour  (uint32_t rgba)                               noexcept;
 
     SHColour  (const SHVec3& rgb)                           noexcept;
     SHColour  (const SHVec4& rgba)                          noexcept;
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp b/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
index e1acccd9..bdee8ba1 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
@@ -17,10 +17,12 @@
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "ECS_Base/Managers/SHEntityManager.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
+#include "Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h"
 #include "Math/SHMathHelpers.h"
 #include "Math/Transform/SHTransformComponent.h"
 #include "Scene/SHSceneManager.h"
 #include "Scripting/SHScriptEngine.h"
+#include "Tools/SHUtilities.h"
 
 namespace SHADE
 {
@@ -30,6 +32,7 @@ namespace SHADE
 
   SHPhysicsSystem::SHPhysicsSystem()
   : worldUpdated        { false }
+  , debugDrawFlags      { 0 }
   , interpolationFactor { 0.0 }
   , fixedDT             { 60.0 }
   , world               { nullptr }
@@ -47,6 +50,11 @@ namespace SHADE
   : SHSystemRoutine { "Physics PostUpdate", false }
   {}
 
+  SHPhysicsSystem::PhysicsDebugDraw::PhysicsDebugDraw()
+  : SHSystemRoutine { "Physics DebugDraw", true }
+  {}
+
+
   /*-----------------------------------------------------------------------------------*/
   /* Getter Function Definitions                                                       */
   /*-----------------------------------------------------------------------------------*/
@@ -99,6 +107,31 @@ namespace SHADE
     return 0;
   }
 
+  bool SHPhysicsSystem::GetDrawColliders() const noexcept
+  {
+    return debugDrawFlags & SHUtilities::ConvertEnum(DebugDrawFlags::COLLIDER);
+  }
+
+  bool SHPhysicsSystem::GetDrawColliderAABBs() const noexcept
+  {
+    return debugDrawFlags & SHUtilities::ConvertEnum(DebugDrawFlags::COLLIDER_AABB);
+  }
+
+  bool SHPhysicsSystem::GetDrawBroadPhase() const noexcept
+  {
+    return debugDrawFlags & SHUtilities::ConvertEnum(DebugDrawFlags::BROAD_PHASE_AABB);
+  }
+
+  bool SHPhysicsSystem::GetDrawContactPoints() const noexcept
+  {
+    return debugDrawFlags & SHUtilities::ConvertEnum(DebugDrawFlags::CONTACT_POINTS);
+  }
+
+  bool SHPhysicsSystem::GetDrawContactNormals() const noexcept
+  {
+    return debugDrawFlags & SHUtilities::ConvertEnum(DebugDrawFlags::CONTACT_NORMALS);
+  }
+
   const SHPhysicsSystem::CollisionEvents& SHPhysicsSystem::GetCollisionInfo() const noexcept
   {
     return collisionInfo;
@@ -181,6 +214,96 @@ namespace SHADE
     }
   }
 
+  void SHPhysicsSystem::SetDrawColliders(bool shouldDraw) noexcept
+  {
+    static constexpr auto FLAG_VALUE = SHUtilities::ConvertEnum(DebugDrawFlags::COLLIDER);
+    shouldDraw ? debugDrawFlags |= FLAG_VALUE : debugDrawFlags &= ~(FLAG_VALUE);
+
+    if (world == nullptr)
+    {
+      SHLOGV_WARNING("No physics world has been initialised!")
+      return;
+    }
+
+    world->getDebugRenderer().setIsDebugItemDisplayed
+    (
+      rp3d::DebugRenderer::DebugItem::COLLISION_SHAPE,
+      shouldDraw
+    );
+  }
+
+  void SHPhysicsSystem::SetDrawColliderAABBs(bool shouldDraw) noexcept
+  {
+    static constexpr auto FLAG_VALUE = SHUtilities::ConvertEnum(DebugDrawFlags::COLLIDER_AABB);
+    shouldDraw ? debugDrawFlags |= FLAG_VALUE : debugDrawFlags &= ~(FLAG_VALUE);
+
+    if (world == nullptr)
+    {
+      SHLOGV_WARNING("No physics world has been initialised!")
+      return;
+    }
+
+    world->getDebugRenderer().setIsDebugItemDisplayed
+    (
+      rp3d::DebugRenderer::DebugItem::COLLIDER_AABB,
+      shouldDraw
+    );
+  }
+
+  void SHPhysicsSystem::SetDrawBroadPhase(bool shouldDraw) noexcept
+  {
+    static constexpr auto FLAG_VALUE = SHUtilities::ConvertEnum(DebugDrawFlags::BROAD_PHASE_AABB);
+    shouldDraw ? debugDrawFlags |= FLAG_VALUE : debugDrawFlags &= ~(FLAG_VALUE);
+
+    if (world == nullptr)
+    {
+      SHLOGV_WARNING("No physics world has been initialised!")
+      return;
+    }
+
+    world->getDebugRenderer().setIsDebugItemDisplayed
+    (
+      rp3d::DebugRenderer::DebugItem::COLLIDER_BROADPHASE_AABB,
+      shouldDraw
+    );
+  }
+
+  void SHPhysicsSystem::SetDrawContactPoints(bool shouldDraw) noexcept
+  {
+    static constexpr auto FLAG_VALUE = SHUtilities::ConvertEnum(DebugDrawFlags::CONTACT_POINTS);
+    shouldDraw ? debugDrawFlags |= FLAG_VALUE : debugDrawFlags &= ~(FLAG_VALUE);
+
+    if (world == nullptr)
+    {
+      SHLOGV_WARNING("No physics world has been initialised!")
+      return;
+    }
+
+    world->getDebugRenderer().setIsDebugItemDisplayed
+    (
+      rp3d::DebugRenderer::DebugItem::CONTACT_POINT,
+      shouldDraw
+    );
+  }
+
+  void SHPhysicsSystem::SetDrawContactNormals(bool shouldDraw) noexcept
+  {
+    static constexpr auto FLAG_VALUE = SHUtilities::ConvertEnum(DebugDrawFlags::CONTACT_NORMALS);
+    shouldDraw ? debugDrawFlags |= FLAG_VALUE : debugDrawFlags &= ~(FLAG_VALUE);
+
+    if (world == nullptr)
+    {
+      SHLOGV_WARNING("No physics world has been initialised!")
+      return;
+    }
+
+    world->getDebugRenderer().setIsDebugItemDisplayed
+    (
+      rp3d::DebugRenderer::DebugItem::CONTACT_NORMAL,
+      shouldDraw
+    );
+  }
+
   /*-----------------------------------------------------------------------------------*/
   /* Public Function Member Definitions                                                */
   /*-----------------------------------------------------------------------------------*/
@@ -198,6 +321,7 @@ namespace SHADE
     
     world = factory.createPhysicsWorld(settings);
     world->setEventListener(this);
+    world->setIsDebugRenderingEnabled(true);
 
     // Set up solvers
     world->setContactsPositionCorrectionTechnique(rp3d::ContactsPositionCorrectionTechnique::SPLIT_IMPULSES);
@@ -323,7 +447,7 @@ namespace SHADE
     auto* scriptingSystem = SHSystemManager::GetSystem<SHScriptEngine>();
     if (scriptingSystem == nullptr)
     {
-        SHLOGV_WARNING("Unable to invoke FixedUpdate() on scripts due to missing SHScriptEngine!");
+        SHLOGV_ERROR("Unable to invoke FixedUpdate() on scripts due to missing SHScriptEngine!");
     }
 
     fixedTimeStep = 1.0 / physicsSystem->fixedDT;
@@ -353,7 +477,7 @@ namespace SHADE
     auto* scriptingSystem = SHSystemManager::GetSystem<SHScriptEngine>();
     if (scriptingSystem == nullptr)
     {
-        SHLOGV_WARNING("Unable to invoke collision and trigger script events due to missing SHScriptEngine!");
+        SHLOGV_ERROR("Unable to invoke collision and trigger script events due to missing SHScriptEngine!");
     }
 
     // Interpolate transforms for rendering
@@ -369,6 +493,40 @@ namespace SHADE
     }
   }
 
+  void SHPhysicsSystem::PhysicsDebugDraw::Execute(double) noexcept
+  {
+    const auto* PHYSICS_SYSTEM = reinterpret_cast<SHPhysicsSystem*>(GetSystem());
+    if (PHYSICS_SYSTEM->debugDrawFlags == 0)
+      return;
+
+    auto* debugDrawSystem = SHSystemManager::GetSystem<SHDebugDrawSystem>();
+    if (debugDrawSystem == nullptr)
+    {
+      SHLOGV_ERROR("Unable to debug draw physics objects due to missing SHDebugDrawSystem!");
+      return;
+    }
+
+    const auto& RP3D_DEBUG_RENDERER = PHYSICS_SYSTEM->world->getDebugRenderer();
+
+    const auto& LINES = RP3D_DEBUG_RENDERER.getLines();
+    const auto& TRIANGLES = RP3D_DEBUG_RENDERER.getTriangles();
+
+    // Draw all lines
+    for (uint32_t i = 0; i < RP3D_DEBUG_RENDERER.getNbLines(); ++i)
+    {
+      const auto& LINE = LINES[i];
+      debugDrawSystem->DrawLine(SHColour{ LINE.color1 }, LINE.point1, LINE.point2);
+    }
+
+    for (uint32_t i = 0; i < RP3D_DEBUG_RENDERER.getNbTriangles(); ++i)
+    {
+      const auto& TRIANGLE = TRIANGLES[i];
+      SHColour triColour{ TRIANGLE.color1 };
+      triColour.a() = 1.0f;
+      debugDrawSystem->DrawTri(triColour, TRIANGLE.point1, TRIANGLE.point2, TRIANGLE.point3);
+    }
+  }
+
   void SHPhysicsSystem::onContact(const CallbackData& callbackData)
   {
     for (uint32_t i = 0; i < callbackData.getNbContactPairs(); ++i)
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystem.h b/SHADE_Engine/src/Physics/SHPhysicsSystem.h
index 1d773618..05e6e57e 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsSystem.h
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystem.h
@@ -51,6 +51,15 @@ namespace SHADE
 
     using CollisionEvents = std::vector<SHCollisionEvent>;
 
+    enum class DebugDrawFlags : uint8_t
+    {
+      COLLIDER          = 1
+    , COLLIDER_AABB     = 2
+    , BROAD_PHASE_AABB  = 4
+    , CONTACT_POINTS    = 8
+    , CONTACT_NORMALS   = 16
+    };
+
     /*---------------------------------------------------------------------------------*/
     /* Constructors & Destructor                                                       */
     /*---------------------------------------------------------------------------------*/
@@ -69,6 +78,12 @@ namespace SHADE
     [[nodiscard]] uint16_t  GetNumberVelocityIterations   ()  const noexcept;
     [[nodiscard]] uint16_t  GetNumberPositionIterations   ()  const noexcept;
 
+    [[nodiscard]] bool      GetDrawColliders              ()  const noexcept;
+    [[nodiscard]] bool      GetDrawColliderAABBs          ()  const noexcept;
+    [[nodiscard]] bool      GetDrawBroadPhase             ()  const noexcept;
+    [[nodiscard]] bool      GetDrawContactPoints          ()  const noexcept;
+    [[nodiscard]] bool      GetDrawContactNormals         ()  const noexcept;
+
     [[nodiscard]] const CollisionEvents& GetCollisionInfo ()  const noexcept;
     [[nodiscard]] const CollisionEvents& GetTriggerInfo   ()  const noexcept;
     
@@ -85,6 +100,13 @@ namespace SHADE
 
     void  SetWorldSettings            (const WorldSettings& settings) const noexcept;
 
+    // TODO(Diren): Can the debug draw flags be done through an enum?
+    void  SetDrawColliders            (bool shouldDraw)               noexcept;
+    void  SetDrawColliderAABBs        (bool shouldDraw)               noexcept;
+    void  SetDrawBroadPhase           (bool shouldDraw)               noexcept;
+    void  SetDrawContactPoints        (bool shouldDraw)               noexcept;
+    void  SetDrawContactNormals       (bool shouldDraw)               noexcept;
+
     /*---------------------------------------------------------------------------------*/
     /* Function Members                                                                */
     /*---------------------------------------------------------------------------------*/
@@ -105,48 +127,31 @@ namespace SHADE
     class SH_API PhysicsPreUpdate final : public SHSystemRoutine
     {
     public:
-      /*-------------------------------------------------------------------------------*/
-      /* Constructors & Destructor                                                     */
-      /*-------------------------------------------------------------------------------*/
 
       PhysicsPreUpdate();
-
-      /*-------------------------------------------------------------------------------*/
-      /* Function Members                                                              */
-      /*-------------------------------------------------------------------------------*/
-
       void Execute(double dt) noexcept override;
     };
 
     class SH_API PhysicsFixedUpdate final : public SHFixedSystemRoutine
     {
     public:
-      /*-------------------------------------------------------------------------------*/
-      /* Constructors & Destructor                                                     */
-      /*-------------------------------------------------------------------------------*/
 
       PhysicsFixedUpdate();
-
-      /*-------------------------------------------------------------------------------*/
-      /* Function Members                                                              */
-      /*-------------------------------------------------------------------------------*/
-
       void Execute      (double dt) noexcept override;
     };
 
     class SH_API PhysicsPostUpdate final : public SHSystemRoutine
     {
     public:
-      /*-------------------------------------------------------------------------------*/
-      /* Constructors & Destructor                                                     */
-      /*-------------------------------------------------------------------------------*/
 
       PhysicsPostUpdate();
+      void Execute(double dt) noexcept override;
+    };
 
-      /*-------------------------------------------------------------------------------*/
-      /* Function Members                                                              */
-      /*-------------------------------------------------------------------------------*/
-
+    class SH_API PhysicsDebugDraw final : public SHSystemRoutine
+    {
+    public:
+      PhysicsDebugDraw();
       void Execute(double dt) noexcept override;
     };
 
@@ -162,6 +167,7 @@ namespace SHADE
     /*---------------------------------------------------------------------------------*/
 
     bool                  worldUpdated;
+    uint8_t               debugDrawFlags;
 
     double                interpolationFactor;
     double                fixedDT;
diff --git a/SHADE_Engine/src/Tools/SHUtilities.h b/SHADE_Engine/src/Tools/SHUtilities.h
index b3d840e7..287a827e 100644
--- a/SHADE_Engine/src/Tools/SHUtilities.h
+++ b/SHADE_Engine/src/Tools/SHUtilities.h
@@ -39,7 +39,7 @@ namespace SHADE
      * @param[in] enumClassMember   A member of the specified enum class.
      * @returns   The value of the enum class member in the output type.
     */
-    template <IsEnum InputType, IsIntegral OutputType = int>
+    template <IsEnum InputType, IsIntegral OutputType = std::underlying_type_t<InputType>>
     static constexpr OutputType ConvertEnum(InputType enumClassMember) noexcept;
 
     /**

From 27526dfd92dfa820f2eb72d7afac3f0fb6496e2f Mon Sep 17 00:00:00 2001
From: Diren D Bharwani <diren.bharwani@gmail.com>
Date: Wed, 2 Nov 2022 16:12:47 +0800
Subject: [PATCH 26/27] Fixed relative size for sphere colliders

---
 .../Editor/EditorWindow/Inspector/SHEditorComponentView.hpp   | 4 ++--
 SHADE_Engine/src/Physics/SHCollider.cpp                       | 2 +-
 2 files changed, 3 insertions(+), 3 deletions(-)

diff --git a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
index 6f03a55e..20615fdc 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
@@ -265,9 +265,9 @@ namespace SHADE
             {
               const SHVec3& TF_WORLD_SCALE = transformComponent->GetWorldScale();
               const float MAX_SCALE = SHMath::Max({ TF_WORLD_SCALE.x, TF_WORLD_SCALE.y, TF_WORLD_SCALE.z });
-              return sphere->GetRadius() / MAX_SCALE;
+              return (sphere->GetRadius() / MAX_SCALE) * 2.0f;
             },
-              [collider](float const& value) { collider->SetBoundingSphere(value); });
+            [collider](float const& value) { collider->SetBoundingSphere(value); });
         }
         else if (collider->GetType() == SHCollider::Type::CAPSULE)
         {
diff --git a/SHADE_Engine/src/Physics/SHCollider.cpp b/SHADE_Engine/src/Physics/SHCollider.cpp
index 6cea3dc1..6d455d67 100644
--- a/SHADE_Engine/src/Physics/SHCollider.cpp
+++ b/SHADE_Engine/src/Physics/SHCollider.cpp
@@ -212,7 +212,7 @@ namespace SHADE
       const SHVec3 TF_WORLD_SCALE = transformComponent->GetWorldScale();
       const float MAX_SCALE       = SHMath::Max({ TF_WORLD_SCALE.x, TF_WORLD_SCALE.y, TF_WORLD_SCALE.z });
 
-      worldRadius *= MAX_SCALE;
+      worldRadius *= MAX_SCALE * 0.5f;
     }
 
     if (type == Type::SPHERE)

From ebc94225e76f1c0ff29b042f90c2342a52ac32c9 Mon Sep 17 00:00:00 2001
From: Brandon Mak <xenosas@hotmail.com>
Date: Wed, 2 Nov 2022 17:04:31 +0800
Subject: [PATCH 27/27] Merge remote-tracking branch 'origin/main' into
 SP3-1-Rendering

---
 Assets/Shaders/DebugDraw_FS.glsl              |   17 +
 Assets/Shaders/DebugDraw_FS.shshaderb         |  Bin 0 -> 673 bytes
 Assets/Shaders/DebugDraw_FS.shshaderb.shmeta  |    3 +
 Assets/Shaders/DebugDraw_VS.glsl              |   24 +
 Assets/Shaders/DebugDraw_VS.shshaderb         |  Bin 0 -> 1513 bytes
 Assets/Shaders/DebugDraw_VS.shshaderb.shmeta  |    3 +
 Assets/Shaders/DeferredComposite_CS.shshaderb |  Bin 5501 -> 5501 bytes
 .../DeferredComposite_CS.shshaderb.shmeta     |    2 +-
 Assets/Shaders/Kirsch_CS.shshaderb            |  Bin 5909 -> 5909 bytes
 Assets/Shaders/PureCopy_CS.shshaderb          |  Bin 1273 -> 1273 bytes
 Assets/Shaders/SSAOBlur_CS.shshaderb          |  Bin 4669 -> 4669 bytes
 Assets/Shaders/SSAO_CS.shshaderb              |  Bin 6125 -> 6125 bytes
 Assets/Shaders/TestCube_FS.shshaderb          |  Bin 2545 -> 2545 bytes
 Assets/Shaders/TestCube_FS.shshaderb.shmeta   |    2 +-
 Assets/Shaders/TestCube_VS.shshaderb          |  Bin 3689 -> 3689 bytes
 Assets/Shaders/TestCube_VS.shshaderb.shmeta   |    2 +-
 .../src/Application/SBApplication.cpp         |   16 +-
 SHADE_Application/src/Scenes/SBTestScene.cpp  |    8 +-
 SHADE_Engine/premake5.lua                     |    2 +-
 .../src/Assets/Asset Types/SHShaderAsset.h    |   11 +-
 .../Compilers/SHShaderSourceCompiler.cpp      |  201 +-
 .../Libraries/Loaders/SHTextBasedLoader.h     |    4 +
 SHADE_Engine/src/Assets/SHAssetMacros.h       |    9 +-
 SHADE_Engine/src/Assets/SHAssetManager.cpp    |    6 +
 .../src/Camera/SHCameraArmComponent.cpp       |   68 +
 .../src/Camera/SHCameraArmComponent.h         |   44 +
 SHADE_Engine/src/Camera/SHCameraComponent.cpp |    2 +-
 SHADE_Engine/src/Camera/SHCameraComponent.h   |    4 +-
 SHADE_Engine/src/Camera/SHCameraDirector.cpp  |    2 +
 SHADE_Engine/src/Camera/SHCameraDirector.h    |    3 +-
 SHADE_Engine/src/Camera/SHCameraSystem.cpp    |  168 +-
 SHADE_Engine/src/Camera/SHCameraSystem.h      |   20 +-
 .../ECS_Base/Managers/SHComponentManager.cpp  |   13 +
 .../src/ECS_Base/Managers/SHEntityManager.cpp |   11 +-
 .../src/ECS_Base/Managers/SHEntityManager.h   |    2 +
 .../src/ECS_Base/Managers/SHSystemManager.cpp |    2 +-
 .../src/Editor/DragDrop/SHDragDrop.hpp        |    6 +-
 .../AssetBrowser/SHAssetBrowser.cpp           |  160 +-
 .../AssetBrowser/SHAssetBrowser.h             |   13 +-
 .../HierarchyPanel/SHHierarchyPanel.cpp       |  190 +-
 .../HierarchyPanel/SHHierarchyPanel.h         |    6 +-
 .../Inspector/SHEditorComponentView.h         |   12 +
 .../Inspector/SHEditorComponentView.hpp       |  159 +-
 .../Inspector/SHEditorInspector.cpp           |   39 +-
 .../EditorWindow/MenuBar/SHEditorMenuBar.cpp  |   20 +-
 .../EditorWindow/MenuBar/SHEditorMenuBar.h    |    6 +
 .../ViewportWindow/SHEditorViewport.cpp       |   89 +-
 .../ViewportWindow/SHEditorViewport.h         |    3 +-
 .../src/Editor/Gizmos/SHTransformGizmo.cpp    |    5 +-
 SHADE_Engine/src/Editor/SHEditor.cpp          |    6 +-
 .../src/Editor/{SHEditor.hpp => SHEditor.h}   |    4 +-
 SHADE_Engine/src/Editor/SHEditorUI.cpp        |   46 +-
 SHADE_Engine/src/Editor/SHEditorUI.h          |    8 +
 SHADE_Engine/src/Editor/SHEditorWidgets.hpp   |  122 +-
 SHADE_Engine/src/Events/SHEventDefines.h      |    3 +
 .../Graphics/Commands/SHVkCommandBuffer.cpp   |    5 +
 .../src/Graphics/Commands/SHVkCommandBuffer.h |    1 +
 .../Graphics/MiddleEnd/Batching/SHBatch.cpp   |   11 +-
 .../MiddleEnd/Batching/SHSuperBatch.cpp       |    6 +-
 .../MiddleEnd/Interface/SHDebugDrawSystem.cpp |  202 +
 .../MiddleEnd/Interface/SHDebugDrawSystem.h   |  159 +
 .../MiddleEnd/Interface/SHDebugDrawSystem.hpp |   48 +
 .../MiddleEnd/Interface/SHGraphicsSystem.cpp  |  111 +-
 .../MiddleEnd/Interface/SHGraphicsSystem.h    |   32 +-
 .../Interface/SHGraphicsSystemInterface.cpp   |   77 +
 .../Interface/SHGraphicsSystemInterface.h     |   52 +
 .../MiddleEnd/Materials/SHMaterialSpec.h      |   36 +
 .../MiddleEnd/Meshes/SHPrimitiveGenerator.cpp |  165 +-
 .../MiddleEnd/Meshes/SHPrimitiveGenerator.h   |   65 +-
 .../Shaders/SHShaderModuleLibrary.cpp         |  139 -
 .../MiddleEnd/Shaders/SHShaderModuleLibrary.h |   44 -
 .../src/Graphics/Pipeline/SHVkPipeline.h      |    3 +-
 .../src/Graphics/Windowing/SHWindow.cpp       |   41 +-
 .../src/Graphics/Windowing/SHWindow.h         |    9 +-
 SHADE_Engine/src/Math/SHColour.cpp            |  172 +-
 SHADE_Engine/src/Math/SHColour.h              |   50 +-
 SHADE_Engine/src/Math/SHMath.h                |    2 +
 .../Math/Transform/SHTransformComponent.cpp   |    7 +-
 .../src/Math/Transform/SHTransformSystem.cpp  |    6 +-
 SHADE_Engine/src/Math/Vector/SHVec4.cpp       |    1 +
 SHADE_Engine/src/Math/Vector/SHVec4.h         |    2 +
 .../Components/SHColliderComponent.cpp        |   10 +-
 .../Physics/Components/SHColliderComponent.h  |    1 +
 .../Components/SHRigidBodyComponent.cpp       |  317 +-
 .../Physics/Components/SHRigidBodyComponent.h |   31 +-
 SHADE_Engine/src/Physics/SHCollider.cpp       |   15 +-
 SHADE_Engine/src/Physics/SHCollider.h         |    5 +-
 SHADE_Engine/src/Physics/SHPhysicsObject.cpp  |  106 +-
 SHADE_Engine/src/Physics/SHPhysicsObject.h    |    1 -
 SHADE_Engine/src/Physics/SHPhysicsSystem.cpp  |  276 +-
 SHADE_Engine/src/Physics/SHPhysicsSystem.h    |   91 +-
 SHADE_Engine/src/Physics/SHPhysicsSystem.hpp  |   84 +
 .../src/Physics/SHPhysicsSystemInterface.cpp  |   65 +
 .../src/Physics/SHPhysicsSystemInterface.h    |   46 +
 SHADE_Engine/src/Physics/SHPhysicsUtils.cpp   |   93 +
 SHADE_Engine/src/Physics/SHPhysicsUtils.h     |  116 +
 .../src/Reflection/SHReflectionMetadata.h     |    1 +
 .../src/Resource/SHResourceManager.cpp        |   17 +-
 SHADE_Engine/src/Resource/SHResourceManager.h |   31 +-
 .../src/Resource/SHResourceManager.hpp        |  206 +-
 SHADE_Engine/src/Scripting/SHScriptEngine.cpp |   11 +-
 SHADE_Engine/src/Scripting/SHScriptEngine.h   |    6 +
 .../src/Scripting/SHScriptEngineRoutines.cpp  |    2 +-
 .../Serialization/Prefab/SHPrefabManager.cpp  |   56 +
 .../Serialization/Prefab/SHPrefabManager.h    |   28 +
 .../src/Serialization/SHSerialization.cpp     |  107 +-
 .../Serialization/SHSerializationHelper.hpp   |  432 +-
 SHADE_Engine/src/Tools/Dialog/SHWinDialog.cpp |   71 +
 SHADE_Engine/src/Tools/Dialog/SHWinDialog.h   |   36 +
 SHADE_Engine/src/Tools/SHDebugDraw.cpp        |   73 +
 SHADE_Engine/src/Tools/SHDebugDraw.h          |  101 +
 SHADE_Engine/src/Tools/SHLog.h                |    2 +-
 SHADE_Managed/premake5.lua                    |   10 +-
 SHADE_Managed/src/Components/Camera.cxx       |  127 +
 SHADE_Managed/src/Components/Camera.hxx       |   70 +
 SHADE_Managed/src/Components/CameraArm.cxx    |   51 +
 SHADE_Managed/src/Components/CameraArm.hxx    |   40 +
 SHADE_Managed/src/Components/Component.cxx    |    5 +
 SHADE_Managed/src/Components/Component.hxx    |    9 +
 SHADE_Managed/src/Components/RigidBody.cxx    |    8 +
 SHADE_Managed/src/Components/RigidBody.hxx    |    5 +
 SHADE_Managed/src/Components/Transform.cxx    |   26 -
 SHADE_Managed/src/Components/Transform.hxx    |   24 -
 SHADE_Managed/src/Editor/Editor.cxx           |   15 +-
 SHADE_Managed/src/Engine/Application.cxx      |   71 +
 SHADE_Managed/src/Engine/Application.hxx      |   77 +
 SHADE_Managed/src/Engine/ECS.cxx              |    4 +
 SHADE_Managed/src/Engine/GameObject.cxx       |   50 +-
 SHADE_Managed/src/Engine/GameObject.hxx       |   19 +-
 SHADE_Managed/src/Engine/Time.cxx             |   13 +
 SHADE_Managed/src/Engine/Time.hxx             |   23 +-
 SHADE_Managed/src/Input/Input.cxx             |    7 +
 SHADE_Managed/src/Input/Input.hxx             |  154 +-
 SHADE_Managed/src/Math/Vector2.cxx            |   16 +
 SHADE_Managed/src/Math/Vector2.hxx            |   16 +
 SHADE_Managed/src/Math/Vector3.cxx            |   18 +
 SHADE_Managed/src/Math/Vector3.hxx            |   16 +
 SHADE_Managed/src/Physics/CollisionInfo.cxx   |   36 +
 SHADE_Managed/src/Physics/CollisionInfo.hxx   |   66 +
 SHADE_Managed/src/Scripts/Script.cxx          |   81 +-
 SHADE_Managed/src/Scripts/Script.hxx          |   92 +-
 SHADE_Managed/src/Scripts/ScriptStore.cxx     |  132 +-
 SHADE_Managed/src/Scripts/ScriptStore.hxx     |    4 +
 .../src/Serialisation/ReflectionUtilities.cxx |   10 +
 TempScriptsFolder/CameraControl.cs            |   22 +
 TempScriptsFolder/PhysicsTest.cs              |   31 +-
 TempScriptsFolder/PrintWhenActive.cs          |   11 +
 TempScriptsFolder/ThirdPersonCamera.cs        |   55 +
 TempShaderFolder/DeferredCompositeCs.glsl     |   83 -
 TempShaderFolder/DeferredCompositeCs.spv      |  Bin 4656 -> 0 bytes
 TempShaderFolder/TestCubeFs.spv               |  Bin 2536 -> 0 bytes
 TempShaderFolder/TestCubeVs.spv               |  Bin 3296 -> 0 bytes
 bin/Debug/SHADE_CSharp.xml                    | 1029 +++
 bin/Debug/SHADE_Managed.xml                   | 6250 +++++++++++++++++
 bin/Release/SHADE_CSharp.xml                  | 1029 +++
 bin/Release/SHADE_Managed.xml                 | 6250 +++++++++++++++++
 156 files changed, 20008 insertions(+), 1476 deletions(-)
 create mode 100644 Assets/Shaders/DebugDraw_FS.glsl
 create mode 100644 Assets/Shaders/DebugDraw_FS.shshaderb
 create mode 100644 Assets/Shaders/DebugDraw_FS.shshaderb.shmeta
 create mode 100644 Assets/Shaders/DebugDraw_VS.glsl
 create mode 100644 Assets/Shaders/DebugDraw_VS.shshaderb
 create mode 100644 Assets/Shaders/DebugDraw_VS.shshaderb.shmeta
 create mode 100644 SHADE_Engine/src/Camera/SHCameraArmComponent.cpp
 create mode 100644 SHADE_Engine/src/Camera/SHCameraArmComponent.h
 create mode 100644 SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.h
 rename SHADE_Engine/src/Editor/{SHEditor.hpp => SHEditor.h} (98%)
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.cpp
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.h
 create mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Materials/SHMaterialSpec.h
 delete mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.cpp
 delete mode 100644 SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.h
 create mode 100644 SHADE_Engine/src/Physics/SHPhysicsSystem.hpp
 create mode 100644 SHADE_Engine/src/Physics/SHPhysicsSystemInterface.cpp
 create mode 100644 SHADE_Engine/src/Physics/SHPhysicsSystemInterface.h
 create mode 100644 SHADE_Engine/src/Physics/SHPhysicsUtils.cpp
 create mode 100644 SHADE_Engine/src/Physics/SHPhysicsUtils.h
 create mode 100644 SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.cpp
 create mode 100644 SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.h
 create mode 100644 SHADE_Engine/src/Tools/Dialog/SHWinDialog.cpp
 create mode 100644 SHADE_Engine/src/Tools/Dialog/SHWinDialog.h
 create mode 100644 SHADE_Engine/src/Tools/SHDebugDraw.cpp
 create mode 100644 SHADE_Engine/src/Tools/SHDebugDraw.h
 create mode 100644 SHADE_Managed/src/Components/Camera.cxx
 create mode 100644 SHADE_Managed/src/Components/Camera.hxx
 create mode 100644 SHADE_Managed/src/Components/CameraArm.cxx
 create mode 100644 SHADE_Managed/src/Components/CameraArm.hxx
 create mode 100644 SHADE_Managed/src/Engine/Application.cxx
 create mode 100644 SHADE_Managed/src/Engine/Application.hxx
 create mode 100644 SHADE_Managed/src/Physics/CollisionInfo.cxx
 create mode 100644 SHADE_Managed/src/Physics/CollisionInfo.hxx
 create mode 100644 TempScriptsFolder/CameraControl.cs
 create mode 100644 TempScriptsFolder/PrintWhenActive.cs
 create mode 100644 TempScriptsFolder/ThirdPersonCamera.cs
 delete mode 100644 TempShaderFolder/DeferredCompositeCs.glsl
 delete mode 100644 TempShaderFolder/DeferredCompositeCs.spv
 delete mode 100644 TempShaderFolder/TestCubeFs.spv
 delete mode 100644 TempShaderFolder/TestCubeVs.spv
 create mode 100644 bin/Debug/SHADE_CSharp.xml
 create mode 100644 bin/Debug/SHADE_Managed.xml
 create mode 100644 bin/Release/SHADE_CSharp.xml
 create mode 100644 bin/Release/SHADE_Managed.xml

diff --git a/Assets/Shaders/DebugDraw_FS.glsl b/Assets/Shaders/DebugDraw_FS.glsl
new file mode 100644
index 00000000..266f8ad4
--- /dev/null
+++ b/Assets/Shaders/DebugDraw_FS.glsl
@@ -0,0 +1,17 @@
+#version 450
+#extension GL_ARB_separate_shader_objects : enable
+#extension GL_ARB_shading_language_420pack : enable
+#extension GL_EXT_nonuniform_qualifier : require
+
+layout(location = 0) in struct
+{
+  vec4 vertColor;
+} In;
+
+
+layout(location = 0) out vec4 outColor;
+
+void main()
+{
+  outColor = In.vertColor;
+}
\ No newline at end of file
diff --git a/Assets/Shaders/DebugDraw_FS.shshaderb b/Assets/Shaders/DebugDraw_FS.shshaderb
new file mode 100644
index 0000000000000000000000000000000000000000..7b59688597046295970cf20f6afdc8f52cb72e81
GIT binary patch
literal 673
zcmY*W%Sr=55Nz`{F)u~Eg@{KX1c@SuLX@xw3jy`uZCH~@9Np}$`v~|aeve<}MX+kK
zkvP!PQ`OboGd-=(oTMwCJ1&cCNmc5yyP~8mIWQtMDW%@BAM9QfPkV#2J|zvwr%Gy?
zQkDWdZQ&S?fo<3htOXr;G{7m3sv=)VDnMb`YIuL6A{{uP6KfT{I8z-e|M^u<;^@By
zA>+-J>v;3TnQJvT?FY`}4RtE4GkSVdp6?}|nfc*Dy(f-qW=4mIR~fg)W6K_?Nf4+g
z{&2N&ji=Srgy>|Jn!VCGna+3<H<@k<icoC6uPDXzjeZi}`mP`1Szz+$wpu03ZGB$q
z@J~by=W>TBS*XZ4b+Q~{#@2Wb)8f32(#c7BKESyIt_wSao^vJU-MZK-@cbF_ml<Xc
zavkiv6JylY;PDkHM=de?liLTb!*?@$lHmq07xSC&)Uw_=UeCMo9$f7A4W<Y`#7=Ds
Y#`>&r1ts&^F!I;P;5~_dQ1t@#3!m>%egFUf

literal 0
HcmV?d00001

diff --git a/Assets/Shaders/DebugDraw_FS.shshaderb.shmeta b/Assets/Shaders/DebugDraw_FS.shshaderb.shmeta
new file mode 100644
index 00000000..58f62b44
--- /dev/null
+++ b/Assets/Shaders/DebugDraw_FS.shshaderb.shmeta
@@ -0,0 +1,3 @@
+Name: DebugDraw_FS
+ID: 36671027
+Type: 2
diff --git a/Assets/Shaders/DebugDraw_VS.glsl b/Assets/Shaders/DebugDraw_VS.glsl
new file mode 100644
index 00000000..cb0886d1
--- /dev/null
+++ b/Assets/Shaders/DebugDraw_VS.glsl
@@ -0,0 +1,24 @@
+#version 450
+#extension GL_KHR_vulkan_glsl : enable
+
+layout(location = 0) in vec4 aVertexPos;
+layout(location = 1) in vec4 aVertColor;
+
+
+layout(location = 0) out struct
+{
+  vec4 vertColor; // location 0
+
+} Out;
+
+layout(set = 2, binding = 0) uniform CameraData
+{
+  vec4 position; 
+  mat4 vpMat;
+} cameraData;
+
+void main()
+{
+  gl_Position = cameraData.vpMat * vec4 (aVertexPos.xyz, 1.0f);
+  Out.vertColor = aVertColor;
+}
\ No newline at end of file
diff --git a/Assets/Shaders/DebugDraw_VS.shshaderb b/Assets/Shaders/DebugDraw_VS.shshaderb
new file mode 100644
index 0000000000000000000000000000000000000000..2d8cd0edd9ff60919d7c1931f06ee0ea6390bff0
GIT binary patch
literal 1513
zcmZ9L-)a*<6vn4XH?6I0t+jvD8k0t?S}0zq2%;jXY%d~dDR{dqn?(k;n~-dRdgUwl
zN<N8?;f>(;o82j)6VA>#-}&bJo5{kTz_?Yfb(V}-Fe_%w9F>sSG&Lc{teS?~!`?;j
zcv1|GU%q+)W!=;r6V8UY;q*m)FJqfytV!-l4kb?|b^U7Ef9t@aGKIY;?DxaorzjbX
zqDk>ROQX!@X*96oG%4&Xg||G%vw4zD2lIqLjQN~_YF$;1uUT}Kj=!YiBK;;)Xo;ia
z8%}Ithq=%t$EOE}+q}52Ka`m>rH`8B>t=RzVkbqMC+U@s3E-P%*_AI)pY+ZO^xM?l
zjW5%2d=eLNSqm6z<O`ABsJPTJ8-0!o?VR7zp3I#GW3F-8o_c{-H;;v}=+)~pO`to>
zhGXGyxQqU@kRG@@aWN{wsW4{8^1H{V35?xi%ms`YcnlqkI|=1Mhlk(y+>y;X6$^}*
zfwM~vHk@16Fg;L*5tnns4Hbj=99*;8vRU|<Rnu9e%?##k-X=DAw-lAQZRMaB^c`sp
z?Jdc!;!y`SJ#Oo}ti2^+9aT2}2IB3@UeOL8tSOC|_!#(*mUuU{`}w`CY~B$VdDb1T
zj7uKu4GC*cHuEAbbv5;6M%duQzpb5qz=@B|?7)1yJJP8e{&wZ_=l3cfF*%RTY~eGP
zd)n!fdWnbrKw`|#55((8!^ioiG~OsWz9-u8fe{<~u)=&U?ulHl^;)QzK3SamD}*=n
zQD5rbk<c6cyc3fib|v80<h?JU{=ROI+V?9AoJB73oGT{1@J8UUJoZpJ7+jCFDvYyd
z%0#ZVg!AxQ66W$taq%5Us0|MFGp9!q?w<R7uMV-{`P!dJXC9vaTsrged~7)XRM{KJ
Ee-OKJU;qFB

literal 0
HcmV?d00001

diff --git a/Assets/Shaders/DebugDraw_VS.shshaderb.shmeta b/Assets/Shaders/DebugDraw_VS.shshaderb.shmeta
new file mode 100644
index 00000000..ab840f4c
--- /dev/null
+++ b/Assets/Shaders/DebugDraw_VS.shshaderb.shmeta
@@ -0,0 +1,3 @@
+Name: DebugDraw_VS
+ID: 48002439
+Type: 2
diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb b/Assets/Shaders/DeferredComposite_CS.shshaderb
index 6e0ff2a40f9907e1126db4f89f94de2523310b2a..172a6a326df3db7eafd630f72351b4b969d9aa0b 100644
GIT binary patch
delta 10
RcmeyX^;e5gVIyOWC;%Al1G4}C

delta 10
RcmeyX^;e6LX(MBeC;%8(1C;;(

diff --git a/Assets/Shaders/DeferredComposite_CS.shshaderb.shmeta b/Assets/Shaders/DeferredComposite_CS.shshaderb.shmeta
index 8f18b04a..62c2a3fe 100644
--- a/Assets/Shaders/DeferredComposite_CS.shshaderb.shmeta
+++ b/Assets/Shaders/DeferredComposite_CS.shshaderb.shmeta
@@ -1,3 +1,3 @@
 Name: DeferredComposite_CS
-ID: 42814284
+ID: 45072428
 Type: 2
diff --git a/Assets/Shaders/Kirsch_CS.shshaderb b/Assets/Shaders/Kirsch_CS.shshaderb
index 6219d9a9c9a9e8ae16a498e700cba315f72f58b8..4c54946c91f269b181aa2869965af1861c3cd8c5 100644
GIT binary patch
delta 10
RcmbQLH&u^OVI!l6H~<k40)+qo

delta 10
RcmbQLH&u_3X(OYEH~<iO0%rgK

diff --git a/Assets/Shaders/PureCopy_CS.shshaderb b/Assets/Shaders/PureCopy_CS.shshaderb
index 9f1b0534b9e2c89fe180c1dc931e2f455964a012..30a629f5bcc0a56885e4bad78b8a2a3c41950982 100644
GIT binary patch
delta 10
Rcmey#`ID1TVI$)Y762E01JnQj

delta 10
Rcmey#`ID28X(Qtg762CK1GWGF

diff --git a/Assets/Shaders/SSAOBlur_CS.shshaderb b/Assets/Shaders/SSAOBlur_CS.shshaderb
index 680cb8d5f8bd787a251d73bf38d4d814202e13e0..e25b57ba66148d71b21d9766a534b9a78300ceda 100644
GIT binary patch
delta 10
Rcmdn1vR8#sVI!lB5C9X40^|Sy

delta 10
Rcmdn1vR8$XX(OYJ5C9VO0>%IU

diff --git a/Assets/Shaders/SSAO_CS.shshaderb b/Assets/Shaders/SSAO_CS.shshaderb
index 6bb4abcd8018cac584ecc8f8b59b86984eb528d7..69f7a44f1a9f7144e912c70a533a67027a7e737b 100644
GIT binary patch
delta 10
RcmaE>|5l$-VI$)kaR3<r1P=fJ

delta 10
RcmaE>|5l%oX(QtsaR3-<1MvU=

diff --git a/Assets/Shaders/TestCube_FS.shshaderb b/Assets/Shaders/TestCube_FS.shshaderb
index b0113dc7799a94fb1c40720187c05a9b26a2617c..95b4f62ae89c1bd3dc23f684757a7298c60833a3 100644
GIT binary patch
delta 10
Rcmew;{85-uU?bxPP5>7&1H}LU

delta 10
Rcmew;{85;ZaU<ggP5>6?1GWGF

diff --git a/Assets/Shaders/TestCube_FS.shshaderb.shmeta b/Assets/Shaders/TestCube_FS.shshaderb.shmeta
index 42f270af..fbe098b1 100644
--- a/Assets/Shaders/TestCube_FS.shshaderb.shmeta
+++ b/Assets/Shaders/TestCube_FS.shshaderb.shmeta
@@ -1,3 +1,3 @@
 Name: TestCube_FS
-ID: 37450402
+ID: 46377769
 Type: 2
diff --git a/Assets/Shaders/TestCube_VS.shshaderb b/Assets/Shaders/TestCube_VS.shshaderb
index fb2965a83900e01b2591230c1de83828ad72c658..fb282b4df95c458e637710753ab4b5beb88c23e2 100644
GIT binary patch
delta 10
RcmaDU^HPS9aU){}9{?5H12q5u

delta 10
RcmaDU^HPS9VIyM(9{?5C12g~t

diff --git a/Assets/Shaders/TestCube_VS.shshaderb.shmeta b/Assets/Shaders/TestCube_VS.shshaderb.shmeta
index b133437b..5c9f895f 100644
--- a/Assets/Shaders/TestCube_VS.shshaderb.shmeta
+++ b/Assets/Shaders/TestCube_VS.shshaderb.shmeta
@@ -1,3 +1,3 @@
 Name: TestCube_VS
-ID: 41688429
+ID: 39210065
 Type: 2
diff --git a/SHADE_Application/src/Application/SBApplication.cpp b/SHADE_Application/src/Application/SBApplication.cpp
index de548060..b865f028 100644
--- a/SHADE_Application/src/Application/SBApplication.cpp
+++ b/SHADE_Application/src/Application/SBApplication.cpp
@@ -4,7 +4,7 @@
 
 //#define SHEDITOR
 #ifdef SHEDITOR
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 //#include "Scenes/SBEditorScene.h"
 #endif // SHEDITOR
 
@@ -31,6 +31,7 @@
 #include "FRC/SHFramerateController.h"
 #include "AudioSystem/SHAudioSystem.h"
 #include "Camera/SHCameraSystem.h"
+#include "Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h"
 
 // Components
 #include "Graphics/MiddleEnd/Interface/SHRenderable.h"
@@ -42,6 +43,7 @@
 #include "Assets/SHAssetManager.h"
 
 #include "Tools/SHLogger.h"
+#include "Tools/SHDebugDraw.h"
 
 using namespace SHADE;
 
@@ -69,6 +71,7 @@ namespace Sandbox
     SHGraphicsSystem* graphicsSystem = static_cast<SHGraphicsSystem*>(SHSystemManager::GetSystem<SHGraphicsSystem>());
     SHSystemManager::CreateSystem<SHAudioSystem>();
     SHSystemManager::CreateSystem<SHCameraSystem>();
+    SHSystemManager::CreateSystem<SHDebugDrawSystem>();
     
 #ifdef SHEDITOR
     SDL_Init(SDL_INIT_VIDEO);
@@ -90,11 +93,12 @@ namespace Sandbox
     SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsPostUpdate>();
 
     SHSystemManager::RegisterRoutine<SHTransformSystem, SHTransformSystem::TransformPostPhysicsUpdate>();
+    SHSystemManager::RegisterRoutine<SHDebugDrawSystem, SHDebugDrawSystem::ProcessPointsRoutine>();
 
     SHSystemManager::RegisterRoutine<SHGraphicsSystem, SHGraphicsSystem::BatcherDispatcherRoutine>();
     SHSystemManager::RegisterRoutine<SHGraphicsSystem, SHGraphicsSystem::BeginRoutine>();
 
-    SHSystemManager::RegisterRoutine<SHCameraSystem, SHCameraSystem::EditorCameraUpdate>();
+    //SHSystemManager::RegisterRoutine<SHCameraSystem, SHCameraSystem::EditorCameraUpdate>();
     SHSystemManager::RegisterRoutine<SHCameraSystem, SHCameraSystem::CameraSystemUpdate>();
     
 #ifdef SHEDITOR
@@ -108,13 +112,10 @@ namespace Sandbox
     SHComponentManager::CreateComponentSparseSet<SHColliderComponent>();
     SHComponentManager::CreateComponentSparseSet<SHTransformComponent>();
     SHComponentManager::CreateComponentSparseSet<SHRenderable>();
-    SHComponentManager::CreateComponentSparseSet<SHCameraComponent>();
+    //SHComponentManager::CreateComponentSparseSet<SHCameraComponent>();
 
     SHAssetManager::Load();
 
-    auto id = SHFamilyID<SHSystem>::GetID<SHGraphicsSystem>();
-    auto id2 = SHFamilyID<SHSystem>::GetID<SHGraphicsSystem>();
-    auto id3 = SHFamilyID<SHSystem>::GetID<SHGraphicsSystem>();
     
     SHSystemManager::RegisterRoutine<SHAudioSystem, SHAudioSystem::AudioRoutine>();
 
@@ -126,6 +127,9 @@ namespace Sandbox
     SHSceneManager::InitSceneManager<SBTestScene>("TestScene");
     
     SHFrameRateController::UpdateFRC();
+
+    // Link up SHDebugDraw
+    SHDebugDraw::Init(SHSystemManager::GetSystem<SHDebugDrawSystem>());
   }
 
   void SBApplication::Update(void)
diff --git a/SHADE_Application/src/Scenes/SBTestScene.cpp b/SHADE_Application/src/Scenes/SBTestScene.cpp
index 23b57dfc..a5b3b546 100644
--- a/SHADE_Application/src/Scenes/SBTestScene.cpp
+++ b/SHADE_Application/src/Scenes/SBTestScene.cpp
@@ -16,7 +16,10 @@
 
 #include "Assets/SHAssetManager.h"
 #include "Camera/SHCameraComponent.h"
+#include "Math/SHColour.h"
 #include "Resource/SHResourceManager.h"
+#include "Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h"
+#include "Tools/SHDebugDraw.h"
 
 using namespace SHADE;
 
@@ -128,7 +131,6 @@ namespace Sandbox
     floorRigidBody.SetType(SHRigidBodyComponent::Type::STATIC);
 
     auto* floorBox = floorCollider.AddBoundingBox();
-    floorBox->SetHalfExtents(floorTransform.GetWorldScale() * 0.5f);
 
     // Create blank entity with a script
     //testObj = SHADE::SHEntityManager::CreateEntity<SHRenderable, SHTransformComponent>();
@@ -160,7 +162,7 @@ namespace Sandbox
     SHComponentManager::RemoveComponent <SHColliderComponent>(0);
 
     auto ambientLight = SHEntityManager::CreateEntity<SHLightComponent>();
-    SHComponentManager::GetComponent<SHLightComponent>(ambientLight)->SetColor(SHVec4(1.0f, 1.0f, 1.0f, 1.0f));
+    SHComponentManager::GetComponent<SHLightComponent>(ambientLight)->SetColor(SHColour::WHITE);
     SHComponentManager::GetComponent<SHLightComponent>(ambientLight)->SetStrength(0.25f);
     SHComponentManager::GetComponent<SHLightComponent>(ambientLight)->SetType(SH_LIGHT_TYPE::AMBIENT);
   }
@@ -187,6 +189,8 @@ namespace Sandbox
       SHADE::SHScriptEngine* scriptEngine = static_cast<SHADE::SHScriptEngine*>(SHADE::SHSystemManager::GetSystem<SHADE::SHScriptEngine>());
       scriptEngine->RemoveAllScripts(testObj);
     }
+
+    SHDebugDraw::Cube(SHColour::CRIMSON, SHVec3(1.0f, 0.0f, 0.0f), SHVec3(1.0f, 1.0f, 1.0f));
   }
 
   void SBTestScene::Render()
diff --git a/SHADE_Engine/premake5.lua b/SHADE_Engine/premake5.lua
index 18920194..bc1f6a03 100644
--- a/SHADE_Engine/premake5.lua
+++ b/SHADE_Engine/premake5.lua
@@ -8,7 +8,7 @@ project "SHADE_Engine"
   pchheader "SHpch.h"
   pchsource "%{prj.location}/src/SHpch.cpp"
   staticruntime "off"
-
+  buildoptions{"/bigobj"}
   files  
   {
     "%{prj.location}/src/**.h",
diff --git a/SHADE_Engine/src/Assets/Asset Types/SHShaderAsset.h b/SHADE_Engine/src/Assets/Asset Types/SHShaderAsset.h
index adcd215a..d71c1bb3 100644
--- a/SHADE_Engine/src/Assets/Asset Types/SHShaderAsset.h	
+++ b/SHADE_Engine/src/Assets/Asset Types/SHShaderAsset.h	
@@ -10,6 +10,7 @@
  *****************************************************************************/
 #pragma once
 
+#include <vulkan/vulkan.hpp>
 #include "SHAssetData.h"
 #include "SH_API.h"
 #include <vector>
@@ -17,12 +18,14 @@
 
 namespace SHADE
 {
+  //! Tighter control over types of shaders. Maps directly to their
+  //! equivalent vk::ShaderStageFlagBits.
   enum class SH_SHADER_TYPE : uint8_t
   {
-    VERTEX,
-    FRAGMENT,
-    COMPUTE,
-    INAVLID_TYPE
+    VERTEX       = static_cast<uint8_t>(vk::ShaderStageFlagBits::eVertex),
+    FRAGMENT     = static_cast<uint8_t>(vk::ShaderStageFlagBits::eFragment),
+    COMPUTE      = static_cast<uint8_t>(vk::ShaderStageFlagBits::eCompute),
+    INAVLID_TYPE = std::numeric_limits<uint8_t>::max()
   };
 
   struct SH_API SHShaderAsset : SHAssetData
diff --git a/SHADE_Engine/src/Assets/Libraries/Compilers/SHShaderSourceCompiler.cpp b/SHADE_Engine/src/Assets/Libraries/Compilers/SHShaderSourceCompiler.cpp
index 329e34e9..fd1f6d8a 100644
--- a/SHADE_Engine/src/Assets/Libraries/Compilers/SHShaderSourceCompiler.cpp
+++ b/SHADE_Engine/src/Assets/Libraries/Compilers/SHShaderSourceCompiler.cpp
@@ -19,144 +19,145 @@
 
 namespace SHADE
 {
-	std::string SHShaderSourceCompiler::CompileShaderSourceToBinary(AssetPath path, SHShaderAsset const& data) noexcept
-	{
-		std::string newPath{ path.string() };
+  std::string SHShaderSourceCompiler::CompileShaderSourceToBinary(AssetPath path, SHShaderAsset const& data) noexcept
+  {
+    std::string newPath{ path.string() };
     newPath = newPath.substr(0, newPath.find_last_of('.'));
     newPath += SHADER_BUILT_IN_EXTENSION.data();
 
-		std::ofstream file{ newPath, std::ios::binary | std::ios::out | std::ios::trunc };
+    std::ofstream file{ newPath, std::ios::binary | std::ios::out | std::ios::trunc };
 
-		file.write(
-			reinterpret_cast<char const*>(& data.shaderType), sizeof(uint8_t)
-		);
+    file.write(
+      reinterpret_cast<char const*>(& data.shaderType), sizeof(uint8_t)
+    );
 
-		size_t const byteCount = sizeof(uint32_t) * data.spirvBinary.size();
+    size_t const byteCount = sizeof(uint32_t) * data.spirvBinary.size();
 
-		file.write(
-			reinterpret_cast<char const*>(&byteCount), sizeof(size_t)
-		);
+    file.write(
+      reinterpret_cast<char const*>(&byteCount), sizeof(size_t)
+    );
 
-		file.write(
-			reinterpret_cast<char const*>(data.spirvBinary.data()), byteCount
-		);
+    file.write(
+      reinterpret_cast<char const*>(data.spirvBinary.data()), byteCount
+    );
 
-		file.close();
+    file.close();
 
-		return newPath;
-	}
+    return newPath;
+  }
 
-	SHShaderAsset const* SHShaderSourceCompiler::CompileShaderSourceToMemory(std::string const& data, std::string const& name, SH_SHADER_TYPE type) noexcept
-	{
-		// shaderc compiler
-		shaderc::Compiler compiler;
-		shaderc::CompileOptions options;
+  SHShaderAsset const* SHShaderSourceCompiler::CompileShaderSourceToMemory(std::string const& data, std::string const& name, SH_SHADER_TYPE type) noexcept
+  {
+    // shaderc compiler
+    shaderc::Compiler compiler;
+    shaderc::CompileOptions options;
 
-		options.AddMacroDefinition("MY_DEFINE", "1");
+    options.AddMacroDefinition("MY_DEFINE", "1");
 
-		//TODO: Check if we need optimisation levels when compiling into spirv
-		// Set optimization levels
-		//if (opLevel != shaderc_optimization_level_zero)
-		//	options.SetOptimizationLevel(opLevel);
+    //TODO: Check if we need optimisation levels when compiling into spirv
+    // Set optimization levels
+    //if (opLevel != shaderc_optimization_level_zero)
+    //	options.SetOptimizationLevel(opLevel);
 
-		// Attempt to get the shaderc equivalent shader stage
-		shaderc_shader_kind shaderKind;
-		switch (type)
-		{
-		case SH_SHADER_TYPE::VERTEX:
-			shaderKind = shaderc_shader_kind::shaderc_glsl_vertex_shader;
-			break;
-		case SH_SHADER_TYPE::FRAGMENT:
-			shaderKind = shaderc_shader_kind::shaderc_glsl_fragment_shader;
-			break;
-		case SH_SHADER_TYPE::COMPUTE:
-			shaderKind = shaderc_shader_kind::shaderc_glsl_compute_shader;
-			break;
-		default:
-			shaderKind = shaderc_shader_kind::shaderc_glsl_vertex_shader;
-			break;
-		}
+    // Attempt to get the shaderc equivalent shader stage
+    shaderc_shader_kind shaderKind;
+    switch (type)
+    {
+    case SH_SHADER_TYPE::VERTEX:
+      shaderKind = shaderc_shader_kind::shaderc_glsl_vertex_shader;
+      break;
+    case SH_SHADER_TYPE::FRAGMENT:
+      shaderKind = shaderc_shader_kind::shaderc_glsl_fragment_shader;
+      break;
+    case SH_SHADER_TYPE::COMPUTE:
+      shaderKind = shaderc_shader_kind::shaderc_glsl_compute_shader;
+      break;
+    default:
+      shaderKind = shaderc_shader_kind::shaderc_glsl_vertex_shader;
+      break;
+    }
 
-		// Compile the shader and get the result
-		shaderc::SpvCompilationResult compileResult = compiler.CompileGlslToSpv(data, shaderKind, name.c_str(), options);
+    // Compile the shader and get the result
+    shaderc::SpvCompilationResult compileResult = compiler.CompileGlslToSpv(data, shaderKind, name.c_str(), options);
 
-		if (compileResult.GetCompilationStatus() != shaderc_compilation_status_success)
-		{
-			SHLOG_ERROR("Shaderc failed to compile GLSL shader to binary | " + compileResult.GetErrorMessage());
-			return nullptr;
-		}
+    if (compileResult.GetCompilationStatus() != shaderc_compilation_status_success)
+    {
+      SHLOG_ERROR("Shaderc failed to compile GLSL shader to binary | " + compileResult.GetErrorMessage());
+      return nullptr;
+    }
 
-		auto result = new SHShaderAsset();
-		result->spirvBinary.resize(compileResult.end() - compileResult.begin());
+    auto result = new SHShaderAsset();
+    result->spirvBinary.resize(compileResult.end() - compileResult.begin());
 
-		std::ranges::copy(compileResult.begin(), compileResult.end(), result->spirvBinary.data());
+    std::ranges::copy(compileResult.begin(), compileResult.end(), result->spirvBinary.data());
 
     result->name = name;
     result->shaderType = type;
 
-		return result;
-	}
+    return result;
+  }
 
-	SH_SHADER_TYPE SHShaderSourceCompiler::GetShaderTypeFromFilename(std::string name) noexcept
-	{
-		for (auto i { 0}; i < SHADER_TYPE_MAX_COUNT; ++i)
-		{
-			if (name.find(SHADER_IDENTIFIERS[i].data()) != std::string::npos)
-			{
-				return static_cast<SH_SHADER_TYPE>(i);
-			}
-		}
+  SH_SHADER_TYPE SHShaderSourceCompiler::GetShaderTypeFromFilename(std::string name) noexcept
+  {
+    for (auto i { 0 }; i < SHADER_TYPE_MAX_COUNT; ++i)
+    {
+      const auto& [SHADER_SUFFIX, SHADER_TYPE] = SHADER_IDENTIFIERS[i];
+      if (name.find(SHADER_SUFFIX.data()) != std::string::npos)
+      {
+        return SHADER_TYPE;
+      }
+    }
 
-		return SH_SHADER_TYPE::INAVLID_TYPE;
-	}
+    return SH_SHADER_TYPE::INAVLID_TYPE;
+  }
 
   std::optional<AssetPath> SHShaderSourceCompiler::LoadAndCompileShader(AssetPath path) noexcept
-	{
-		auto type = GetShaderTypeFromFilename(path.filename().string());
+  {
+    auto type = GetShaderTypeFromFilename(path.filename().string());
 
-		if (type == SH_SHADER_TYPE::INAVLID_TYPE)
-		{
-			SHLOG_ERROR("Invalid filename for shaders, follow suffix in SHAssetMacros.h: {}", path.string());
-			return {};
-		}
+    if (type == SH_SHADER_TYPE::INAVLID_TYPE)
+    {
+      SHLOG_ERROR("Invalid filename for shaders, follow suffix in SHAssetMacros.h: {}", path.string());
+      return {};
+    }
 
     path.make_preferred();
 
-		std::ifstream file{ path.string(), std::ios::in };
+    std::ifstream file{ path.string(), std::ios::in };
 
-		if (file.is_open())
-		{
-			std::stringstream stream;
+    if (file.is_open())
+    {
+      std::stringstream stream;
 
-			stream << file.rdbuf();
+      stream << file.rdbuf();
 
-			std::string const content = stream.str();
+      std::string const content = stream.str();
 
-			auto data = CompileShaderSourceToMemory(content, path.filename().string(), type);
+      auto data = CompileShaderSourceToMemory(content, path.filename().string(), type);
 
-			if (data == nullptr)
-			{
-				return{};
-			}
+      if (data == nullptr)
+      {
+        return{};
+      }
 
-			return CompileShaderSourceToBinary(path, *data);
-		}
+      return CompileShaderSourceToBinary(path, *data);
+    }
 
-		SHLOG_ERROR("Unable to open shader file: {}", path.string());
+    SHLOG_ERROR("Unable to open shader file: {}", path.string());
 
-		return {};
-	}
+    return {};
+  }
 
-	std::optional<AssetPath> SHShaderSourceCompiler::CompileShaderFromString
-	(std::string const& string, AssetPath path, SH_SHADER_TYPE type) noexcept
-	{
-		auto const data = CompileShaderSourceToMemory(string, path.filename().string(), type);
+  std::optional<AssetPath> SHShaderSourceCompiler::CompileShaderFromString
+  (std::string const& string, AssetPath path, SH_SHADER_TYPE type) noexcept
+  {
+    auto const data = CompileShaderSourceToMemory(string, path.filename().string(), type);
 
-		if (data == nullptr)
-		{
-			return{};
-		}
+    if (data == nullptr)
+    {
+      return{};
+    }
 
-		return CompileShaderSourceToBinary(path, *data);
-	}
+    return CompileShaderSourceToBinary(path, *data);
+  }
 }
diff --git a/SHADE_Engine/src/Assets/Libraries/Loaders/SHTextBasedLoader.h b/SHADE_Engine/src/Assets/Libraries/Loaders/SHTextBasedLoader.h
index 80771058..b74c6c94 100644
--- a/SHADE_Engine/src/Assets/Libraries/Loaders/SHTextBasedLoader.h
+++ b/SHADE_Engine/src/Assets/Libraries/Loaders/SHTextBasedLoader.h
@@ -11,6 +11,10 @@
 #pragma once
 #include "SHAssetLoader.h"
 
+#include "Assets/Asset Types/SHPrefabAsset.h"
+#include "Assets/Asset Types/SHSceneAsset.h"
+#include "Assets/Asset Types/SHMaterialAsset.h"
+
 namespace SHADE
 {
 	struct SHTextBasedLoader : SHAssetLoader
diff --git a/SHADE_Engine/src/Assets/SHAssetMacros.h b/SHADE_Engine/src/Assets/SHAssetMacros.h
index a21a9840..3376a2d5 100644
--- a/SHADE_Engine/src/Assets/SHAssetMacros.h
+++ b/SHADE_Engine/src/Assets/SHAssetMacros.h
@@ -13,6 +13,7 @@
 #include <cstdint>
 #include <string>
 #include <filesystem>
+#include "Asset Types/SHShaderAsset.h"
 
 // FMOD Fwd Declare
 namespace FMOD
@@ -113,10 +114,10 @@ constexpr std::string_view VERTEX_SHADER{ "_VS" };
 constexpr std::string_view FRAGMENT_SHADER{ "_FS" };
 constexpr std::string_view COMPUTER_SHADER{ "_CS" };
 
-constexpr std::string_view SHADER_IDENTIFIERS[] = {
-	VERTEX_SHADER,
-	FRAGMENT_SHADER,
-	COMPUTER_SHADER
+constexpr std::pair<std::string_view, SHADE::SH_SHADER_TYPE> SHADER_IDENTIFIERS[] = {
+	std::make_pair(VERTEX_SHADER, SHADE::SH_SHADER_TYPE::VERTEX),
+	std::make_pair(FRAGMENT_SHADER, SHADE::SH_SHADER_TYPE::FRAGMENT),
+	std::make_pair(COMPUTER_SHADER, SHADE::SH_SHADER_TYPE::COMPUTE)
 };
 
 constexpr size_t SHADER_TYPE_MAX_COUNT{ 3 };
diff --git a/SHADE_Engine/src/Assets/SHAssetManager.cpp b/SHADE_Engine/src/Assets/SHAssetManager.cpp
index 682eb9ec..4897fc42 100644
--- a/SHADE_Engine/src/Assets/SHAssetManager.cpp
+++ b/SHADE_Engine/src/Assets/SHAssetManager.cpp
@@ -151,19 +151,23 @@ namespace SHADE
 	****************************************************************************/
 	AssetID SHAssetManager::CreateNewAsset(AssetType type, AssetName name) noexcept
 	{
+    SHAssetData* data = nullptr;
     std::string newPath{ ASSET_ROOT };
     switch (type)
     {
     case AssetType::PREFAB:
       newPath += PREFAB_FOLDER;
+      data = new SHPrefabAsset();
       break;
 
     case AssetType::SCENE:
       newPath += SCENE_FOLDER;
+      data = new SHSceneAsset();
       break;
 
     case AssetType::MATERIAL:
       newPath += MATERIAL_FOLDER;
+      data = new SHMaterialAsset();
       break;
 
     default:
@@ -189,6 +193,8 @@ namespace SHADE
           )
     });
 
+    assetData.emplace(id, data);
+
 		return id;
 	}
 
diff --git a/SHADE_Engine/src/Camera/SHCameraArmComponent.cpp b/SHADE_Engine/src/Camera/SHCameraArmComponent.cpp
new file mode 100644
index 00000000..9cb221ff
--- /dev/null
+++ b/SHADE_Engine/src/Camera/SHCameraArmComponent.cpp
@@ -0,0 +1,68 @@
+#include "SHpch.h"
+#include "SHCameraArmComponent.h"
+
+
+
+namespace SHADE
+{
+
+  SHCameraArmComponent::SHCameraArmComponent()
+    :pitch(0.0f), yaw(0.0f), armLength(1.0f),offset(), dirty(true), lookAtCameraOrigin(true)
+  {
+
+  }
+
+
+  SHVec3 const& SHCameraArmComponent::GetOffset() const noexcept
+  {
+    return offset;
+  }
+  
+  float SHCameraArmComponent::GetPitch() const noexcept
+  {
+    return pitch;
+  }
+
+  float SHCameraArmComponent::GetYaw() const noexcept
+  {
+    return yaw;
+  }
+
+  float SHCameraArmComponent::GetArmLength() const noexcept
+  {
+    return armLength;
+  }
+
+  void SHCameraArmComponent::SetPitch(float pitch) noexcept
+  {
+    this->pitch = pitch;
+    dirty = true;
+  }
+
+  void SHCameraArmComponent::SetYaw(float yaw) noexcept
+  {
+    this->yaw = yaw;
+    dirty = true;
+  }
+
+  void SHCameraArmComponent::SetArmLength(float length) noexcept
+  {
+    this->armLength = length;
+    dirty = true;
+  }
+
+}//namespace SHADE
+
+
+RTTR_REGISTRATION
+{
+  using namespace SHADE;
+  using namespace rttr;
+
+  registration::class_<SHCameraArmComponent>("Camera Arm Component")
+    .property("Arm Pitch", &SHCameraArmComponent::GetPitch, &SHCameraArmComponent::SetPitch)
+    .property("Arm Yaw", &SHCameraArmComponent::GetYaw, &SHCameraArmComponent::SetYaw)
+    .property("Arm Length", &SHCameraArmComponent::GetArmLength, &SHCameraArmComponent::SetArmLength)
+    .property("Look At Camera Origin", &SHCameraArmComponent::lookAtCameraOrigin);
+    
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Camera/SHCameraArmComponent.h b/SHADE_Engine/src/Camera/SHCameraArmComponent.h
new file mode 100644
index 00000000..2b81a808
--- /dev/null
+++ b/SHADE_Engine/src/Camera/SHCameraArmComponent.h
@@ -0,0 +1,44 @@
+#pragma once
+
+
+#include <rttr/registration>
+#include "ECS_Base/Components/SHComponent.h"
+#include "Math/SHMatrix.h"
+#include "SH_API.h"
+
+namespace SHADE
+{
+  class SH_API SHCameraArmComponent final: public SHComponent
+  {
+  private:
+    float pitch;
+    float yaw;
+    float armLength;
+
+    bool dirty;
+    SHVec3 offset;
+
+  public:
+    friend class SHCameraSystem;
+    SHCameraArmComponent();
+    virtual ~SHCameraArmComponent() = default;
+    
+    bool lookAtCameraOrigin;
+    //Getters
+    //SHMatrix const& GetMatrix() const noexcept;
+    SHVec3 const& GetOffset() const noexcept;
+    float GetPitch() const noexcept;
+    float GetYaw() const noexcept;
+    float GetArmLength() const noexcept;
+
+    //Setters
+    void SetPitch(float pitch) noexcept;
+    void SetYaw(float yaw) noexcept;
+    void SetArmLength(float length) noexcept;
+
+  protected:
+
+
+  };
+
+}//namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Camera/SHCameraComponent.cpp b/SHADE_Engine/src/Camera/SHCameraComponent.cpp
index 31afe2ac..ac451df5 100644
--- a/SHADE_Engine/src/Camera/SHCameraComponent.cpp
+++ b/SHADE_Engine/src/Camera/SHCameraComponent.cpp
@@ -13,7 +13,7 @@ namespace SHADE
 		, width(1920.0f), height(1080.0f), zNear(0.01f), zFar(10000.0f), fov(90.0f), movementSpeed(1.0f), turnSpeed(0.5f)
 		, perspProj(true), dirtyView(true), dirtyProj(true)
 		, viewMatrix(), projMatrix()
-		, position()
+		, position(), offset()
 	{
 		ComponentFamily::GetID<SHCameraComponent>();
 	}
diff --git a/SHADE_Engine/src/Camera/SHCameraComponent.h b/SHADE_Engine/src/Camera/SHCameraComponent.h
index f5e08af4..b778b8fa 100644
--- a/SHADE_Engine/src/Camera/SHCameraComponent.h
+++ b/SHADE_Engine/src/Camera/SHCameraComponent.h
@@ -33,7 +33,7 @@ namespace SHADE
 		SHVec3 position;
 
 		bool perspProj;
-
+    SHVec3 offset;
 
 
 
@@ -41,7 +41,7 @@ namespace SHADE
 		friend class SHCameraSystem;
 
 		SHCameraComponent();
-		~SHCameraComponent();
+		virtual ~SHCameraComponent();
 		
 
 		//Getters and setters.
diff --git a/SHADE_Engine/src/Camera/SHCameraDirector.cpp b/SHADE_Engine/src/Camera/SHCameraDirector.cpp
index 559897c0..98341098 100644
--- a/SHADE_Engine/src/Camera/SHCameraDirector.cpp
+++ b/SHADE_Engine/src/Camera/SHCameraDirector.cpp
@@ -1,6 +1,7 @@
 #include "SHpch.h"
 #include "SHCameraDirector.h"
 #include "SHCameraComponent.h"
+#include "SHCameraArmComponent.h"
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "ECS_Base/SHECSMacros.h"
 #include "ECS_Base/Managers/SHEntityManager.h"
@@ -48,6 +49,7 @@ namespace SHADE
 			viewMatrix = camComponent->GetViewMatrix();
 			projMatrix = camComponent->GetProjMatrix();
 		}
+
 	}
 
 	void SHCameraDirector::SetMainCamera(SHCameraComponent& camera) noexcept
diff --git a/SHADE_Engine/src/Camera/SHCameraDirector.h b/SHADE_Engine/src/Camera/SHCameraDirector.h
index 5d09788b..6d5404c5 100644
--- a/SHADE_Engine/src/Camera/SHCameraDirector.h
+++ b/SHADE_Engine/src/Camera/SHCameraDirector.h
@@ -21,6 +21,7 @@ namespace SHADE
 		
 		EntityID mainCameraEID;
 		EntityID transitionCameraEID;
+    
 
 		SHMatrix GetViewMatrix() const noexcept;
 		SHMatrix GetProjMatrix() const noexcept;
@@ -35,7 +36,7 @@ namespace SHADE
 	protected:
 		SHMatrix viewMatrix;
 		SHMatrix projMatrix;
-
+    
 	};
 
 	typedef Handle<SHCameraDirector> DirectorHandle;
diff --git a/SHADE_Engine/src/Camera/SHCameraSystem.cpp b/SHADE_Engine/src/Camera/SHCameraSystem.cpp
index 609805f8..d5bd414d 100644
--- a/SHADE_Engine/src/Camera/SHCameraSystem.cpp
+++ b/SHADE_Engine/src/Camera/SHCameraSystem.cpp
@@ -1,10 +1,12 @@
 #include "SHpch.h"
 #include "SHCameraSystem.h"
+#include "SHCameraArmComponent.h"
 #include "Math/SHMathHelpers.h"
 #include "Input/SHInputManager.h"
 #include "Math/Vector/SHVec2.h"
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "Math/Transform/SHTransformComponent.h"
+#include <math.h>
 
 
 namespace SHADE
@@ -59,6 +61,7 @@ namespace SHADE
     }
 
     UpdateCameraComponent(editorCamera);
+
   }
 	void SHCameraSystem::EditorCameraUpdate::Execute(double dt) noexcept 
 	{
@@ -112,6 +115,8 @@ namespace SHADE
 
     //std::cout << "Camera position: " << camera.position.x << " " << camera.position.y << std::endl;
     system->UpdateCameraComponent(system->editorCamera);
+    
+    system->DecomposeViewMatrix(camera.viewMatrix, camera.pitch, camera.yaw, camera.roll, camera.position);
 	}
 
   void SHCameraSystem::Init(void) 
@@ -121,6 +126,9 @@ namespace SHADE
     editorCamera.SetYaw(0.0f);
     editorCamera.SetRoll(0.0f);
     editorCamera.movementSpeed = 2.0f;
+
+    SHComponentManager::CreateComponentSparseSet<SHCameraComponent>();
+    SHComponentManager::CreateComponentSparseSet<SHCameraArmComponent>();
     
   }
 
@@ -134,6 +142,26 @@ namespace SHADE
     return &editorCamera;
   }
 
+  void SHCameraSystem::UpdatePivotArmComponent(SHCameraArmComponent& pivot) noexcept
+  {
+    if (pivot.dirty)
+    {
+
+      SHVec3 offset{ 0.0f,0.0f, pivot.GetArmLength() };
+      offset = SHVec3::RotateX(offset, -(SHMath::DegreesToRadians(pivot.GetPitch())));
+      offset = SHVec3::RotateY(offset, (SHMath::DegreesToRadians(pivot.GetYaw())));
+
+
+      //pivot.rtMatrix = SHMatrix::RotateX(SHMath::DegreesToRadians(pivot.GetPitch()))
+      //  * SHMatrix::RotateY(SHMath::DegreesToRadians(pivot.GetYaw()))
+      //  * SHMatrix::Translate(SHVec3(0.0f , 0.0f, pivot.GetArmLength()));
+
+      pivot.offset = offset;
+      // pivot.rtMatrix = SHMatrix::Inverse(pivot.rtMatrix);
+    }
+  }
+
+
   void SHCameraSystem::UpdateCameraComponent(SHCameraComponent& camera) noexcept
 	{
     if (SHComponentManager::HasComponent<SHTransformComponent>(camera.GetEID()) == true && &camera != &editorCamera)
@@ -151,6 +179,15 @@ namespace SHADE
 		if (camera.dirtyView)
 		{
       
+      camera.offset = SHVec3{ 0.0f };
+      if (SHComponentManager::HasComponent<SHCameraArmComponent>(camera.GetEID()))
+      {
+        auto arm = SHComponentManager::GetComponent<SHCameraArmComponent>(camera.GetEID());        
+        camera.offset = arm->GetOffset();
+        if(arm->lookAtCameraOrigin)
+          CameraLookAt(camera, camera.position);
+      }
+
       SHVec3 view, right, UP;
 
       
@@ -171,9 +208,12 @@ namespace SHADE
       camera.viewMatrix(2, 1) = view[1];
       camera.viewMatrix(2, 2) = view[2];
 
-      camera.viewMatrix(0, 3) = -right.Dot(camera.position);
-      camera.viewMatrix(1, 3) = -UP.Dot(camera.position);
-      camera.viewMatrix(2, 3) = -view.Dot(camera.position);
+      camera.viewMatrix(0, 3) = -right.Dot(camera.position + camera.offset);
+      camera.viewMatrix(1, 3) = -UP.Dot(camera.position + camera.offset);
+      camera.viewMatrix(2, 3) = -view.Dot(camera.position + camera.offset);
+
+      
+      
 
       camera.dirtyView = false;
 		}
@@ -221,6 +261,8 @@ namespace SHADE
     SHVec3 up = { 0.0f,1.0f,0.0f };
 
 
+
+
     target = SHVec3::RotateX(target, SHMath::DegreesToRadians(camera.pitch));
     target = SHVec3::RotateY(target, SHMath::DegreesToRadians(camera.yaw));
     target += camera.position;
@@ -241,6 +283,13 @@ namespace SHADE
   {
     SHCameraSystem* system = static_cast<SHCameraSystem*>(GetSystem());
     auto& dense = SHComponentManager::GetDense<SHCameraComponent>();
+    auto& pivotDense = SHComponentManager::GetDense<SHCameraArmComponent>();
+
+    for (auto& pivot : pivotDense)
+    {
+      system->UpdatePivotArmComponent(pivot);
+    }
+
     for (auto& cam : dense)
     {
       system->UpdateCameraComponent(cam);
@@ -274,18 +323,115 @@ namespace SHADE
   }
   void SHCameraSystem::ClampCameraRotation(SHCameraComponent& camera) noexcept
   {
+    constexpr float clampVal = 85.0f;
 
 
+    if (camera.pitch > clampVal)
+      camera.SetPitch(clampVal);
+    if (camera.pitch < -clampVal)
+      camera.SetPitch(-clampVal);
+    if (camera.roll > clampVal)
+      camera.SetRoll(clampVal);
+    if (camera.roll < -clampVal)
+      camera.SetRoll(-clampVal);
 
-    if (camera.pitch > 85)
-      camera.SetPitch(85);
-    if (camera.pitch < -85)
-      camera.SetPitch(-85);
-    if (camera.roll > 85)
-      camera.SetRoll(85);
-    if (camera.roll < -85)
-      camera.SetRoll(-85);
+    while (camera.yaw > 360)
+      camera.yaw -= 360;
+    while (camera.yaw < -360)
+      camera.yaw += 360;
 
   }
 
+  void SHCameraSystem::SetMainCamera(EntityID eid, size_t directorIndex) noexcept
+  {
+    if (SHComponentManager::HasComponent<SHCameraComponent>(eid) && directorIndex < directorHandleList.size())
+      directorHandleList[directorIndex]->SetMainCamera(*SHComponentManager::GetComponent<SHCameraComponent>(eid));
+    else
+    {
+      SHLOG_WARNING("Set Main Camera warning: Entity does not have camera component or director does not exist.")
+    }
+  }
+
+  void SHCameraSystem::DecomposeViewMatrix(SHMatrix const& viewMatrix, float& pitch, float& yaw, float& roll, SHVec3& pos) noexcept
+  {
+
+    float initPitch = pitch;
+    SHVec3 initPos = pos;
+    SHVec3 translate3, scale;
+    SHQuaternion quat;
+
+    //SHMatrix viewInverse = viewMatrix;
+
+    viewMatrix.Decompose(translate3, quat, scale);
+    yaw = 180+ SHMath::RadiansToDegrees(quat.ToEuler().y);
+    pitch = -SHMath::RadiansToDegrees(quat.ToEuler().x);
+
+    SHVec4 dotPos{ -viewMatrix(0,3),-viewMatrix(1,3), -viewMatrix(2,3), 1.0f };
+    SHMatrix mtx = viewMatrix;
+    mtx(0, 3) = 0.0f;
+    mtx(1, 3) = 0.0f;
+    mtx(2, 3) = 0.0f;
+    mtx.Transpose();
+    mtx = SHMatrix::Inverse(mtx);
+    SHVec4 translate =  mtx* dotPos;
+
+    pos.x = translate.x;
+    pos.y = translate.y;
+    pos.z = translate.z;
+    
+  }
+  void SHCameraSystem::SetCameraViewMatrix(SHCameraComponent& camera, SHMatrix const& viewMatrix) noexcept
+  {
+    DecomposeViewMatrix(viewMatrix, camera.pitch, camera.yaw, camera.roll, camera.position);
+    camera.dirtyView = true;
+  }
+
+  void SHCameraSystem::CameraLookAt(SHCameraComponent& camera, SHVec3 target) noexcept
+  {
+ 
+    if (camera.position == target)
+    {
+      //lets off set it abit so the view is nt fked
+      target.z -= 0.0001f;
+    }
+    SHVec3 forward, right, upVec;
+
+    SHVec3 up = { 0.0f,1.0f,0.0f };
+    
+
+    ////SHVec3::RotateZ(target, SHMath::DegreesToRadians(camera.roll));
+
+    //target = SHVec3::Normalise(target);
+
+    SHVec3::RotateZ(up, camera.roll);
+    up = SHVec3::Normalise(up);
+
+
+    forward = target - (camera.position + camera.offset); forward = SHVec3::Normalise(forward);
+    right = SHVec3::Cross(forward, up); right = SHVec3::Normalise(right);
+    upVec = SHVec3::Cross(forward, right);
+
+
+    SHMatrix viewMtx;
+    viewMtx = SHMatrix::Identity;
+    viewMtx(0, 0) = right[0];
+    viewMtx(0, 1) = right[1];
+    viewMtx(0, 2) = right[2];
+
+    viewMtx(1, 0) = upVec[0];
+    viewMtx(1, 1) = upVec[1];
+    viewMtx(1, 2) = upVec[2];
+
+    viewMtx(2, 0) = forward[0];
+    viewMtx(2, 1) = forward[1];
+    viewMtx(2, 2) = forward[2];
+
+    viewMtx(0, 3) = -right.Dot(camera.position + camera.offset);
+    viewMtx(1, 3) = -upVec.Dot(camera.position + camera.offset);
+    viewMtx(2, 3) = -forward.Dot(camera.position + camera.offset);
+
+
+    SetCameraViewMatrix(camera, viewMtx);
+  }
+
 }
diff --git a/SHADE_Engine/src/Camera/SHCameraSystem.h b/SHADE_Engine/src/Camera/SHCameraSystem.h
index 68071160..98fd442f 100644
--- a/SHADE_Engine/src/Camera/SHCameraSystem.h
+++ b/SHADE_Engine/src/Camera/SHCameraSystem.h
@@ -9,6 +9,9 @@
 
 namespace SHADE
 {
+
+  class SHCameraArmComponent;
+
 	class SH_API SHCameraSystem final : public SHSystem
 	{
 	private:
@@ -19,6 +22,11 @@ namespace SHADE
 		SHResourceLibrary<SHCameraDirector> directorLibrary;
 		std::vector<DirectorHandle> directorHandleList;
 
+
+    void UpdateCameraComponent(SHCameraComponent& camera) noexcept;
+    void UpdatePivotArmComponent(SHCameraArmComponent& pivot) noexcept;
+
+
 	public:
     SHCameraSystem(void) = default;
     virtual ~SHCameraSystem(void) = default;
@@ -39,7 +47,7 @@ namespace SHADE
 		class SH_API CameraSystemUpdate final: public SHSystemRoutine
 		{
 		public:
-			CameraSystemUpdate() : SHSystemRoutine("Camera System Update", false) {};
+			CameraSystemUpdate() : SHSystemRoutine("Camera System Update", true) {};
 			virtual void Execute(double dt)noexcept override final;
 		};
 		friend class CameraSystemUpdate;
@@ -51,12 +59,10 @@ namespace SHADE
 		DirectorHandle GetDirector(size_t index) noexcept;
 		void ClampCameraRotation(SHCameraComponent& camera) noexcept;
 		void UpdateEditorCamera(double dt) noexcept;
-	protected:
-
-		void UpdateCameraComponent(SHCameraComponent& camera) noexcept;
-
-		
-
+    void SetMainCamera(EntityID eid, size_t directorIndex) noexcept;
+    void DecomposeViewMatrix(SHMatrix const& matrix, float& pitch, float& yaw, float& roll, SHVec3& pos) noexcept;
+    void SetCameraViewMatrix(SHCameraComponent& camera, SHMatrix const& viewMatrix) noexcept;
+    void CameraLookAt(SHCameraComponent& camera, SHVec3 target) noexcept;
 	};
 
 
diff --git a/SHADE_Engine/src/ECS_Base/Managers/SHComponentManager.cpp b/SHADE_Engine/src/ECS_Base/Managers/SHComponentManager.cpp
index be78a146..8a715a49 100644
--- a/SHADE_Engine/src/ECS_Base/Managers/SHComponentManager.cpp
+++ b/SHADE_Engine/src/ECS_Base/Managers/SHComponentManager.cpp
@@ -33,12 +33,18 @@ namespace SHADE
 			return;
 		}
 
+    std::vector<SHComponentRemovedEvent> eventVec;
+
 		for (uint32_t i = 0; i < componentSet.Size(); ++i)
 		{
 			SHComponent* comp = (SHComponent*) componentSet.GetElement(i,  EntityHandleGenerator::GetIndex(entityID));
 			if (comp)
 			{
 				comp->OnDestroy();
+        SHComponentRemovedEvent eventData;
+        eventData.eid = entityID;
+        eventData.removedComponentType = i;
+        eventVec.push_back(eventData);
 			}
 		}
 
@@ -51,8 +57,15 @@ namespace SHADE
 
 		componentSet.RemoveElements(EntityHandleGenerator::GetIndex(entityID));
 
+    for (auto& eventData : eventVec)
+    {
+      SHEventManager::BroadcastEvent<SHComponentRemovedEvent>(eventData, SH_COMPONENT_REMOVED_EVENT);
+    }
+
+
 		//entityHandle.RemoveHandle(entityID);
 
+
 	}
 
 
diff --git a/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.cpp b/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.cpp
index bbf8d400..6ce4f277 100644
--- a/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.cpp
+++ b/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.cpp
@@ -213,5 +213,14 @@ namespace SHADE
 		return SHSerialization::DeserializeEntityToSceneFromString(data);
 	}*/
 
-
+  EntityID SHEntityManager::GetEntityByName(std::string const& name) noexcept
+  {
+    EntityID result = MAX_EID;
+    for (auto& entity : entityVec)
+    {
+      if (entity->name == name)
+        result = entity->GetEID();
+    }
+    return result;
+  }
 }
diff --git a/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.h b/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.h
index f32ab2c4..911748bd 100644
--- a/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.h
+++ b/SHADE_Engine/src/ECS_Base/Managers/SHEntityManager.h
@@ -209,6 +209,8 @@ namespace SHADE
 
 		//static EntityID DuplicateEntity(EntityID eid) noexcept;
 
+    static EntityID GetEntityByName(std::string const& name) noexcept;
+
 	protected:
 
 
diff --git a/SHADE_Engine/src/ECS_Base/Managers/SHSystemManager.cpp b/SHADE_Engine/src/ECS_Base/Managers/SHSystemManager.cpp
index 551233db..057568d6 100644
--- a/SHADE_Engine/src/ECS_Base/Managers/SHSystemManager.cpp
+++ b/SHADE_Engine/src/ECS_Base/Managers/SHSystemManager.cpp
@@ -29,7 +29,7 @@ namespace SHADE
 		{
 			system.second->Init();
 #ifdef _DEBUG
-			std::cout << system.first << " Init" << std::endl;
+      SHLOG_INFO("Initialising System {}...", system.first)
 #endif
 		}
 	}
diff --git a/SHADE_Engine/src/Editor/DragDrop/SHDragDrop.hpp b/SHADE_Engine/src/Editor/DragDrop/SHDragDrop.hpp
index f9849d78..ce0615e1 100644
--- a/SHADE_Engine/src/Editor/DragDrop/SHDragDrop.hpp
+++ b/SHADE_Engine/src/Editor/DragDrop/SHDragDrop.hpp
@@ -6,12 +6,12 @@
 namespace SHADE
 {
   //TODO: Convert to RTTR?
-  constexpr auto DRAG_EID = "DragEID";
-  constexpr auto DRAG_RESOURCE = "DragResource";
-
 
   struct SHDragDrop
   {
+    using DragDropTag = std::string_view;
+    static constexpr DragDropTag DRAG_EID = "DragEID";
+    static constexpr DragDropTag DRAG_RESOURCE = "DragResource";
     static bool BeginSource(ImGuiDragDropFlags const flags = 0);
     /**
      * \brief Ends the DragDrop Source. ONLY CALL IF BeginSource returns true
diff --git a/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.cpp b/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.cpp
index caad9b10..8c71eb8f 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.cpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.cpp
@@ -4,14 +4,16 @@
 #include "Editor/IconsMaterialDesign.h"
 #include "Editor/SHImGuiHelpers.hpp"
 #include <imgui.h>
+#include <imgui_internal.h>
 
 #include "Assets/SHAssetManager.h"
+#include "Editor/IconsFontAwesome6.h"
 #include "Editor/DragDrop/SHDragDrop.hpp"
 
 namespace SHADE
 {
   SHAssetBrowser::SHAssetBrowser()
-    :SHEditorWindow("\xee\x8b\x87 Asset Browser", ImGuiWindowFlags_MenuBar)
+    :SHEditorWindow("\xee\x8b\x87 Asset Browser", ImGuiWindowFlags_MenuBar), rootFolder(SHAssetManager::GetRootFolder()), prevFolder(rootFolder), currentFolder(rootFolder)
   {
   }
 
@@ -23,62 +25,140 @@ namespace SHADE
   void SHAssetBrowser::Update()
   {
     SHEditorWindow::Update();
-    if(Begin())
+    if (Begin())
     {
+      RecursivelyDrawTree(rootFolder);
       DrawMenuBar();
-      auto const& assets = SHAssetManager::GetAllAssets();
-      if(ImGui::BeginTable("AssetBrowserTable", 3))
-      {
-        ImGui::TableNextColumn();
-        ImGui::TableHeader("Asset ID");
-        ImGui::TableNextColumn();
-        ImGui::TableHeader("Name");
-        ImGui::TableNextColumn();
-        ImGui::TableHeader("Type");
-        for(SHAsset const& asset : assets)
-        {
-          DrawAsset(asset);
-        }
-        ImGui::EndTable();
-      }
+      DrawCurrentFolder();
     }
     ImGui::End();
   }
 
   void SHAssetBrowser::DrawMenuBar()
   {
-    if(ImGui::BeginMenuBar())
+    if (ImGui::BeginMenuBar())
     {
 
       ImGui::EndMenuBar();
     }
   }
 
-  void SHAssetBrowser::DrawAsset(SHAsset const& asset)
+  ImRect SHAssetBrowser::RecursivelyDrawTree(FolderPointer folder)
   {
-    ImGui::PushID(asset.id);
-    ImGui::BeginGroup();
-
-    ImGui::TableNextColumn();
-    ImGui::Selectable(std::format("{}", asset.id).data(), false, ImGuiSelectableFlags_SpanAllColumns);
-    if(SHDragDrop::BeginSource())
+    auto const& subFolders = folder->subFolders;
+    auto const& files = folder->files;
+    const bool isSelected = std::ranges::find(selectedFolders, folder) != selectedFolders.end();
+    ImGuiTreeNodeFlags flags = (subFolders.empty() && files.empty()) ? ImGuiTreeNodeFlags_Leaf : ImGuiTreeNodeFlags_OpenOnArrow;
+    if (isSelected)
+      flags |= ImGuiTreeNodeFlags_Selected;
+    if (folder == rootFolder)
+      flags |= ImGuiTreeNodeFlags_DefaultOpen;
+    
+    bool isOpen = ImGui::TreeNodeEx(folder, flags, "%s %s", ICON_MD_FOLDER, folder->name.data());
+    const ImRect nodeRect = ImRect(ImGui::GetItemRectMin(), ImGui::GetItemRectMax());
+    if(ImGui::IsItemClicked())
     {
-      auto id = asset.id;
-      ImGui::Text("Moving Asset: %zu", id);
-      SHDragDrop::SetPayload<AssetID>(DRAG_RESOURCE, &id);
-      SHDragDrop::EndSource();
+      selectedFolders.clear();
+      selectedFolders.push_back(folder);
+    }
+    if (isOpen)
+    {
+      const ImColor treeLineColor = ImGui::GetColorU32(ImGuiCol_CheckMark);
+      const float horizontalOffset = 0.0f;
+      ImDrawList* drawList = ImGui::GetWindowDrawList();
+      ImVec2 vertLineStart = ImGui::GetCursorScreenPos();
+      vertLineStart.x += horizontalOffset;
+      ImVec2 vertLineEnd = vertLineStart;
+      for (auto const& subFolder : subFolders)
+      {
+        const float horizontalLineSize = 8.0f;
+        const ImRect childRect = RecursivelyDrawTree(subFolder);
+        const float midPoint = (childRect.Min.y + childRect.Max.y) * 0.5f;
+        drawList->AddLine(ImVec2(vertLineStart.x, midPoint), ImVec2(vertLineStart.x + horizontalLineSize, midPoint), treeLineColor, 1);
+        vertLineEnd.y = midPoint;
+      }
+      for (auto const& file : files)
+      {
+        const float horizontalLineSize = 25.0f;
+        const ImRect childRect = DrawFile(file);
+        const float midPoint = (childRect.Min.y + childRect.Max.y) * 0.5f;
+        drawList->AddLine(ImVec2(vertLineStart.x, midPoint), ImVec2(vertLineStart.x + horizontalLineSize, midPoint), treeLineColor, 1);
+        vertLineEnd.y = midPoint;
+      }
+      drawList->AddLine(vertLineStart, vertLineEnd, treeLineColor, 1);
+      ImGui::TreePop();
+    }
+    return nodeRect;
+  }
+
+  void SHAssetBrowser::DrawCurrentFolder()
+  {
+    //auto const& subFolders = currentFolder->subFolders;
+    //ImVec2 initialCursorPos = ImGui::GetCursorPos();
+    //ImVec2 initialRegionAvail = ImGui::GetContentRegionAvail();
+    //int maxTiles = initialRegionAvail.x / tileWidth;
+    //float maxX = (maxTiles - 1)*tileWidth;
+    //ImVec2 tilePos = initialCursorPos;
+    //for (auto const& subFolder : subFolders)
+    //{
+    //  ImGui::SetCursorPos(tilePos);
+    //  ImGui::BeginGroup();
+    //  ImGui::PushStyleVar(ImGuiStyleVar_ItemInnerSpacing, {0.0f, 0.0f});
+    //  ImGui::Button(ICON_MD_FOLDER, {tileWidth});
+    //  ImGui::Text(subFolder->name.data());
+    //  ImGui::PopStyleVar();
+    //  ImGui::EndGroup();
+    //  if(tilePos.x >= maxX)
+    //  {
+    //    tilePos.x = initialCursorPos.x;
+    //  }
+    //  else
+    //  {
+    //    ImGui::SameLine();
+    //    tilePos.x += tileWidth;
+    //  }
+    //}
+  }
+
+  ImRect SHAssetBrowser::DrawFile(SHFile const& file) noexcept
+  {
+    if (file.assetMeta == nullptr)
+      return ImRect(ImGui::GetItemRectMin(), ImGui::GetItemRectMax());
+    const bool isSelected = std::ranges::find(selectedAssets, file.assetMeta->id) != selectedAssets.end();
+    ImGuiTreeNodeFlags flags = ImGuiTreeNodeFlags_Leaf;
+    if (isSelected)
+      flags |= ImGuiTreeNodeFlags_Selected;
+    std::string icon{};
+
+    switch(file.assetMeta->type)
+    {
+    case AssetType::INVALID: break;
+    case AssetType::SHADER: icon = ICON_FA_FILE_CODE; break;
+    case AssetType::SHADER_BUILT_IN: icon = ICON_FA_FILE_CODE; break;
+    case AssetType::TEXTURE: icon = ICON_FA_IMAGES; break;
+    case AssetType::MESH: icon = ICON_FA_CUBES; break;
+    case AssetType::SCENE: icon = ICON_MD_IMAGE; break;
+    case AssetType::PREFAB: icon = ICON_FA_BOX_OPEN; break;
+    case AssetType::MATERIAL: break;
+    case AssetType::MAX_COUNT: break;
+    default: ;
     }
 
-    ImGui::TableNextColumn();
-    ImGui::Text("%s", asset.name.c_str());
-
-    ImGui::TableNextColumn();
-    ImGui::Text("%s", "Type");
-
-    ImGui::EndGroup();
-    ImGui::PopID();
-
-    
-
+    ImGui::TreeNodeEx(file.assetMeta, flags, "%s %s", icon.data(), file.assetMeta->name.data());
+    const ImRect nodeRect = ImRect(ImGui::GetItemRectMin(), ImGui::GetItemRectMax());
+    if(SHDragDrop::BeginSource())
+    {
+      auto id = file.assetMeta->id;
+      ImGui::Text("Moving Asset: %s [%zu]", file.name.data(), file.assetMeta->id);
+      SHDragDrop::SetPayload<AssetID>(SHDragDrop::DRAG_RESOURCE, &id);
+      SHDragDrop::EndSource();
+    }
+    if(ImGui::IsItemClicked())
+    {
+      selectedAssets.clear();
+      selectedAssets.push_back(file.assetMeta->id);
+    }
+    ImGui::TreePop();
+    return nodeRect;
   }
 }
diff --git a/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.h b/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.h
index 0e3053bc..d56fc029 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.h
+++ b/SHADE_Engine/src/Editor/EditorWindow/AssetBrowser/SHAssetBrowser.h
@@ -1,7 +1,9 @@
 #pragma once
 
+#include "imgui_internal.h"
 #include "Assets/SHAsset.h"
 #include "Editor/EditorWindow/SHEditorWindow.h"
+#include "Filesystem/SHFolder.h"
 
 namespace SHADE
 {
@@ -16,9 +18,14 @@ namespace SHADE
     void Refresh();
   private:
     void DrawMenuBar();
-    void DrawAsset(SHAsset const& asset);
+    ImRect RecursivelyDrawTree(FolderPointer folder);
+    void DrawCurrentFolder();
+    ImRect DrawFile(SHFile const& file) noexcept;
 
-    float idColumnWidth, nameColumnWidth, typeColumnWidth;
+    FolderPointer rootFolder, prevFolder, currentFolder;
+    std::vector<FolderPointer> selectedFolders;
+    std::vector<AssetID> selectedAssets;
+    static constexpr float tileWidth = 50.0f;
     
   };
-}
\ No newline at end of file
+}
diff --git a/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.cpp b/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.cpp
index f2f8d927..1b289a90 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.cpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.cpp
@@ -6,7 +6,7 @@
 //#==============================================================#
 //||                       SHADE Includes                       ||
 //#==============================================================#
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "Editor/SHImGuiHelpers.hpp"
 #include "Editor/SHEditorWidgets.hpp"
 #include "SHHierarchyPanel.h"
@@ -48,15 +48,28 @@ namespace SHADE
 
     if (Begin())
     {
+      if (skipFrame)
+      {
+        ImGui::End();
+        skipFrame = false;
+        return;
+      }
       DrawMenuBar();
       auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
-      if(const auto root = sceneGraph.GetRoot())
+
+      if (const auto root = sceneGraph.GetRoot())
       {
         auto const& children = root->GetChildren();
-        
+
         for (const auto child : children)
         {
-          RecursivelyDrawEntityNode(child);
+          if (child)
+            RecursivelyDrawEntityNode(child);
+          if (skipFrame)
+          {
+            ImGui::End();
+            return;
+          }
         }
       }
       else
@@ -64,12 +77,36 @@ namespace SHADE
         SHLOG_WARNING("Scene Graph root is null! Unable to render hierarchy.")
       }
 
-      if(ImGui::IsWindowHovered() && !SHDragDrop::hasDragDrop && !ImGui::IsAnyItemHovered() && ImGui::IsMouseReleased(ImGuiMouseButton_Left))
+      if (ImGui::IsWindowHovered() && !SHDragDrop::hasDragDrop && !ImGui::IsAnyItemHovered() && ImGui::IsMouseReleased(ImGuiMouseButton_Left))
       {
-        if(auto editor = SHSystemManager::GetSystem<SHEditor>())
+        if (auto editor = SHSystemManager::GetSystem<SHEditor>())
           editor->selectedEntities.clear();
       }
       ImGui::SeparatorEx(ImGuiSeparatorFlags_Horizontal);
+      if (ImGui::IsWindowFocused())
+      {
+        if (ImGui::IsKeyDown(ImGuiKey_LeftCtrl) && ImGui::IsKeyReleased(ImGuiKey_A))
+        {
+          SelectAllEntities();
+        }
+        if (ImGui::IsKeyDown(ImGuiKey_LeftCtrl) && ImGui::IsKeyReleased(ImGuiKey_C))
+        {
+          CopySelectedEntities();
+        }
+        if (ImGui::IsKeyDown(ImGuiKey_LeftCtrl) && !ImGui::IsKeyDown(ImGuiKey_LeftShift) && ImGui::IsKeyReleased(ImGuiKey_V))
+        {
+          PasteEntities();
+        }
+        if (ImGui::IsKeyDown(ImGuiKey_LeftCtrl) && ImGui::IsKeyDown(ImGuiKey_LeftShift) && ImGui::IsKeyReleased(ImGuiKey_V))
+        {
+          const auto editor = SHSystemManager::GetSystem<SHEditor>();
+          if (editor->selectedEntities.size() == 1)
+          {
+            PasteEntities(editor->selectedEntities.back());
+          }
+        }
+      }
+
     }
     ImGui::End();
   }
@@ -81,7 +118,7 @@ namespace SHADE
 
   void SHHierarchyPanel::SetScrollTo(EntityID eid)
   {
-    if(eid == MAX_EID)
+    if (eid == MAX_EID)
       return;
     scrollTo = eid;
   }
@@ -93,8 +130,10 @@ namespace SHADE
   {
     if (ImGui::BeginMenuBar())
     {
-      ImGui::SetCursorPosX(ImGui::GetContentRegionAvail().x * 0.75f);
-      if(ImGui::SmallButton(ICON_MD_DESELECT))
+      auto size = ImGui::GetWindowSize();
+      auto g = ImGui::GetCurrentContext();
+      ImGui::SetCursorPosX(size.x - g->Style.FramePadding.x * 15.0f);
+      if (ImGui::SmallButton(ICON_MD_CLEAR_ALL))
       {
         auto editor = SHSystemManager::GetSystem<SHEditor>();
         editor->selectedEntities.clear();
@@ -119,15 +158,17 @@ namespace SHADE
     }
   }
 
-  ImRect SHHierarchyPanel::RecursivelyDrawEntityNode(SHSceneNode* currentNode)
+  ImRect SHHierarchyPanel::RecursivelyDrawEntityNode(SHSceneNode* const currentNode)
   {
+    if (currentNode == nullptr)
+      return {};
     auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
 
     //Get node data (Children, eid, selected)
     auto& children = currentNode->GetChildren();
     EntityID eid = currentNode->GetEntityID();
 
-    if(scrollTo != MAX_EID && eid == scrollTo)
+    if (scrollTo != MAX_EID && eid == scrollTo)
     {
       ImGui::SetScrollHereY();
       scrollTo = MAX_EID;
@@ -154,23 +195,27 @@ namespace SHADE
     if (SHDragDrop::BeginSource())
     {
       std::string moveLabel = "Moving EID: ";
-      if(!isSelected)
-        editor->selectedEntities.push_back(eid);
-      for(int i = 0; i < static_cast<int>(editor->selectedEntities.size()); ++i)
+      static std::vector<EntityID> draggingEntities = editor->selectedEntities;
+      if (!isSelected)
       {
-        moveLabel.append(std::to_string(editor->selectedEntities[i]));
-        if(i + 1 < static_cast<int>(editor->selectedEntities.size()))
+        draggingEntities.clear();
+        draggingEntities.push_back(eid);
+      }
+      for (int i = 0; i < static_cast<int>(draggingEntities.size()); ++i)
+      {
+        moveLabel.append(std::to_string(draggingEntities[i]));
+        if (i + 1 < static_cast<int>(draggingEntities.size()))
         {
           moveLabel.append(", ");
         }
       }
       ImGui::Text(moveLabel.c_str());
-      SHDragDrop::SetPayload<std::vector<EntityID>>(DRAG_EID, &editor->selectedEntities);
+      SHDragDrop::SetPayload<std::vector<EntityID>>(SHDragDrop::DRAG_EID, &draggingEntities);
       SHDragDrop::EndSource();
     }
     else if (SHDragDrop::BeginTarget()) //If Received DragDrop
     {
-      if (const std::vector<EntityID>* eidPayload = SHDragDrop::AcceptPayload<std::vector<EntityID>>(DRAG_EID)) //If payload is valid
+      if (const std::vector<EntityID>* eidPayload = SHDragDrop::AcceptPayload<std::vector<EntityID>>(SHDragDrop::DRAG_EID)) //If payload is valid
       {
         ParentSelectedEntities(eid);
         SHDragDrop::EndTarget();
@@ -178,37 +223,43 @@ namespace SHADE
     }
 
     //Context menu
-    if(ImGui::BeginPopupContextItem(std::to_string(eid).c_str()))
+    if (ImGui::BeginPopupContextItem(std::to_string(eid).c_str()))
     {
-      if(!isSelected)
+      if (!isSelected)
       {
         editor->selectedEntities.clear();
         editor->selectedEntities.push_back(eid);
       }
-      if(ImGui::Selectable("Copy"))
+      if (ImGui::Selectable("Copy"))
       {
-        SHClipboardUtilities::WriteToClipboard(SHSerialization::SerializeEntitiesToString(editor->selectedEntities));
+        CopySelectedEntities();
       }
-      if(ImGui::Selectable("Paste"))
+      if (ImGui::Selectable("Paste"))
       {
-        SetScrollTo(SHSerialization::DeserializeEntitiesFromString(SHClipboardUtilities::GetDataFromClipboard()));
+        PasteEntities();
+        skipFrame = true;
+        ImGui::EndPopup();
+        if (isNodeOpen)
+          ImGui::TreePop();
+        return nodeRect;
       }
-      if(ImGui::Selectable("Paste as Child"))
+      if (ImGui::Selectable("Paste as Child"))
       {
-        SetScrollTo(SHSerialization::DeserializeEntitiesFromString(SHClipboardUtilities::GetDataFromClipboard(), eid));
+        PasteEntities(eid);
+        skipFrame = true;
       }
-      if(ImGui::Selectable(std::format("{} Delete", ICON_MD_DELETE).data()))
+      if (ImGui::Selectable(std::format("{} Delete", ICON_MD_DELETE).data()))
       {
         SHEntityManager::DestroyEntity(eid);
       }
-      
-      if((currentNode->GetParent() != sceneGraph.GetRoot()) && ImGui::Selectable(std::format("{} Unparent Selected", ICON_MD_NORTH_WEST).data()))
+
+      if ((currentNode->GetParent() != sceneGraph.GetRoot()) && ImGui::Selectable(std::format("{} Unparent Selected", ICON_MD_NORTH_WEST).data()))
       {
         ParentSelectedEntities(MAX_EID);
       }
       ImGui::EndPopup();
     }
-    
+
     //Handle node selection
     if (ImGui::IsItemHovered())
     {
@@ -216,11 +267,11 @@ namespace SHADE
       {
         if (!isSelected)
         {
-          if(ImGui::IsKeyDown(ImGuiKey_LeftShift))
+          if (ImGui::IsKeyDown(ImGuiKey_LeftShift))
           {
-            if(editor->selectedEntities.size() >= 1)
+            if (editor->selectedEntities.size() >= 1)
             {
-              SelectRangeOfEntities(editor->selectedEntities[0], eid);              
+              SelectRangeOfEntities(editor->selectedEntities[0], eid);
             }
             else editor->selectedEntities.clear();
           }
@@ -278,12 +329,12 @@ namespace SHADE
     auto const editor = SHSystemManager::GetSystem<SHEditor>();
     SHEntityParentCommand::EntityParentData entityParentData;
     std::vector<EntityID> parentedEIDS;
-    for(auto const& eid : editor->selectedEntities)
+    for (auto const& eid : editor->selectedEntities)
     {
-      if(sceneGraph.GetChild(eid, parentEID) == nullptr)
+      if (sceneGraph.GetChild(eid, parentEID) == nullptr)
       {
         parentedEIDS.push_back(eid);
-        if(auto parent = sceneGraph.GetParent(eid))
+        if (auto parent = sceneGraph.GetParent(eid))
           entityParentData[eid].oldParentEID = parent->GetEntityID();
         entityParentData[eid].newParentEID = parentEID;
       }
@@ -298,34 +349,57 @@ namespace SHADE
     editor->selectedEntities.clear();
     auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
     sceneGraph.Traverse([&](SHSceneNode* nodePtr)
-    {
-      auto eid = nodePtr->GetEntityID();
-      if(!startSelecting)
       {
-        if(eid == beginEID || eid == endEID)
+        auto eid = nodePtr->GetEntityID();
+        if (!startSelecting)
         {
-          startSelecting = true;
-          editor->selectedEntities.push_back(eid);
-        }
-      }
-      else
-      {
-        if(!endSelecting)
-        {
-          editor->selectedEntities.push_back(eid);
-          if(eid == endEID || eid == beginEID)
+          if (eid == beginEID || eid == endEID)
           {
-            endSelecting = true;
+            startSelecting = true;
+            editor->selectedEntities.push_back(eid);
           }
         }
-      }
-    });
+        else
+        {
+          if (!endSelecting)
+          {
+            editor->selectedEntities.push_back(eid);
+            if (eid == endEID || eid == beginEID)
+            {
+              endSelecting = true;
+            }
+          }
+        }
+      });
+  }
+
+  void SHHierarchyPanel::SelectAllEntities()
+  {
+    const auto editor = SHSystemManager::GetSystem<SHEditor>();
+    editor->selectedEntities.clear();
+    auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
+    sceneGraph.Traverse([&](SHSceneNode* nodePtr)
+      {
+        auto eid = nodePtr->GetEntityID();
+        editor->selectedEntities.push_back(eid);
+      });
+  }
+
+  void SHHierarchyPanel::CopySelectedEntities()
+  {
+    const auto editor = SHSystemManager::GetSystem<SHEditor>();
+    SHClipboardUtilities::WriteToClipboard(SHSerialization::SerializeEntitiesToString(editor->selectedEntities));
+  }
+
+  void SHHierarchyPanel::PasteEntities(EntityID parentEID)
+  {
+    SetScrollTo(SHSerialization::DeserializeEntitiesFromString(SHClipboardUtilities::GetDataFromClipboard(), parentEID));
   }
 
   void SHCreateEntityCommand::Execute()
   {
     EntityID newEID = SHEntityManager::CreateEntity(eid);
-    if(eid == MAX_EID)
+    if (eid == MAX_EID)
       eid = newEID;
   }
 
@@ -337,9 +411,9 @@ namespace SHADE
   void SHEntityParentCommand::Execute()
   {
     auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
-    for(auto const& eid : entities)
+    for (auto const& eid : entities)
     {
-      if(entityParentData[eid].newParentEID == MAX_EID)
+      if (entityParentData[eid].newParentEID == MAX_EID)
         sceneGraph.SetParent(eid, nullptr);
       else
         sceneGraph.SetParent(eid, entityParentData[eid].newParentEID);
@@ -349,9 +423,9 @@ namespace SHADE
   void SHEntityParentCommand::Undo()
   {
     auto const& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
-    for(auto const& eid : entities)
+    for (auto const& eid : entities)
     {
-      if(entityParentData[eid].oldParentEID == MAX_EID)
+      if (entityParentData[eid].oldParentEID == MAX_EID)
         sceneGraph.SetParent(eid, nullptr);
       else
         sceneGraph.SetParent(eid, entityParentData[eid].oldParentEID);
diff --git a/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.h b/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.h
index 0cfe6474..9b26e9d6 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.h
+++ b/SHADE_Engine/src/Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.h
@@ -26,10 +26,14 @@ namespace SHADE
     void SetScrollTo(EntityID eid);
   private:
     void DrawMenuBar() const noexcept;
-    ImRect RecursivelyDrawEntityNode(SHSceneNode*);
+    ImRect RecursivelyDrawEntityNode(SHSceneNode* const);
     void CreateChildEntity(EntityID parentEID) const noexcept;
     void ParentSelectedEntities(EntityID parentEID) const noexcept;
     void SelectRangeOfEntities(EntityID beginEID, EntityID EndEID);
+    void SelectAllEntities();
+    void CopySelectedEntities();
+    void PasteEntities(EntityID parentEID = MAX_EID);
+    bool skipFrame = false;
     std::string filter;
     bool isAnyNodeSelected = false;
     EntityID scrollTo = MAX_EID;
diff --git a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.h b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.h
new file mode 100644
index 00000000..69f4c145
--- /dev/null
+++ b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.h
@@ -0,0 +1,12 @@
+#pragma once
+#include "ECS_Base/Components/SHComponent.h"
+
+namespace SHADE
+{
+  template<typename T, std::enable_if_t<std::is_base_of<SHComponent, T>::value, bool> = true>
+  static void DrawContextMenu(T* component);
+  template<typename T, std::enable_if_t<std::is_base_of_v<SHComponent, T>, bool> = true>
+  static void DrawComponent(T* component);
+}
+
+#include "SHEditorComponentView.hpp"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
index 9899d4a4..4777fc6a 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp
@@ -13,25 +13,28 @@
 #include "Editor/IconsFontAwesome6.h"
 #include "ECS_Base/Components/SHComponent.h"
 #include "Editor/SHEditorWidgets.hpp"
+#include "Graphics/MiddleEnd/Interface/SHRenderable.h"
 #include "Graphics/MiddleEnd/Lights/SHLightComponent.h"
 #include "Physics/Components/SHColliderComponent.h"
 #include "Reflection/SHReflectionMetadata.h"
+#include "Resource/SHResourceManager.h"
+
 namespace SHADE
 {
   template<typename T>
   std::vector<const char*> GetRTTREnumNames()
   {
     auto const rttrType = rttr::type::get<T>();
-    if(!rttrType.is_enumeration())
+    if (!rttrType.is_enumeration())
       return {};
     auto const enumAlign = rttrType.get_enumeration();
     auto const names = enumAlign.get_names();
     std::vector<const char*> result;
-    std::transform(names.begin(), names.end(), std::back_inserter(result), [](rttr::string_view const& name){return name.data();});
+    std::transform(names.begin(), names.end(), std::back_inserter(result), [](rttr::string_view const& name) {return name.data(); });
     return result;
   }
 
-  template<typename T, std::enable_if_t<std::is_base_of<SHComponent, T>::value, bool> = true>
+  template<typename T, std::enable_if_t<std::is_base_of<SHComponent, T>::value, bool>>
   static void DrawContextMenu(T* component)
   {
     if (!component)
@@ -60,13 +63,15 @@ namespace SHADE
       ImGui::EndPopup();
     }
   }
-  template<typename T, std::enable_if_t<std::is_base_of_v<SHComponent, T>, bool> = true>
+  template<typename T, std::enable_if_t<std::is_base_of_v<SHComponent, T>, bool>>
   static void DrawComponent(T* component)
   {
     if (!component)
       return;
-    const auto componentType = rttr::type::get(*component);
+    const auto componentType = rttr::type::get<T>();
+    ImGui::PushID(SHFamilyID<SHComponent>::GetID<T>());
     SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; }, "Is Component Active");
+    ImGui::PopID();
     ImGui::SameLine();
     if (ImGui::CollapsingHeader(componentType.get_name().data()))
     {
@@ -75,7 +80,8 @@ namespace SHADE
       for (auto const& property : properties)
       {
         auto const& type = property.get_type();
-
+        auto tooltip = property.get_metadata(META::tooltip);
+        bool const& isAngleInRad = property.get_metadata(META::angleInRad).is_valid() ? property.get_metadata(META::angleInRad).template get_value<bool>() : false;
         if (type.is_enumeration())
         {
           auto enumAlign = type.get_enumeration();
@@ -89,29 +95,25 @@ namespace SHADE
               auto values = enumAlign.get_values();
               auto it = std::next(values.begin(), idx);
               property.set_value(component, *it);
-            });
+            }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
         }
         else if (type.is_arithmetic())
         {
           if (type == rttr::type::get<bool>())
           {
-            SHEditorWidgets::CheckBox(property.get_name().data(), [component, property] {return property.get_value(component).to_bool(); }, [component, property](bool const& result) {property.set_value(component, result); });
+            SHEditorWidgets::CheckBox(property.get_name().data(), [component, property] {return property.get_value(component).to_bool(); }, [component, property](bool const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
           }
-          //else if (type == rttr::type::get<char>())
-          //{
-          //  
-          //}
           else if (type == rttr::type::get<int8_t>() || type == rttr::type::get<int16_t>() || type == rttr::type::get<int32_t>() || type == rttr::type::get<int64_t>())
           {
             auto metaMin = property.get_metadata(META::min);
             auto metaMax = property.get_metadata(META::max);
             if (metaMin && metaMax)
             {
-              SHEditorWidgets::SliderInt(property.get_name().data(), metaMin.template get_value<int>(), metaMax.template get_value<int>(), [component, property] {return property.get_value(component).to_int(); }, [component, property](int const& result) {property.set_value(component, result); });
+              SHEditorWidgets::SliderInt(property.get_name().data(), metaMin.template get_value<int>(), metaMax.template get_value<int>(), [component, property] {return property.get_value(component).to_int(); }, [component, property](int const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
             else
             {
-              SHEditorWidgets::DragInt(property.get_name().data(), [component, property] {return property.get_value(component).to_int(); }, [component, property](int const& result) {property.set_value(component, result); });
+              SHEditorWidgets::DragInt(property.get_name().data(), [component, property] {return property.get_value(component).to_int(); }, [component, property](int const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<uint8_t>())
@@ -120,11 +122,11 @@ namespace SHADE
             auto metaMax = property.get_metadata(META::max);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderScalar<uint8_t>(property.get_name().data(), ImGuiDataType_U8, metaMin.template get_value<uint8_t>(), metaMax.template get_value<uint8_t>(), [component, property] {return property.get_value(component).to_uint8(); }, [component, property](uint8_t const& result) {property.set_value(component, result); }, "%zu");
+              SHEditorWidgets::SliderScalar<uint8_t>(property.get_name().data(), ImGuiDataType_U8, metaMin.template get_value<uint8_t>(), metaMax.template get_value<uint8_t>(), [component, property] {return property.get_value(component).to_uint8(); }, [component, property](uint8_t const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string(), "%zu");
             }
             else
             {
-              SHEditorWidgets::DragScalar<uint8_t>(property.get_name().data(), ImGuiDataType_U8, [component, property] {return property.get_value(component).to_uint8(); }, [component, property](uint8_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu");
+              SHEditorWidgets::DragScalar<uint8_t>(property.get_name().data(), ImGuiDataType_U8, [component, property] {return property.get_value(component).to_uint8(); }, [component, property](uint8_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu", tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<uint16_t>())
@@ -133,11 +135,11 @@ namespace SHADE
             auto metaMax = property.get_metadata(META::max);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderScalar<uint16_t>(property.get_name().data(), ImGuiDataType_U16, metaMin.template get_value<uint16_t>(), metaMax.template get_value<uint16_t>(), [component, property] {return property.get_value(component).to_uint16(); }, [component, property](uint16_t const& result) {property.set_value(component, result); }, "%zu");
+              SHEditorWidgets::SliderScalar<uint16_t>(property.get_name().data(), ImGuiDataType_U16, metaMin.template get_value<uint16_t>(), metaMax.template get_value<uint16_t>(), [component, property] {return property.get_value(component).to_uint16(); }, [component, property](uint16_t const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string(), "%zu");
             }
             else
             {
-              SHEditorWidgets::DragScalar<uint16_t>(property.get_name().data(), ImGuiDataType_U16, [component, property] {return property.get_value(component).to_uint16(); }, [component, property](uint16_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu");
+              SHEditorWidgets::DragScalar<uint16_t>(property.get_name().data(), ImGuiDataType_U16, [component, property] {return property.get_value(component).to_uint16(); }, [component, property](uint16_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu", tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<uint32_t>())
@@ -146,11 +148,11 @@ namespace SHADE
             auto metaMax = property.get_metadata(META::max);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderScalar<uint32_t>(property.get_name().data(), ImGuiDataType_U32, metaMin.template get_value<uint32_t>(), metaMax.template get_value<uint32_t>(), [component, property] { return property.get_value(component).to_uint32(); }, [component, property](uint32_t const& result) {property.set_value(component, result); }, "%zu");
+              SHEditorWidgets::SliderScalar<uint32_t>(property.get_name().data(), ImGuiDataType_U32, metaMin.template get_value<uint32_t>(), metaMax.template get_value<uint32_t>(), [component, property] { return property.get_value(component).to_uint32(); }, [component, property](uint32_t const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string(), "%zu");
             }
             else
             {
-              SHEditorWidgets::DragScalar<uint32_t>(property.get_name().data(), ImGuiDataType_U32, [component, property] { return property.get_value(component).to_uint32(); }, [component, property](uint32_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu");
+              SHEditorWidgets::DragScalar<uint32_t>(property.get_name().data(), ImGuiDataType_U32, [component, property] { return property.get_value(component).to_uint32(); }, [component, property](uint32_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu", tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<uint64_t>())
@@ -159,11 +161,11 @@ namespace SHADE
             auto metaMax = property.get_metadata(META::max);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderScalar<uint64_t>(property.get_name().data(), ImGuiDataType_U64, metaMin.template get_value<uint64_t>(), metaMax.template get_value<uint64_t>(), [component, property] {return property.get_value(component).to_uint64(); }, [component, property](uint64_t const& result) {property.set_value(component, result); }, "%zu");
+              SHEditorWidgets::SliderScalar<uint64_t>(property.get_name().data(), ImGuiDataType_U64, metaMin.template get_value<uint64_t>(), metaMax.template get_value<uint64_t>(), [component, property] {return property.get_value(component).to_uint64(); }, [component, property](uint64_t const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string(), "%zu");
             }
             else
             {
-              SHEditorWidgets::DragScalar<uint64_t>(property.get_name().data(), ImGuiDataType_U64, [component, property] {return property.get_value(component).to_uint64(); }, [component, property](uint64_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu");
+              SHEditorWidgets::DragScalar<uint64_t>(property.get_name().data(), ImGuiDataType_U64, [component, property] {return property.get_value(component).to_uint64(); }, [component, property](uint64_t const& result) {property.set_value(component, result); }, 0.1f, 0, 0, "%zu", tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<float>())
@@ -171,17 +173,17 @@ namespace SHADE
             auto metaMin = property.get_metadata(META::min);
             auto metaMax = property.get_metadata(META::max);
             float min{}, max{};
-            if(metaMin.is_valid())
+            if (metaMin.is_valid())
               min = std::max(metaMin.template get_value<float>(), -FLT_MAX * 0.5f);
-            if(metaMax.is_valid())
+            if (metaMax.is_valid())
               max = std::min(metaMax.template get_value<float>(), FLT_MAX * 0.5f);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderFloat(property.get_name().data(), min, max, [component, property] {return property.get_value(component).to_float(); }, [component, property](float const& result) {property.set_value(component, result); });
+              SHEditorWidgets::SliderFloat(property.get_name().data(), min, max, [component, property] {return property.get_value(component).to_float(); }, [component, property](float const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
             else
             {
-              SHEditorWidgets::DragFloat(property.get_name().data(), [component, property] {return property.get_value(component).to_float(); }, [component, property](float const& result) {property.set_value(component, result); }, "Test");
+              SHEditorWidgets::DragFloat(property.get_name().data(), [component, property] {return property.get_value(component).to_float(); }, [component, property](float const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
           else if (type == rttr::type::get<double>())
@@ -190,25 +192,25 @@ namespace SHADE
             auto metaMax = property.get_metadata(META::max);
             if (metaMin.is_valid() && metaMax.is_valid())
             {
-              SHEditorWidgets::SliderScalar<double>(property.get_name().data(), ImGuiDataType_Double, metaMin.template get_value<double>(), metaMax.template get_value<double>(), [component, property] {return property.get_value(component).to_double(); }, [component, property](double const& result) {property.set_value(component, result); });
+              SHEditorWidgets::SliderScalar<double>(property.get_name().data(), ImGuiDataType_Double, metaMin.template get_value<double>(), metaMax.template get_value<double>(), [component, property] {return property.get_value(component).to_double(); }, [component, property](double const& result) {property.set_value(component, result); }, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
             else
             {
-              SHEditorWidgets::DragScalar<double>(property.get_name().data(), ImGuiDataType_Double, [component, property] {return property.get_value(component).to_double(); }, [component, property](double const& result) {property.set_value(component, result); }, 0.1f);
+              SHEditorWidgets::DragScalar<double>(property.get_name().data(), ImGuiDataType_Double, [component, property] {return property.get_value(component).to_double(); }, [component, property](double const& result) {property.set_value(component, result); }, 0.1f, {}, {}, "%.3f", tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
             }
           }
         }
         else if (type == rttr::type::get<SHVec4>())
         {
-          SHEditorWidgets::DragVec4(property.get_name().data(), { "X", "Y", "Z", "W" }, [component, property]() {return property.get_value(component).template convert<SHVec4>(); }, [component, property](SHVec4 vec) {return property.set_value(component, vec); });
+          SHEditorWidgets::DragVec4(property.get_name().data(), { "X", "Y", "Z", "W" }, [component, property]() {return property.get_value(component).template convert<SHVec4>(); }, [component, property](SHVec4 vec) {return property.set_value(component, vec); }, isAngleInRad, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
         }
         else if (type == rttr::type::get<SHVec3>())
         {
-          SHEditorWidgets::DragVec3(property.get_name().data(), { "X", "Y", "Z" }, [component, property]() {return property.get_value(component).template convert<SHVec3>(); }, [component, property](SHVec3 vec) {return property.set_value(component, vec); });
+          SHEditorWidgets::DragVec3(property.get_name().data(), { "X", "Y", "Z" }, [component, property]() {return property.get_value(component).template convert<SHVec3>(); }, [component, property](SHVec3 vec) {return property.set_value(component, vec); }, isAngleInRad, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
         }
         else if (type == rttr::type::get<SHVec2>())
         {
-          SHEditorWidgets::DragVec2(property.get_name().data(), { "X", "Y" }, [component, property]() {return property.get_value(component).template convert<SHVec2>(); }, [component, property](SHVec2 vec) {return property.set_value(component, vec); });
+          SHEditorWidgets::DragVec2(property.get_name().data(), { "X", "Y" }, [component, property]() {return property.get_value(component).template convert<SHVec2>(); }, [component, property](SHVec2 vec) {return property.set_value(component, vec); }, isAngleInRad, tooltip.is_valid() ? tooltip.template get_value<std::string>() : std::string());
         }
 
       }
@@ -223,10 +225,10 @@ namespace SHADE
       return;
 
     // Get transform component for extrapolating relative sizes
-    auto* transformComponent = SHComponentManager::GetComponent<SHTransformComponent>(component->GetEID());
+    auto* transformComponent = SHComponentManager::GetComponent_s<SHTransformComponent>(component->GetEID());
 
     const auto componentType = rttr::type::get(*component);
-    SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; });
+    SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; }, "Is Component Active");
     ImGui::SameLine();
     if (ImGui::CollapsingHeader(componentType.get_name().data()))
     {
@@ -234,8 +236,8 @@ namespace SHADE
 
       auto& colliders = component->GetColliders();
       int const size = static_cast<int>(colliders.size());
-      ImGui::BeginChild("Colliders", {0.0f,  colliders.empty() ? 1.0f : 250.0f}, true);
-      std::optional<int> colliderToDelete{std::nullopt};
+      ImGui::BeginChild("Colliders", { 0.0f,  colliders.empty() ? 1.0f : 250.0f }, true);
+      std::optional<int> colliderToDelete{ std::nullopt };
       for (int i{}; i < size; ++i)
       {
         ImGui::PushID(i);
@@ -244,12 +246,12 @@ namespace SHADE
 
         if (collider->GetType() == SHCollider::Type::BOX)
         {
-          SHEditorWidgets::BeginPanel( std::format("{} Box Collider #{}", ICON_FA_CUBE, i).data(), { ImGui::GetContentRegionAvail().x, ImGui::GetContentRegionAvail().y });
+          SHEditorWidgets::BeginPanel(std::format("{} Box Collider #{}", ICON_FA_CUBE, i).data(), { ImGui::GetContentRegionAvail().x, ImGui::GetContentRegionAvail().y });
           auto box = reinterpret_cast<SHBoundingBox*>(collider->GetShape());
           SHEditorWidgets::DragVec3
           (
-            "Half Extents", { "X", "Y", "Z" }, 
-            [box, transformComponent] { return (transformComponent->GetWorldScale() * 2.0f) * box->GetHalfExtents(); }, 
+            "Half Extents", { "X", "Y", "Z" },
+            [box, transformComponent] { return (box->GetHalfExtents() * 2.0f) / transformComponent->GetWorldScale(); },
             [collider](SHVec3 const& vec) { collider->SetBoundingBox(vec); });
         }
         else if (collider->GetType() == SHCollider::Type::SPHERE)
@@ -258,32 +260,51 @@ namespace SHADE
           auto sphere = reinterpret_cast<SHBoundingSphere*>(collider->GetShape());
           SHEditorWidgets::DragFloat
           (
-            "Radius", 
+            "Radius",
             [sphere, transformComponent]
             {
               const SHVec3& TF_WORLD_SCALE = transformComponent->GetWorldScale();
               const float MAX_SCALE = SHMath::Max({ TF_WORLD_SCALE.x, TF_WORLD_SCALE.y, TF_WORLD_SCALE.z });
               return sphere->GetRadius() / MAX_SCALE;
-            }, 
-            [collider](float const& value) { collider->SetBoundingSphere(value);});
+            },
+              [collider](float const& value) { collider->SetBoundingSphere(value); });
         }
         else if (collider->GetType() == SHCollider::Type::CAPSULE)
         {
 
         }
         {
-          SHEditorWidgets::BeginPanel("Offset", { ImGui::GetContentRegionAvail().x, 30.0f });
+          SHEditorWidgets::BeginPanel("Offsets",{ ImGui::GetContentRegionAvail().x, 30.0f });
           SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [&collider] {return collider->GetPositionOffset(); }, [&collider](SHVec3 const& vec) {collider->SetPositionOffset(vec); });
+          SHEditorWidgets::DragVec3("Rotation", { "X", "Y", "Z" }, 
+          [&collider]
+          {
+            auto offset = collider->GetRotationOffset();
+            offset.x = SHMath::RadiansToDegrees(offset.x);
+            offset.y = SHMath::RadiansToDegrees(offset.y);
+            offset.z = SHMath::RadiansToDegrees(offset.z);
+            return offset;
+          }, 
+          [&collider](SHVec3 const& vec)
+          {
+            const SHVec3 vecInRad
+            {
+              SHMath::DegreesToRadians(vec.x)
+            , SHMath::DegreesToRadians(vec.y)
+            , SHMath::DegreesToRadians(vec.z)
+            };
+            collider->SetRotationOffset(vecInRad);
+          });
           SHEditorWidgets::EndPanel();
         }
-        if(ImGui::Button(std::format("{} Remove Collider #{}", ICON_MD_REMOVE, i).data()))
+        if (ImGui::Button(std::format("{} Remove Collider #{}", ICON_MD_REMOVE, i).data()))
         {
           colliderToDelete = i;
         }
         SHEditorWidgets::EndPanel();
         ImGui::PopID();
       }
-      if(colliderToDelete.has_value())
+      if (colliderToDelete.has_value())
       {
         component->RemoveCollider(colliderToDelete.value());
       }
@@ -291,11 +312,11 @@ namespace SHADE
 
       if (ImGui::BeginMenu("Add Collider"))
       {
-        if(ImGui::Selectable("Box Collider"))
+        if (ImGui::Selectable("Box Collider"))
         {
           component->AddBoundingBox();
         }
-        if(ImGui::Selectable("Sphere Collider"))
+        if (ImGui::Selectable("Sphere Collider"))
         {
           component->AddBoundingSphere();
         }
@@ -308,10 +329,10 @@ namespace SHADE
   template<>
   static void DrawComponent(SHLightComponent* component)
   {
-        if (!component)
+    if (!component)
       return;
     const auto componentType = rttr::type::get(*component);
-    SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; });
+    SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; }, "Is Component Active");
     ImGui::SameLine();
     if (ImGui::CollapsingHeader(componentType.get_name().data()))
     {
@@ -319,19 +340,49 @@ namespace SHADE
 
       static auto const enumAlign = rttr::type::get<SH_LIGHT_TYPE>().get_enumeration();
       static std::vector<const char*> list(GetRTTREnumNames<SH_LIGHT_TYPE>());
-          
+
       SHEditorWidgets::ComboBox("Type", list, [component] {return static_cast<int>(component->GetType()); }, [component](int const& idx)
         {
           component->SetType(static_cast<SH_LIGHT_TYPE>(idx));
         });
-      SHEditorWidgets::DragVec3("Position", {"X", "Y", "Z"}, [component](){return component->GetPosition();}, [component](SHVec3 const& vec){component->SetPosition(vec);});
-      SHEditorWidgets::DragVec3("Direction", {"X", "Y", "Z"}, [component](){return component->GetDirection();}, [component](SHVec3 const& vec){component->SetDirection(vec);});
-      SHEditorWidgets::ColorPicker("Color", [component](){return component->GetColor();}, [component](SHVec4 const& rgba){component->SetColor(rgba);});
-      SHEditorWidgets::DragFloat("Strength", [component](){return component->GetStrength();}, [component](float const& value){component->SetStrength(value);});
+      SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [component]() {return component->GetPosition(); }, [component](SHVec3 const& vec) {component->SetPosition(vec); });
+      SHEditorWidgets::DragVec3("Direction", { "X", "Y", "Z" }, [component]() {return component->GetDirection(); }, [component](SHVec3 const& vec) {component->SetDirection(vec); });
+      SHEditorWidgets::ColorPicker("Color", [component]() {return component->GetColor(); }, [component](SHVec4 const& rgba) {component->SetColor(rgba); });
+      SHEditorWidgets::DragFloat("Strength", [component]() {return component->GetStrength(); }, [component](float const& value) {component->SetStrength(value); });
     }
     else
     {
       DrawContextMenu(component);
     }
   }
-}
\ No newline at end of file
+
+  template<>
+  static void DrawComponent(SHRenderable* component)
+  {
+    if (!component)
+      return;
+    const auto componentType = rttr::type::get(*component);
+    SHEditorWidgets::CheckBox("##IsActive", [component]() {return component->isActive; }, [component](bool const& active) {component->isActive = active; }, "Is Component Active");
+    ImGui::SameLine();
+    if (ImGui::CollapsingHeader(componentType.get_name().data()))
+    {
+      DrawContextMenu(component);
+      Handle<SHMesh> const& mesh = component->GetMesh();
+
+      SHEditorWidgets::DragDropReadOnlyField<AssetID>("Mesh", std::to_string(SHResourceManager::GetAssetID<SHMesh>(mesh).value_or(0)).data(), [component]()
+      {
+        Handle<SHMesh> const& mesh = component->GetMesh();
+        return SHResourceManager::GetAssetID<SHMesh>(mesh).value_or(0);
+      },
+        [component](AssetID const& id)
+        {
+          component->SetMesh(SHResourceManager::LoadOrGet<SHMesh>(id));
+          SHResourceManager::FinaliseChanges();
+        }, SHDragDrop::DRAG_RESOURCE);
+    }
+    else
+    {
+      DrawContextMenu(component);
+    }
+  }
+}
diff --git a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorInspector.cpp b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorInspector.cpp
index ebb241ef..2fecae25 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorInspector.cpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorInspector.cpp
@@ -1,6 +1,6 @@
 #include "SHpch.h"
 
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "SHEditorInspector.h"
 
 #include "ECS_Base/SHECSMacros.h"
@@ -10,17 +10,15 @@
 
 #include "Editor/SHImGuiHelpers.hpp"
 #include "Editor/SHEditorWidgets.hpp"
-#include "SHEditorComponentView.hpp"
-#include "ECS_Base/UnitTesting/SHTestComponents.h"
 #include "Graphics/MiddleEnd/Interface/SHRenderable.h"
 #include "Scripting/SHScriptEngine.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
 
-#include "ECS_Base/Managers/SHSystemManager.h"
-#include "AudioSystem/SHAudioSystem.h"
 #include "Physics/Components/SHRigidBodyComponent.h"
 #include "Physics/Components/SHColliderComponent.h"
 #include "Camera/SHCameraComponent.h"
+#include "Camera/SHCameraArmComponent.h"
+#include "SHEditorComponentView.h"
 
 namespace SHADE
 {
@@ -30,8 +28,17 @@ namespace SHADE
     bool selected = false;
     if(!SHComponentManager::HasComponent<ComponentType>(eid))
     {
-      if(selected = ImGui::Selectable(std::format("Add {}", rttr::type::get<ComponentType>().get_name().data()).data()); selected)
+      const char* componentName = rttr::type::get<ComponentType>().get_name().data();
+      if(selected = ImGui::Selectable(std::format("Add {}", componentName).data()); selected)
         SHComponentManager::AddComponent<ComponentType>(eid);
+      if(ImGui::IsItemHovered())
+      {
+        ImGui::BeginTooltip();
+        ImGui::Text("Adds", componentName); ImGui::SameLine();
+        ImGui::TextColored(ImGuiColors::green, "%s", componentName); ImGui::SameLine();
+        ImGui::Text("to this entity", componentName);
+        ImGui::EndTooltip();
+      }
     }
     return selected;
   }
@@ -42,13 +49,26 @@ namespace SHADE
     bool selected = false;
     if (!SHComponentManager::HasComponent<ComponentType>(eid))
     {
-      if(selected = ImGui::Selectable(std::format("Add {}", rttr::type::get<ComponentType>().get_name().data()).data()); selected)
+      const char* componentName = rttr::type::get<ComponentType>().get_name().data();
+
+      if(selected = ImGui::Selectable(std::format("Add {}", componentName).data()); selected)
       {
         if(SHComponentManager::GetComponent_s<EnforcedComponent>(eid) == nullptr)
           SHComponentManager::AddComponent<EnforcedComponent>(eid);
 
         SHComponentManager::AddComponent<ComponentType>(eid);
       }
+      if(ImGui::IsItemHovered())
+      {
+        ImGui::BeginTooltip();
+        ImGui::Text("Adds", componentName); ImGui::SameLine();
+        ImGui::TextColored(ImGuiColors::green, "%s", componentName); ImGui::SameLine();
+        ImGui::Text("to this entity", componentName);
+        ImGui::Text("Adds"); ImGui::SameLine();
+        ImGui::TextColored(ImGuiColors::red, "%s", rttr::type::get<EnforcedComponent>().get_name().data()); ImGui::SameLine();
+        ImGui::Text("if the entity does not already have it");
+        ImGui::EndTooltip();
+      }
     }
     return selected;
   }
@@ -107,6 +127,9 @@ namespace SHADE
         if (auto cameraComponent = SHComponentManager::GetComponent_s<SHCameraComponent>(eid))
         {
           DrawComponent(cameraComponent);
+        }if (auto cameraArmComponent = SHComponentManager::GetComponent_s<SHCameraArmComponent>(eid))
+        {
+          DrawComponent(cameraArmComponent);
         }
         ImGui::Separator();
         // Render Scripts
@@ -117,6 +140,8 @@ namespace SHADE
         {
           DrawAddComponentButton<SHTransformComponent>(eid);
           DrawAddComponentButton<SHCameraComponent>(eid);
+          DrawAddComponentButton<SHCameraArmComponent>(eid);
+          DrawAddComponentButton<SHLightComponent>(eid);
 
           // Components that require Transforms
 
diff --git a/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.cpp b/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.cpp
index c33f4fb6..06c0c2ae 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.cpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.cpp
@@ -3,7 +3,7 @@
 //#==============================================================#
 //||                       SHADE Includes                       ||
 //#==============================================================#
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "SHEditorMenuBar.h"
 #include "Editor/IconsMaterialDesign.h"
 #include "Editor/Command/SHCommandManager.h"
@@ -175,19 +175,37 @@ namespace SHADE
       ImGui::BeginDisabled(editor->editorState == SHEditor::State::PLAY);
       if(ImGui::SmallButton(ICON_MD_PLAY_ARROW))
       {
+        const SHEditorStateChangeEvent STATE_CHANGE_EVENT
+        {
+          .previousState  = editor->editorState
+        };
         editor->editorState = SHEditor::State::PLAY;
+
+        SHEventManager::BroadcastEvent<SHEditorStateChangeEvent>(STATE_CHANGE_EVENT, SH_EDITOR_ON_PLAY_EVENT);
       }
       ImGui::EndDisabled();
       ImGui::BeginDisabled(editor->editorState == SHEditor::State::PAUSE);
       if(ImGui::SmallButton(ICON_MD_PAUSE))
       {
+        const SHEditorStateChangeEvent STATE_CHANGE_EVENT
+        {
+          .previousState  = editor->editorState
+        };
         editor->editorState = SHEditor::State::PAUSE;
+
+        SHEventManager::BroadcastEvent<SHEditorStateChangeEvent>(STATE_CHANGE_EVENT, SH_EDITOR_ON_PAUSE_EVENT);
       }
       ImGui::EndDisabled();
       ImGui::BeginDisabled(editor->editorState == SHEditor::State::STOP);
       if(ImGui::SmallButton(ICON_MD_STOP))
       {
+        const SHEditorStateChangeEvent STATE_CHANGE_EVENT
+        {
+          .previousState  = editor->editorState
+        };
         editor->editorState = SHEditor::State::STOP;
+
+        SHEventManager::BroadcastEvent<SHEditorStateChangeEvent>(STATE_CHANGE_EVENT, SH_EDITOR_ON_STOP_EVENT);
       }
       ImGui::EndDisabled();
       ImGui::EndMenuBar();
diff --git a/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.h b/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.h
index 7cbcd696..e4f1d20b 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.h
+++ b/SHADE_Engine/src/Editor/EditorWindow/MenuBar/SHEditorMenuBar.h
@@ -20,4 +20,10 @@ namespace SHADE
     float menuBarHeight = 20.0f;
     std::vector<std::filesystem::path> layoutPaths;
   };//class SHEditorMenuBar
+
+  struct SHEditorStateChangeEvent
+  {
+    SHEditor::State previousState;
+  };
+
 }//namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.cpp b/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.cpp
index f5170999..d6ef8d19 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.cpp
+++ b/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.cpp
@@ -5,13 +5,16 @@
 #include "ImGuizmo.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
 #include "Editor/IconsMaterialDesign.h"
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "Editor/EditorWindow/HierarchyPanel/SHHierarchyPanel.h"
 #include "Graphics/MiddleEnd/Interface/SHGraphicsSystem.h"
 #include "Graphics/Descriptors/SHVkDescriptorSetGroup.h"
 #include "Graphics/MiddleEnd/Interface/SHMousePickSystem.h"
 #include <Editor/IconsFontAwesome6.h>
 
+#include "Camera/SHCameraSystem.h"
+#include "FRC/SHFramerateController.h"
+
 constexpr std::string_view windowName = "\xef\x80\x95 Viewport";
 
 namespace SHADE
@@ -30,8 +33,15 @@ namespace SHADE
   void SHEditorViewport::Update()
   {
     SHEditorWindow::Update();
-    ImGui::PushStyleVar(ImGuiStyleVar_WindowPadding, ImVec2(0.0f,0.0f));
-    if(Begin())
+    if (shouldUpdateCamera)
+    {
+      auto camSystem = SHSystemManager::GetSystem<SHCameraSystem>();
+      camSystem->UpdateEditorCamera(SHFrameRateController::GetRawDeltaTime());
+      shouldUpdateCamera = false;
+    }
+    ImGui::PushStyleVar(ImGuiStyleVar_WindowPadding, ImVec2(0.0f, 0.0f));
+
+    if (Begin())
     {
       ImGuizmo::SetDrawlist();
       DrawMenuBar();
@@ -39,21 +49,38 @@ namespace SHADE
       auto const& descriptorSet = gfxSystem->GetPostOffscreenRenderSystem()->GetDescriptorSetGroup()->GetVkHandle()[0];
       auto mousePos = ImGui::GetMousePos();
       beginCursorPos = ImGui::GetCursorScreenPos();
-      viewportMousePos = {mousePos.x - beginCursorPos.x, mousePos.y - beginCursorPos.y};
-      gfxSystem->GetMousePickSystem ()->SetViewportMousePos (viewportMousePos);
+      viewportMousePos = { mousePos.x - beginCursorPos.x, mousePos.y - beginCursorPos.y };
+      gfxSystem->GetMousePickSystem()->SetViewportMousePos(viewportMousePos);
 
-      ImGui::Image((ImTextureID)descriptorSet, {beginContentRegionAvailable.x, beginContentRegionAvailable.y});
+      ImGui::Image((ImTextureID)descriptorSet, { beginContentRegionAvailable.x, beginContentRegionAvailable.y });
 
-      if(ImGui::IsWindowHovered() && ImGui::IsMouseDown(ImGuiMouseButton_Right))
+      if (ImGui::IsWindowHovered() && ImGui::IsMouseDown(ImGuiMouseButton_Right))
       {
         ImGui::SetMouseCursor(ImGuiMouseCursor_None);
         ImGui::SetCursorScreenPos(ImGui::GetMousePos());
         ImGui::PushStyleColor(ImGuiCol_Text, ImGuiColors::green);
         ImGui::Text(ICON_FA_EYE);
         ImGui::PopStyleColor();
+        
+        shouldUpdateCamera = true;
+      }
+      if (ImGui::IsWindowFocused() && !ImGui::IsMouseDown(ImGuiMouseButton_Right))
+      {
+        if (ImGui::IsKeyReleased(ImGuiKey_Q))
+        {
+          transformGizmo.operation = SHTransformGizmo::Operation::TRANSLATE;
+        }
+        if (ImGui::IsKeyReleased(ImGuiKey_W))
+        {
+          transformGizmo.operation = SHTransformGizmo::Operation::ROTATE;
+        }
+        if (ImGui::IsKeyReleased(ImGuiKey_E))
+        {
+          transformGizmo.operation = SHTransformGizmo::Operation::SCALE;
+        }
       }
     }
-    ImGuizmo::SetRect(beginCursorPos.x , beginCursorPos.y, beginContentRegionAvailable.x, beginContentRegionAvailable.y);
+    ImGuizmo::SetRect(beginCursorPos.x, beginCursorPos.y, beginContentRegionAvailable.x, beginContentRegionAvailable.y);
     transformGizmo.Draw();
     ImGui::End();
     ImGui::PopStyleVar();
@@ -72,11 +99,12 @@ namespace SHADE
 
     //auto pos = ImGui::GetCursorPos();
     //windowCursorPos = {}
-    if(beginContentRegionAvailable.x == 0 || beginContentRegionAvailable.y == 0)
+    if (beginContentRegionAvailable.x == 0 || beginContentRegionAvailable.y == 0)
     {
-      beginContentRegionAvailable =  windowSize;
+      beginContentRegionAvailable = windowSize;
     }
     gfxSystem->PrepareResize(static_cast<uint32_t>(beginContentRegionAvailable.x), static_cast<uint32_t>(beginContentRegionAvailable.y));
+    shouldUpdateCamera = true;
   }
 
   void SHEditorViewport::OnPosChange()
@@ -86,44 +114,63 @@ namespace SHADE
 
   void SHEditorViewport::DrawMenuBar() noexcept
   {
-    if(ImGui::BeginMenuBar())
+    if (ImGui::BeginMenuBar())
     {
+      ImGui::BeginDisabled(ImGui::IsWindowFocused() && ImGui::IsMouseDown(ImGuiMouseButton_Right));
       bool const isTranslate = transformGizmo.operation == SHTransformGizmo::Operation::TRANSLATE;
       ImGui::BeginDisabled(isTranslate);
-      if(isTranslate)
+      if (isTranslate)
         ImGui::PushStyleColor(ImGuiCol_Text, ImGui::GetStyle().Colors[ImGuiCol_CheckMark]);
-      if(ImGui::Button(ICON_MD_OPEN_WITH))
+      if (ImGui::Button(ICON_MD_OPEN_WITH))
       {
         transformGizmo.operation = SHTransformGizmo::Operation::TRANSLATE;
       }
       ImGui::EndDisabled();
-      if(isTranslate)
+      if (ImGui::IsItemHovered(ImGuiHoveredFlags_AllowWhenDisabled))
+      {
+        ImGui::BeginTooltip();
+        ImGui::Text("Translate [Q]");
+        ImGui::EndTooltip();
+      }
+      if (isTranslate)
         ImGui::PopStyleColor();
 
       bool const isRotate = transformGizmo.operation == SHTransformGizmo::Operation::ROTATE;
       ImGui::BeginDisabled(isRotate);
-      if(isRotate)
+      if (isRotate)
         ImGui::PushStyleColor(ImGuiCol_Text, ImGui::GetStyle().Colors[ImGuiCol_CheckMark]);
-      if(ImGui::Button(ICON_MD_AUTORENEW))
+      if (ImGui::Button(ICON_MD_AUTORENEW))
       {
         transformGizmo.operation = SHTransformGizmo::Operation::ROTATE;
       }
       ImGui::EndDisabled();
-      if(isRotate)
+      if (ImGui::IsItemHovered(ImGuiHoveredFlags_AllowWhenDisabled))
+      {
+        ImGui::BeginTooltip();
+        ImGui::Text("Rotate [W]");
+        ImGui::EndTooltip();
+      }
+      if (isRotate)
         ImGui::PopStyleColor();
 
       bool const isScale = transformGizmo.operation == SHTransformGizmo::Operation::SCALE;
       ImGui::BeginDisabled(isScale);
-      if(isScale)
+      if (isScale)
         ImGui::PushStyleColor(ImGuiCol_Text, ImGui::GetStyle().Colors[ImGuiCol_CheckMark]);
-      if(ImGui::Button(ICON_MD_EXPAND))
+      if (ImGui::Button(ICON_MD_EXPAND))
       {
         transformGizmo.operation = SHTransformGizmo::Operation::SCALE;
       }
       ImGui::EndDisabled();
-      if(isScale)
+      if (ImGui::IsItemHovered(ImGuiHoveredFlags_AllowWhenDisabled))
+      {
+        ImGui::BeginTooltip();
+        ImGui::Text("Scale [E]");
+        ImGui::EndTooltip();
+      }
+      if (isScale)
         ImGui::PopStyleColor();
-      
+      ImGui::EndDisabled();
       ImGui::EndMenuBar();
     }
   }
diff --git a/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.h b/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.h
index 80b13285..0fae4317 100644
--- a/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.h
+++ b/SHADE_Engine/src/Editor/EditorWindow/ViewportWindow/SHEditorViewport.h
@@ -14,7 +14,7 @@
 
 namespace SHADE
 {
-    class SHEditorViewport final : public SHEditorWindow
+  class SHEditorViewport final : public SHEditorWindow
   {
   public:
     SHEditorViewport();
@@ -28,5 +28,6 @@ namespace SHADE
   private:
     void DrawMenuBar() noexcept;
     SHVec2 beginCursorPos;
+    bool shouldUpdateCamera = false;
   };//class SHEditorViewport
 }//namespace SHADE
diff --git a/SHADE_Engine/src/Editor/Gizmos/SHTransformGizmo.cpp b/SHADE_Engine/src/Editor/Gizmos/SHTransformGizmo.cpp
index 3c984051..e3bbc809 100644
--- a/SHADE_Engine/src/Editor/Gizmos/SHTransformGizmo.cpp
+++ b/SHADE_Engine/src/Editor/Gizmos/SHTransformGizmo.cpp
@@ -3,7 +3,7 @@
 
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "Editor/SHImGuiHelpers.hpp"
 #include <imgui.h>
 #include <ImGuizmo.h>
@@ -63,6 +63,9 @@ namespace SHADE
     if (selectedEntityTransformComponent == nullptr)
       return;
 
+    if(!selectedEntityTransformComponent->isActive)
+      return;
+
     SHMatrix mat = selectedEntityTransformComponent->GetTRS();
     useSnap = ImGui::IsKeyDown(ImGuiKey_LeftCtrl);
     if(useSnap)
diff --git a/SHADE_Engine/src/Editor/SHEditor.cpp b/SHADE_Engine/src/Editor/SHEditor.cpp
index 06fadfee..cf5056a5 100644
--- a/SHADE_Engine/src/Editor/SHEditor.cpp
+++ b/SHADE_Engine/src/Editor/SHEditor.cpp
@@ -21,7 +21,7 @@
 #include "Graphics/MiddleEnd/Interface/SHViewport.h"
 #include "Graphics/MiddleEnd/Interface/SHRenderer.h"
 
-#include "SHEditor.hpp"
+#include "SHEditor.h"
 #include "SHEditorWidgets.hpp"
 
 #include "Math/Transform/SHTransformSystem.h"
@@ -175,7 +175,7 @@ namespace SHADE
     ImFontConfig icons_config{}; icons_config.MergeMode = true; icons_config.GlyphOffset.y = 5.f;
     constexpr ImWchar icon_ranges_fa[] = { ICON_MIN_FA, ICON_MAX_FA, 0 };
     ImFont* UIFontFA = io->Fonts->AddFontFromFileTTF("../../Assets/Editor/Fonts/fa-solid-900.ttf", 20.f, &icons_config, icon_ranges_fa); //TODO: Change to config based assets path
-    constexpr ImWchar icon_ranges_md[] = { ICON_MIN_MD, ICON_MAX_MD, 0 };
+    constexpr ImWchar icon_ranges_md[] = { ICON_MIN_MD, ICON_MAX_16_MD, 0 };
     ImFont* UIFontMD = io->Fonts->AddFontFromFileTTF("../../Assets/Editor/Fonts/MaterialIcons-Regular.ttf", 20.f, &icons_config, icon_ranges_md); //TODO: Change to config based assets path
     io->Fonts->Build();
   }
@@ -293,6 +293,7 @@ namespace SHADE
   //#==============================================================#
   void SHEditor::InitBackend()
   {
+#ifdef SHEDITOR
     if(ImGui_ImplSDL2_InitForVulkan(sdlWindow) == false)
     {
       SHLOG_CRITICAL("Editor backend initialisation; Failed to perform SDL initialisation for Vulkan")
@@ -339,6 +340,7 @@ namespace SHADE
     renderGraph->GetNode("ImGui Node")->GetSubpass("ImGui Draw")->AddExteriorDrawCalls([](Handle<SHVkCommandBuffer>& cmd) {
       ImGui_ImplVulkan_RenderDrawData(ImGui::GetDrawData(), cmd->GetVkCommandBuffer());
       });
+#endif
   }
 
   void SHEditor::PollPicking()
diff --git a/SHADE_Engine/src/Editor/SHEditor.hpp b/SHADE_Engine/src/Editor/SHEditor.h
similarity index 98%
rename from SHADE_Engine/src/Editor/SHEditor.hpp
rename to SHADE_Engine/src/Editor/SHEditor.h
index 34405390..624069db 100644
--- a/SHADE_Engine/src/Editor/SHEditor.hpp
+++ b/SHADE_Engine/src/Editor/SHEditor.h
@@ -15,7 +15,7 @@
 #include "ECS_Base/System/SHSystemRoutine.h"
 #include "Resource/SHHandle.h"
 #include "EditorWindow/SHEditorWindow.h"
-#include "Tools/SHLogger.h"
+#include "Tools/SHLog.h"
 #include "Gizmos/SHTransformGizmo.h"
 
 
@@ -76,7 +76,7 @@ namespace SHADE
       }
       else
       {
-        SHLOG_WARNING("Attempt to create duplicate of Editor window type")
+        SHLog::Warning("Attempt to create duplicate of Editor window type");
       }
     }
 
diff --git a/SHADE_Engine/src/Editor/SHEditorUI.cpp b/SHADE_Engine/src/Editor/SHEditorUI.cpp
index 0137b951..cc63c565 100644
--- a/SHADE_Engine/src/Editor/SHEditorUI.cpp
+++ b/SHADE_Engine/src/Editor/SHEditorUI.cpp
@@ -16,6 +16,7 @@ of DigiPen Institute of Technology is prohibited.
 // External Dependencies
 #include <imgui.h>
 #include "SHEditorWidgets.hpp"
+#include "ECS_Base/Managers/SHEntityManager.h"
 
 namespace SHADE
 {
@@ -156,7 +157,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::Checkbox("#", &value);
+    return ImGui::Checkbox("##", &value);
   }
   bool SHEditorUI::InputInt(const std::string& label, int& value, bool* isHovered)
   {
@@ -164,7 +165,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputInt("#", &value,
+    return ImGui::InputInt("##", &value,
                            1, 10,
                            ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -175,7 +176,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    const bool CHANGED = InputInt("#", signedVal);
+    const bool CHANGED = InputInt("##", signedVal);
     if (CHANGED)
     {
       signedVal = std::clamp(signedVal, 0, std::numeric_limits<int>::max());
@@ -189,7 +190,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputFloat("#", &value,
+    return ImGui::InputFloat("##", &value,
                              0.1f, 1.0f, "%.3f", 
                              ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -199,7 +200,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputDouble("#", &value,
+    return ImGui::InputDouble("##", &value,
                               0.1, 1.0, "%.3f", 
                               ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -209,7 +210,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    return ImGui::InputDouble("#", &value,
+    return ImGui::InputDouble("##", &value,
                               1.0, 45.0, "%.3f", 
                               ImGuiInputTextFlags_EnterReturnsTrue);
   }
@@ -279,7 +280,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    const bool CHANGED = ImGui::InputText("#", &buffer[0], TEXT_FIELD_MAX_LENGTH);
+    const bool CHANGED = ImGui::InputText("##", &buffer[0], TEXT_FIELD_MAX_LENGTH);
     if (CHANGED)
     {
       value = std::string(buffer.data(), buffer.data() + TEXT_FIELD_MAX_LENGTH);
@@ -287,6 +288,35 @@ namespace SHADE
     return CHANGED;
   }
 
+  bool SHEditorUI::InputGameObjectField(const std::string& label, uint32_t& value, bool* isHovered)
+  {
+    ImGui::Text(label.c_str());
+    if (isHovered)
+      *isHovered = ImGui::IsItemHovered();
+    ImGui::SameLine();
+    SHEntity* entity = SHEntityManager::GetEntityByID(value);
+    std::ostringstream oss;
+    if (entity)
+    {
+      oss << value << ": " << entity->name;
+    }
+    std::string entityName = oss.str();
+    bool changed = ImGui::InputText("##", &entityName, ImGuiInputTextFlags_ReadOnly);
+    if (SHDragDrop::BeginTarget())
+    {
+      if (const std::vector<EntityID>* payload = SHDragDrop::AcceptPayload<std::vector<EntityID>>(SHDragDrop::DRAG_EID))
+      {
+        if (!payload->empty())
+        {
+          value = payload->at(0);
+          changed = true;
+        }
+        SHDragDrop::EndTarget();
+      }
+    }
+    return changed;
+  }
+
   bool SHEditorUI::InputEnumCombo(const std::string& label, int& v, const std::vector<std::string>& enumNames, bool* isHovered)
   {
     // Clamp input value
@@ -297,7 +327,7 @@ namespace SHADE
     if (isHovered)
         *isHovered = ImGui::IsItemHovered();
     ImGui::SameLine();
-    if (ImGui::BeginCombo("#", INITIAL_NAME.c_str(), ImGuiComboFlags_None))
+    if (ImGui::BeginCombo("##", INITIAL_NAME.c_str(), ImGuiComboFlags_None))
     {
       for (int i = 0; i < enumNames.size(); ++i)
       {
diff --git a/SHADE_Engine/src/Editor/SHEditorUI.h b/SHADE_Engine/src/Editor/SHEditorUI.h
index f3051aa1..d4104639 100644
--- a/SHADE_Engine/src/Editor/SHEditorUI.h
+++ b/SHADE_Engine/src/Editor/SHEditorUI.h
@@ -308,6 +308,14 @@ namespace SHADE
     /// <returns>True if the value was changed.</returns>
     static bool InputTextField(const std::string& label, std::string& value, bool* isHovered = nullptr);
     /// <summary>
+    /// Creates a drag field widget for int input.
+    /// </summary>
+    /// <param name="label">Label used to identify this widget.</param>
+    /// <param name="value">Reference to the variable to store the result.</param>
+    /// <param name="isHovered>If set, stores the hover state of this widget.</param>
+    /// <returns>True if the value was changed.</returns>
+    static bool InputGameObjectField(const std::string& label, uint32_t& value, bool* isHovered = nullptr);
+    /// <summary>
     /// Creates a combo box for enumeration input.
     /// </summary>
     /// <typeparam name="Enum">The type of enum to input.</typeparam>
diff --git a/SHADE_Engine/src/Editor/SHEditorWidgets.hpp b/SHADE_Engine/src/Editor/SHEditorWidgets.hpp
index 46538827..053348d7 100644
--- a/SHADE_Engine/src/Editor/SHEditorWidgets.hpp
+++ b/SHADE_Engine/src/Editor/SHEditorWidgets.hpp
@@ -22,6 +22,8 @@
 #include <misc/cpp/imgui_stdlib.h>
 #include <rttr/type.h>
 
+#include "DragDrop/SHDragDrop.hpp"
+
 namespace SHADE
 {
   class SH_API SHEditorWidgets
@@ -41,7 +43,7 @@ namespace SHADE
       ImGui::BeginGroup();
 
       auto itemSpacing = ImGui::GetStyle().ItemSpacing;
-      ImGui::PushStyleVar(ImGuiStyleVar_FramePadding, ImVec2(0.0f, 0.0f));
+      ImGui::PushStyleVar(ImGuiStyleVar_FramePadding, ImVec2(0.0f, 0.2f));
       ImGui::PushStyleVar(ImGuiStyleVar_ItemSpacing, ImVec2(0.0f, 0.0f));
 
       auto frameHeight = ImGui::GetFrameHeight();
@@ -86,7 +88,7 @@ namespace SHADE
 
       auto itemSpacing = ImGui::GetStyle().ItemSpacing;
 
-      ImGui::PushStyleVar(ImGuiStyleVar_FramePadding, ImVec2(0.0f, 0.0f));
+      ImGui::PushStyleVar(ImGuiStyleVar_FramePadding, ImVec2(0.0f, 0.2f));
       ImGui::PushStyleVar(ImGuiStyleVar_ItemSpacing, ImVec2(0.0f, 0.0f));
 
       auto frameHeight = ImGui::GetFrameHeight();
@@ -127,7 +129,7 @@ namespace SHADE
 
         ImGui::GetWindowDrawList()->AddRect(
           frameRect.Min, frameRect.Max,
-          ImColor(ImGui::GetStyleColorVec4(ImGuiCol_Button)),
+          ImColor(ImGui::GetStyleColorVec4(ImGuiCol_TextDisabled)),
           halfFrame.x);
 
         ImGui::PopClipRect();
@@ -174,15 +176,19 @@ namespace SHADE
       ImGui::SetColumnWidth(-1, 80.0f);
       ImGui::Text(label.c_str());
       if (isHovered)
-        *isHovered = ImGui::IsItemHovered();
+        *isHovered |= ImGui::IsItemHovered();
       ImGui::NextColumn();
       for (std::size_t i = 0; i < N; ++i)
       {
         ImGui::PushID(static_cast<int>(i));
-        ImGui::TextUnformatted(componentLabels[i].c_str(), ImGui::FindRenderedTextEnd(componentLabels[i].c_str())); ImGui::SameLine();
+        ImGui::TextUnformatted(componentLabels[i].c_str(), ImGui::FindRenderedTextEnd(componentLabels[i].c_str()));
+        if (isHovered)
+          *isHovered |= ImGui::IsItemHovered();
+        ImGui::SameLine();
         ImGui::SetNextItemWidth(80.0f);
         valueChanged |= ImGui::DragFloat("##v", values[i], speed, valueMin, valueMax, displayFormat, flags);
-
+        if (isHovered)
+          *isHovered |= ImGui::IsItemHovered();
         const ImVec2 min = ImGui::GetItemRectMin();
         const ImVec2 max = ImGui::GetItemRectMax();
         const float spacing = g.Style.FrameRounding;
@@ -203,23 +209,31 @@ namespace SHADE
     }
 
     static bool DragVec2(const std::string& label, std::vector<std::string>const& componentLabels, std::function<SHVec2(void)> get,
-      std::function<void(SHVec2)> set, float speed = 0.1f, const char* displayFormat = "%.3f", std::string_view const& tooltip = {}, float valueMin = 0.0f, float valueMax = 0.0f,
+      std::function<void(SHVec2)> set, bool const& isAnAngleInRad = false, std::string_view const& tooltip = {}, float speed = 0.1f, const char* displayFormat = "%.3f", float valueMin = 0.0f, float valueMax = 0.0f,
       ImGuiSliderFlags flags = 0)
     {
       SHVec2 values = get();
+      if(isAnAngleInRad)
+      {
+        values = {SHMath::RadiansToDegrees(values.x), SHMath::RadiansToDegrees(values.y)};
+      }
       bool const changed = DragN<float, 2>(label, componentLabels, { &values.x, &values.y }, speed, displayFormat, valueMin, valueMax, flags);
       static bool startRecording = false;
       if (changed)
       {
+        if(isAnAngleInRad)
+        {
+          values = {SHMath::DegreesToRadians(values.x), SHMath::DegreesToRadians(values.y)};
+        }
         SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<SHVec2>>(get(), values, set)), startRecording);
         if (!startRecording)
           startRecording = true;
       }
       if (startRecording && ImGui::IsMouseReleased(ImGuiMouseButton_Left))
         startRecording = false;
-      if(!tooltip.empty())
+      if (!tooltip.empty())
       {
-        if(ImGui::IsItemHovered())
+        if (ImGui::IsItemHovered())
         {
           ImGui::BeginTooltip();
           ImGui::Text(tooltip.data());
@@ -230,17 +244,24 @@ namespace SHADE
     }
 
     static bool DragVec3(const std::string& label, std::vector<std::string>const& componentLabels, std::function<SHVec3(void)> get,
-      std::function<void(SHVec3)> set, float speed = 0.1f, const char* displayFormat = "%.3f", std::string_view const& tooltip = {}, float valueMin = 0.0f, float valueMax = 0.0f,
+      std::function<void(SHVec3)> set, bool const& isAnAngleInRad = false, std::string_view const& tooltip = {}, float speed = 0.1f, const char* displayFormat = "%.3f", float valueMin = 0.0f, float valueMax = 0.0f,
       ImGuiSliderFlags flags = 0)
     {
       SHVec3 values = get();
-      bool const changed = DragN<float, 3>(label, componentLabels, { &values.x, &values.y, &values.z }, speed, displayFormat, valueMin, valueMax, flags);
-
-
+      if(isAnAngleInRad)
+      {
+        values = {SHMath::RadiansToDegrees(values.x), SHMath::RadiansToDegrees(values.y), SHMath::RadiansToDegrees(values.z)};
+      }
+      bool isHovered = false;
+      bool const changed = DragN<float, 3>(label, componentLabels, { &values.x, &values.y, &values.z }, speed, displayFormat, valueMin, valueMax, flags, &isHovered);
       static bool startRecording = false;
       if (changed)
       {
         SHVec3 old = get();
+        if(isAnAngleInRad)
+        {
+          values = {SHMath::DegreesToRadians(values.x), SHMath::DegreesToRadians(values.y), SHMath::DegreesToRadians(values.z)};
+        }
         SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<SHVec3>>(old, values, set)), startRecording);
         if (!startRecording)
           startRecording = true;
@@ -249,9 +270,9 @@ namespace SHADE
       {
         startRecording = false;
       }
-      if(!tooltip.empty())
+      if (!tooltip.empty())
       {
-        if(ImGui::IsItemHovered())
+        if (isHovered)
         {
           ImGui::BeginTooltip();
           ImGui::Text(tooltip.data());
@@ -262,14 +283,22 @@ namespace SHADE
     }
 
     static bool DragVec4(const std::string& label, std::vector<std::string>const& componentLabels, std::function<SHVec4(void)> get,
-      std::function<void(SHVec4)> set, float speed = 0.1f, const char* displayFormat = "%.3f", std::string_view const& tooltip = {}, float valueMin = 0.0f, float valueMax = 0.0f,
+      std::function<void(SHVec4)> set, bool const& isAnAngleInRad = false, std::string_view const& tooltip = {}, float speed = 0.1f, const char* displayFormat = "%.3f", float valueMin = 0.0f, float valueMax = 0.0f,
       ImGuiSliderFlags flags = 0)
     {
       SHVec4 values = get();
+      if(isAnAngleInRad)
+      {
+        values = {SHMath::RadiansToDegrees(values.x), SHMath::RadiansToDegrees(values.y), SHMath::RadiansToDegrees(values.z), SHMath::RadiansToDegrees(values.w)};
+      }
       bool const changed = DragN<float, 4>(label, componentLabels, { &values.x, &values.y, &values.z, &values.w }, speed, displayFormat, valueMin, valueMax, flags);
       static bool startRecording = false;
       if (changed)
       {
+        if(isAnAngleInRad)
+        {
+          values = {SHMath::DegreesToRadians(values.x), SHMath::DegreesToRadians(values.y), SHMath::DegreesToRadians(values.z), SHMath::DegreesToRadians(values.w)};
+        }
         SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<SHVec4>>(get(), values, set)), startRecording);
         if (!startRecording)
           startRecording = true;
@@ -278,9 +307,9 @@ namespace SHADE
       {
         startRecording = false;
       }
-      if(!tooltip.empty())
+      if (!tooltip.empty())
       {
-        if(ImGui::IsItemHovered())
+        if (ImGui::IsItemHovered())
         {
           ImGui::BeginTooltip();
           ImGui::Text(tooltip.data());
@@ -297,7 +326,7 @@ namespace SHADE
     static void TextLabel(std::string_view const& text, bool sameLine = true)
     {
       const ImVec2 textSize = ImGui::CalcTextSize(text.data(), NULL, true);
-      if(textSize.x > 0.0f)
+      if (textSize.x > 0.0f)
       {
         ImGui::Text(text.data());
         ImGui::SameLine();
@@ -310,32 +339,32 @@ namespace SHADE
       ImGui::BeginGroup();
       ImGui::PushID(label.data());
       TextLabel(label);
-      if (ImGui::Checkbox("##", &value))
+      bool const changed = ImGui::Checkbox("##", &value);
+      if (changed)
       {
         SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<bool>>(get(), value, set)), false);
-        return true;
       }
       ImGui::PopID();
       ImGui::EndGroup();
-      if(!tooltip.empty())
+      if (!tooltip.empty())
       {
-        if(ImGui::IsItemHovered())
+        if (ImGui::IsItemHovered())
         {
           ImGui::BeginTooltip();
           ImGui::Text(tooltip.data());
           ImGui::EndTooltip();
         }
       }
-      return false;
+      return changed;
     }
 
     template<typename T>
-    static bool RadioButton(std::vector<std::string> const& label, std::vector<T> const& listTypes, std::function<T(void)> get, std::function<void(T const&)> set ,std::string_view const& tooltip = {})
+    static bool RadioButton(std::vector<std::string> const& label, std::vector<T> const& listTypes, std::function<T(void)> get, std::function<void(T const&)> set, std::string_view const& tooltip = {})
     {
       T type = get();
       ImGui::BeginGroup();
       ImGui::PushID(label.data());
-      TextLabel(label);
+      //TextLabel(label);
       for (size_t i = 0; i < listTypes.size(); i++)
       {
         if (ImGui::RadioButton(label[i].c_str(), type == listTypes[i]))
@@ -366,12 +395,11 @@ namespace SHADE
       ImGui::BeginGroup();
       ImGui::PushID(label.data());
       TextLabel(label);
-      if (ImGui::InputText("##", &text, flag, callback, userData))
+      bool const changed = ImGui::InputText("##", &text, flag, callback, userData);
+      if (changed)
       {
         if (ImGui::IsItemDeactivatedAfterEdit())
           SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<std::string>>(get(), text, set)), false);
-
-        return true;
       }
       ImGui::PopID();
       ImGui::EndGroup();
@@ -384,7 +412,37 @@ namespace SHADE
           ImGui::EndTooltip();
         }
       }
-      return false;
+      return changed;
+    }
+
+    template<typename T>
+    static bool DragDropReadOnlyField(std::string const& label, std::string_view const& fieldVTextValue, std::function<T (void)> const& get, std::function<void(T const&)> const& set, SHDragDrop::DragDropTag const& dragDropTag, std::string_view const& tooltip = {})
+    {
+      std::string text = fieldVTextValue.data();
+      ImGui::BeginGroup();
+      ImGui::PushID(label.data());
+      TextLabel(label);
+      bool const changed = ImGui::InputText("##", &text, ImGuiInputTextFlags_ReadOnly, nullptr, nullptr);
+      if(SHDragDrop::BeginTarget())
+      {
+        if(T* payload = SHDragDrop::AcceptPayload<T>(dragDropTag))
+        {
+          SHCommandManager::PerformCommand(std::reinterpret_pointer_cast<SHBaseCommand>(std::make_shared<SHCommand<T>>(get(), *payload, set)), false);
+          SHDragDrop::EndTarget();
+        }
+      }
+      ImGui::PopID();
+      ImGui::EndGroup();
+      if (!tooltip.empty())
+      {
+        if (ImGui::IsItemHovered())
+        {
+          ImGui::BeginTooltip();
+          ImGui::Text(tooltip.data());
+          ImGui::EndTooltip();
+        }
+      }
+      return changed;
     }
 
     template <typename T>
@@ -442,9 +500,9 @@ namespace SHADE
       }
       ImGui::PopID();
       ImGui::EndGroup();
-      if(!tooltip.empty())
+      if (!tooltip.empty())
       {
-        if(ImGui::IsItemHovered())
+        if (ImGui::IsItemHovered())
         {
           ImGui::BeginTooltip();
           ImGui::Text(tooltip.data());
diff --git a/SHADE_Engine/src/Events/SHEventDefines.h b/SHADE_Engine/src/Events/SHEventDefines.h
index 804fbfec..d649fabf 100644
--- a/SHADE_Engine/src/Events/SHEventDefines.h
+++ b/SHADE_Engine/src/Events/SHEventDefines.h
@@ -13,4 +13,7 @@ constexpr SHEventIdentifier SH_COMPONENT_REMOVED_EVENT        { 4 };
 constexpr SHEventIdentifier SH_SCENEGRAPH_CHANGE_PARENT_EVENT { 5 };
 constexpr SHEventIdentifier SH_PHYSICS_COLLIDER_ADDED_EVENT   { 6 };
 constexpr SHEventIdentifier SH_PHYSICS_COLLIDER_REMOVED_EVENT { 7 };
+constexpr SHEventIdentifier SH_EDITOR_ON_PLAY_EVENT           { 8 };
+constexpr SHEventIdentifier SH_EDITOR_ON_PAUSE_EVENT          { 9 };
+constexpr SHEventIdentifier SH_EDITOR_ON_STOP_EVENT           { 10 };
 
diff --git a/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.cpp b/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.cpp
index a744c795..fb64bcc2 100644
--- a/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.cpp
+++ b/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.cpp
@@ -282,6 +282,11 @@ namespace SHADE
 
   }
 
+  void SHVkCommandBuffer::SetLineWidth(float lineWidth) noexcept
+  {
+    vkCommandBuffer.setLineWidth(lineWidth);
+  }
+
   /***************************************************************************/
   /*!
 
diff --git a/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.h b/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.h
index 4c978c34..bc0d4b04 100644
--- a/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.h
+++ b/SHADE_Engine/src/Graphics/Commands/SHVkCommandBuffer.h
@@ -115,6 +115,7 @@ namespace SHADE
 
     // Dynamic State
     void SetViewportScissor (float vpWidth, float vpHeight, uint32_t sWidth, uint32_t sHeight, float vpX = 0.0f, float vpY = 0.0f, int32_t sX = 0.0f, int32_t sY = 0.0f, float vpMinDepth = 0.0f, float vpMaxDepth = 1.0f) noexcept;
+    void SetLineWidth       (float lineWidth) noexcept;
 
     // Binding Commands
     void BindPipeline       (Handle<SHVkPipeline> const& pipelineHdl) noexcept;
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHBatch.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHBatch.cpp
index 1bda7c90..22d1875b 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHBatch.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHBatch.cpp
@@ -74,11 +74,12 @@ namespace SHADE
 
   void SHBatch::Remove(const SHRenderable* renderable)
   {
-    // Check if we have a SubBatch with the same mesh yet
+    // Check if we have a SubBatch with the existing mesh yet (if changed, we use the old mesh)
+    Handle<SHMesh> prevSubBatchMesh = renderable->HasMeshChanged() ? renderable->GetPrevMesh() : renderable->GetMesh();
     auto subBatch = std::find_if(subBatches.begin(), subBatches.end(), [&](const SHSubBatch& batch)
-      {
-        return batch.Mesh == renderable->GetMesh();
-      });
+    {
+      return batch.Mesh == prevSubBatchMesh;
+    });
 
     // Attempt to remove if it exists
     if (subBatch == subBatches.end())
@@ -88,9 +89,7 @@ namespace SHADE
 
     // Check if other renderables in subBatches contain the same material instance
     bool matUnused = true;
-
     Handle<SHMaterialInstance> matToCheck = renderable->HasMaterialChanged() ? renderable->GetPrevMaterial() : renderable->GetMaterial();
-
     for (const auto& sb : subBatches)
     {
       // Check material usage
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHSuperBatch.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHSuperBatch.cpp
index 434e7163..df389879 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHSuperBatch.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Batching/SHSuperBatch.cpp
@@ -37,9 +37,9 @@ namespace SHADE
 
     // Check if we have a batch with the same pipeline first
     auto batch = std::find_if(batches.begin(), batches.end(), [&](const SHBatch& batch)
-      {
-        return batch.GetPipeline() == PIPELINE;
-      });
+    {
+      return batch.GetPipeline() == PIPELINE;
+    });
 
 
     // Create one if not found
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
new file mode 100644
index 00000000..08019665
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.cpp
@@ -0,0 +1,202 @@
+/************************************************************************************//*!
+\file           SHDebugDrawSystem.cpp
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 16, 2022
+\brief          Contains the definition of functions of the SHDebugDrawSystem class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#include "SHpch.h"
+#include "SHDebugDrawSystem.h"
+// STL Includes
+#include <algorithm>
+// Project Includes
+#include "../Meshes/SHMeshData.h"
+#include "../Meshes/SHPrimitiveGenerator.h"
+#include "ECS_Base/Managers/SHSystemManager.h"
+#include "SHGraphicsSystem.h"
+#include "Graphics/Devices/SHVkLogicalDevice.h"
+#include "../../SHVkUtil.h"
+#include "Graphics/MiddleEnd/Interface/SHViewport.h"
+#include "Graphics/MiddleEnd/Interface/SHRenderer.h"
+
+namespace SHADE
+{
+    /*---------------------------------------------------------------------------------*/
+    /* DrawRoutine                                                                     */
+    /*---------------------------------------------------------------------------------*/
+    SHDebugDrawSystem::ProcessPointsRoutine::ProcessPointsRoutine()
+    : SHSystemRoutine("Debug Draw", true)
+    {
+        SystemFamily::GetID<SHDebugDrawSystem>();
+    }
+
+    void SHDebugDrawSystem::ProcessPointsRoutine::Execute(double dt) noexcept
+    {
+        auto gfxSys = SHSystemManager::GetSystem<SHGraphicsSystem>();
+        if (!gfxSys)
+        {
+            SHLOG_WARNING("[DebugDraw] Attempted to do debug draw without a graphics system.");
+            return;
+        }
+
+        // Get current frame index
+        const uint32_t FRAME_IDX = gfxSys->GetCurrentFrameIndex();
+
+        // Create the buffer if it doesn't exist or just update it
+        SHDebugDrawSystem* system = static_cast<SHDebugDrawSystem*>(GetSystem());
+        system->numPoints[FRAME_IDX] = system->points.size();
+        const uint32_t DATA_SIZE = sizeof(PointVertex) * system->points.size();
+        if (DATA_SIZE > 0)
+        {
+          system->vertexBuffers[FRAME_IDX]->WriteToMemory(system->points.data(), DATA_SIZE, 0, 0);
+        }
+
+        // Reset for next frame
+        system->points.clear();
+    }
+    
+    /*---------------------------------------------------------------------------------*/
+    /* SHSystem overrides                                                              */
+    /*---------------------------------------------------------------------------------*/
+    void SHDebugDrawSystem::Init()
+    {
+        // Register function for subpass
+        const auto* GFX_SYSTEM = SHSystemManager::GetSystem<SHGraphicsSystem>();
+        auto const& RENDERERS = GFX_SYSTEM->GetDefaultViewport()->GetRenderers();
+        auto renderGraph = RENDERERS[SHGraphicsConstants::RenderGraphIndices::WORLD]->GetRenderGraph();
+        auto subPass = renderGraph->GetNode("Debug Draw")->GetSubpass("Debug Draw");
+        subPass->AddExteriorDrawCalls([this, GFX_SYSTEM](Handle<SHVkCommandBuffer>& cmdBuffer)
+        {
+            // Get Current frame index
+            const uint32_t FRAME_IDX = GFX_SYSTEM->GetCurrentFrameIndex();
+
+            // Don't draw if no points
+            if (numPoints[FRAME_IDX] <= 0)
+              return;
+
+            cmdBuffer->BindPipeline(GFX_SYSTEM->GetDebugDrawPipeline());
+            cmdBuffer->SetLineWidth(LineWidth);
+            cmdBuffer->BindVertexBuffer(0, vertexBuffers[FRAME_IDX], 0);
+            cmdBuffer->DrawArrays(numPoints[FRAME_IDX], 1, 0, 0);
+        });
+
+        // Reset trackers
+        std::fill_n(numPoints.begin(), numPoints.size(), 0);
+
+        // Allocate buffers
+        static constexpr uint32_t BUFFER_SIZE = MAX_POINTS * sizeof(PointVertex);
+        for (Handle<SHVkBuffer>& bufHandle : vertexBuffers)
+        {
+          bufHandle = GFX_SYSTEM->GetDevice()->CreateBuffer
+          (
+            BUFFER_SIZE,
+            nullptr,
+            0,
+            vk::BufferUsageFlagBits::eVertexBuffer,
+            VmaMemoryUsage::VMA_MEMORY_USAGE_AUTO,
+            VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_HOST_ACCESS_SEQUENTIAL_WRITE_BIT | VmaAllocationCreateFlagBits::VMA_ALLOCATION_CREATE_MAPPED_BIT
+          );
+        }
+    }
+
+    void SHDebugDrawSystem::Exit()
+    {
+        for (auto vertexBuffer : vertexBuffers)
+        {
+            if (vertexBuffer)
+                vertexBuffer.Free();
+        }
+    }
+
+    /*---------------------------------------------------------------------------------*/
+    /* Draw Functions                                                                  */
+    /*---------------------------------------------------------------------------------*/
+    void SHDebugDrawSystem::DrawLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
+    {
+        if (points.size() > MAX_POINTS)
+        {
+            SHLOG_WARNING("[DebugDraw] Exceeded maximum size of drawable debug elements.");
+            return;
+        }
+
+        points.emplace_back(PointVertex{ startPt, color });
+        points.emplace_back(PointVertex{ endPt, color });
+    }
+
+    void SHDebugDrawSystem::DrawTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+    {
+        DrawPoly(color, { pt1, pt2, pt3 });
+    }
+
+    void SHDebugDrawSystem::DrawQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+    {
+        DrawPoly(color, { pt1, pt2, pt3, pt4 });
+    }
+
+    void SHDebugDrawSystem::DrawPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
+    {
+        DrawPoly(color, pointList.begin(), pointList.end());
+    }
+
+    void SHDebugDrawSystem::DrawCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
+    {
+        static const SHVec3 EXTENTS = SHVec3 { 0.5f, 0.5f, 0.5f };
+        static const SHVec3 UNIT_BOT_LEFT_FRONT  = SHVec3 { pos - EXTENTS };
+        static const SHVec3 UNIT_BOT_RIGHT_FRONT = SHVec3 { pos + SHVec3 {  EXTENTS.x, -EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_BOT_RIGHT_BACK  = SHVec3 { pos + SHVec3 {  EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_BOT_LEFT_BACK   = SHVec3 { pos + SHVec3 { -EXTENTS.x, -EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_LEFT_BACK   = SHVec3 { pos + SHVec3 { -EXTENTS.x,  EXTENTS.y,  EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_RIGHT_FRONT = SHVec3 { pos + SHVec3 {  EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_LEFT_FRONT  = SHVec3 { pos + SHVec3 { -EXTENTS.x,  EXTENTS.y, -EXTENTS.z } };
+        static const SHVec3 UNIT_TOP_RIGHT_BACK  = SHVec3 { pos + EXTENTS };
+        
+        const SHVec3 BOT_LEFT_BACK   = UNIT_BOT_LEFT_BACK   * size;
+        const SHVec3 BOT_RIGHT_BACK  = UNIT_BOT_RIGHT_BACK  * size;
+        const SHVec3 BOT_LEFT_FRONT  = UNIT_BOT_LEFT_FRONT  * size;
+        const SHVec3 BOT_RIGHT_FRONT = UNIT_BOT_RIGHT_FRONT * size;
+        const SHVec3 TOP_LEFT_BACK   = UNIT_TOP_LEFT_BACK   * size;
+        const SHVec3 TOP_RIGHT_BACK  = UNIT_TOP_RIGHT_BACK  * size;
+        const SHVec3 TOP_LEFT_FRONT  = UNIT_TOP_LEFT_FRONT  * size;
+        const SHVec3 TOP_RIGHT_FRONT = UNIT_TOP_RIGHT_FRONT * size;
+
+        DrawPoly
+        (
+            color,
+            {
+                // Bottom Square
+                BOT_LEFT_BACK  , BOT_RIGHT_BACK,
+                BOT_RIGHT_BACK , BOT_RIGHT_FRONT,
+                BOT_RIGHT_FRONT, BOT_LEFT_FRONT,
+                BOT_LEFT_FRONT , BOT_LEFT_BACK,
+                // Top Square
+                TOP_LEFT_BACK  , TOP_RIGHT_BACK,
+                TOP_RIGHT_BACK , TOP_RIGHT_FRONT,
+                TOP_RIGHT_FRONT, TOP_LEFT_FRONT,
+                TOP_LEFT_FRONT , TOP_LEFT_BACK,
+                // Middle Lines
+                TOP_LEFT_BACK  , BOT_LEFT_BACK,
+                TOP_RIGHT_BACK , BOT_RIGHT_BACK,
+                TOP_RIGHT_FRONT, BOT_RIGHT_FRONT,
+                TOP_LEFT_FRONT , BOT_LEFT_FRONT
+            }
+        );
+    }
+
+    void SHDebugDrawSystem::DrawSphere(const SHVec4& color, const SHVec3& pos, double radius)
+    {
+        if (spherePoints.empty())
+        {
+            // Generate
+            static const SHMeshData SPHERE = SHPrimitiveGenerator::Sphere();
+            for (const auto& idx : SPHERE.Indices)
+            {
+                spherePoints.emplace_back(SPHERE.VertexPositions[idx]);
+            }
+        }
+        DrawPoly(color, spherePoints.begin(), spherePoints.end());
+    }
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
new file mode 100644
index 00000000..4b83958d
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h
@@ -0,0 +1,159 @@
+/************************************************************************************//*!
+\file           SHDebugDrawSystem.h
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 16, 2022
+\brief          Contains the definition of the SHDebugDrawSystem class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+
+// STL Includes
+#include <vector>
+// Project Includes
+#include "SH_API.h"
+#include "Math/Vector/SHVec2.h"
+#include "Math/Vector/SHVec3.h"
+#include "Math/Vector/SHVec4.h"
+#include "ECS_Base/System/SHSystem.h"
+#include "ECS_Base/System/SHSystemRoutine.h"
+#include "Resource/SHHandle.h"
+#include "Graphics/Buffers/SHVkBuffer.h"
+#include "SHGraphicsConstants.h"
+#include "Math/SHColour.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Forward Declarations                                                              */
+  /*-----------------------------------------------------------------------------------*/
+  class SHVkBuffer;
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Type Definitions                                                                  */
+  /*-----------------------------------------------------------------------------------*/
+  /// <summary>
+  /// Manages the Debug Draw system.
+  /// </summary>
+  class SH_API SHDebugDrawSystem final : public SHSystem
+  {
+    public:
+    /*---------------------------------------------------------------------------------*/
+    /* System Routines                                                                 */
+    /*---------------------------------------------------------------------------------*/
+    class SH_API ProcessPointsRoutine final : public SHSystemRoutine
+    { 
+      public:
+	  ProcessPointsRoutine();
+      virtual void Execute(double dt) noexcept override final;
+    };
+
+    /*---------------------------------------------------------------------------------*/
+    /* SHSystem overrides                                                              */
+    /*---------------------------------------------------------------------------------*/
+    virtual void Init() override final;
+    virtual void Exit() override final;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Configuration Functions                                                         */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Configures the line width used to draw all lines in the Debug Draw system.
+    /// </summary>
+    float LineWidth = 1.0f;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Draw Functions                                                                  */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Renders a line between two points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the line.</param>
+    /// <param name="startPt">First point of the line.</param>
+    /// <param name="endPt">Second point of the line.</param>
+    void DrawLine(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    /// <summary>
+    /// Renders a triangle indicated by three points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the triangle.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the triangle.</param>
+    /// <param name="pt3">Third point of the triangle.</param>
+    void DrawTri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3);
+    /// <summary>
+    /// Renders a quadrilateral indicated by four points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the quadrilateral.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the quadrilateral.</param>
+    /// <param name="pt3">Third point of the quadrilateral.</param>
+    /// <param name="pt4">Third point of the quadrilateral.</param>
+    void DrawQuad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointList">List of points for the polygon.</param>
+    void DrawPoly(const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space.
+    /// </summary>
+    /// <typeparam name="IterType">Iterator for a STL-like container.</typeparam>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointListBegin">
+    /// Iterator to the first point of the point container.
+    /// </param>
+    /// <param name="pointListEnd">
+    /// One past last iterator of the point container.
+    /// </param>
+    template<typename IterType>
+    void DrawPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd);
+    /// <summary>
+    /// Renders a wireframe cube centered around the position specified in world space.
+    /// </summary>
+    /// <param name="color">Colour of the cube.</param>
+    /// <param name="pos">Position where the cube wil be centered at.</param>
+    /// <param name="size">Size of the rendered cube.</param>
+    void DrawCube(const SHVec4& color, const SHVec3& pos, const SHVec3& size);
+    /// <summary>
+    /// Renders a wireframe sphere centered around the position specified in world space.
+    /// </summary>
+    /// <param name="color">Colour of the sphere.</param>
+    /// <param name="pos">Position where the sphere wil be centered at.</param>
+    /// <param name="size">Size of the rendered sphere.</param>
+    void DrawSphere(const SHVec4& color, const SHVec3& pos, double radius);
+
+    private:
+    /*---------------------------------------------------------------------------------*/
+    /* Type Definitions                                                                */
+    /*---------------------------------------------------------------------------------*/
+    struct SH_API PointVertex
+    {
+        SHVec4 Position;
+        SHVec4 Color;
+    };
+    using TripleBuffer = std::array<Handle<SHVkBuffer>, SHGraphicsConstants::NUM_FRAME_BUFFERS>;
+    using TripleUInt = std::array<uint32_t, SHGraphicsConstants::NUM_FRAME_BUFFERS>;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Constants                                                                       */
+    /*---------------------------------------------------------------------------------*/
+    static constexpr uint32_t MAX_POINTS = 100'000;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Data Members                                                                    */
+    /*---------------------------------------------------------------------------------*/
+    // CPU Buffers
+    std::vector<PointVertex> points;
+    // GPU Buffers
+    TripleBuffer vertexBuffers;
+    TripleUInt   numPoints;
+    // Cached Points for polygon drawing
+    std::vector<SHVec3> spherePoints;
+  };
+}
+
+#include "SHDebugDrawSystem.hpp"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
new file mode 100644
index 00000000..14fbb42f
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHDebugDrawSystem.hpp
@@ -0,0 +1,48 @@
+/************************************************************************************//*!
+\file           SHDebugDrawSystem.hpp
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 16, 2022
+\brief          Contains the definition of template functions the SHDebugDrawSystem
+                class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+#include "SHDebugDrawSystem.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Draw Functions                                                                    */
+  /*-----------------------------------------------------------------------------------*/
+  template<typename IterType>
+  void SHDebugDrawSystem::DrawPoly(const SHVec4& color, IterType pointListBegin, IterType pointListEnd)
+  {
+    // Ensure dereferenced type is SHVec3
+    static_assert(std::is_same_v<SHVec3, std::remove_cvref_t<decltype(*pointListBegin)>>, "Parameters to DrawPoly must be SHVec3.");
+
+    // Check if points exceeded max
+    if (points.size() > MAX_POINTS)
+    {
+      SHLOG_WARNING("[DebugDraw] Exceeded maximum size of drawable debug elements.");
+      return;
+    }
+
+    const size_t POINTS_COUNT = pointListEnd - pointListBegin;
+    // Invalid polygon
+    if (POINTS_COUNT < 2)
+    {
+      SHLOG_WARNING("[SHDebugDraw] Invalid polygon provided to DrawPoly().");
+      return;
+    }
+
+    const size_t POINTS_ROUNDED_COUNT = POINTS_COUNT / 2 * 2;
+    for (auto pointIter = pointListBegin; pointIter != (pointListBegin + POINTS_ROUNDED_COUNT); ++pointIter)
+    {
+      points.emplace_back(PointVertex{ *pointIter, color });
+    }
+  }
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
index af3b46e1..eb9269e6 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.cpp
@@ -17,7 +17,7 @@ of DigiPen Institute of Technology is prohibited.
 #include "Graphics/Windowing/Surface/SHVkSurface.h"
 #include "Graphics/Swapchain/SHVkSwapchain.h"
 #include "Camera/SHCameraSystem.h"
-#include "Editor/SHEditor.hpp"
+#include "Editor/SHEditor.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
 //#include "SHRenderer.h"
 #include "Graphics/Windowing/SHWindow.h"
@@ -37,8 +37,10 @@ of DigiPen Institute of Technology is prohibited.
 #include "Assets/Asset Types/SHTextureAsset.h"
 #include "Graphics/MiddleEnd/Interface/SHMousePickSystem.h"
 #include "Graphics/MiddleEnd/Lights/SHLightingSubSystem.h"
-#include "Graphics/RenderGraph/SHRenderGraphNodeCompute.h"
 #include "Assets/SHAssetManager.h"
+#include "Resource/SHResourceManager.h"
+#include "Graphics/SHVkUtil.h"
+#include "Graphics/RenderGraph/SHRenderGraphNodeCompute.h"
 
 namespace SHADE
 {
@@ -106,19 +108,16 @@ namespace SHADE
     descPool = device->CreateDescriptorPools();
 
     // Create generic command buffer
-    //transferCmdPool = device->CreateCommandPool(SH_QUEUE_FAMILY_ARRAY_INDEX::GRAPHICS, SH_CMD_POOL_RESET::POOL_BASED, true);
     graphicsCmdPool = device->CreateCommandPool(SH_QUEUE_FAMILY_ARRAY_INDEX::GRAPHICS, SH_CMD_POOL_RESET::POOL_BASED, true);
-    transferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
-    graphicsTexCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
 
-    SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_VS.glsl");
-    SHAssetManager::CompileAsset("../../Assets/Shaders/TestCube_FS.glsl");
-    SHAssetManager::CompileAsset("../../Assets/Shaders/DeferredComposite_CS.glsl");
-    SHAssetManager::CompileAsset("../../Assets/Shaders/SSAO_CS.glsl");
-    SHAssetManager::CompileAsset("../../Assets/Shaders/SSAOBlur_CS.glsl");
-
-    shaderModuleLibrary.ImportAllShaderSource(device);
-    shaderModuleLibrary.ReflectAllShaderModules();
+    // Load Built In Shaders
+    static constexpr AssetID VS_DEFAULT   = 39210065; defaultVertShader       = SHResourceManager::LoadOrGet<SHVkShaderModule>(VS_DEFAULT);
+    static constexpr AssetID FS_DEFAULT   = 46377769; defaultFragShader       = SHResourceManager::LoadOrGet<SHVkShaderModule>(FS_DEFAULT);
+    static constexpr AssetID VS_DEBUG     = 48002439; debugVertShader         = SHResourceManager::LoadOrGet<SHVkShaderModule>(VS_DEBUG);
+    static constexpr AssetID FS_DEBUG     = 36671027; debugFragShader         = SHResourceManager::LoadOrGet<SHVkShaderModule>(FS_DEBUG);
+    static constexpr AssetID CS_COMPOSITE = 45072428; deferredCompositeShader = SHResourceManager::LoadOrGet<SHVkShaderModule>(CS_COMPOSITE);
+    static constexpr AssetID SSAO         = 38430899; ssaoShader              = SHResourceManager::LoadOrGet<SHVkShaderModule>(SSAO);
+    static constexpr AssetID SSAO_BLUR    = 39760835; ssaoBlurShader          = SHResourceManager::LoadOrGet<SHVkShaderModule>(SSAO_BLUR);
   }
 
   void SHGraphicsSystem::InitSceneRenderGraph(void) noexcept
@@ -220,7 +219,6 @@ namespace SHADE
 
     ssaoStorage->PrepareRotationVectorsVkData(device);
 
-    auto ssaoShader = shaderModuleLibrary.GetBuiltInShaderModule("SSAO_CS");
     Handle<SHRenderGraphNodeCompute> ssaoPass = gBufferNode->AddNodeCompute(ssaoShader, {"Position", "Normals", "SSAO"});
     auto ssaoDataBuffer = ssaoStorage->GetBuffer();
     ssaoPass->ModifyWriteDescBufferComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_BUFFER_BINDING, { &ssaoDataBuffer, 1 }, 0, ssaoStorage->GetBuffer()->GetSizeStored());
@@ -228,21 +226,21 @@ namespace SHADE
     auto viewSamplerLayout = ssaoStorage->GetViewSamplerLayout();
     ssaoPass->ModifyWriteDescImageComputeResource(SHGraphicsConstants::DescriptorSetIndex::RENDERGRAPH_NODE_COMPUTE_RESOURCE, SHSSAO::DESC_SET_IMAGE_BINDING, {&viewSamplerLayout, 1});
 
-    auto ssaoBlurShader = shaderModuleLibrary.GetBuiltInShaderModule("SSAOBlur_CS");
     Handle<SHRenderGraphNodeCompute> ssaoBlurPass = gBufferNode->AddNodeCompute(ssaoBlurShader, { "SSAO", "SSAO Blur"});
 
 
     /*-----------------------------------------------------------------------*/
     /* DEFERRED COMPOSITE SUBPASS INIT                                       */
     /*-----------------------------------------------------------------------*/
-    auto deferredCompositeShader = shaderModuleLibrary.GetBuiltInShaderModule("DeferredComposite_CS");
     gBufferNode->AddNodeCompute(deferredCompositeShader, { "Position", "Normals", "Albedo", "Light Layer Indices", "SSAO Blur", "Scene" });
 
-    /*-----------------------------------------------------------------------*/
-    /* DUMMY SUBPASS TO TRANSITION SCENE FOR PRESENT USAGE                   */
-    /*-----------------------------------------------------------------------*/
-    // Dummy to transition scene to be used for shader read
-    auto dummyNode = worldRenderGraph->AddNode("Dummy Pass", { "Scene" }, {"G-Buffer"}); // no predecessors
+    // Set up Debug Draw Pass
+    auto debugDrawNode = worldRenderGraph->AddNode("Debug Draw", { "Scene" }, {"G-Buffer"});
+    auto debugDrawSubpass = debugDrawNode->AddSubpass("Debug Draw");
+    debugDrawSubpass->AddColorOutput("Scene");
+
+    // Dummy Node
+    auto dummyNode = worldRenderGraph->AddNode("Dummy Pass", { "Scene" }, { "Debug Draw" }); // no predecessors
     auto dummySubpass = dummyNode->AddSubpass("Dummy Subpass");
     dummySubpass->AddInput("Scene");
 
@@ -262,10 +260,57 @@ namespace SHADE
 
     worldRenderer->SetCameraDirector(cameraSystem->CreateDirector());
 
-    auto cubeVS = shaderModuleLibrary.GetBuiltInShaderModule("TestCube_VS");
-    auto cubeFS = shaderModuleLibrary.GetBuiltInShaderModule("TestCube_FS");
+    // Create default materials
+    defaultMaterial = AddMaterial(defaultVertShader, defaultFragShader, gBufferSubpass);
 
-    defaultMaterial = AddMaterial(cubeVS, cubeFS, gBufferSubpass);
+    // Create debug draw pipeline
+    auto debugDrawPipelineLayout = resourceManager.Create<SHVkPipelineLayout>
+    (
+      device, SHPipelineLayoutParams
+      {
+        .shaderModules = { debugVertShader, debugFragShader },
+        .globalDescSetLayouts = SHGraphicsGlobalData::GetDescSetLayouts()
+      }
+    );
+    debugDrawPipeline = resourceManager.Create<SHVkPipeline>(device, debugDrawPipelineLayout, nullptr, debugDrawNode->GetRenderpass(), debugDrawSubpass);
+    debugDrawPipeline->GetPipelineState().SetRasterizationState(SHRasterizationState
+    {
+      .polygonMode = vk::PolygonMode::eLine,
+      .cull_mode = vk::CullModeFlagBits::eNone
+    });
+    debugDrawPipeline->GetPipelineState().SetInputAssemblyState(SHInputAssemblyState
+    {
+      .topology = vk::PrimitiveTopology::eLineList
+    });
+
+    SHVertexInputState debugDrawVertexInputState;
+    debugDrawVertexInputState.AddBinding(false, true, { SHVertexAttribute(SHAttribFormat::FLOAT_4D), SHVertexAttribute(SHAttribFormat::FLOAT_4D) });
+    debugDrawPipeline->GetPipelineState().SetVertexInputState(debugDrawVertexInputState);
+    SHColorBlendState colorBlendState{};
+    colorBlendState.logic_op_enable = VK_FALSE;
+    colorBlendState.logic_op = vk::LogicOp::eCopy;
+
+    auto const& subpassColorReferences = debugDrawSubpass->GetColorAttachmentReferences();
+    colorBlendState.attachments.reserve(subpassColorReferences.size());
+
+    for (auto& att : subpassColorReferences)
+    {
+      colorBlendState.attachments.push_back(vk::PipelineColorBlendAttachmentState
+        {
+          .blendEnable = SHVkUtil::IsBlendCompatible(debugDrawSubpass->GetFormatFromAttachmentReference(att.attachment)),
+          .srcColorBlendFactor = vk::BlendFactor::eSrcAlpha,
+          .dstColorBlendFactor = vk::BlendFactor::eOneMinusSrcAlpha,
+          .colorBlendOp = vk::BlendOp::eAdd,
+          .srcAlphaBlendFactor = vk::BlendFactor::eOne,
+          .dstAlphaBlendFactor = vk::BlendFactor::eZero,
+          .alphaBlendOp = vk::BlendOp::eAdd,
+          .colorWriteMask = vk::ColorComponentFlagBits::eR | vk::ColorComponentFlagBits::eG | vk::ColorComponentFlagBits::eB | vk::ColorComponentFlagBits::eA,
+        }
+      );
+    }
+
+    debugDrawPipeline->GetPipelineState().SetColorBlenState(colorBlendState);
+    debugDrawPipeline->ConstructPipeline();
   }
 
   void SHGraphicsSystem::InitMiddleEnd(void) noexcept
@@ -696,10 +741,14 @@ namespace SHADE
 
   void SHGraphicsSystem::BuildMeshBuffers()
   {
+      transferCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
+      device->WaitIdle();
 	  transferCmdBuffer->BeginRecording();
 	  meshLibrary.BuildBuffers(device, transferCmdBuffer);
 	  transferCmdBuffer->EndRecording();
 	  graphicsQueue->SubmitCommandBuffer({ transferCmdBuffer });
+      device->WaitIdle();
+      transferCmdBuffer.Free(); transferCmdBuffer = {};
   }
 
   /*---------------------------------------------------------------------------------*/
@@ -724,10 +773,14 @@ namespace SHADE
 
   void SHGraphicsSystem::BuildTextures()
   {
+      graphicsTexCmdBuffer = graphicsCmdPool->RequestCommandBuffer(SH_CMD_BUFFER_TYPE::PRIMARY);
+      device->WaitIdle();
       texLibrary.BuildTextures
       (
           device, graphicsTexCmdBuffer, graphicsQueue, descPool
       );
+      device->WaitIdle();
+      graphicsTexCmdBuffer.Free(); graphicsTexCmdBuffer = {};
   }
 
 #pragma endregion ADD_REMOVE
@@ -767,6 +820,7 @@ namespace SHADE
   void SHGraphicsSystem::EndRoutine::Execute(double) noexcept
   {
     reinterpret_cast<SHGraphicsSystem*>(system)->EndRender();
+    SHResourceManager::FinaliseChanges();
   }
   
   /*-----------------------------------------------------------------------------------*/
@@ -784,8 +838,13 @@ namespace SHADE
       if (!renderable.HasChanged())
         continue;
     
-      // Remove from old material's SuperBatch
-      Handle<SHMaterialInstance> prevMaterial = renderable.GetPrevMaterial();
+      if (!renderable.GetMesh())
+      {
+        SHLOG_CRITICAL("NULL Mesh provided!");
+      }
+
+      // Remove from the SuperBatch it is previously in (prevMat if mat has changed)
+      Handle<SHMaterialInstance> prevMaterial = renderable.HasMaterialChanged() ? renderable.GetPrevMaterial() : renderable.GetMaterial();
       if (prevMaterial)
       {
         Handle<SHSuperBatch> oldSuperBatch = prevMaterial->GetBaseMaterial()->GetPipeline()->GetPipelineState().GetSubpass()->GetSuperBatch();
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
index 9b95ebe4..d8b4650e 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystem.h
@@ -25,7 +25,6 @@ of DigiPen Institute of Technology is prohibited.
 #include "ECS_Base/System/SHSystemRoutine.h"
 #include "Graphics/Descriptors/SHVkDescriptorPool.h"
 #include "Graphics/RenderGraph/SHRenderGraph.h"
-#include "Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.h"
 #include "SHMeshLibrary.h"
 #include "Graphics/MiddleEnd/Materials/SHMaterialInstanceCache.h"
 #include "../Textures/SHTextureLibrary.h"
@@ -290,10 +289,13 @@ namespace SHADE
     Handle<SHMousePickSystem>           GetMousePickSystem(void) const noexcept {return mousePickSystem;};
     Handle<SHPostOffscreenRenderSystem> GetPostOffscreenRenderSystem(void) const noexcept {return postOffscreenRender;};
     Handle<SHRenderGraphNode>           GetPrimaryRenderpass() const noexcept;
-    //SHRenderGraph const& GetRenderGraph(void) const noexcept;
-
-    //Handle<SHVkRenderpass> GetRenderPass() const { return renderPass; }
+    Handle<SHVkPipeline>                GetDebugDrawPipeline(void) const noexcept { return debugDrawPipeline; }
+    uint32_t                            GetCurrentFrameIndex(void) const noexcept { return renderContext.GetCurrentFrame(); }
 
+    /*-----------------------------------------------------------------------------*/
+    /* Getters                                                                     */
+    /*-----------------------------------------------------------------------------*/
+    SHWindow* GetWindow() noexcept { return window; }
 
   private:
     /*-----------------------------------------------------------------------------*/
@@ -322,11 +324,12 @@ namespace SHADE
     SHWindow*                                                 window = nullptr;
 
     // Middle End Resources
-    SHResourceHub                                           resourceManager;
+    SHResourceHub                                             resourceManager;
     SHMeshLibrary                                             meshLibrary;
     SHTextureLibrary                                          texLibrary;
     SHSamplerCache                                            samplerCache;
     SHMaterialInstanceCache                                   materialInstanceCache;
+
     // Viewports  
 #ifdef SHEDITOR
     Handle<SHViewport>                                        editorViewport;
@@ -337,21 +340,26 @@ namespace SHADE
     Handle<SHViewport>                                        worldViewport;    // Whole screen
     std::vector<Handle<SHViewport>>                           viewports;          // Additional viewports
 
-    // Debug Renderers
-    Handle<SHRenderer>                                        debugWorldRenderer;
-    Handle<SHRenderer>                                        debugScreenRenderer;
-
     // Temp renderers
     Handle<SHRenderer>                                        worldRenderer;
 
     // Temp Cameras
     Handle<SHCamera>                                          worldCamera;
     Handle<SHCamera>                                          screenCamera;
-    
-    SHShaderModuleLibrary                                     shaderModuleLibrary;
 
-    // Temp Materials
+    // Built-In Shaders
+    Handle<SHVkShaderModule>                                  defaultVertShader;
+    Handle<SHVkShaderModule>                                  defaultFragShader;
+    Handle<SHVkShaderModule>                                  debugVertShader;
+    Handle<SHVkShaderModule>                                  debugFragShader;
+    Handle<SHVkShaderModule>                                  deferredCompositeShader;
+    Handle<SHVkShaderModule>                                  ssaoShader;
+    Handle<SHVkShaderModule>                                  ssaoBlurShader;
+
+
+    // Built-In Materials
     Handle<SHMaterial>                                        defaultMaterial;
+    Handle<SHVkPipeline>                                      debugDrawPipeline;
 
     Handle<SHRenderGraph>                                     worldRenderGraph;
 
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.cpp
new file mode 100644
index 00000000..1ad46e04
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.cpp
@@ -0,0 +1,77 @@
+/************************************************************************************//*!
+\file           SHGraphicsSystemInterface.cpp
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definitions of the functions of the static 
+                SHGraphicsSystemInterface class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+// Precompiled Headers
+#include "SHpch.h"
+// Primary Header
+#include "SHGraphicsSystemInterface.h"
+// Project Includes
+#include "ECS_Base/Managers/SHSystemManager.h"
+#include "Graphics/MiddleEnd/Interface/SHGraphicsSystem.h"
+#include "Graphics/Windowing/SHWindow.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Static Usage Functions                                                            */
+  /*-----------------------------------------------------------------------------------*/
+  uint32_t SHGraphicsSystemInterface::GetWindowWidth()
+  {
+    auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
+    if (gfxSystem)
+    {
+      const auto WND = gfxSystem->GetWindow();
+      return WND->GetWindowSize().first;
+    }
+
+    SHLOG_WARNING("[SHGraphicsSystemInterface] Failed to get window width. Value of 0 returned instead.");
+    return 0;
+  }
+
+  uint32_t SHGraphicsSystemInterface::GetWindowHeight()
+  {
+    auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
+    if (gfxSystem)
+    {
+      const auto WND = gfxSystem->GetWindow();
+      return WND->GetWindowSize().second;
+    }
+
+    SHLOG_WARNING("[SHGraphicsSystemInterface] Failed to get window height. Value of 0 returned instead.");
+    return 0;
+  }
+
+  bool SHGraphicsSystemInterface::IsFullscreen()
+  {
+    auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
+    if (gfxSystem)
+    {
+      const auto WND = gfxSystem->GetWindow();
+      return WND->GetWindowData().isFullscreen;
+    }
+
+    SHLOG_WARNING("[SHGraphicsSystemInterface] Failed to get window fullscreen status. Value of false returned instead.");
+    return false;
+  }
+
+  void SHGraphicsSystemInterface::CloseWindow()
+  {
+    auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
+    if (gfxSystem)
+    {
+      auto WND = gfxSystem->GetWindow();
+      return WND->Close();
+    }
+
+    SHLOG_WARNING("[SHGraphicsSystemInterface] Failed to close window.");
+  }
+}
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.h b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.h
new file mode 100644
index 00000000..5bc77ed9
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.h
@@ -0,0 +1,52 @@
+/************************************************************************************//*!
+\file           SHGraphicsSystemInterface.h
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definition of the SHGraphicsSystemInterface static class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+
+namespace SHADE
+{
+  /// <summary>
+  /// Static class that wraps up certain functions in the SHGraphicsSystem so that 
+  /// accessing it from SHADE_Managed would not cause issues due to C++20 features.
+  /// </summary>
+  class SH_API SHGraphicsSystemInterface final
+  {
+    public:
+    /*---------------------------------------------------------------------------------*/
+    /* Constructor                                                                     */
+    /*---------------------------------------------------------------------------------*/
+    SHGraphicsSystemInterface() = delete;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Static Usage Functions                                                          */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Retrieves the current window width.
+    /// </summary>
+    /// <returns>The current window width.</returns>
+    static uint32_t GetWindowWidth();
+    /// <summary>
+    /// Retrieves the current window height.
+    /// </summary>
+    /// <returns>The current window height.</returns>
+    static uint32_t GetWindowHeight();
+    /// <summary>
+    /// Retrieves the current window fullscreen status.
+    /// </summary>
+    /// <returns>The current window fullscreen status..</returns>
+    static bool IsFullscreen();
+    /// <summary>
+    /// Closes the current window, and depending on the implementation, should also
+    /// close the application.
+    /// </summary>
+    static void CloseWindow();
+  };
+}
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Materials/SHMaterialSpec.h b/SHADE_Engine/src/Graphics/MiddleEnd/Materials/SHMaterialSpec.h
new file mode 100644
index 00000000..338c34b2
--- /dev/null
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Materials/SHMaterialSpec.h
@@ -0,0 +1,36 @@
+/************************************************************************************//*!
+\file           SHMaterialSpec.h
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief			Contains the struct definition of SHMaterialSpec.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+// Standard Library
+#include <string>
+#include <vector>
+#include <utility>
+// Project Includes
+#include "Assets/SHAssetMacros.h"
+
+namespace SHADE
+{
+  /*************************************************************************************/
+  /*!
+    \brief
+    Describes a Material's serialized properties. A representation of a material that is
+    independent of GPU resources.
+  */
+  /*************************************************************************************/
+  struct SHMaterialSpec
+  {
+    AssetID vertexShader;
+    AssetID fragShader;
+    std::string subpassName;
+    YAML::Node properties;
+  };
+}
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.cpp
index be181beb..c9a3f6c5 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.cpp
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.cpp
@@ -3,7 +3,7 @@
 \author         Tng Kah Wei, kahwei.tng, 390009620
 \par            email: kahwei.tng\@digipen.edu
 \date           Aug 30, 2022
-\brief          Contains definitions for all of the functions of the classes that deal 
+\brief          Contains definitions for all of the functions of the classes that deal
                 with storage and management of vertex and index buffers of meshes.
 
 Copyright (C) 2022 DigiPen Institute of Technology.
@@ -18,50 +18,59 @@ of DigiPen Institute of Technology is prohibited.
 
 namespace SHADE
 {
+  /*-----------------------------------------------------------------------------------*/
+  /* Static Member Definitions                                                         */
+  /*-----------------------------------------------------------------------------------*/
+  SHMeshData SHPrimitiveGenerator::cubeMesh;
+  SHMeshData SHPrimitiveGenerator::sphereMesh;
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Primitive Generation Functions                                                    */
+  /*-----------------------------------------------------------------------------------*/
   SHMeshData SHPrimitiveGenerator::Cube() noexcept
   {
     SHMeshData mesh;
 
-    mesh.VertexPositions = 
+    mesh.VertexPositions =
     {
       // front
-      SHVec3(-0.5f, -0.5f,  0.5f),  
-      SHVec3( 0.5f, -0.5f,  0.5f), 
-      SHVec3( 0.5f,  0.5f,  0.5f), 
-      SHVec3(-0.5f,  0.5f,  0.5f), 
+      SHVec3(-0.5f, -0.5f,  0.5f),
+      SHVec3(0.5f, -0.5f,  0.5f),
+      SHVec3(0.5f,  0.5f,  0.5f),
+      SHVec3(-0.5f,  0.5f,  0.5f),
 
       // back
-      SHVec3(-0.5f, -0.5f, -0.5f), 
-      SHVec3(-0.5f,  0.5f, -0.5f), 
-      SHVec3( 0.5f,  0.5f, -0.5f), 
-      SHVec3( 0.5f, -0.5f, -0.5f), 
+      SHVec3(-0.5f, -0.5f, -0.5f),
+      SHVec3(-0.5f,  0.5f, -0.5f),
+      SHVec3(0.5f,  0.5f, -0.5f),
+      SHVec3(0.5f, -0.5f, -0.5f),
 
-       // top
+      // top
       SHVec3(-0.5f,  0.5f, -0.5f),
       SHVec3(-0.5f,  0.5f,  0.5f),
-      SHVec3( 0.5f,  0.5f,  0.5f),
-      SHVec3( 0.5f,  0.5f, -0.5f),
-
+      SHVec3(0.5f,  0.5f,  0.5f),
+      SHVec3(0.5f,  0.5f, -0.5f),
+      
        // bottom
-      SHVec3(-0.5f, -0.5f, -0.5f), 
-      SHVec3( 0.5f, -0.5f, -0.5f), 
-      SHVec3( 0.5f, -0.5f,  0.5f), 
-      SHVec3(-0.5f, -0.5f,  0.5f), 
-
+      SHVec3(-0.5f, -0.5f, -0.5f),
+      SHVec3(0.5f, -0.5f, -0.5f),
+      SHVec3(0.5f, -0.5f,  0.5f),
+      SHVec3(-0.5f, -0.5f,  0.5f),
+      
       // right
-      SHVec3(0.5f, -0.5f, -0.5f),  
-      SHVec3(0.5f,  0.5f, -0.5f),  
-      SHVec3(0.5f,  0.5f,  0.5f),  
-      SHVec3(0.5f, -0.5f,  0.5f),  
-
+      SHVec3(0.5f, -0.5f, -0.5f),
+      SHVec3(0.5f,  0.5f, -0.5f),
+      SHVec3(0.5f,  0.5f,  0.5f),
+      SHVec3(0.5f, -0.5f,  0.5f),
+      
       // left
-      SHVec3(-0.5f, -0.5f, -0.5f), 
-      SHVec3(-0.5f, -0.5f,  0.5f), 
-      SHVec3(-0.5f,  0.5f,  0.5f), 
-      SHVec3(-0.5f,  0.5f, -0.5f) 
+      SHVec3(-0.5f, -0.5f, -0.5f),
+      SHVec3(-0.5f, -0.5f,  0.5f),
+      SHVec3(-0.5f,  0.5f,  0.5f),
+      SHVec3(-0.5f,  0.5f, -0.5f)
     };
 
-    mesh.VertexTexCoords = 
+    mesh.VertexTexCoords =
     {
       SHVec2(0.0f, 1.0f),
       SHVec2(1.0f, 1.0f),
@@ -99,7 +108,7 @@ namespace SHADE
       SHVec2(0.0f, 0.0f)
     };
 
-    mesh.VertexTangents = 
+    mesh.VertexTangents =
     {
       // front
       SHVec3(1.0f, 0.0f, 0.0f),
@@ -118,7 +127,7 @@ namespace SHADE
       SHVec3(1.0f, 0.0f, 0.0f),
       SHVec3(1.0f, 0.0f, 0.0f),
       SHVec3(1.0f, 0.0f, 0.0f),
-      
+
       // bottom
       SHVec3(1.0f, 0.0f, 0.0f),
       SHVec3(1.0f, 0.0f, 0.0f),
@@ -193,10 +202,93 @@ namespace SHADE
 
   Handle<SHMesh> SHPrimitiveGenerator::Cube(SHMeshLibrary& meshLibrary) noexcept
   {
-    static SHMeshData meshData = Cube();
+    if (cubeMesh.VertexPositions.empty())
+      cubeMesh = Cube();
+    return addMeshDataTo(cubeMesh, meshLibrary);
+  }
+
+  Handle<SHADE::SHMesh> SHPrimitiveGenerator::Cube(SHGraphicsSystem& gfxSystem) noexcept
+  {
+    if (cubeMesh.VertexPositions.empty())
+      cubeMesh = Cube();
+    return addMeshDataTo(cubeMesh, gfxSystem);
+  }
+
+  SHADE::SHMeshData SHPrimitiveGenerator::Sphere() noexcept
+  {
+    SHMeshData meshData;
+
+    const int LAT_SLICES = 12;
+    const int LONG_SLICES = 12;
+    float radius = 1;
+    for (int latNum = 0; latNum <= LAT_SLICES; ++latNum)
+    {
+      float theta = static_cast<float>(latNum * std::numbers::pi / LAT_SLICES);
+      float sinTheta = sin(theta);
+      float cosTheta = cos(theta);
+
+      for (int longNum = 0; longNum <= LONG_SLICES; ++longNum)
+      {
+        float phi = static_cast<float>(longNum * 2 * std::numbers::pi / LONG_SLICES);
+        float sinPhi = sin(phi);
+        float cosPhi = cos(phi);
+
+        const SHVec3 NORMAL = SHVec3(cosPhi * sinTheta, cosTheta, sinPhi * sinTheta);
+        meshData.VertexNormals.emplace_back(NORMAL);
+        meshData.VertexTangents.emplace_back(/* TODO */);
+        meshData.VertexTexCoords.emplace_back
+        (
+          1.0f - (longNum / static_cast<float>(LONG_SLICES)),
+          1.0f - (latNum / static_cast<float>(LAT_SLICES))
+        );
+        meshData.VertexPositions.emplace_back(radius * NORMAL.x, radius * NORMAL.y, radius * NORMAL.z);
+      }
+    }
+
+    for (int latNumber{}; latNumber < LAT_SLICES; latNumber++)
+    {
+      for (int longNumber{}; longNumber < LONG_SLICES; longNumber++)
+      {
+        const auto FIRST = (latNumber * (LONG_SLICES + 1)) + longNumber;
+        const auto SECOND = (FIRST + LONG_SLICES + 1);
+
+        meshData.Indices.emplace_back(FIRST);
+        meshData.Indices.emplace_back(SECOND);
+        meshData.Indices.emplace_back(FIRST + 1);
+
+        meshData.Indices.emplace_back(SECOND);
+        meshData.Indices.emplace_back(SECOND + 1);
+        meshData.Indices.emplace_back(FIRST + 1);
+      }
+    }
+
+    return meshData;
+  }
+
+  SHADE::Handle<SHADE::SHMesh> SHPrimitiveGenerator::Sphere(SHMeshLibrary& meshLibrary) noexcept
+  {
+    if (sphereMesh.VertexPositions.empty())
+      sphereMesh = Sphere();
+
+    return addMeshDataTo(sphereMesh, meshLibrary);
+  }
+
+  SHADE::Handle<SHADE::SHMesh> SHPrimitiveGenerator::Sphere(SHGraphicsSystem& gfxSystem) noexcept
+  {
+    if (sphereMesh.VertexPositions.empty())
+      sphereMesh = Sphere();
+
+    return addMeshDataTo(sphereMesh, gfxSystem);
+  }
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Helper Functions                                                                  */
+  /*-----------------------------------------------------------------------------------*/
+  SHADE::Handle<SHADE::SHMesh> SHPrimitiveGenerator::addMeshDataTo(const SHMeshData& meshData, SHMeshLibrary& meshLibrary) noexcept
+  {
     return meshLibrary.AddMesh
     (
-       static_cast<uint32_t>(meshData.VertexPositions.size()),
+      static_cast<uint32_t>(meshData.VertexPositions.size()),
       meshData.VertexPositions.data(),
       meshData.VertexTexCoords.data(),
       meshData.VertexTangents.data(),
@@ -206,17 +298,16 @@ namespace SHADE
     );
   }
 
-  Handle<SHADE::SHMesh> SHPrimitiveGenerator::Cube(SHGraphicsSystem& gfxSystem) noexcept
+  SHADE::Handle<SHADE::SHMesh> SHPrimitiveGenerator::addMeshDataTo(const SHMeshData& meshData, SHGraphicsSystem& gfxSystem) noexcept
   {
-    static SHMeshData meshData = Cube();
     return gfxSystem.AddMesh
     (
-       static_cast<uint32_t>(meshData.VertexPositions.size()),
+      static_cast<uint32_t>(meshData.VertexPositions.size()),
       meshData.VertexPositions.data(),
       meshData.VertexTexCoords.data(),
       meshData.VertexTangents.data(),
       meshData.VertexNormals.data(),
-       static_cast<uint32_t>(meshData.Indices.size()),
+      static_cast<uint32_t>(meshData.Indices.size()),
       meshData.Indices.data()
     );
   }
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.h b/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.h
index dd059a29..ef4e26a6 100644
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.h
+++ b/SHADE_Engine/src/Graphics/MiddleEnd/Meshes/SHPrimitiveGenerator.h
@@ -4,9 +4,9 @@
 \par            email: kahwei.tng\@digipen.edu
 \date           Sep 18, 2022
 \brief          Contains the static class definition of SHPrimitiveGenerator.
-  
+
 Copyright (C) 2022 DigiPen Institute of Technology.
-Reproduction or disclosure of this file or its contents without the prior written consent 
+Reproduction or disclosure of this file or its contents without the prior written consent
 of DigiPen Institute of Technology is prohibited.
 *//*************************************************************************************/
 #pragma once
@@ -29,12 +29,12 @@ namespace SHADE
   /*************************************************************************************/
   /*!
     \brief
-  	Static class that contains functions for generating 3D primitives.
+    Static class that contains functions for generating 3D primitives.
   */
   /*************************************************************************************/
   class SH_API SHPrimitiveGenerator
   {
-    public:
+  public:
     /*---------------------------------------------------------------------------------*/
     /* Constructors                                                                    */
     /*---------------------------------------------------------------------------------*/
@@ -42,7 +42,7 @@ namespace SHADE
 
     /*---------------------------------------------------------------------------------*/
     /* Primitive Generation Functions                                                  */
-	/*---------------------------------------------------------------------------------*/
+  /*---------------------------------------------------------------------------------*/
     /***********************************************************************************/
     /*!
       \brief
@@ -52,20 +52,20 @@ namespace SHADE
         SHMeshData object containing vertex data for the cube.
     */
     /***********************************************************************************/
-	[[nodiscard]] static SHMeshData Cube() noexcept;
+    [[nodiscard]] static SHMeshData Cube() noexcept;
     /***********************************************************************************/
     /*!
       \brief
         Produces a cube and constructs a SHMesh using the SHMeshLibrary provided.
 
       \param meshLibrary
-        Reference to the SHMeshLibrary to procude and store a cube mesh in.
+        Reference to the SHMeshLibrary to produce and store a cube mesh in.
 
       \return
         SHMesh object that points to the generated cube mesh in the SHMeshLibrary.
     */
     /***********************************************************************************/
-	[[nodiscard]] static Handle<SHMesh> Cube(SHMeshLibrary& meshLibrary) noexcept;
+    [[nodiscard]] static Handle<SHMesh> Cube(SHMeshLibrary& meshLibrary) noexcept;
     /***********************************************************************************/
     /*!
       \brief
@@ -78,12 +78,55 @@ namespace SHADE
         SHMesh object that points to the generated cube mesh in the SHGraphicsSystem.
     */
     /***********************************************************************************/
-	[[nodiscard]] static Handle<SHMesh> Cube(SHGraphicsSystem& gfxSystem) noexcept;
+    [[nodiscard]] static Handle<SHMesh> Cube(SHGraphicsSystem& gfxSystem) noexcept;
+    /***********************************************************************************/
+    /*!
+      \brief
+        Produces a sphere and stores the data in a SHMeshData object.
 
-    private:
+      \return
+        SHMeshData object containing vertex data for the sphere.
+    */
+    /***********************************************************************************/
+    [[nodiscard]] static SHMeshData Sphere() noexcept;
+    /***********************************************************************************/
+    /*!
+      \brief
+        Produces a sphere and constructs a SHMesh using the SHMeshLibrary provided.
+
+      \param meshLibrary
+        Reference to the SHMeshLibrary to produce and store a sphere mesh in.
+
+      \return
+        SHMesh object that points to the generated sphere mesh in the SHMeshLibrary.
+    */
+    /***********************************************************************************/
+    [[nodiscard]] static Handle<SHMesh> Sphere(SHMeshLibrary& meshLibrary) noexcept;
+    /***********************************************************************************/
+    /*!
+      \brief
+        Produces a sphere and constructs a SHMesh using the SHGraphicsSystem provided.
+
+      \param gfxSystem
+        Reference to the SHGraphicsSystem to produce and store a sphere mesh in. 
+
+      \return
+        SHMesh object that points to the generated sphere mesh in the SHGraphicsSystem.
+    */
+    /***********************************************************************************/
+    [[nodiscard]] static Handle<SHMesh> Sphere(SHGraphicsSystem& gfxSystem) noexcept;
+
+  private:
     /*---------------------------------------------------------------------------------*/
     /* Helper Functions                                                                */
     /*---------------------------------------------------------------------------------*/
-    [[nodiscard]] static SHMeshData genCubeData() noexcept;
+    static Handle<SHMesh> addMeshDataTo(const SHMeshData& meshData, SHMeshLibrary& meshLibrary) noexcept;
+    static Handle<SHMesh> addMeshDataTo(const SHMeshData& meshData, SHGraphicsSystem& gfxSystem) noexcept;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Data Members                                                                    */
+    /*---------------------------------------------------------------------------------*/
+    static SHMeshData cubeMesh;
+    static SHMeshData sphereMesh;
   };
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.cpp b/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.cpp
deleted file mode 100644
index d0b160df..00000000
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.cpp
+++ /dev/null
@@ -1,139 +0,0 @@
-#include "SHPch.h"
-#include "SHShaderModuleLibrary.h"
-#include "Graphics/Devices/SHVkLogicalDevice.h"
-#include "Assets/SHAssetManager.h"
-
-namespace SHADE
-{
-  /***************************************************************************/
-  /*!
-  
-    \brief
-      Imports all shader binaries from the source library.
-    
-    \param logicalDeviceHdl
-      For creating shader modules.
-
-    \param sourceLib
-      The source library class that stores the container of shader binary data.
-   
-  */
-  /***************************************************************************/
-  //void SHShaderModuleLibrary::ImportFromSourceLibrary(Handle<SHVkLogicalDevice>& logicalDeviceHdl, SHShaderSourceLibrary const& sourceLib) noexcept
-  //{
-  //  auto const& sources = sourceLib.GetSourceLibrary();
-  //  for (auto const& source : sources)
-  //  {
-  //    vk::ShaderStageFlagBits shaderType{};
-  //    switch (source.shaderType)
-  //    {
-  //    case SH_SHADER_TYPE::VERTEX:
-  //      shaderType = vk::ShaderStageFlagBits::eVertex;
-  //      break;
-  //    case SH_SHADER_TYPE::FRAGMENT:
-  //      shaderType = vk::ShaderStageFlagBits::eFragment;
-  //      break;
-  //    case SH_SHADER_TYPE::COMPUTE:
-  //      shaderType = vk::ShaderStageFlagBits::eCompute;
-  //      break;
-  //    default:
-  //      shaderType = vk::ShaderStageFlagBits::eVertex;
-  //      break;
-  //    }
-
-  //    Handle<SHVkShaderModule> newShaderModule = logicalDeviceHdl->CreateShaderModule(source.spirvBinary, "main", shaderType, source.name);
-  //    shaderModules.emplace(source.id, newShaderModule);
-  //    stringToID.emplace(source.name, source.id);
-  //  }
-  //}
-
-  /***************************************************************************/
-  /*!
-  
-    \brief
-      Gets the shader module based on module name.
-    
-    \param shaderName
-   
-    \return 
-  
-  */
-  /***************************************************************************/
-  //Handle<SHVkShaderModule> SHShaderModuleLibrary::GetShaderModule(std::string shaderName) const noexcept
-  //{
-  //  if (stringToID.contains(shaderName))
-  //    return shaderModules.at(stringToID.at(shaderName));
-  //  else
-  //    return {};
-  //}
-
-  vk::ShaderStageFlagBits SHShaderModuleLibrary::GetVkShaderFlag(SH_SHADER_TYPE type) noexcept
-  {
-    vk::ShaderStageFlagBits shaderType{};
-    switch (type)
-    {
-    case SH_SHADER_TYPE::VERTEX:
-      shaderType = vk::ShaderStageFlagBits::eVertex;
-      break;
-    case SH_SHADER_TYPE::FRAGMENT:
-      shaderType = vk::ShaderStageFlagBits::eFragment;
-      break;
-    case SH_SHADER_TYPE::COMPUTE:
-      shaderType = vk::ShaderStageFlagBits::eCompute;
-      break;
-    default:
-      shaderType = vk::ShaderStageFlagBits::eVertex;
-      break;
-    }
-
-    return shaderType;
-  }
-
-  Handle<SHVkShaderModule> SHShaderModuleLibrary::GetBuiltInShaderModule(std::string shaderName) const noexcept
-  {
-      if (builtInShaderModules.contains(shaderName))
-        return builtInShaderModules.at(shaderName);
-      else
-        return {};
-  }
-
-  void SHShaderModuleLibrary::ImportAllShaderSource(Handle<SHVkLogicalDevice>& logicalDeviceHdl) noexcept
-  {
-    uint32_t idCounter{ 0 };
-
-    auto const data = SHAssetManager::GetAllDataOfType(AssetType::SHADER);
-    for (auto const& dataPtr : data)
-    {
-      auto const shader = dynamic_cast<SHShaderAsset const*>(dataPtr);
-
-	    Handle<SHVkShaderModule> newShaderModule = 
-        logicalDeviceHdl->CreateShaderModule(shader->spirvBinary, "main", GetVkShaderFlag(shader->shaderType), shader->name);
-
-	    shaderModules.emplace(idCounter++, newShaderModule);
-    }
-
-    auto const builtIn = SHAssetManager::GetAllDataOfType(AssetType::SHADER_BUILT_IN);
-    for (auto const& dataPtr : builtIn)
-    {
-      auto const shader = dynamic_cast<SHShaderAsset const*>(dataPtr);
-
-      Handle<SHVkShaderModule> newShaderModule =
-        logicalDeviceHdl->CreateShaderModule(shader->spirvBinary, "main", GetVkShaderFlag(shader->shaderType), shader->name);
-
-      builtInShaderModules.emplace(shader->name, newShaderModule);
-    }
-  }
-
-  void SHShaderModuleLibrary::ReflectAllShaderModules() noexcept
-  {
-    for (auto& module : shaderModules)
-    {
-      module.second->Reflect();
-    }
-
-    for (auto& module : builtInShaderModules)
-    {
-      module.second->Reflect();
-    }
-  }
-}
diff --git a/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.h b/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.h
deleted file mode 100644
index 9daae816..00000000
--- a/SHADE_Engine/src/Graphics/MiddleEnd/Shaders/SHShaderModuleLibrary.h
+++ /dev/null
@@ -1,44 +0,0 @@
-#ifndef SH_SHADER_MODULE_LIBRARY_H
-#define SH_SHADER_MODULE_LIBRARY_H
-
-#include "Graphics/Shaders/SHVkShaderModule.h"
-#include "Assets/Asset Types/SHShaderAsset.h"
-
-namespace SHADE
-{
-  class SHVkLogicalDevice;
-
-  /*
-   * The purpose of this shader module library is to be separate from the source library. The source library contains
-   * pure shader binary data that contains no vulkan related objects. Every time we load on unload a scene/level,
-   * this class and the source library class is cleared of its modules and recreated. 
-   */
-  class SHShaderModuleLibrary
-  {
-  private:
-    /*-----------------------------------------------------------------------*/
-    /* PRIVATE MEMBER VARIABLES                                              */
-    /*-----------------------------------------------------------------------*/
-    //! Stored shader modules
-    std::unordered_map<uint32_t, Handle<SHVkShaderModule>> shaderModules;
-    std::unordered_map<std::string, Handle<SHVkShaderModule>> builtInShaderModules;
-
-    inline vk::ShaderStageFlagBits GetVkShaderFlag(SH_SHADER_TYPE type) noexcept;
-
-  public:
-    /*-----------------------------------------------------------------------*/
-    /* PUBLIC MEMBER FUNCTIONS                                               */
-    /*-----------------------------------------------------------------------*/
-    //void ImportFromSourceLibrary(Handle<SHVkLogicalDevice>& logicalDeviceHdl, SHShaderSourceLibrary const& sourceLib) noexcept;
-
-    /*-----------------------------------------------------------------------*/
-    /* SETTERS AND GETTERS                                                   */
-    /*-----------------------------------------------------------------------*/
-    Handle<SHVkShaderModule> GetBuiltInShaderModule(std::string shaderName) const noexcept;
-    
-    void ImportAllShaderSource(Handle<SHVkLogicalDevice>& logicalDeviceHdl) noexcept;
-    void ReflectAllShaderModules() noexcept;
-  };
-}
-
-#endif
\ No newline at end of file
diff --git a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipeline.h b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipeline.h
index 7378cc48..7e313ed6 100644
--- a/SHADE_Engine/src/Graphics/Pipeline/SHVkPipeline.h
+++ b/SHADE_Engine/src/Graphics/Pipeline/SHVkPipeline.h
@@ -47,12 +47,13 @@ namespace SHADE
     /*-----------------------------------------------------------------------*/
     /* CTORS AND DTORS                                                       */
     /*-----------------------------------------------------------------------*/
+    //! For constructing a graphics pipeline
     SHVkPipeline  (Handle<SHVkLogicalDevice> const&  inLogicalDeviceHdl, 
                    Handle<SHVkPipelineLayout> const& inPipelineLayout, 
                    SHVkPipelineState const* const    state, 
                    Handle<SHVkRenderpass> const&     renderpassHdl,
                    Handle<SHSubpass>                 subpass) noexcept;
-
+    //! For constructing a compute pipeline
     SHVkPipeline(Handle<SHVkLogicalDevice> const& inLogicalDeviceHdl,
       Handle<SHVkPipelineLayout> const& inPipelineLayout) noexcept;
 
diff --git a/SHADE_Engine/src/Graphics/Windowing/SHWindow.cpp b/SHADE_Engine/src/Graphics/Windowing/SHWindow.cpp
index 44a1cb0e..e0dbc1a4 100644
--- a/SHADE_Engine/src/Graphics/Windowing/SHWindow.cpp
+++ b/SHADE_Engine/src/Graphics/Windowing/SHWindow.cpp
@@ -54,13 +54,14 @@ namespace SHADE
 
     if (wndData.isFullscreen)
     {
-      dwExStyle = WS_EX_APPWINDOW | WS_EX_ACCEPTFILES;
+      dwExStyle = WS_EX_APPWINDOW;
       dwStyle = WS_POPUP | WS_VISIBLE | WS_CLIPSIBLINGS | WS_CLIPCHILDREN;
+      dwExStyle |= WS_EX_ACCEPTFILES;
     }
     else
     {
-      dwExStyle = WS_EX_APPWINDOW | WS_EX_WINDOWEDGE | WS_EX_ACCEPTFILES;
-
+      dwExStyle = WS_EX_APPWINDOW | WS_EX_WINDOWEDGE;
+      dwExStyle |= WS_EX_ACCEPTFILES;
       if (wndData.frameEnabled)
       {
         dwStyle = WNDSTYLE::SHWS_WINDOWED;
@@ -87,7 +88,7 @@ namespace SHADE
       }
     }
 
-    //DPI_AWARENESS_CONTEXT prevDPIContext = SetThreadDpiAwarenessContext(DPI_AWARENESS_CONTEXT_PER_MONITOR_AWARE_V2);
+    DPI_AWARENESS_CONTEXT prevDPIContext = SetThreadDpiAwarenessContext(DPI_AWARENESS_CONTEXT_PER_MONITOR_AWARE_V2);
 
     RECT windowRect;
     windowRect.left = wndData.x; //or CW_USEDEFAULT ?
@@ -97,13 +98,16 @@ namespace SHADE
     AdjustWindowRectEx(&windowRect, dwStyle, false, dwExStyle);
 
     //Create window
-    wndHWND = CreateWindowEx(0, (LPWSTR) wndData.name.c_str(), (LPWSTR)wndData.title.c_str(), dwStyle, 0, 0, windowRect.right - windowRect.left, windowRect.bottom - windowRect.top, parent, NULL, hInstance, NULL);
-
+    wndHWND = CreateWindowEx(dwExStyle, (LPWSTR) wndData.name.c_str(), (LPWSTR)wndData.title.c_str(), dwStyle, 0, 0, windowRect.right - windowRect.left, windowRect.bottom - windowRect.top, parent, NULL, hInstance, NULL);
+    
     if (!wndHWND)
     {
       //DWORD err = GetLastError();
       return false;
     }
+    BOOL help = ChangeWindowMessageFilter (WM_DROPFILES, MSGFLT_ADD);
+    help &= ChangeWindowMessageFilter (WM_COPYDATA, MSGFLT_ADD);
+    help &= ChangeWindowMessageFilter (0x0049, MSGFLT_ADD);
 
     if (wndData.isVisible)
     {
@@ -256,7 +260,7 @@ namespace SHADE
     return wndHWND;
   }
 
-  const WindowData SHWindow::GetWindowData()
+  const WindowData SHWindow::GetWindowData() const
   {
     return wndData;
   }
@@ -318,13 +322,13 @@ namespace SHADE
     case WM_CREATE:
       OnCreate(hwnd, reinterpret_cast<LPCREATESTRUCT>(wparam));
       break;
+    case WM_QUIT:
     case WM_CLOSE:
-
     case WM_DESTROY:
       OnDestroy();
       return 0;
     case WM_DROPFILES:
-      //OnFileDrop(reinterpret_cast<HDROP>(wparam));
+      OnFileDrop(reinterpret_cast<HDROP>(wparam));
       break;
     case WM_ENTERSIZEMOVE:
     case WM_EXITSIZEMOVE:
@@ -386,12 +390,25 @@ namespace SHADE
   void SHWindow::OnDestroy()
   {
     OnClose();
+    DragAcceptFiles(wndHWND, false);
     this->Destroy();
   }
 
-  //void SHWindow::OnFileDrop(HDROP drop)
-  //{
-  //}
+  void SHWindow::OnFileDrop(HDROP drop)
+  {
+    
+    int const numFiles = static_cast<int>(DragQueryFile(drop, 0xFFFFFFFF, nullptr, 0));
+    for(int i = 0; i < numFiles; ++i)
+    {
+      //char fileNameBuffer[MAX_PATH];
+      std::wstring fileNameBuffer;
+      fileNameBuffer.reserve(MAX_PATH);
+      DragQueryFile(drop, static_cast<UINT>(i), fileNameBuffer.data(), MAX_PATH);
+      std::string name(fileNameBuffer.begin(), fileNameBuffer.end());
+      SHLOG_INFO("Dropped: {}", name)
+    }
+    DragFinish(drop);
+  }
 
   void SHWindow::OnSize([[maybe_unused]] UINT msg,[[maybe_unused]] UINT type, SIZE size)
   {
diff --git a/SHADE_Engine/src/Graphics/Windowing/SHWindow.h b/SHADE_Engine/src/Graphics/Windowing/SHWindow.h
index 0a180285..11308d90 100644
--- a/SHADE_Engine/src/Graphics/Windowing/SHWindow.h
+++ b/SHADE_Engine/src/Graphics/Windowing/SHWindow.h
@@ -2,6 +2,7 @@
 #define SH_WINDOW_H
 
 #include <Windows.h>
+#include <shellapi.h>
 #include <functional>
 #include <unordered_map>
 #include "SHWindowMap.h"
@@ -10,7 +11,7 @@
 namespace SHADE
 {
   constexpr uint16_t MAX_BUFFER = 1024;
-
+  
   enum WNDSTYLE : DWORD
   {
     SHWS_WINDOWED = WS_OVERLAPPEDWINDOW,
@@ -47,7 +48,7 @@ namespace SHADE
 
     //bool canFullscreen = true;
 
-    unsigned bgColor = WHITE_BRUSH;
+    unsigned bgColor = DKGRAY_BRUSH;
 
     //bool transparent = false;
 
@@ -122,7 +123,7 @@ namespace SHADE
 
     HWND GetHWND();
 
-    const WindowData GetWindowData();
+    const WindowData GetWindowData() const;
 
     CALLBACKID RegisterWindowSizeCallback(WindowResizeCallbackFn);
     void UnregisterWindowSizeCallback(CALLBACKID const& callbackid);
@@ -168,7 +169,7 @@ namespace SHADE
     void OnCreate(HWND hwnd, LPCREATESTRUCT create_struct);
     void OnClose();
     void OnDestroy();
-    //void OnFileDrop(HDROP drop);
+    void OnFileDrop(HDROP drop);
     void OnSize(UINT msg, UINT type, SIZE size);
     void OnPosChange(LPWINDOWPOS pos);
     void OnPaint(HDC hdc, LPPAINTSTRUCT paint);
diff --git a/SHADE_Engine/src/Math/SHColour.cpp b/SHADE_Engine/src/Math/SHColour.cpp
index 8aae2cb3..944c37cb 100644
--- a/SHADE_Engine/src/Math/SHColour.cpp
+++ b/SHADE_Engine/src/Math/SHColour.cpp
@@ -87,19 +87,19 @@ namespace SHADE
   /*-----------------------------------------------------------------------------------*/
 
   SHColour::SHColour() noexcept
-  : SHVec4 { 0.0f, 0.0f, 0.0f, 1.0f }
+  : XMFLOAT4 { 0.0f, 0.0f, 0.0f, 1.0f }
   {}
 
   SHColour::SHColour(float r, float g, float b) noexcept
-  : SHVec4 { r, g, b, 1.0f }
+  : XMFLOAT4 { r, g, b, 1.0f }
   {}
 
   SHColour::SHColour(float r, float g, float b, float a) noexcept
-  : SHVec4 { r, g, b, a }
+  : XMFLOAT4 { r, g, b, a }
   {}
 
   SHColour::SHColour(uint8_t r, uint8_t g, uint8_t b) noexcept
-  : SHVec4
+  : XMFLOAT4
   {
     static_cast<float>(r) / 255.0f,
     static_cast<float>(g) / 255.0f,
@@ -109,7 +109,7 @@ namespace SHADE
   {}
 
   SHColour::SHColour(uint8_t r, uint8_t g, uint8_t b, uint8_t a) noexcept
-  : SHVec4
+  : XMFLOAT4
   {
     static_cast<float>(r) / 255.0f,
     static_cast<float>(g) / 255.0f,
@@ -118,12 +118,24 @@ namespace SHADE
   }
   {}
 
-  SHColour::SHColour(const DirectX::XMFLOAT3& colour) noexcept
-  : SHVec4 { colour.x, colour.y, colour.z, 1.0f }
+  SHColour::SHColour(const SHVec3& rgb) noexcept
+  : XMFLOAT4 { rgb.x, rgb.y, rgb.z, 1.0f }
+  {}
+
+  SHColour::SHColour(const SHVec4& rgba) noexcept
+  : XMFLOAT4 { rgba.x, rgba.y, rgba.z, rgba.w }
+  {}
+
+  SHColour::SHColour(const DirectX::XMFLOAT3& rgb) noexcept
+  : XMFLOAT4 { rgb.x, rgb.y, rgb.z, 1.0f }
+  {}
+
+  SHColour::SHColour(const DirectX::XMFLOAT4& rgba) noexcept
+  : XMFLOAT4 { rgba.x, rgba.y, rgba.z, rgba.w }
   {}
 
   SHColour::SHColour(const DirectX::XMVECTORF32& colour) noexcept
-  : SHVec4
+  : XMFLOAT4
   {
     XMVectorGetX(colour),
     XMVectorGetY(colour),
@@ -136,6 +148,86 @@ namespace SHADE
   /* Operator Overload Definitions                                                     */
   /*-----------------------------------------------------------------------------------*/
 
+  SHColour::operator XMVECTOR() const noexcept
+  {
+    return XMLoadFloat4(this);
+  }
+
+  SHColour::operator SHVec4() const noexcept
+  {
+    return SHVec4{ *this };
+  }
+
+  SHColour& SHColour::operator+=(const SHColour& rhs) noexcept
+  {
+    return *this = *this + rhs;
+  }
+
+  SHColour& SHColour::operator-=(const SHColour& rhs) noexcept
+  {
+    return *this = *this - rhs;
+  }
+
+  SHColour& SHColour::operator*=(const SHColour& rhs) noexcept
+  {
+    return *this = *this * rhs;
+  }
+
+  SHColour& SHColour::operator*=(float rhs) noexcept
+  {
+    return *this = *this * rhs;
+  }
+
+  SHColour& SHColour::operator/=(const SHColour& rhs) noexcept
+  {
+    return *this = *this / rhs;
+  }
+
+  SHColour SHColour::operator+(const SHColour& rhs) const noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorAdd(*this, rhs));
+    return result;
+  }
+
+  SHColour SHColour::operator-(const SHColour& rhs) const noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorSubtract(*this, rhs));
+    return result;
+  }
+
+  SHColour SHColour::operator-() const noexcept
+  {
+    return SHColour{ -x, -y, -z, -w };
+  }
+
+  SHColour SHColour::operator*(const SHColour& rhs) const noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorMultiply(*this, rhs));
+    return result;
+  }
+
+  SHColour SHColour::operator*(float rhs) const noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorScale(*this, rhs));
+    return result;
+  }
+
+  SHColour SHColour::operator/(const SHColour& rhs) const noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorDivide(*this, rhs));
+    return result;
+  }
+
   bool SHColour::operator==(const SHColour& rhs) const noexcept
   {
     return XMColorEqual(*this, rhs);
@@ -146,6 +238,70 @@ namespace SHADE
     return XMColorNotEqual(*this, rhs);
   }
 
+  float& SHColour::operator[](int index)
+  {
+    if (index >= SIZE || index < 0)
+      throw std::invalid_argument("Index out of range!");
+
+    switch (index)
+    {
+      case 0:   return x;
+      case 1:   return y;
+      case 2:   return z;
+      case 3:   return w;
+    }
+  }
+
+  float& SHColour::operator[](size_t index)
+  {
+    if (index >= SIZE || index < 0)
+      throw std::invalid_argument("Index out of range!");
+
+    switch (index)
+    {
+      case 0:   return x;
+      case 1:   return y;
+      case 2:   return z;
+      case 3:   return w;
+    }
+  }
+
+  float SHColour::operator[](int index) const
+  {
+    if (index >= SIZE || index < 0)
+      throw std::invalid_argument("Index out of range!");
+
+    switch (index)
+    {
+      case 0:   return x;
+      case 1:   return y;
+      case 2:   return z;
+      case 3:   return w;
+    }
+  }
+
+  float SHColour::operator[](size_t index) const
+  {
+    if (index >= SIZE || index < 0)
+      throw std::invalid_argument("Index out of range!");
+
+    switch (index)
+    {
+      case 0:   return x;
+      case 1:   return y;
+      case 2:   return z;
+      case 3:   return w;
+    }
+  }
+
+  SHColour operator* (float lhs, const SHColour& rhs) noexcept
+  {
+    SHColour result;
+
+    XMStoreFloat4(&result, XMVectorScale(rhs, lhs));
+    return result;
+  }
+
   /*-----------------------------------------------------------------------------------*/
   /* Function Member Definitions                                                       */
   /*-----------------------------------------------------------------------------------*/
diff --git a/SHADE_Engine/src/Math/SHColour.h b/SHADE_Engine/src/Math/SHColour.h
index bd2bc9e7..a6adf7bb 100644
--- a/SHADE_Engine/src/Math/SHColour.h
+++ b/SHADE_Engine/src/Math/SHColour.h
@@ -19,12 +19,6 @@
 
 namespace SHADE
 {
-  /*-----------------------------------------------------------------------------------*/
-  /* Forward Declarations                                                              */
-  /*-----------------------------------------------------------------------------------*/
-
-  class SHColour;
-
   /*-----------------------------------------------------------------------------------*/
   /* Type Definitions                                                                  */
   /*-----------------------------------------------------------------------------------*/
@@ -40,7 +34,7 @@ namespace SHADE
     float v = 0.0f;
   };
 
-  class SH_API SHColour : private SHVec4
+  class SH_API SHColour : public DirectX::XMFLOAT4
   {
   public:
     /*---------------------------------------------------------------------------------*/
@@ -53,9 +47,11 @@ namespace SHADE
     SHColour  (uint8_t r, uint8_t g, uint8_t b)             noexcept;
     SHColour  (uint8_t r, uint8_t g, uint8_t b, uint8_t a)  noexcept;
 
-    SHColour  (const SHVec3& colour)                        noexcept;
-    SHColour  (const DirectX::XMFLOAT3& colour)             noexcept;
-    SHColour  (const DirectX::XMVECTORF32& colour)          noexcept;
+    SHColour  (const SHVec3& rgb)                           noexcept;
+    SHColour  (const SHVec4& rgba)                          noexcept;
+    SHColour  (const DirectX::XMFLOAT3& rgb)                noexcept;
+    SHColour  (const DirectX::XMFLOAT4& rgba)               noexcept;
+    SHColour  (const DirectX::XMVECTORF32& rgba)            noexcept;
 
     SHColour  (const SHColour&) = default;
     SHColour  (SHColour&&) = default;
@@ -66,11 +62,32 @@ namespace SHADE
     /* Operator Overloads                                                              */
     /*---------------------------------------------------------------------------------*/
 
-    SHColour& operator=         (const SHColour&) = default;
-    SHColour& operator=         (SHColour&&) = default;
+    SHColour&               operator=   (const SHColour&) = default;
+    SHColour&               operator=   (SHColour&&)      = default;
 
-    bool      operator==        (const SHColour& rhs) const noexcept;
-    bool      operator!=        (const SHColour& rhs) const noexcept;
+    operator DirectX::XMVECTOR          ()                    const noexcept;
+    operator SHVec4                     ()                    const noexcept;
+
+    SHColour&               operator+=  (const SHColour& rhs)       noexcept;
+    SHColour&               operator-=  (const SHColour& rhs)       noexcept;
+    SHColour&               operator*=  (const SHColour& rhs)       noexcept;
+    SHColour&               operator*=  (float rhs)                 noexcept;
+    SHColour&               operator/=  (const SHColour& rhs)       noexcept;
+
+    [[nodiscard]] SHColour  operator+   (const SHColour& rhs) const noexcept;
+    [[nodiscard]] SHColour  operator-   (const SHColour& rhs) const noexcept;
+    [[nodiscard]] SHColour  operator-   ()                    const noexcept;
+    [[nodiscard]] SHColour  operator*   (const SHColour& rhs) const noexcept;
+    [[nodiscard]] SHColour  operator*   (float rhs)           const noexcept;
+    [[nodiscard]] SHColour  operator/   (const SHColour& rhs) const noexcept;
+
+    [[nodiscard]] bool      operator==  (const SHColour& rhs) const noexcept;
+    [[nodiscard]] bool      operator!=  (const SHColour& rhs) const noexcept;
+
+    [[nodiscard]] float&    operator[]  (int index);
+    [[nodiscard]] float&    operator[]  (size_t index);
+    [[nodiscard]] float     operator[]  (int index)           const;
+    [[nodiscard]] float     operator[]  (size_t index)        const;
 
     /*---------------------------------------------------------------------------------*/
     /* Properties                                                                      */
@@ -105,6 +122,8 @@ namespace SHADE
     /* Static Data Members                                                             */
     /*---------------------------------------------------------------------------------*/
 
+    static constexpr size_t SIZE = 4U;
+
     static const SHColour BEIGE       ;
     static const SHColour BLACK       ;
     static const SHColour BLUE        ;
@@ -159,8 +178,9 @@ namespace SHADE
     static const SHColour TURQUOISE   ;
     static const SHColour VIOLET      ;
     static const SHColour WHITE       ;
-    static const SHColour YELLOW;
+    static const SHColour YELLOW      ;
   };
 
+  SHColour operator* (float lhs, const SHColour& rhs) noexcept;
 
 } // namespace SHADE
diff --git a/SHADE_Engine/src/Math/SHMath.h b/SHADE_Engine/src/Math/SHMath.h
index 5fcea9fc..3a24d6ef 100644
--- a/SHADE_Engine/src/Math/SHMath.h
+++ b/SHADE_Engine/src/Math/SHMath.h
@@ -9,4 +9,6 @@
 #include "SHQuaternion.h"
 #include "SHMatrix.h"
 
+#include "SHColour.h"
+
 #include "Transform/SHTransform.h"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Math/Transform/SHTransformComponent.cpp b/SHADE_Engine/src/Math/Transform/SHTransformComponent.cpp
index e56cbc8d..fa0befa3 100644
--- a/SHADE_Engine/src/Math/Transform/SHTransformComponent.cpp
+++ b/SHADE_Engine/src/Math/Transform/SHTransformComponent.cpp
@@ -14,6 +14,7 @@
 #include "SHTransformComponent.h"
 // Project Headers
 #include "Math/SHMathHelpers.h"
+#include "Reflection/SHReflectionMetadata.h"
 
 namespace SHADE
 {
@@ -184,7 +185,7 @@ RTTR_REGISTRATION
   using namespace rttr;
 
   registration::class_<SHTransformComponent>("Transform Component")
-    .property("Translate" , &SHTransformComponent::GetLocalPosition , &SHTransformComponent::SetLocalPosition                                       )
-    .property("Rotate"    , &SHTransformComponent::GetLocalRotation , select_overload<void(const SHVec3&)>(&SHTransformComponent::SetLocalRotation) )
-    .property("Scale"     , &SHTransformComponent::GetLocalScale    , &SHTransformComponent::SetLocalScale                                          );
+    .property("Translate" ,&SHTransformComponent::GetLocalPosition  ,&SHTransformComponent::SetLocalPosition                                      ) (metadata(META::tooltip, "Translate"))
+    .property("Rotate"    ,&SHTransformComponent::GetLocalRotation  ,select_overload<void(const SHVec3&)>(&SHTransformComponent::SetLocalRotation)) (metadata(META::tooltip, "Rotate"), metadata(META::angleInRad, true))
+    .property("Scale"     ,&SHTransformComponent::GetLocalScale     ,&SHTransformComponent::SetLocalScale                                         ) (metadata(META::tooltip, "Scale"));
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Math/Transform/SHTransformSystem.cpp b/SHADE_Engine/src/Math/Transform/SHTransformSystem.cpp
index c90e4431..f000aa5b 100644
--- a/SHADE_Engine/src/Math/Transform/SHTransformSystem.cpp
+++ b/SHADE_Engine/src/Math/Transform/SHTransformSystem.cpp
@@ -47,16 +47,14 @@ namespace SHADE
   {
     // Get the current scene graph to traverse and update
     const auto& SCENE_GRAPH = SHSceneManager::GetCurrentSceneGraph();
-
-    // TODO(Diren): Consider how to clear dirty in pause / stop mode and update physics, but do not clear in play mode.
-    UpdateEntity(SCENE_GRAPH.GetRoot(), false);
+    UpdateEntity(SCENE_GRAPH.GetRoot(), !IsRunInEditorPause);
   }
 
   void SHTransformSystem::TransformPostPhysicsUpdate::Execute(double) noexcept
   {
     // Get the current scene graph to traverse and update
     const auto& SCENE_GRAPH = SHSceneManager::GetCurrentSceneGraph();
-    UpdateEntity(SCENE_GRAPH.GetRoot(), true);
+    UpdateEntity(SCENE_GRAPH.GetRoot(), IsRunInEditorPause);
   }
 
   void SHTransformSystem::Init()
diff --git a/SHADE_Engine/src/Math/Vector/SHVec4.cpp b/SHADE_Engine/src/Math/Vector/SHVec4.cpp
index 88e7f5c9..943d540e 100644
--- a/SHADE_Engine/src/Math/Vector/SHVec4.cpp
+++ b/SHADE_Engine/src/Math/Vector/SHVec4.cpp
@@ -14,6 +14,7 @@
 #include "SHVec4.h"
 // Project Headers
 #include "Math/SHMatrix.h"
+#include "Math/SHColour.h"
 #include "Tools/SHLogger.h"
 
 using namespace DirectX;
diff --git a/SHADE_Engine/src/Math/Vector/SHVec4.h b/SHADE_Engine/src/Math/Vector/SHVec4.h
index db8ef860..3c509039 100644
--- a/SHADE_Engine/src/Math/Vector/SHVec4.h
+++ b/SHADE_Engine/src/Math/Vector/SHVec4.h
@@ -23,7 +23,9 @@ namespace SHADE
   /*-----------------------------------------------------------------------------------*/
   /* Forward Declarations                                                              */
   /*-----------------------------------------------------------------------------------*/
+
   class SHMatrix;
+  class SHColour;
 
   /*-----------------------------------------------------------------------------------*/
   /* Type Definitions                                                                  */
diff --git a/SHADE_Engine/src/Physics/Components/SHColliderComponent.cpp b/SHADE_Engine/src/Physics/Components/SHColliderComponent.cpp
index fb999847..c7e327fa 100644
--- a/SHADE_Engine/src/Physics/Components/SHColliderComponent.cpp
+++ b/SHADE_Engine/src/Physics/Components/SHColliderComponent.cpp
@@ -146,4 +146,12 @@ namespace SHADE
     system->RemoveCollisionShape(GetEID(), index);
   }
 
-} // namespace SHADE
\ No newline at end of file
+} // namespace SHADE
+
+RTTR_REGISTRATION
+{
+  using namespace rttr;
+  using namespace SHADE;
+
+  registration::class_<SHColliderComponent>("Collider Component");
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/Components/SHColliderComponent.h b/SHADE_Engine/src/Physics/Components/SHColliderComponent.h
index af726b51..7ce272a9 100644
--- a/SHADE_Engine/src/Physics/Components/SHColliderComponent.h
+++ b/SHADE_Engine/src/Physics/Components/SHColliderComponent.h
@@ -100,5 +100,6 @@ namespace SHADE
     SHQuaternion      orientation;
     Colliders         colliders;
 
+    RTTR_ENABLE()
   };
 } // namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.cpp b/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.cpp
index c1969557..369d26a5 100644
--- a/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.cpp
+++ b/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.cpp
@@ -18,6 +18,7 @@
 
 // Project Headers
 #include "ECS_Base/Managers/SHSystemManager.h"
+#include "Math/SHMathHelpers.h"
 #include "Physics/SHPhysicsSystem.h"
 
 namespace SHADE
@@ -28,21 +29,9 @@ namespace SHADE
 
   SHRigidBodyComponent::SHRigidBodyComponent() noexcept
   : type        { Type::DYNAMIC }
-  , flags       { 0 }
-  , dirtyFlags  { 0 }
   , interpolate { true }
   , rp3dBody    { nullptr }
-  , mass        { 1.0f }
-  , drag        { 0.01f }
-  , angularDrag { 0.01f }
-  {
-    // Set default flags: Gravity & Sleeping enabled
-    flags |= 1U << 0;
-    flags |= 1U << 1;
-
-    // Set all dirty flags to true
-    dirtyFlags = 1023;
-  }
+  {}
 
   /*-----------------------------------------------------------------------------------*/
   /* Getter Function Definitions                                                       */
@@ -50,12 +39,24 @@ namespace SHADE
 
   bool SHRigidBodyComponent::IsGravityEnabled() const noexcept
   {
-    return flags & (1U << 0);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    return rp3dBody->isGravityEnabled();
   }
 
   bool SHRigidBodyComponent::IsAllowedToSleep() const noexcept
   {
-    return flags & (1U << 1);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    return rp3dBody->isAllowedToSleep();
   }
 
   bool SHRigidBodyComponent::IsInterpolating() const noexcept
@@ -70,67 +71,151 @@ namespace SHADE
 
   float SHRigidBodyComponent::GetMass() const noexcept
   {
-    return mass;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return 0.0f;
+    }
+
+    return rp3dBody->getMass();
   }
 
   float SHRigidBodyComponent::GetDrag() const noexcept
   {
-    return drag;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return 0.0f;
+    }
+
+    return rp3dBody->getLinearDamping();
   }
 
   float SHRigidBodyComponent::GetAngularDrag() const noexcept
   {
-    return angularDrag;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return 0.0f;
+    }
+
+    return rp3dBody->getAngularDamping();
   }
 
   bool SHRigidBodyComponent::GetFreezePositionX() const noexcept
   {
-    return flags & (1U << 2);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& LINEAR_CONSTRAINTS = rp3dBody->getLinearLockAxisFactor();
+    return SHMath::CompareFloat(LINEAR_CONSTRAINTS.x, 0.0f);
   }
 
   bool SHRigidBodyComponent::GetFreezePositionY() const noexcept
   {
-    return flags & (1U << 3);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& LINEAR_CONSTRAINTS = rp3dBody->getLinearLockAxisFactor();
+    return SHMath::CompareFloat(LINEAR_CONSTRAINTS.y, 0.0f);
   }
 
   bool SHRigidBodyComponent::GetFreezePositionZ() const noexcept
   {
-    return flags & (1U << 4);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& LINEAR_CONSTRAINTS = rp3dBody->getLinearLockAxisFactor();
+    return SHMath::CompareFloat(LINEAR_CONSTRAINTS.z, 0.0f);
   }
 
   bool SHRigidBodyComponent::GetFreezeRotationX() const noexcept
   {
-    return flags & (1U << 5);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& ANGULAR_CONSTRAINTS = rp3dBody->getAngularLockAxisFactor();
+    return SHMath::CompareFloat(ANGULAR_CONSTRAINTS.x, 0.0f);
   }
 
   bool SHRigidBodyComponent::GetFreezeRotationY() const noexcept
   {
-    return flags & (1U << 6);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& ANGULAR_CONSTRAINTS = rp3dBody->getAngularLockAxisFactor();
+    return SHMath::CompareFloat(ANGULAR_CONSTRAINTS.y, 0.0f);
   }
 
   bool SHRigidBodyComponent::GetFreezeRotationZ() const noexcept
   {
-    return flags & (1U << 7);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    const auto& ANGULAR_CONSTRAINTS = rp3dBody->getAngularLockAxisFactor();
+    return SHMath::CompareFloat(ANGULAR_CONSTRAINTS.z, 0.0f);
   }
 
-  const SHVec3& SHRigidBodyComponent::GetForce() const noexcept
+  SHVec3 SHRigidBodyComponent::GetForce() const noexcept
   {
-    return force;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return false;
+    }
+
+    return rp3dBody->getForce();
   }
 
-  const SHVec3& SHRigidBodyComponent::GetTorque() const noexcept
+  SHVec3 SHRigidBodyComponent::GetTorque() const noexcept
   {
-    return torque;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return SHVec3::Zero;
+    }
+
+    return rp3dBody->getTorque();
   }
 
-  const SHVec3& SHRigidBodyComponent::GetLinearVelocity() const noexcept
+  SHVec3 SHRigidBodyComponent::GetLinearVelocity() const noexcept
   {
-    return linearVelocity;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return SHVec3::Zero;
+    }
+
+    return rp3dBody->getLinearVelocity();
   }
 
-  const SHVec3& SHRigidBodyComponent::GetAngularVelocity() const noexcept
+  SHVec3 SHRigidBodyComponent::GetAngularVelocity() const noexcept
   {
-    return angularVelocity;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return SHVec3::Zero;
+    }
+
+    return rp3dBody->getAngularVelocity();
   }
 
   const SHVec3& SHRigidBodyComponent::GetPosition() const noexcept
@@ -157,8 +242,15 @@ namespace SHADE
     if (type == newType)
       return;
 
-    dirtyFlags |=  1U << 4;
     type = newType;
+
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setType(static_cast<rp3d::BodyType>(type));
   }
 
   void SHRigidBodyComponent::SetGravityEnabled(bool enableGravity) noexcept
@@ -171,8 +263,13 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |= 1U << FLAG_POS;
-    enableGravity ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->enableGravity(enableGravity);
   }
 
   void SHRigidBodyComponent::SetIsAllowedToSleep(bool isAllowedToSleep) noexcept
@@ -185,92 +282,127 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |= 1U << 1;
-    isAllowedToSleep ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setIsAllowedToSleep(isAllowedToSleep);
   }
 
   void SHRigidBodyComponent::SetFreezePositionX(bool freezePositionX) noexcept
   {
-    static constexpr int FLAG_POS = 2;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set linear constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 2;
-    freezePositionX ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto linearConstraints = rp3dBody->getLinearLockAxisFactor();
+    linearConstraints.x = freezePositionX ? 0.0f : 1.0f;
+    rp3dBody->setLinearLockAxisFactor(linearConstraints);
   }
 
   void SHRigidBodyComponent::SetFreezePositionY(bool freezePositionY) noexcept
   {
-    static constexpr int FLAG_POS = 3;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set linear constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 2;
-    freezePositionY ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto linearConstraints = rp3dBody->getLinearLockAxisFactor();
+    linearConstraints.y = freezePositionY ? 0.0f : 1.0f;
+    rp3dBody->setLinearLockAxisFactor(linearConstraints);
   }
 
   void SHRigidBodyComponent::SetFreezePositionZ(bool freezePositionZ) noexcept
   {
-    static constexpr int FLAG_POS = 4;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set linear constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 2;
-    freezePositionZ ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto linearConstraints = rp3dBody->getLinearLockAxisFactor();
+    linearConstraints.z = freezePositionZ ? 0.0f : 1.0f;
+    rp3dBody->setLinearLockAxisFactor(linearConstraints);
   }
 
   void SHRigidBodyComponent::SetFreezeRotationX(bool freezeRotationX) noexcept
   {
-    static constexpr int FLAG_POS = 5;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set angular constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 3;
-    freezeRotationX ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto angularConstraints = rp3dBody->getAngularLockAxisFactor();
+    angularConstraints.x = freezeRotationX ? 0.0f : 1.0f;
+    rp3dBody->setAngularLockAxisFactor(angularConstraints);
   }
 
   void SHRigidBodyComponent::SetFreezeRotationY(bool freezeRotationY) noexcept
   {
-    static constexpr int FLAG_POS = 6;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set angular constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 3;
-    freezeRotationY ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto angularConstraints = rp3dBody->getAngularLockAxisFactor();
+    angularConstraints.y = freezeRotationY ? 0.0f : 1.0f;
+    rp3dBody->setAngularLockAxisFactor(angularConstraints);
   }
 
   void SHRigidBodyComponent::SetFreezeRotationZ(bool freezeRotationZ) noexcept
   {
-    static constexpr int FLAG_POS = 7;
-
     if (type == Type::STATIC)
     {
       SHLOG_WARNING("Cannot set angular constraints of a static object {}", GetEID())
       return;
     }
 
-    dirtyFlags |= 1U << 3;
-    freezeRotationZ ? flags |= (1U << FLAG_POS) : flags &= ~(1U << FLAG_POS);
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    auto angularConstraints = rp3dBody->getAngularLockAxisFactor();
+    angularConstraints.z = freezeRotationZ ? 0.0f : 1.0f;
+    rp3dBody->setAngularLockAxisFactor(angularConstraints);
   }
 
   void SHRigidBodyComponent::SetInterpolate(bool allowInterpolation) noexcept
@@ -283,11 +415,16 @@ namespace SHADE
     if (type != Type::DYNAMIC)
     {
       SHLOG_WARNING("Cannot set mass of a non-dynamic object {}", GetEID())
-      return;
+        return;
     }
 
-    dirtyFlags |=  1U << 5;
-    mass = newMass;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+        return;
+    }
+
+    rp3dBody->setMass(newMass);
   }
 
   void SHRigidBodyComponent::SetDrag(float newDrag) noexcept
@@ -298,8 +435,13 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |=  1U << 6;
-    drag = newDrag;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setLinearDamping(newDrag);
   }
 
   void SHRigidBodyComponent::SetAngularDrag(float newAngularDrag) noexcept
@@ -310,8 +452,13 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |=  1U << 7;
-    angularDrag = newAngularDrag;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setLinearDamping(newAngularDrag);
   }
 
   void SHRigidBodyComponent::SetLinearVelocity(const SHVec3& newLinearVelocity) noexcept
@@ -322,8 +469,13 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |= 1U << 8;
-    linearVelocity = newLinearVelocity;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setLinearVelocity(newLinearVelocity);
   }
 
   void SHRigidBodyComponent::SetAngularVelocity(const SHVec3& newAngularVelocity) noexcept
@@ -334,8 +486,13 @@ namespace SHADE
       return;
     }
 
-    dirtyFlags |= 1U << 9;
-    angularVelocity = newAngularVelocity;
+    if (rp3dBody == nullptr)
+    {
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
+      return;
+    }
+
+    rp3dBody->setAngularVelocity(newAngularVelocity);
   }
 
   /*-----------------------------------------------------------------------------------*/
@@ -346,7 +503,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -357,7 +514,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -368,7 +525,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -379,7 +536,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -390,7 +547,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -401,7 +558,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -412,7 +569,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
@@ -423,7 +580,7 @@ namespace SHADE
   {
     if (rp3dBody == nullptr)
     {
-      SHLOGV_ERROR("Entity {} is missing an rp3dBody!", GetEID())
+      SHLOG_ERROR("Missing rp3dBody from Entity {}", GetEID())
       return;
     }
 
diff --git a/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.h b/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.h
index 3c5dd4f9..ba7d2dd9 100644
--- a/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.h
+++ b/SHADE_Engine/src/Physics/Components/SHRigidBodyComponent.h
@@ -94,10 +94,10 @@ namespace SHADE
     [[nodiscard]] bool                GetFreezeRotationY  ()  const noexcept;
     [[nodiscard]] bool                GetFreezeRotationZ  ()  const noexcept;
 
-    [[nodiscard]] const SHVec3&       GetForce            ()  const noexcept;
-    [[nodiscard]] const SHVec3&       GetTorque           ()  const noexcept;
-    [[nodiscard]] const SHVec3&       GetLinearVelocity   ()  const noexcept;
-    [[nodiscard]] const SHVec3&       GetAngularVelocity  ()  const noexcept;
+    [[nodiscard]] SHVec3              GetForce            ()  const noexcept;
+    [[nodiscard]] SHVec3              GetTorque           ()  const noexcept;
+    [[nodiscard]] SHVec3              GetLinearVelocity   ()  const noexcept;
+    [[nodiscard]] SHVec3              GetAngularVelocity  ()  const noexcept;
 
     [[nodiscard]] const SHVec3&       GetPosition         ()  const noexcept;
     [[nodiscard]] const SHQuaternion& GetOrientation      ()  const noexcept;
@@ -149,28 +149,13 @@ namespace SHADE
     static constexpr size_t NUM_FLAGS       = 8;
     static constexpr size_t NUM_DIRTY_FLAGS = 16;
 
-    Type              type;
-
-    // rX rY rZ pX pY pZ slp g
-    uint8_t           flags;
-    // 0 0 0 0 0 0 aV lV aD d m t ag lc slp g
-    uint16_t          dirtyFlags;
-    bool              interpolate;
+    Type                        type;
+    bool                        interpolate;
 
     reactphysics3d::RigidBody*  rp3dBody;
 
-    float             mass;
-    float             drag;
-    float             angularDrag;
-
-    SHVec3            force;
-    SHVec3            linearVelocity;
-
-    SHVec3            torque;
-    SHVec3            angularVelocity;
-
-    SHVec3            position;
-    SHQuaternion      orientation;
+    SHVec3                      position;
+    SHQuaternion                orientation;
 
     RTTR_ENABLE()
   };
diff --git a/SHADE_Engine/src/Physics/SHCollider.cpp b/SHADE_Engine/src/Physics/SHCollider.cpp
index 9488042d..6cea3dc1 100644
--- a/SHADE_Engine/src/Physics/SHCollider.cpp
+++ b/SHADE_Engine/src/Physics/SHCollider.cpp
@@ -17,6 +17,7 @@
 #include "Math/Geometry/SHBoundingSphere.h"
 #include "Math/Transform/SHTransformComponent.h"
 #include "Math/SHMathHelpers.h"
+#include "Reflection/SHReflectionMetadata.h"
 
 namespace SHADE
 {
@@ -158,6 +159,11 @@ namespace SHADE
     return positionOffset;
   }
 
+  const SHVec3& SHCollider::GetRotationOffset() const noexcept
+  {
+    return rotationOffset;
+  }
+
   SHShape* SHCollider::GetShape() noexcept
   {
     dirty = true;
@@ -275,6 +281,12 @@ namespace SHADE
     }
   }
 
+  void SHCollider::SetRotationOffset(const SHVec3& rotOffset) noexcept
+  {
+    dirty = true;
+    rotationOffset = rotOffset;
+  }
+
   /*-----------------------------------------------------------------------------------*/
   /* Private Function Member Definitions                                               */
   /*-----------------------------------------------------------------------------------*/
@@ -316,5 +328,6 @@ RTTR_REGISTRATION
   );
 
   registration::class_<SHCollider>("Collider")
-    .property("Position Offset", &SHCollider::GetPositionOffset, &SHCollider::SetPositionOffset);
+    .property("Position Offset", &SHCollider::GetPositionOffset, &SHCollider::SetPositionOffset)
+    .property("Rotation Offset", &SHCollider::GetRotationOffset, &SHCollider::SetRotationOffset) (metadata(META::angleInRad, true));
 }
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/SHCollider.h b/SHADE_Engine/src/Physics/SHCollider.h
index f760ffd0..8cc233c4 100644
--- a/SHADE_Engine/src/Physics/SHCollider.h
+++ b/SHADE_Engine/src/Physics/SHCollider.h
@@ -80,6 +80,7 @@ namespace SHADE
     [[nodiscard]] const SHPhysicsMaterial&  GetMaterial       ()  const noexcept;
 
     [[nodiscard]] const SHVec3&             GetPositionOffset ()  const noexcept;
+    [[nodiscard]] const SHVec3&             GetRotationOffset ()  const noexcept;
 
     [[nodiscard]] SHShape*                  GetShape          ()  noexcept;
 
@@ -96,7 +97,8 @@ namespace SHADE
     void    SetDensity          (float density)                         noexcept;
     void    SetMaterial         (const SHPhysicsMaterial& newMaterial)  noexcept;
 
-    void    SetPositionOffset   (const SHVec3& positionOffset)  noexcept;
+    void    SetPositionOffset   (const SHVec3& posOffset) noexcept;
+    void    SetRotationOffset   (const SHVec3& rotOffset) noexcept;
 
   private:
     /*---------------------------------------------------------------------------------*/
@@ -110,6 +112,7 @@ namespace SHADE
     SHShape*          shape;
     SHPhysicsMaterial material;
     SHVec3            positionOffset;
+    SHVec3            rotationOffset;
 
     /*---------------------------------------------------------------------------------*/
     /* Function Members                                                                */
diff --git a/SHADE_Engine/src/Physics/SHPhysicsObject.cpp b/SHADE_Engine/src/Physics/SHPhysicsObject.cpp
index 4d4d8cd7..37c1269e 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsObject.cpp
+++ b/SHADE_Engine/src/Physics/SHPhysicsObject.cpp
@@ -130,6 +130,8 @@ namespace SHADE
 
   int SHPhysicsObject::AddCollider(SHCollider* collider)
   {
+    const rp3d::Transform OFFSETS{ collider->GetPositionOffset(), collider->GetRotationOffset() };
+
     switch (collider->GetType())
     {
       case SHCollider::Type::BOX:
@@ -137,7 +139,7 @@ namespace SHADE
         const auto* box = reinterpret_cast<SHBoundingBox*>(collider->GetShape());
         rp3d::BoxShape* newBox = factory->createBoxShape(box->GetHalfExtents());
 
-        rp3dBody->addCollider(newBox, rp3d::Transform{ collider->GetPositionOffset(), SHQuaternion::Identity });
+        rp3dBody->addCollider(newBox, OFFSETS);
         break;
       }
       case SHCollider::Type::SPHERE:
@@ -145,7 +147,7 @@ namespace SHADE
         const auto* sphere = reinterpret_cast<SHBoundingSphere*>(collider->GetShape());
         rp3d::SphereShape* newSphere = factory->createSphereShape(sphere->GetRadius());
 
-        rp3dBody->addCollider(newSphere, rp3d::Transform{ collider->GetPositionOffset(), SHQuaternion::Identity });
+        rp3dBody->addCollider(newSphere, OFFSETS);
         break;
       }
       // TODO(Diren): Add more collider shapes
@@ -168,96 +170,6 @@ namespace SHADE
       rp3dBody->removeCollider(collider);
   }
 
-  void SHPhysicsObject::SyncRigidBody(SHRigidBodyComponent* rb) const noexcept
-  {
-    SHASSERT(rp3dBody != nullptr, "ReactPhysics body does not exist!")
-
-    if (rb->dirtyFlags == 0)
-      return;
-
-    auto* rigidBody = reinterpret_cast<rp3d::RigidBody*>(rp3dBody);
-
-    const uint16_t RB_FLAGS = rb->dirtyFlags;
-    for (size_t i = 0; i < SHRigidBodyComponent::NUM_DIRTY_FLAGS; ++i)
-    {
-      // Check if current dirty flag has been set to true
-      if (RB_FLAGS & 1U << i)
-      {
-        switch (i)
-        {
-          case 0: // Gravity
-          {
-            rigidBody->enableGravity(rb->IsGravityEnabled());
-            break;
-          }
-          case 1: // Sleeping
-          {
-            rigidBody->setIsAllowedToSleep(rb->IsAllowedToSleep());
-            break;
-          }
-          case 2: // Linear Constraints
-          {
-            const rp3d::Vector3 CONSTRAINTS
-            {
-              rb->flags & 1U << 2 ? 0.0f : 1.0f,
-              rb->flags & 1U << 3 ? 0.0f : 1.0f,
-              rb->flags & 1U << 4 ? 0.0f : 1.0f
-            };
-
-    
-            rigidBody->setLinearLockAxisFactor(CONSTRAINTS);
-            break;
-          }
-          case 3: // Angular Constraints
-          {
-            const rp3d::Vector3 CONSTRAINTS
-            {
-              rb->flags & 1U << 5 ? 0.0f : 1.0f,
-              rb->flags & 1U << 6 ? 0.0f : 1.0f,
-              rb->flags & 1U << 7 ? 0.0f : 1.0f
-            };
-
-            rigidBody->setAngularLockAxisFactor(CONSTRAINTS);
-            break;
-          }
-          case 4: // Type
-          {
-            rigidBody->setType(static_cast<rp3d::BodyType>(rb->GetType()));
-            break;
-          }
-          case 5: // Mass
-          {
-            rigidBody->setMass(rb->GetMass());
-            break;
-          }
-          case 6: // Drag
-          {
-            rigidBody->setLinearDamping(rb->GetDrag());
-            break;
-          }
-          case 7: // Angular Drag
-          {
-            rigidBody->setAngularDamping(rb->GetAngularDrag());
-            break;
-          }
-          case 8: // Linear Velocity
-          {
-            rigidBody->setLinearVelocity(rb->GetLinearVelocity());
-            break;
-          }
-          case 9: // Angular Velocity
-          {
-            rigidBody->setAngularVelocity(rb->GetAngularVelocity());
-            break;
-          }
-          default: break;
-        }
-      }
-    }
-
-    rb->dirtyFlags = 0;
-  }
-
   void SHPhysicsObject::SyncColliders(SHColliderComponent* c) const noexcept
   {
     int index = 0;
@@ -266,9 +178,13 @@ namespace SHADE
       if (!collider.dirty)
         continue;
 
-      // Update offsets
       auto* rp3dCollider = rp3dBody->getCollider(index);
-      rp3dCollider->setLocalToBodyTransform(rp3d::Transform(collider.GetPositionOffset(), SHQuaternion::Identity));
+
+      // Update trigger flag
+      rp3dCollider->setIsTrigger(collider.IsTrigger());
+
+      // Update offsets
+      rp3dCollider->setLocalToBodyTransform(rp3d::Transform(collider.GetPositionOffset(), collider.GetRotationOffset()));
 
       switch (collider.GetType())
       {
@@ -293,6 +209,8 @@ namespace SHADE
         default: break;
       }
 
+      // TODO(Diren): Update Material
+
       collider.dirty = false;
       ++index;
     }
diff --git a/SHADE_Engine/src/Physics/SHPhysicsObject.h b/SHADE_Engine/src/Physics/SHPhysicsObject.h
index 67e5ec64..64caacdb 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsObject.h
+++ b/SHADE_Engine/src/Physics/SHPhysicsObject.h
@@ -72,7 +72,6 @@ namespace SHADE
     int   AddCollider           (SHCollider* collider);
     void  RemoveCollider        (int index);
 
-    void  SyncRigidBody         (SHRigidBodyComponent* rb)    const noexcept;
     void  SyncColliders         (SHColliderComponent* c)      const noexcept;
 
   private:
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp b/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
index 44142aaf..e1acccd9 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystem.cpp
@@ -17,10 +17,10 @@
 #include "ECS_Base/Managers/SHComponentManager.h"
 #include "ECS_Base/Managers/SHEntityManager.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
-#include "Editor/SHEditor.hpp"
 #include "Math/SHMathHelpers.h"
-#include "Scene/SHSceneManager.h"
 #include "Math/Transform/SHTransformComponent.h"
+#include "Scene/SHSceneManager.h"
+#include "Scripting/SHScriptEngine.h"
 
 namespace SHADE
 {
@@ -99,6 +99,16 @@ namespace SHADE
     return 0;
   }
 
+  const SHPhysicsSystem::CollisionEvents& SHPhysicsSystem::GetCollisionInfo() const noexcept
+  {
+    return collisionInfo;
+  }
+
+  const SHPhysicsSystem::CollisionEvents& SHPhysicsSystem::GetTriggerInfo() const noexcept
+  {
+    return triggerInfo;
+  }
+
   /*-----------------------------------------------------------------------------------*/
   /* Setter Function Definitions                                                       */
   /*-----------------------------------------------------------------------------------*/
@@ -187,6 +197,7 @@ namespace SHADE
     settings.defaultBounciness                  = 0.0f;
     
     world = factory.createPhysicsWorld(settings);
+    world->setEventListener(this);
 
     // Set up solvers
     world->setContactsPositionCorrectionTechnique(rp3d::ContactsPositionCorrectionTechnique::SPLIT_IMPULSES);
@@ -200,6 +211,12 @@ namespace SHADE
     const std::shared_ptr REMOVE_COMPONENT_RECEIVER { std::make_shared<SHEventReceiverSpec<SHPhysicsSystem>>(this, &SHPhysicsSystem::RemovePhysicsComponent) };
     const ReceiverPtr REMOVE_COMPONENT_RECEIVER_PTR = std::dynamic_pointer_cast<SHEventReceiver>(REMOVE_COMPONENT_RECEIVER);
     SHEventManager::SubscribeTo(SH_COMPONENT_REMOVED_EVENT, REMOVE_COMPONENT_RECEIVER_PTR);
+
+    #ifdef SHEDITOR
+        const std::shared_ptr EDITOR_STOP_RECEIVER { std::make_shared<SHEventReceiverSpec<SHPhysicsSystem>>(this, &SHPhysicsSystem::ResetWorld) };
+        const ReceiverPtr EDITOR_STOP_RECEIVER_PTR = std::dynamic_pointer_cast<SHEventReceiver>(EDITOR_STOP_RECEIVER);
+        SHEventManager::SubscribeTo(SH_EDITOR_ON_STOP_EVENT, EDITOR_STOP_RECEIVER_PTR);
+    #endif
   }
 
   void SHPhysicsSystem::Exit()
@@ -246,7 +263,10 @@ namespace SHADE
       if (physicsObject.rp3dBody == nullptr)
         continue;
 
-      const auto* transformComponent = SHComponentManager::GetComponent_s<SHTransformComponent>(entityID);
+      const auto* transformComponent  = SHComponentManager::GetComponent_s<SHTransformComponent>(entityID);
+      auto* rigidBodyComponent        = SHComponentManager::GetComponent_s<SHRigidBodyComponent>(entityID);
+      auto* colliderComponent         = SHComponentManager::GetComponent_s<SHColliderComponent>(entityID);
+
       if (transformComponent && transformComponent->HasChanged())
       {
         const auto WORLD_POS = transformComponent->GetWorldPosition();
@@ -255,68 +275,119 @@ namespace SHADE
         physicsObject.SetPosition(WORLD_POS);
         physicsObject.SetOrientation(WORLD_ROT);
 
-        auto* rigidBodyComponent = SHComponentManager::GetComponent_s<SHRigidBodyComponent>(entityID);
+        // Sync physics component transforms
+
         if (rigidBodyComponent)
         {
           rigidBodyComponent->position    = WORLD_POS;
           rigidBodyComponent->orientation = WORLD_ROT;
-
-          // Clear all forces and velocities if editor is stopped
-          if (SHSystemManager::GetSystem<SHEditor>()->editorState == SHEditor::State::STOP)
-          {
-            auto* rp3dRigidBody = reinterpret_cast<rp3d::RigidBody*>(physicsObject.rp3dBody);
-            rp3dRigidBody->resetForce();
-            rp3dRigidBody->resetTorque();
-            rp3dRigidBody->setLinearVelocity(SHVec3::Zero);
-            rp3dRigidBody->setAngularVelocity(SHVec3::Zero);
-          }
         }
 
-        auto* colliderComponent = SHComponentManager::GetComponent_s<SHColliderComponent>(entityID);
         if (colliderComponent)
         {
           colliderComponent->position    = WORLD_POS;
           colliderComponent->orientation = WORLD_ROT;
         }
       }
-    }
 
-    // Update bodies and colliders if component is dirty
-    system->SyncRigidBodyComponents(SHComponentManager::GetDense<SHRigidBodyComponent>());
-    system->SyncColliderComponents(SHComponentManager::GetDense<SHColliderComponent>());
+      // Sync rigid bodies
+
+      if (rigidBodyComponent)
+      {
+        // Sync active states
+        const bool COMPONENT_ACTIVE = rigidBodyComponent->isActive;
+        SyncActiveStates(physicsObject, COMPONENT_ACTIVE);
+
+        if (!COMPONENT_ACTIVE)
+          continue;
+      }
+
+      // Sync colliders
+
+      if (colliderComponent)
+      {
+        const bool COMPONENT_ACTIVE = colliderComponent->isActive;
+        SyncActiveStates(physicsObject, colliderComponent->isActive);
+
+        if (!COMPONENT_ACTIVE)
+          continue;
+
+        physicsObject.SyncColliders(colliderComponent);
+      }
+    }
   }
 
   void SHPhysicsSystem::PhysicsFixedUpdate::Execute(double dt) noexcept
   {
-    auto* system = reinterpret_cast<SHPhysicsSystem*>(GetSystem());
-    fixedTimeStep = 1.0 / system->fixedDT;
+    auto* physicsSystem   = reinterpret_cast<SHPhysicsSystem*>(GetSystem());
+    auto* scriptingSystem = SHSystemManager::GetSystem<SHScriptEngine>();
+    if (scriptingSystem == nullptr)
+    {
+        SHLOGV_WARNING("Unable to invoke FixedUpdate() on scripts due to missing SHScriptEngine!");
+    }
+
+    fixedTimeStep = 1.0 / physicsSystem->fixedDT;
     accumulatedTime += dt;
 
     int count = 0;
     while (accumulatedTime > fixedTimeStep)
     {
-      system->world->update(static_cast<rp3d::decimal>(fixedTimeStep));
+      if (scriptingSystem != nullptr)
+        scriptingSystem->ExecuteFixedUpdates();
+      
+      physicsSystem->world->update(static_cast<rp3d::decimal>(fixedTimeStep));
 
       accumulatedTime -= fixedTimeStep;
       ++count;
     }
 
     stats.numSteps = count;
-    system->worldUpdated = count > 0;
+    physicsSystem->worldUpdated = count > 0;
     
-    system->interpolationFactor = accumulatedTime / fixedTimeStep;
+    physicsSystem->interpolationFactor = accumulatedTime / fixedTimeStep;
   }
 
   void SHPhysicsSystem::PhysicsPostUpdate::Execute(double) noexcept
   {
-    auto* system = reinterpret_cast<SHPhysicsSystem*>(GetSystem());
+    auto* physicsSystem = reinterpret_cast<SHPhysicsSystem*>(GetSystem());
+    auto* scriptingSystem = SHSystemManager::GetSystem<SHScriptEngine>();
+    if (scriptingSystem == nullptr)
+    {
+        SHLOGV_WARNING("Unable to invoke collision and trigger script events due to missing SHScriptEngine!");
+    }
 
     // Interpolate transforms for rendering
-    if (system->worldUpdated)
+    if (physicsSystem->worldUpdated)
     {
-      system->SyncTransforms();
+      physicsSystem->SyncTransforms();
 
-      // TODO(Diren): Handle trigger messages for scripting
+      // Collision & Trigger messages
+      if (scriptingSystem != nullptr)
+        scriptingSystem->ExecuteCollisionFunctions();
+
+      physicsSystem->ClearInvalidCollisions();
+    }
+  }
+
+  void SHPhysicsSystem::onContact(const CallbackData& callbackData)
+  {
+    for (uint32_t i = 0; i < callbackData.getNbContactPairs(); ++i)
+    {
+      const auto CONTACT_PAIR           = callbackData.getContactPair(i);
+      const SHCollisionEvent NEW_EVENT  = GenerateCollisionEvent(CONTACT_PAIR);
+
+      UpdateEventContainers(NEW_EVENT, collisionInfo);
+    }
+  }
+
+  void SHPhysicsSystem::onTrigger(const rp3d::OverlapCallback::CallbackData& callbackData)
+  {
+    for (uint32_t i = 0; i < callbackData.getNbOverlappingPairs(); ++i)
+    {
+      const auto& OVERLAP_PAIR          = callbackData.getOverlappingPair(i);
+      const SHCollisionEvent NEW_EVENT  = GenerateCollisionEvent(OVERLAP_PAIR);
+
+      UpdateEventContainers(NEW_EVENT, triggerInfo);
     }
   }
 
@@ -353,58 +424,11 @@ namespace SHADE
     map.erase(entityID);
   }
 
-  void SHPhysicsSystem::SyncActiveStates(SHPhysicsObject* physicsObject, bool componentActive) noexcept
+  void SHPhysicsSystem::SyncActiveStates(SHPhysicsObject& physicsObject, bool componentActive) noexcept
   {
-    const bool RP3D_ACTIVE = physicsObject->rp3dBody->isActive();
+    const bool RP3D_ACTIVE = physicsObject.rp3dBody->isActive();
     if (RP3D_ACTIVE != componentActive)
-      physicsObject->rp3dBody->setIsActive(componentActive);
-  }
-
-
-  void SHPhysicsSystem::SyncRigidBodyComponents(std::vector<SHRigidBodyComponent>& denseArray) noexcept
-  {
-    if (denseArray.empty())
-      return;
-
-    for (auto& comp : denseArray)
-    {
-      const EntityID ENTITY_ID = comp.GetEID();
-
-      // Get physicsObject
-      auto* physicsObject = GetPhysicsObject(ENTITY_ID);
-
-      // TODO(Diren): Check if active in hierarchy
-      const bool COMPONENT_ACTIVE = comp.isActive;
-      SyncActiveStates(physicsObject, COMPONENT_ACTIVE);
-
-      if (!COMPONENT_ACTIVE)
-        continue;
-
-      physicsObject->SyncRigidBody(&comp);
-    }
-  }
-
-  void SHPhysicsSystem::SyncColliderComponents(std::vector<SHColliderComponent>& denseArray) noexcept
-  {
-    if (denseArray.empty())
-      return;
-
-    for (auto& comp : denseArray)
-    {
-      const EntityID ENTITY_ID = comp.GetEID();
-
-      // Get physicsObject
-      auto* physicsObject = GetPhysicsObject(ENTITY_ID);
-
-      // TODO(Diren): Check if active in hierarchy
-      const bool COMPONENT_ACTIVE = comp.isActive;
-      SyncActiveStates(physicsObject, COMPONENT_ACTIVE);
-
-      if (!COMPONENT_ACTIVE)
-        continue;
-
-      physicsObject->SyncColliders(&comp);
-    }
+      physicsObject.rp3dBody->setIsActive(componentActive);
   }
 
   void SHPhysicsSystem::SyncTransforms() noexcept
@@ -459,15 +483,54 @@ namespace SHADE
       }
 
       // Convert RP3D Transform to SHADE
-      auto* transformComponent = SHComponentManager::GetComponent<SHTransformComponent>(entityID);
-      transformComponent->SetWorldPosition(rp3dPos);
-      transformComponent->SetWorldOrientation(rp3dRot);
+      auto* transformComponent = SHComponentManager::GetComponent_s<SHTransformComponent>(entityID);
+
+      if (transformComponent != nullptr)
+      {
+        transformComponent->SetWorldPosition(rp3dPos);
+        transformComponent->SetWorldOrientation(rp3dRot);
+      }
 
       // Cache transforms
       physicsObject.prevTransform = CURRENT_TF;
     }
   }
 
+  void SHPhysicsSystem::UpdateEventContainers(const SHCollisionEvent& collisionEvent, CollisionEvents& container) noexcept
+  {
+    const auto IT = std::ranges::find_if(container.begin(), container.end(), [&](const SHCollisionEvent& e)
+    {
+      const bool ENTITY_MATCH     = e.value[0] == collisionEvent.value[0];
+      const bool COLLIDERS_MATCH  = e.value[1] == collisionEvent.value[1];
+      return ENTITY_MATCH && COLLIDERS_MATCH;
+    });
+
+    if (IT == container.end())
+      container.emplace_back(collisionEvent);
+    else
+      IT->collisionState = collisionEvent.collisionState;
+  }
+
+  void SHPhysicsSystem::ClearInvalidCollisions() noexcept
+  {
+    static const auto CLEAR = [](CollisionEvents& container)
+    {
+      for (auto eventIter = container.begin(); eventIter != container.end();)
+      {
+        const bool CLEAR_EVENT =  eventIter->GetCollisionState() == SHCollisionEvent::State::EXIT
+                              ||  eventIter->GetCollisionState() == SHCollisionEvent::State::INVALID;
+
+        if (CLEAR_EVENT)
+          eventIter = container.erase(eventIter);
+        else
+          ++eventIter;
+      }
+    };
+
+    CLEAR(collisionInfo);
+    CLEAR(triggerInfo);
+  }
+
   SHEventHandle SHPhysicsSystem::AddPhysicsComponent(SHEventPtr addComponentEvent)
   {
     const auto& EVENT_DATA = reinterpret_cast<const SHEventSpec<SHComponentAddedEvent>*>(addComponentEvent.get());
@@ -556,14 +619,21 @@ namespace SHADE
       const EntityID ENTITY_ID = EVENT_DATA->data->eid;
       auto* physicsObject = GetPhysicsObject(ENTITY_ID);
 
-      SHASSERT(physicsObject != nullptr, "Physics object has been lost from the world!")
+      auto* rigidBodyComponent = SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ENTITY_ID);
+      auto* colliderComponent = SHComponentManager::GetComponent_s<SHColliderComponent>(ENTITY_ID);
 
-      if (REMOVED_ID == RIGID_BODY_ID)
+      // Wake up all physics objects
+      for (auto& [entityID, object] : map)
+      {
+        if (SHComponentManager::HasComponent<SHRigidBodyComponent>(entityID))
+          reinterpret_cast<rp3d::RigidBody*>(object.rp3dBody)->setIsSleeping(false);
+      }
+
+      if (REMOVED_ID == RIGID_BODY_ID && physicsObject != nullptr)
       {
         world->destroyRigidBody(reinterpret_cast<rp3d::RigidBody*>(physicsObject->rp3dBody));
-        physicsObject->rp3dBody       = nullptr;
+        physicsObject->rp3dBody = nullptr;
 
-        auto* colliderComponent = SHComponentManager::GetComponent_s<SHColliderComponent>(ENTITY_ID);
         if (colliderComponent != nullptr)
         {
           // Preserve colliders as a collision body
@@ -575,16 +645,9 @@ namespace SHADE
           for (auto& collider : colliderComponent->colliders)
             physicsObject->AddCollider(&collider);
         }
-
-        // Wake up all physics objects
-        for (auto& [entityID, object] : map)
-        {
-          if (SHComponentManager::HasComponent<SHRigidBodyComponent>(entityID))
-            reinterpret_cast<rp3d::RigidBody*>(object.rp3dBody)->setIsSleeping(false);
-        }
       }
 
-      if (REMOVED_ID == COLLIDER_ID)
+      if (REMOVED_ID == COLLIDER_ID && physicsObject != nullptr)
       {
         // Remove all colliders
         const int NUM_COLLIDERS = static_cast<int>(physicsObject->rp3dBody->getNbColliders());
@@ -594,13 +657,36 @@ namespace SHADE
           auto* collider = physicsObject->rp3dBody->getCollider(i);
           physicsObject->rp3dBody->removeCollider(collider);
         }
+
+        // Check for a rigidbody component
+        if (rigidBodyComponent == nullptr)
+          physicsObject->rp3dBody = nullptr;
       }
 
-      if (physicsObject->rp3dBody == nullptr)
-          DestroyPhysicsObject(ENTITY_ID);
+      if (physicsObject != nullptr && physicsObject->rp3dBody == nullptr)
+        DestroyPhysicsObject(ENTITY_ID);
     }
 
     return EVENT_DATA->handle;
   }
 
+  SHEventHandle SHPhysicsSystem::ResetWorld(SHEventPtr editorStopEvent)
+  {
+    // TODO(Diren): Rebuild world based on how scene reloading is done
+
+    for (auto& [entityID, physicsObject] : map)
+    {
+      if (SHComponentManager::HasComponent<SHRigidBodyComponent>(entityID))
+      {
+        auto* rp3dRigidBody = reinterpret_cast<rp3d::RigidBody*>(physicsObject.rp3dBody);
+        rp3dRigidBody->resetForce();
+        rp3dRigidBody->resetTorque();
+        rp3dRigidBody->setLinearVelocity(SHVec3::Zero);
+        rp3dRigidBody->setAngularVelocity(SHVec3::Zero);
+      }
+    }
+
+    return editorStopEvent->handle;
+  }
+
 } // namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystem.h b/SHADE_Engine/src/Physics/SHPhysicsSystem.h
index a3c3bea1..1d773618 100644
--- a/SHADE_Engine/src/Physics/SHPhysicsSystem.h
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystem.h
@@ -23,16 +23,18 @@
 #include "Math/Transform/SHTransformComponent.h"
 #include "Scene/SHSceneGraph.h"
 #include "SHPhysicsObject.h"
-
+#include "SHPhysicsUtils.h"
 
 
 namespace SHADE
 {
+
   /*-----------------------------------------------------------------------------------*/
   /* Type Definitions                                                                  */
   /*-----------------------------------------------------------------------------------*/
 
-  class SH_API SHPhysicsSystem final : public SHSystem
+  class SH_API SHPhysicsSystem final  : public SHSystem
+                                      , public rp3d::EventListener
   {
   public:
     /*---------------------------------------------------------------------------------*/
@@ -47,6 +49,8 @@ namespace SHADE
       bool      sleepingEnabled;
     };
 
+    using CollisionEvents = std::vector<SHCollisionEvent>;
+
     /*---------------------------------------------------------------------------------*/
     /* Constructors & Destructor                                                       */
     /*---------------------------------------------------------------------------------*/
@@ -57,13 +61,16 @@ namespace SHADE
     /* Getter Functions                                                                */
     /*---------------------------------------------------------------------------------*/
 
-    [[nodiscard]] double    GetFixedDT                  ()  const noexcept;
+    [[nodiscard]] double    GetFixedDT                    ()  const noexcept;
 
-    [[nodiscard]] bool      IsSleepingEnabled           ()  const noexcept;
+    [[nodiscard]] bool      IsSleepingEnabled             ()  const noexcept;
 
-    [[nodiscard]] SHVec3    GetWorldGravity             ()  const noexcept;
-    [[nodiscard]] uint16_t  GetNumberVelocityIterations ()  const noexcept;
-    [[nodiscard]] uint16_t  GetNumberPositionIterations ()  const noexcept;
+    [[nodiscard]] SHVec3    GetWorldGravity               ()  const noexcept;
+    [[nodiscard]] uint16_t  GetNumberVelocityIterations   ()  const noexcept;
+    [[nodiscard]] uint16_t  GetNumberPositionIterations   ()  const noexcept;
+
+    [[nodiscard]] const CollisionEvents& GetCollisionInfo ()  const noexcept;
+    [[nodiscard]] const CollisionEvents& GetTriggerInfo   ()  const noexcept;
     
 
     /*---------------------------------------------------------------------------------*/
@@ -82,16 +89,14 @@ namespace SHADE
     /* Function Members                                                                */
     /*---------------------------------------------------------------------------------*/
 
-    void  Init                         () override;
-    void  Exit                         () override;
+    void  Init                  () override;
+    void  Exit                  () override;
 
-    //void  AddRigidBody                (EntityID entityID) noexcept;
-    //void  AddCollider                 (EntityID entityID) noexcept;
-    //void  RemoveRigidBody             (EntityID entityID) noexcept;
-    //void  RemoveCollider              (EntityID entityID) noexcept;
+    void  AddCollisionShape     (EntityID entityID, SHCollider* collider);
+    void  RemoveCollisionShape  (EntityID entityID, int index);
 
-    void  AddCollisionShape           (EntityID entityID, SHCollider* collider);
-    void  RemoveCollisionShape        (EntityID entityID, int index);
+    void onContact              (const rp3d::CollisionCallback::CallbackData& callbackData) override;
+    void onTrigger              (const rp3d::OverlapCallback::CallbackData& callbackData) override;
 
     /*---------------------------------------------------------------------------------*/
     /* System Routines                                                                 */
@@ -156,49 +161,41 @@ namespace SHADE
     /* Data Members                                                                    */
     /*---------------------------------------------------------------------------------*/
 
-    bool                      worldUpdated;
+    bool                  worldUpdated;
 
-    double                    interpolationFactor;
-    double                    fixedDT;
-
-    rp3d::PhysicsWorld*       world;
-    rp3d::PhysicsCommon       factory;
-
-    EntityObjectMap           map;
+    double                interpolationFactor;
+    double                fixedDT;
 
+    rp3d::PhysicsWorld*   world;
+    rp3d::PhysicsCommon   factory;
 
+    EntityObjectMap       map;
+    CollisionEvents       collisionInfo;
+    CollisionEvents       triggerInfo;
 
     /*---------------------------------------------------------------------------------*/
     /* Function Members                                                                */
     /*---------------------------------------------------------------------------------*/
-    SHPhysicsObject*  EnsurePhysicsObject       (EntityID entityID)                                     noexcept;
-    SHPhysicsObject*  GetPhysicsObject          (EntityID entityID)                                     noexcept;
-    void              DestroyPhysicsObject      (EntityID entityID)                                     noexcept;
 
-    void              SyncActiveStates          (SHPhysicsObject* physicsObject, bool componentActive)  noexcept;
-    void              SyncRigidBodyComponents   (std::vector<SHRigidBodyComponent>& denseArray)         noexcept;
-    void              SyncColliderComponents    (std::vector<SHColliderComponent>& denseArray)          noexcept;
+    SHPhysicsObject*  EnsurePhysicsObject       (EntityID entityID) noexcept;
+    SHPhysicsObject*  GetPhysicsObject          (EntityID entityID) noexcept;
+    void              DestroyPhysicsObject      (EntityID entityID) noexcept;
+
+    static void       SyncActiveStates          (SHPhysicsObject& physicsObject, bool componentActive)  noexcept;
     void              SyncTransforms            ()                                                      noexcept;
 
+    static void       UpdateEventContainers     (const SHCollisionEvent& collisionEvent, CollisionEvents& container)  noexcept;
+    void              ClearInvalidCollisions    ()                                                              noexcept;
+
     SHEventHandle     AddPhysicsComponent       (SHEventPtr addComponentEvent);
     SHEventHandle     RemovePhysicsComponent    (SHEventPtr removeComponentEvent);
+    SHEventHandle     ResetWorld                (SHEventPtr editorStopEvent);
+
+    template <typename RP3DCollisionPair, typename = std::enable_if_t
+                                                    <std::is_same_v<RP3DCollisionPair, rp3d::CollisionCallback::ContactPair>
+                                                  || std::is_same_v<RP3DCollisionPair, rp3d::OverlapCallback::OverlapPair>>>
+    SHCollisionEvent GenerateCollisionEvent     (const RP3DCollisionPair& cp)           noexcept;
   };
+} // namespace SHADE
 
-  /*-----------------------------------------------------------------------------------*/
-  /* Event Data Definitions                                                            */
-  /*-----------------------------------------------------------------------------------*/
-
-  struct SHPhysicsColliderAddedEvent
-  {
-    EntityID          entityID;
-    SHCollider::Type  colliderType;
-    int               colliderIndex;
-  };
-
-  struct SHPhysicsColliderRemovedEvent
-  {
-    EntityID          entityID;
-    int               colliderIndex;
-  };
-
-} // namespace SHADE
\ No newline at end of file
+#include "SHPhysicsSystem.hpp"
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystem.hpp b/SHADE_Engine/src/Physics/SHPhysicsSystem.hpp
new file mode 100644
index 00000000..957fb3aa
--- /dev/null
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystem.hpp
@@ -0,0 +1,84 @@
+/****************************************************************************************
+ * \file      SHPhysicsSystem.hpp
+ * \author    Diren D Bharwani, diren.dbharwani, 390002520
+ * \brief     Implementation for templated functions the Physics System
+ *
+ * \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
+ *            disclosure of this file or its contents without the prior written consent
+ *            of DigiPen Institute of Technology is prohibited.
+****************************************************************************************/
+
+#pragma once
+
+#include <type_traits>
+
+// Primary Header
+#include "SHPhysicsSystem.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Private Function Member Definitions                                               */
+  /*-----------------------------------------------------------------------------------*/
+
+  template <typename RP3DCollisionPair, typename Condition>
+  SHCollisionEvent SHPhysicsSystem::GenerateCollisionEvent(const RP3DCollisionPair& cp) noexcept
+  {
+    static const auto MATCH_COLLIDER = []
+    (
+      const SHPhysicsObject&  physicsObject
+    , const rp3d::Entity      colliderID
+    )->uint32_t
+    {
+      for (uint32_t i = 0; i < physicsObject.rp3dBody->getNbColliders(); ++i)
+      {
+        const auto* collider = physicsObject.rp3dBody->getCollider(i);
+        if (collider->getEntity() == colliderID)
+          return i;
+      }
+
+      return std::numeric_limits<uint32_t>::max();
+    };
+
+    SHCollisionEvent cInfo;
+
+    // Update collision state
+    cInfo.collisionState = static_cast<SHCollisionEvent::State>(cp.getEventType());
+
+    // Match body and collider for collision event
+    const rp3d::Entity body1      = cp.getBody1()->getEntity();
+    const rp3d::Entity body2      = cp.getBody2()->getEntity();
+    const rp3d::Entity collider1  = cp.getCollider1()->getEntity();
+    const rp3d::Entity collider2  = cp.getCollider2()->getEntity();
+
+    // Find and match both ids
+    bool matched[2] = { false, false };
+
+    
+    for (auto& [entityID, physicsObject] : map)
+    {
+      // Match body 1
+      if (matched[SHCollisionEvent::ENTITY_A] == false && physicsObject.rp3dBody->getEntity() == body1)
+      {
+        cInfo.ids[SHCollisionEvent::ENTITY_A] = entityID;
+        cInfo.ids[SHCollisionEvent::COLLIDER_A] = MATCH_COLLIDER(physicsObject, collider1);
+
+        matched[SHCollisionEvent::ENTITY_A] = true;
+      }
+
+      // Match body 2
+      if (matched[SHCollisionEvent::ENTITY_B] == false && physicsObject.rp3dBody->getEntity() == body2)
+      {
+        cInfo.ids[SHCollisionEvent::ENTITY_B] = entityID;
+        cInfo.ids[SHCollisionEvent::COLLIDER_B] = MATCH_COLLIDER(physicsObject, collider2);
+
+        matched[SHCollisionEvent::ENTITY_B] = true;
+      }
+
+      if (matched[SHCollisionEvent::ENTITY_A] == true && matched[SHCollisionEvent::ENTITY_B] == true)
+        return cInfo;
+    }
+
+    return cInfo;
+  }
+} // namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.cpp b/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.cpp
new file mode 100644
index 00000000..4b292340
--- /dev/null
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.cpp
@@ -0,0 +1,65 @@
+/************************************************************************************//*!
+\file           SHPhysicsSystemInterface.cpp
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definitions of the functions of the static
+                SHPhysicsSystemInterface class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+// Precompiled Headers
+#include "SHpch.h"
+// Primary Header
+#include "SHPhysicsSystemInterface.h"
+// Project Includes
+#include "ECS_Base/Managers/SHSystemManager.h"
+#include "Physics/SHPhysicsSystem.h"
+#include "Physics/SHPhysicsUtils.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Static Usage Functions                                                            */
+  /*-----------------------------------------------------------------------------------*/
+  const std::vector<SHCollisionEvent>& SHPhysicsSystemInterface::GetCollisionInfo() noexcept
+  {
+    static std::vector<SHCollisionEvent> emptyVec;
+
+    auto phySystem = SHSystemManager::GetSystem<SHPhysicsSystem>();
+    if (phySystem)
+    {
+      return phySystem->GetCollisionInfo();
+    }
+
+    SHLOG_WARNING("[SHPhysicsSystemInterface] Failed to get collision events. Empty vector returned instead.");
+    return emptyVec;
+  }
+  const std::vector<SHCollisionEvent>& SHPhysicsSystemInterface::GetTriggerInfo() noexcept
+  {
+    static std::vector<SHCollisionEvent> emptyVec;
+
+    auto phySystem = SHSystemManager::GetSystem<SHPhysicsSystem>();
+    if (phySystem)
+    {
+      return phySystem->GetTriggerInfo(); 
+    }
+
+    SHLOG_WARNING("[SHPhysicsSystemInterface] Failed to get trigger events. Empty vector returned instead.");
+    return emptyVec;
+  }
+
+  double SHPhysicsSystemInterface::GetFixedDT() noexcept
+  {
+    auto phySystem = SHSystemManager::GetSystem<SHPhysicsSystem>();
+    if (phySystem)
+    {
+      return phySystem->GetFixedDT();
+    }
+
+    SHLOG_WARNING("[SHPhysicsSystemInterface] Failed to get fixed delta time. 0.0 returned instead.");
+    return 0.0;
+  }
+}
diff --git a/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.h b/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.h
new file mode 100644
index 00000000..da6a0433
--- /dev/null
+++ b/SHADE_Engine/src/Physics/SHPhysicsSystemInterface.h
@@ -0,0 +1,46 @@
+/************************************************************************************//*!
+\file           SHPhysicsSystemInterface.h
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definition of the SHGraphicsSystemInterface static class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+
+// STL Includes
+#include <vector>
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Forward Declarations                                                              */
+  /*-----------------------------------------------------------------------------------*/
+  class SHCollisionEvent;
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Type Definitions                                                                  */
+  /*-----------------------------------------------------------------------------------*/
+  /// <summary>
+  /// Static class that wraps up certain functions in the SHPhysicsSystem so that 
+  /// accessing it from SHADE_Managed would not cause issues due to C++20 features.
+  /// </summary>
+  class SH_API SHPhysicsSystemInterface final
+  {
+    public:
+    /*---------------------------------------------------------------------------------*/
+    /* Constructor                                                                     */
+    /*---------------------------------------------------------------------------------*/
+    SHPhysicsSystemInterface() = delete;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Static Usage Functions                                                          */
+    /*---------------------------------------------------------------------------------*/
+    [[nodiscard]] static const std::vector<SHCollisionEvent>& GetCollisionInfo() noexcept;
+    [[nodiscard]] static const std::vector<SHCollisionEvent>& GetTriggerInfo() noexcept;
+    [[nodiscard]] static double GetFixedDT() noexcept;
+  };
+}
diff --git a/SHADE_Engine/src/Physics/SHPhysicsUtils.cpp b/SHADE_Engine/src/Physics/SHPhysicsUtils.cpp
new file mode 100644
index 00000000..8d5bc956
--- /dev/null
+++ b/SHADE_Engine/src/Physics/SHPhysicsUtils.cpp
@@ -0,0 +1,93 @@
+/****************************************************************************************
+ * \file      SHPhysicsUtils.cpp
+ * \author    Diren D Bharwani, diren.dbharwani, 390002520
+ * \brief     Implementation for some Physics Utilities
+ *
+ * \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
+ *            disclosure of this file or its contents without the prior written consent
+ *            of DigiPen Institute of Technology is prohibited.
+****************************************************************************************/
+
+#include <SHpch.h>
+
+// Primary Header
+#include "SHPhysicsUtils.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Constructors & Destructor Definitions                                             */
+  /*-----------------------------------------------------------------------------------*/
+
+  SHCollisionEvent::SHCollisionEvent() noexcept
+  : collisionState  { State::INVALID }
+  {
+    ids[ENTITY_A]   = MAX_EID;
+    ids[ENTITY_B]   = MAX_EID;
+    ids[COLLIDER_A] = std::numeric_limits<uint32_t>::max();
+    ids[COLLIDER_B] = std::numeric_limits<uint32_t>::max();
+  }
+
+  SHCollisionEvent::SHCollisionEvent(EntityID entityA, EntityID entityB) noexcept
+  : collisionState  { State::INVALID }
+  {
+    ids[ENTITY_A]   = entityA;
+    ids[ENTITY_B]   = entityB;
+    ids[COLLIDER_A] = std::numeric_limits<uint32_t>::max();
+    ids[COLLIDER_B] = std::numeric_limits<uint32_t>::max();
+  }
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Operator Overload Definitions                                                     */
+  /*-----------------------------------------------------------------------------------*/
+
+  bool SHCollisionEvent::operator==(const SHCollisionEvent& rhs) const noexcept
+  {
+    return value[0] == rhs.value[0] && value[1] == rhs.value[1];
+  }
+
+  bool SHCollisionEvent::operator!=(const SHCollisionEvent& rhs) const noexcept
+  {
+    return  value[0] != rhs.value[0] || value[1] != rhs.value[1];
+  }
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Getter Function Definitions                                                       */
+  /*-----------------------------------------------------------------------------------*/
+
+  EntityID SHCollisionEvent::GetEntityA() const noexcept
+  {
+    return ids[ENTITY_A];
+  }
+
+  EntityID SHCollisionEvent::GetEntityB() const noexcept
+  {
+    return ids[ENTITY_B];
+  }
+
+  const SHRigidBodyComponent* SHCollisionEvent::GetRigidBodyA() const noexcept
+  {
+    return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_A]);
+  }
+
+  const SHRigidBodyComponent* SHCollisionEvent::GetRigidBodyB() const noexcept
+  {
+    return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_B]);
+  }
+
+  const SHCollider* SHCollisionEvent::GetColliderA() const noexcept
+  {
+    return &SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_A])->GetCollider(ids[COLLIDER_A]);
+  }
+
+  const SHCollider* SHCollisionEvent::GetColliderB() const noexcept
+  {
+    return &SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_B])->GetCollider(ids[COLLIDER_B]);
+  }
+
+  SHCollisionEvent::State SHCollisionEvent::GetCollisionState() const noexcept
+  {
+    return collisionState;
+  }
+
+} // namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Physics/SHPhysicsUtils.h b/SHADE_Engine/src/Physics/SHPhysicsUtils.h
new file mode 100644
index 00000000..57f9c6fc
--- /dev/null
+++ b/SHADE_Engine/src/Physics/SHPhysicsUtils.h
@@ -0,0 +1,116 @@
+/****************************************************************************************
+ * \file      SHPhysicsUtils.h
+ * \author    Diren D Bharwani, diren.dbharwani, 390002520
+ * \brief     Interface for some Physics Utilities
+ *
+ * \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
+ *            disclosure of this file or its contents without the prior written consent
+ *            of DigiPen Institute of Technology is prohibited.
+****************************************************************************************/
+
+#pragma once
+
+// Project Headers
+#include "Components/SHColliderComponent.h"
+#include "Components/SHRigidBodyComponent.h"
+
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Type Definitions                                                                  */
+  /*-----------------------------------------------------------------------------------*/
+
+  struct SHPhysicsColliderAddedEvent
+  {
+    EntityID          entityID;
+    SHCollider::Type  colliderType;
+    int               colliderIndex;
+  };
+
+  struct SHPhysicsColliderRemovedEvent
+  {
+    EntityID          entityID;
+    int               colliderIndex;
+  };
+
+  class SH_API SHCollisionEvent
+  {
+  private:
+    /*---------------------------------------------------------------------------------*/
+    /* Friends                                                                         */
+    /*---------------------------------------------------------------------------------*/
+
+    friend class SHPhysicsSystem;
+
+  public:
+    /*---------------------------------------------------------------------------------*/
+    /* Type Definitions                                                                */
+    /*---------------------------------------------------------------------------------*/
+
+    enum class State
+    {
+      ENTER
+    , STAY
+    , EXIT
+
+    , TOTAL
+    , INVALID = -1
+    };
+
+    /*---------------------------------------------------------------------------------*/
+    /* Constructors & Destructor                                                       */
+    /*---------------------------------------------------------------------------------*/
+
+    SHCollisionEvent   ()                                    noexcept;
+    SHCollisionEvent   (EntityID entityA, EntityID entityB)  noexcept;
+
+
+    SHCollisionEvent   (const SHCollisionEvent& rhs)  = default;
+    SHCollisionEvent   (SHCollisionEvent&& rhs)       = default;
+    ~SHCollisionEvent  ()                             = default;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Operator Overloads                                                              */
+    /*---------------------------------------------------------------------------------*/
+
+    bool operator== (const SHCollisionEvent& rhs)      const noexcept;
+    bool operator!= (const SHCollisionEvent& rhs)      const noexcept;
+
+    SHCollisionEvent& operator= (const SHCollisionEvent& rhs) = default;
+    SHCollisionEvent& operator= (SHCollisionEvent&& rhs)      = default;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Getter Functions                                                                */
+    /*---------------------------------------------------------------------------------*/
+
+    [[nodiscard]] EntityID                    GetEntityA        ()  const noexcept;
+    [[nodiscard]] EntityID                    GetEntityB        ()  const noexcept;
+    [[nodiscard]] const SHRigidBodyComponent* GetRigidBodyA     ()  const noexcept;
+    [[nodiscard]] const SHRigidBodyComponent* GetRigidBodyB     ()  const noexcept;
+    [[nodiscard]] const SHCollider*           GetColliderA      ()  const noexcept;
+    [[nodiscard]] const SHCollider*           GetColliderB      ()  const noexcept;
+    [[nodiscard]] State                       GetCollisionState ()  const noexcept;
+
+  private:
+
+    static constexpr uint32_t ENTITY_A    = 0;
+    static constexpr uint32_t ENTITY_B    = 1;
+    static constexpr uint32_t COLLIDER_A  = 2;
+    static constexpr uint32_t COLLIDER_B  = 3;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Data Members                                                                    */
+    /*---------------------------------------------------------------------------------*/
+
+    union
+    {
+      uint64_t value[2];  // EntityValue, ColliderIndexValue
+      uint32_t ids  [4];  // EntityA, EntityB, ColliderIndexA, ColliderIndexB
+    };
+
+    State     collisionState;
+  };
+
+
+} // namespace SHADE
\ No newline at end of file
diff --git a/SHADE_Engine/src/Reflection/SHReflectionMetadata.h b/SHADE_Engine/src/Reflection/SHReflectionMetadata.h
index 0cc6d8a5..b4dc009c 100644
--- a/SHADE_Engine/src/Reflection/SHReflectionMetadata.h
+++ b/SHADE_Engine/src/Reflection/SHReflectionMetadata.h
@@ -7,5 +7,6 @@ namespace SHADE
     constexpr const char* min = "MIN";
     constexpr const char* max = "MAX";
     constexpr const char* tooltip = "tooltip";
+    constexpr const char* angleInRad = "angleInRad";
   }
 }
diff --git a/SHADE_Engine/src/Resource/SHResourceManager.cpp b/SHADE_Engine/src/Resource/SHResourceManager.cpp
index 156c31c7..dad9fd9f 100644
--- a/SHADE_Engine/src/Resource/SHResourceManager.cpp
+++ b/SHADE_Engine/src/Resource/SHResourceManager.cpp
@@ -21,9 +21,11 @@ namespace SHADE
   /*-----------------------------------------------------------------------------------*/
   SHResourceHub SHResourceManager::resourceHub;
   std::unordered_map<std::type_index, std::unordered_map<AssetID, Handle<void>>> SHResourceManager::handlesMap;
-  std::unordered_map<std::type_index, SHADE::SHResourceManager::HandleAssetMap> SHResourceManager::assetIdMap;
+  std::unordered_map<std::type_index, SHResourceManager::HandleAssetMap> SHResourceManager::assetIdMap;
   std::unordered_map<std::type_index, std::function<void(AssetID)>> SHResourceManager::typedFreeFuncMap;
   std::vector<AssetID> SHResourceManager::loadedAssetData;
+  bool SHResourceManager::textureChanged = false;
+  bool SHResourceManager::meshChanged    = false;
 
   /*-----------------------------------------------------------------------------------*/
   /* Function Definitions                                                              */
@@ -63,8 +65,17 @@ namespace SHADE
     SHGraphicsSystem* gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
     if (gfxSystem == nullptr)
       throw std::runtime_error("[SHResourceManager] Attempted to load graphics resource without a SHGraphicsSystem installed.");
-    gfxSystem->BuildMeshBuffers();
-    gfxSystem->BuildTextures();
+
+    if (meshChanged)
+    {
+      gfxSystem->BuildMeshBuffers();
+      meshChanged = false;
+    }
+    if (textureChanged)
+    {
+      gfxSystem->BuildTextures();
+      textureChanged = false;
+    }
 
     // Free CPU Resources
     for (auto assetId : loadedAssetData)
diff --git a/SHADE_Engine/src/Resource/SHResourceManager.h b/SHADE_Engine/src/Resource/SHResourceManager.h
index 84f93b10..e5e303e1 100644
--- a/SHADE_Engine/src/Resource/SHResourceManager.h
+++ b/SHADE_Engine/src/Resource/SHResourceManager.h
@@ -17,9 +17,27 @@ of DigiPen Institute of Technology is prohibited.
 #include "SH_API.h"
 #include "SHResourceLibrary.h"
 #include "Assets/SHAssetMacros.h"
+#include "Assets/Asset Types/SHMeshAsset.h"
+#include "Assets/Asset Types/SHTextureAsset.h"
+#include "Assets/Asset Types/SHShaderAsset.h"
+#include "Graphics/Shaders/SHVkShaderModule.h"
+#include "Graphics/MiddleEnd/Textures/SHTextureLibrary.h"
+#include "Graphics/MiddleEnd/Interface/SHMeshLibrary.h"
+#include "Graphics/MiddleEnd/Interface/SHMaterial.h"
+#include "Assets/Asset Types/SHMaterialAsset.h"
 
 namespace SHADE
 {
+  /// <summary>
+  /// Template structs that maps a resource to their loaded asset representation type.
+  /// </summary>
+  template<typename T = void>
+  struct SHResourceLoader                              { using AssetType = void;            };
+  template<> struct SHResourceLoader<SHMesh>           { using AssetType = SHMeshAsset;     };
+  template<> struct SHResourceLoader<SHTexture>        { using AssetType = SHTextureAsset;  };
+  template<> struct SHResourceLoader<SHVkShaderModule> { using AssetType = SHShaderAsset;   };
+  template<> struct SHResourceLoader<SHMaterial>       { using AssetType = SHMaterialAsset; };
+
   /// <summary>
   /// Static class responsible for loading and caching runtime resources from their
   /// serialised Asset IDs.
@@ -61,7 +79,7 @@ namespace SHADE
     /// <param name="assetId">Handle to the resource to unload.</param>
     static void Unload(AssetID assetId);
     /// <summary>
-    /// Needs to be called to finalise all changes to loads.
+    /// Needs to be called to finalise all changes to loads, unless at runtime.
     /// </summary>
     static void FinaliseChanges();
 
@@ -111,6 +129,9 @@ namespace SHADE
     static std::unordered_map<std::type_index, std::function<void(AssetID)>> typedFreeFuncMap;
     // Pointers to temp CPU resources
     static std::vector<AssetID> loadedAssetData;
+    // Dirty Flags
+    static bool meshChanged;
+    static bool textureChanged;
 
     /*---------------------------------------------------------------------------------*/
     /* Helper Functions                                                                */
@@ -124,6 +145,14 @@ namespace SHADE
     /// <returns>Reference to the AssetHandleMap of the specified type.</returns>
     template<typename ResourceType>
     static std::pair<AssetHandleMapRef, HandleAssetMapRef> getAssetHandleMap();
+    /// <summary>
+    /// 
+    /// </summary>
+    /// <typeparam name="ResourceType"></typeparam>
+    /// <param name="assetData"></param>
+    /// <returns></returns>
+    template<typename ResourceType>
+    static Handle<ResourceType> load(AssetID assetId, const typename SHResourceLoader<ResourceType>::AssetType& assetData);
   };
 }
 
diff --git a/SHADE_Engine/src/Resource/SHResourceManager.hpp b/SHADE_Engine/src/Resource/SHResourceManager.hpp
index 072adaa2..1623d70a 100644
--- a/SHADE_Engine/src/Resource/SHResourceManager.hpp
+++ b/SHADE_Engine/src/Resource/SHResourceManager.hpp
@@ -3,7 +3,7 @@
 \author         Tng Kah Wei, kahwei.tng, 390009620
 \par            email: kahwei.tng\@digipen.edu
 \date           Oct 21, 2022
-\brief          Contains the definition of the function templates of the 
+\brief          Contains the definition of the function templates of the
                 SHResourceManager static class.
 
 Copyright (C) 2022 DigiPen Institute of Technology.
@@ -13,12 +13,17 @@ of DigiPen Institute of Technology is prohibited.
 #pragma once
 // Primary Include
 #include "SHResourceManager.h"
+// External Dependencies
+#include <yaml-cpp/yaml.h>
 // Project Includes
 #include "Assets/SHAssetManager.h"
 #include "Assets/Asset Types/SHAssetIncludes.h"
 #include "Graphics/MiddleEnd/Interface/SHGraphicsSystem.h"
 #include "ECS_Base/Managers/SHSystemManager.h"
 #include "Tools/SHLog.h"
+#include "Graphics/Shaders/SHVkShaderModule.h"
+#include "Graphics/Devices/SHVkLogicalDevice.h"
+#include "Graphics/MiddleEnd/Materials/SHMaterialSpec.h"
 
 namespace SHADE
 {
@@ -40,67 +45,19 @@ namespace SHADE
       return Handle<ResourceType>(typedHandleMap.get()[assetId]);
 
     /* Otherwise, we need to load it! */
-    // Meshes
-    if constexpr (std::is_same_v<ResourceType, SHMesh>)
+    // Load Asset Data
+    const auto* assetData = SHAssetManager::GetData<SHResourceLoader<ResourceType>::AssetType>(assetId);
+    if (assetData == nullptr)
     {
-      // Get system
-      SHGraphicsSystem* gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
-      if (gfxSystem == nullptr)
-        throw std::runtime_error("[SHResourceManager] Attempted to load graphics resource without a SHGraphicsSystem installed.");
-
-      // Load
-      const SHMeshAsset* assetData = SHAssetManager::GetData<SHMeshAsset>(assetId);
-      if (assetData == nullptr)
-      {
-        SHLog::Warning("[SHResourceManager] Attempted to load an asset with an invalid Asset ID.");
-        return {};
-      }
-      loadedAssetData.emplace_back(assetId);
-
-      Handle<SHMesh> meshHandle = gfxSystem->AddMesh
-      (
-        assetData->vertexPosition.size(), 
-        assetData->vertexPosition.data(),
-        assetData->texCoords.data(),
-        assetData->vertexTangent.data(),
-        assetData->vertexNormal.data(),
-        assetData->indices.size(),
-        assetData->indices.data()
-      );
-      Handle genericHandle = Handle(meshHandle);
-      typedHandleMap.get().emplace(assetId, genericHandle);
-      typedAssetIdMap.get().emplace(genericHandle, assetId);
-      return meshHandle;
+      SHLog::Warning("[SHResourceManager] Attempted to load an asset with an invalid Asset ID.");
+      return {};
     }
-    // Textures
-    else if constexpr (std::is_same_v<ResourceType, SHTexture>)
-    {
-      // Get system
-      SHGraphicsSystem* gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
-      if (gfxSystem == nullptr)
-        throw std::runtime_error("[SHResourceManager] Attempted to load graphics resource without a SHGraphicsSystem installed.");
 
-      // Load
-      const SHTextureAsset* assetData = SHAssetManager::GetData<SHTextureAsset>(assetId);
-      if (assetData == nullptr)
-      {
-        SHLog::Warning("[SHResourceManager] Attempted to load an asset with an invalid Asset ID.");
-        return {};
-      }
-      loadedAssetData.emplace_back(assetId);
-
-      Handle<SHTexture> texHandle = gfxSystem->AddTexture
-      (
-        assetData->numBytes,
-        assetData->pixelData,
-        assetData->width,
-        assetData->height,
-        assetData->format,
-        assetData->mipOffsets
-      );
-      typedHandleMap.get().emplace(assetId, Handle(texHandle));
-      return texHandle;
-    }
+    auto handle = load<ResourceType>(assetId, *assetData);
+    Handle genericHandle = Handle(handle);
+    typedHandleMap.get().emplace(assetId, genericHandle);
+    typedAssetIdMap.get().emplace(genericHandle, assetId);
+    return handle;
   }
 
   template<typename ResourceType>
@@ -152,7 +109,7 @@ namespace SHADE
   template<typename ResourceType>
   std::pair<SHResourceManager::AssetHandleMapRef, SHResourceManager::HandleAssetMapRef> SHResourceManager::getAssetHandleMap()
   {
-     const std::type_index TYPE = typeid(ResourceType);
+    const std::type_index TYPE = typeid(ResourceType);
 
     if (!handlesMap.contains(TYPE))
     {
@@ -160,7 +117,7 @@ namespace SHADE
       assetIdMap.emplace(TYPE, HandleAssetMap{});
       typedFreeFuncMap.emplace
       (
-        TYPE, 
+        TYPE,
         [TYPE](AssetID assetId)
         {
           static_cast<Handle<ResourceType>>(SHResourceManager::handlesMap[TYPE][assetId]).Free();
@@ -169,4 +126,131 @@ namespace SHADE
     }
     return std::make_pair(std::ref(handlesMap[TYPE]), std::ref(assetIdMap[TYPE]));
   }
+
+  template<typename ResourceType>
+  Handle<ResourceType> SHResourceManager::load(AssetID assetId, const typename SHResourceLoader<ResourceType>::AssetType& assetData)
+  {
+    // Get system
+    SHGraphicsSystem* gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
+    if (gfxSystem == nullptr)
+      throw std::runtime_error("[SHResourceManager] Attempted to load graphics resource without a SHGraphicsSystem installed.");
+
+    // Meshes
+    if constexpr (std::is_same_v<ResourceType, SHMesh>)
+    {
+      loadedAssetData.emplace_back(assetId);
+      meshChanged = true;
+
+      return gfxSystem->AddMesh
+      (
+        assetData.vertexPosition.size(),
+        assetData.vertexPosition.data(),
+        assetData.texCoords.data(),
+        assetData.vertexTangent.data(),
+        assetData.vertexNormal.data(),
+        assetData.indices.size(),
+        assetData.indices.data()
+      );
+    }
+    // Textures
+    else if constexpr (std::is_same_v<ResourceType, SHTexture>)
+    {
+      loadedAssetData.emplace_back(assetId);
+      textureChanged = true;
+
+      return gfxSystem->AddTexture
+      (
+        assetData.numBytes,
+        assetData.pixelData,
+        assetData.width,
+        assetData.height,
+        assetData.format,
+        assetData.mipOffsets
+      );
+    }
+    // Shaders
+    else if constexpr (std::is_same_v<ResourceType, SHVkShaderModule>)
+    {
+      auto shader = gfxSystem->GetDevice()->CreateShaderModule
+      (
+        assetData.spirvBinary,
+        "main",
+        static_cast<vk::ShaderStageFlagBits>(assetData.shaderType),
+        assetData.name
+      );
+      shader->Reflect();
+      return shader;
+    }
+    // Materials
+    else if constexpr (std::is_same_v<ResourceType, SHMaterial>)
+    {
+      // Get the data we need to construct
+      SHMaterialSpec matSpec = YAML::Node(assetData.data).as<SHMaterialSpec>();
+
+      // Load shaders
+      auto vertexShader = SHResourceManager::LoadOrGet<SHVkShaderModule>(matSpec.vertexShader);
+      auto fragShader   = SHResourceManager::LoadOrGet<SHVkShaderModule>(matSpec.fragShader);
+
+      // Ensure that both shaders are present
+      if (!(vertexShader && fragShader))
+      {
+        SHLOG_ERROR("[SHResourceManager] Failed to load material as shaders failed to be loaded.");
+        return {};
+      }
+
+      // Grab subpass from worldRenderer
+      auto renderPass = gfxSystem->GetPrimaryRenderpass();
+      if (!renderPass)
+      {
+        SHLOG_ERROR("[SHResourceManager] Failed to load material as RenderPass could not be found.");
+        return {};
+      }
+      auto subPass = renderPass->GetSubpass(matSpec.subpassName);
+      if (!subPass)
+      {
+        SHLOG_ERROR("[SHResourceManager] Failed to load material as SubPass could not be found.");
+        return {};
+      }
+      
+      // Create material
+      auto matHandle = gfxSystem->AddMaterial(vertexShader, fragShader, subPass);
+
+      // Set properties for the material
+      Handle<SHShaderBlockInterface> pipelineProperties = matHandle->GetShaderBlockInterface();
+      for (int i = 0; i < static_cast<int>(pipelineProperties->GetVariableCount()); ++i)
+      {
+        const std::string& PROP_NAME = pipelineProperties->GetVariableName(i);
+        const auto& PROP_NODE = matSpec.properties;
+        if (PROP_NODE)
+        {
+          const std::string& VAR_NAME = pipelineProperties->GetVariableName(i);
+          const SHShaderBlockInterface::Variable* VARIABLE = pipelineProperties->GetVariable(i);
+          switch (VARIABLE->type)
+          {
+            case SHADE::SHShaderBlockInterface::Variable::Type::FLOAT:
+              matHandle->SetProperty(VARIABLE->offset, PROP_NODE.as<float>());
+              break;
+            case SHADE::SHShaderBlockInterface::Variable::Type::INT:
+              matHandle->SetProperty(VARIABLE->offset, PROP_NODE.as<int>());
+              break;
+            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR2:
+              matHandle->SetProperty(VARIABLE->offset, PROP_NODE.as<SHVec2>());
+              break;
+            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR3:
+              matHandle->SetProperty(VARIABLE->offset, PROP_NODE.as<SHVec3>());
+              break;
+            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR4:
+              matHandle->SetProperty(VARIABLE->offset, PROP_NODE.as<SHVec4>());
+              break;
+            case SHADE::SHShaderBlockInterface::Variable::Type::OTHER:
+            default:
+              continue;
+              break;
+          }
+        }
+      }
+
+      return matHandle;
+    }
+  }
 }
diff --git a/SHADE_Engine/src/Scripting/SHScriptEngine.cpp b/SHADE_Engine/src/Scripting/SHScriptEngine.cpp
index 21ce7b82..4a73342e 100644
--- a/SHADE_Engine/src/Scripting/SHScriptEngine.cpp
+++ b/SHADE_Engine/src/Scripting/SHScriptEngine.cpp
@@ -80,7 +80,10 @@ namespace SHADE
   {
     csScriptsExecuteFixedUpdate();
   }
-
+  void SHScriptEngine::ExecuteCollisionFunctions()
+  {
+    csScriptsExecutePhysicsEvents();
+  }
   void SHScriptEngine::Exit()
   {
     // Do not allow deinitialization if not initialised
@@ -377,6 +380,12 @@ namespace SHADE
       DEFAULT_CSHARP_NAMESPACE + ".ScriptStore",
       "ExecuteLateUpdate"
     );
+    csScriptsExecutePhysicsEvents = dotNet.GetFunctionPtr<CsFuncPtr>
+    (
+      DEFAULT_CSHARP_LIB_NAME,
+      DEFAULT_CSHARP_NAMESPACE + ".ScriptStore",
+      "ExecuteCollisionFunctions"
+    );
     csScriptsFrameCleanUp = dotNet.GetFunctionPtr<CsFuncPtr>
     (
       DEFAULT_CSHARP_LIB_NAME,
diff --git a/SHADE_Engine/src/Scripting/SHScriptEngine.h b/SHADE_Engine/src/Scripting/SHScriptEngine.h
index c38e3618..9ddd617a 100644
--- a/SHADE_Engine/src/Scripting/SHScriptEngine.h
+++ b/SHADE_Engine/src/Scripting/SHScriptEngine.h
@@ -98,6 +98,11 @@ namespace SHADE
     /// </summary>
     void ExecuteFixedUpdates();
     /// <summary>
+    /// Executes the OnCollision*()s and OnTrigger*()s of the Scripts that are attached 
+    /// to Entities.
+    /// </summary>
+    void ExecuteCollisionFunctions();
+    /// <summary>
     /// Shuts down the DotNetRuntime.
     /// </summary>
     void Exit() override;
@@ -245,6 +250,7 @@ namespace SHADE
     CsFuncPtr                      csScriptsExecuteFixedUpdate   = nullptr;
     CsFuncPtr                      csScriptsExecuteUpdate        = nullptr;
     CsFuncPtr                      csScriptsExecuteLateUpdate    = nullptr;
+    CsFuncPtr                      csScriptsExecutePhysicsEvents = nullptr;
     CsFuncPtr                      csScriptsFrameCleanUp         = nullptr;
     CsScriptManipFuncPtr           csScriptsAdd                  = nullptr;
     CsScriptBasicFuncPtr           csScriptsRemoveAll            = nullptr;
diff --git a/SHADE_Engine/src/Scripting/SHScriptEngineRoutines.cpp b/SHADE_Engine/src/Scripting/SHScriptEngineRoutines.cpp
index 5467fc56..a2981c06 100644
--- a/SHADE_Engine/src/Scripting/SHScriptEngineRoutines.cpp
+++ b/SHADE_Engine/src/Scripting/SHScriptEngineRoutines.cpp
@@ -54,7 +54,7 @@ namespace SHADE
   /* System Routine Functions - FrameCleanUpRoutine                                    */
   /*-----------------------------------------------------------------------------------*/
   SHScriptEngine::FrameCleanUpRoutine::FrameCleanUpRoutine()
-      : SHSystemRoutine("Script Engine Frame Clean Up", false)
+      : SHSystemRoutine("Script Engine Frame Clean Up", true)
   {}
   void SHScriptEngine::FrameCleanUpRoutine::Execute(double) noexcept
   {
diff --git a/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.cpp b/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.cpp
new file mode 100644
index 00000000..8ab098b8
--- /dev/null
+++ b/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.cpp
@@ -0,0 +1,56 @@
+#include "SHpch.h"
+#include "SHPrefabManager.h"
+
+namespace SHADE
+{
+  SHPrefabManager::PrefabMap SHPrefabManager::prefabMap{};
+
+  void SHPrefabManager::AddPrefab(AssetID const& prefabAssetID) noexcept
+  {
+    prefabMap.insert({ prefabAssetID, {} });
+  }
+
+  void SHPrefabManager::RemovePrefab(AssetID const& prefabAssetID) noexcept
+  {
+    prefabMap.erase(prefabAssetID);
+  }
+
+  void SHPrefabManager::ClearPrefab(AssetID const& prefabAssetID) noexcept
+  {
+    if (prefabMap.contains(prefabAssetID))
+    {
+      prefabMap[prefabAssetID].clear();
+    }
+  }
+
+  void SHPrefabManager::UpdateAllPrefabEntities(AssetID const& prefabAssetID) noexcept
+  {
+    //Loop through all entities and deserialize new data
+  }
+
+  void SHPrefabManager::AddEntity(AssetID const& prefabAssetID, EntityID const& eid) noexcept
+  {
+    if (prefabMap.contains(prefabAssetID))
+    {
+      prefabMap[prefabAssetID].insert(eid);
+    }
+  }
+
+  void SHPrefabManager::RemoveEntity(AssetID const& prefabAssetID, EntityID const& eid) noexcept
+  {
+    if (prefabMap.contains(prefabAssetID))
+    {
+      prefabMap[prefabAssetID].erase(eid);
+    }
+  }
+
+  void SHPrefabManager::Clear() noexcept
+  {
+    prefabMap.clear();
+  }
+
+  bool SHPrefabManager::Empty() noexcept
+  {
+    return prefabMap.empty();
+  }
+}
diff --git a/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.h b/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.h
new file mode 100644
index 00000000..37c317ed
--- /dev/null
+++ b/SHADE_Engine/src/Serialization/Prefab/SHPrefabManager.h
@@ -0,0 +1,28 @@
+#pragma once
+
+#include "Assets/SHAssetMacros.h"
+#include "ECS_Base/SHECSMacros.h"
+#include <unordered_set>
+#include <unordered_map>
+
+
+namespace SHADE
+{
+  class SHPrefabManager
+  {
+  public:
+    using PrefabMap = std::unordered_map<AssetID, std::unordered_set<EntityID>>;
+
+    static void AddPrefab(AssetID const& prefabAssetID) noexcept;
+    static void RemovePrefab(AssetID const& prefabAssetID) noexcept;
+    static void ClearPrefab(AssetID const& prefabAssetID) noexcept;
+    static void UpdateAllPrefabEntities(AssetID const& prefabAssetID) noexcept;
+    static void AddEntity(AssetID const& prefabAssetID, EntityID const& eid) noexcept;
+    static void RemoveEntity(AssetID const& prefabAssetID, EntityID const& eid) noexcept;
+    static void Clear() noexcept;
+    static bool Empty() noexcept;
+
+  private:
+    static PrefabMap prefabMap;
+  };
+}
diff --git a/SHADE_Engine/src/Serialization/SHSerialization.cpp b/SHADE_Engine/src/Serialization/SHSerialization.cpp
index f8913d8d..03498951 100644
--- a/SHADE_Engine/src/Serialization/SHSerialization.cpp
+++ b/SHADE_Engine/src/Serialization/SHSerialization.cpp
@@ -10,6 +10,7 @@
 #include "Assets/SHAssetManager.h"
 #include <fstream>
 
+#include "Camera/SHCameraComponent.h"
 #include "Graphics/MiddleEnd/Interface/SHRenderable.h"
 #include "Math/Transform/SHTransformComponent.h"
 #include "Physics/Components/SHRigidBodyComponent.h"
@@ -58,7 +59,7 @@ namespace SHADE
   static EntityID DeserializeEntity(YAML::iterator& it, YAML::Node const& node, std::vector<EntityID>& createdEntities, EntityID parentEID = MAX_EID)
   {
     EntityID eid = MAX_EID;
-    if(!node)
+    if (!node)
       return eid;
     if (node[EIDNode])
       eid = node[EIDNode].as<EntityID>();
@@ -71,13 +72,13 @@ namespace SHADE
     createdEntities.push_back(eid);
     if (node[NumberOfChildrenNode])
     {
-      if(const int numOfChildren = node[NumberOfChildrenNode].as<int>(); numOfChildren > 0)
+      if (const int numOfChildren = node[NumberOfChildrenNode].as<int>(); numOfChildren > 0)
       {
         ++it;
         for (int i = 0; i < numOfChildren; ++i)
         {
           DeserializeEntity(it, (*it), createdEntities, eid);
-          if((i + 1) < numOfChildren)
+          if ((i + 1) < numOfChildren)
             ++it;
         }
       }
@@ -85,7 +86,9 @@ namespace SHADE
 
     // Deserialise scripts
     if (node[ScriptsNode])
-        SHSystemManager::GetSystem<SHScriptEngine>()->DeserialiseScripts(eid, node[ScriptsNode]);
+      SHSystemManager::GetSystem<SHScriptEngine>()->DeserialiseScripts(eid, node[ScriptsNode]);
+
+    return eid;
   }
 
   void SHSerialization::DeserializeSceneFromFile(std::filesystem::path const& path)
@@ -120,10 +123,10 @@ namespace SHADE
     {
       DeserializeEntity(it, (*it), createdEntities);
     }
-    if(createdEntities.empty())
+    if (createdEntities.empty())
     {
       SHLOG_ERROR("Failed to create entities from deserializaiton")
-      return;
+        return;
     }
     //Initialize Entity
     auto entityVecIt = createdEntities.begin();
@@ -137,7 +140,7 @@ namespace SHADE
   {
     out << SerializeEntityToNode(entityNode);
     auto const& children = entityNode->GetChildren();
-    for(auto const& child : children)
+    for (auto const& child : children)
     {
       EmitEntity(child, out);
     }
@@ -162,17 +165,36 @@ namespace SHADE
   {
   }
 
+  template<typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
+  static void AddComponentToComponentNode(YAML::Node& componentsNode, EntityID const& eid)
+  {
+    if (const ComponentType* component = SHComponentManager::GetComponent_s<ComponentType>(eid))
+    {
+      componentsNode[rttr::type::get<ComponentType>().get_name().data()] = SHSerializationHelper::SerializeComponentToNode(component);
+    }
+  }
+
+  template<typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
+  static void AddConvComponentToComponentNode(YAML::Node& componentsNode, EntityID const& eid)
+  {
+    if (ComponentType* component = SHComponentManager::GetComponent_s<ComponentType>(eid))
+    {
+      componentsNode[rttr::type::get<ComponentType>().get_name().data()] = YAML::convert<ComponentType>::encode(*component);
+    }
+  }
+
+
   YAML::Node SHSerialization::SerializeEntityToNode(SHSceneNode* sceneNode)
   {
     YAML::Node node;
     auto eid = sceneNode->GetEntityID();
     auto entity = SHEntityManager::GetEntityByID(eid);
-    if (!sceneNode || !entity)
+    if (!sceneNode && !entity)
     {
       node = YAML::Null;
       return node;
     }
-    node.SetStyle(YAML::EmitterStyle::Block);                                       
+    node.SetStyle(YAML::EmitterStyle::Block);
     node[EIDNode] = eid;
     node[EntityNameNode] = entity->name;
     node[IsActiveNode] = sceneNode->IsActive();
@@ -181,22 +203,13 @@ namespace SHADE
 
     YAML::Node components;
 
-    if (const auto transform = SHComponentManager::GetComponent_s<SHTransformComponent>(eid))
-    {
-      components[rttr::type::get<SHTransformComponent>().get_name().data()] = SHSerializationHelper::SerializeComponentToNode(transform);
-    }
-    if (const auto renderable = SHComponentManager::GetComponent_s<SHRenderable>(eid))
-    {
-      components[rttr::type::get<SHRenderable>().get_name().data()] = *renderable;
-    }
-    if (const auto rigidbody = SHComponentManager::GetComponent_s<SHRigidBodyComponent>(eid))
-    {
-      components[rttr::type::get<SHRigidBodyComponent>().get_name().data()] = SHSerializationHelper::SerializeComponentToNode(rigidbody);
-    }
-    if(const auto light = SHComponentManager::GetComponent_s<SHLightComponent>(eid))
-    {
-      components[rttr::type::get<SHLightComponent>().get_name().data()] = SHSerializationHelper::SerializeComponentToNode(light);
-    }
+    AddComponentToComponentNode<SHTransformComponent>(components, eid);
+    AddComponentToComponentNode<SHCameraComponent>(components, eid);
+    AddConvComponentToComponentNode<SHRenderable>(components, eid);
+    AddComponentToComponentNode<SHLightComponent>(components, eid);
+    AddComponentToComponentNode<SHRigidBodyComponent>(components, eid);
+    AddConvComponentToComponentNode<SHColliderComponent>(components, eid);
+
     node[ComponentsNode] = components;
 
     YAML::Node scripts;
@@ -208,22 +221,22 @@ namespace SHADE
 
   EntityID SHSerialization::DeserializeEntitiesFromString(std::string const& data, EntityID const& parentEID) noexcept
   {
-    if(data.empty())
+    if (data.empty())
       return MAX_EID;
     YAML::Node entities = YAML::Load(data.c_str());
-    EntityID eid{MAX_EID};
+    EntityID eid{ MAX_EID };
     std::vector<EntityID> createdEntities;
-    for(auto it = entities.begin(); it != entities.end(); ++it)
+    for (auto it = entities.begin(); it != entities.end(); ++it)
     {
       eid = DeserializeEntity(it, *it, createdEntities, parentEID);
     }
-    if(createdEntities.empty())
+    if (createdEntities.empty())
     {
       SHLOG_ERROR("Failed to create entities from deserializaiton")
-      return MAX_EID;
+        return MAX_EID;
     }
     auto entityVecIt = createdEntities.begin();
-    for(auto it = entities.begin(); it != entities.end(); ++it)
+    for (auto it = entities.begin(); it != entities.end(); ++it)
     {
       InitializeEntity(*it, *entityVecIt++);
     }
@@ -231,33 +244,22 @@ namespace SHADE
   }
 
   template<typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
-  std::optional<ComponentTypeID> GetComponentID(YAML::Node const& componentNode)
+  static void AddComponentID(std::vector<ComponentTypeID>& idList, YAML::Node const& componentNode)
   {
     if (componentNode[rttr::type::get<ComponentType>().get_name().data()])
-      return { SHFamilyID<SHComponent>::GetID<ComponentType>() };
-    else
-      return std::nullopt;
+      idList.push_back(SHFamilyID<SHComponent>::GetID<ComponentType>());
   }
 
   std::vector<ComponentTypeID> SHSerialization::GetComponentIDList(YAML::Node const& componentsNode)
   {
     std::vector<ComponentTypeID> componentIDList;
-
-    auto id = GetComponentID<SHTransformComponent>(componentsNode);
-    if (id.has_value())
-      componentIDList.push_back(id.value());
-
-    id = GetComponentID<SHRenderable>(componentsNode);
-    if (id.has_value())
-      componentIDList.push_back(id.value());
-
-    id = GetComponentID<SHRigidBodyComponent>(componentsNode);
-    if (id.has_value())
-      componentIDList.push_back(id.value());
-
-    id = GetComponentID<SHLightComponent>(componentsNode);
-    if(id.has_value())
-      componentIDList.push_back(id.value());
+    
+    AddComponentID<SHTransformComponent>(componentIDList, componentsNode);
+    AddComponentID<SHCameraComponent>(componentIDList, componentsNode);
+    AddComponentID<SHRenderable>(componentIDList, componentsNode);
+    AddComponentID<SHRigidBodyComponent>(componentIDList, componentsNode);
+    AddComponentID<SHLightComponent>(componentIDList, componentsNode);
+    AddComponentID<SHColliderComponent>(componentIDList, componentsNode);
 
     return componentIDList;
   }
@@ -268,7 +270,10 @@ namespace SHADE
     if (!componentsNode)
       return;
     SHSerializationHelper::InitializeComponentFromNode<SHTransformComponent>(componentsNode, eid);
+    SHSerializationHelper::InitializeComponentFromNode<SHCameraComponent>(componentsNode, eid);
+    SHSerializationHelper::InitializeComponentFromNode<SHRigidBodyComponent>(componentsNode, eid);
     SHSerializationHelper::ConvertNodeToComponent<SHRenderable>(componentsNode, eid);
+    SHSerializationHelper::ConvertNodeToComponent<SHColliderComponent>(componentsNode, eid);
     SHSerializationHelper::InitializeComponentFromNode<SHLightComponent>(componentsNode, eid);
   }
 }
diff --git a/SHADE_Engine/src/Serialization/SHSerializationHelper.hpp b/SHADE_Engine/src/Serialization/SHSerializationHelper.hpp
index 047232a0..2179d1cf 100644
--- a/SHADE_Engine/src/Serialization/SHSerializationHelper.hpp
+++ b/SHADE_Engine/src/Serialization/SHSerializationHelper.hpp
@@ -12,11 +12,240 @@
 #include "Resource/SHResourceManager.h"
 #include "Graphics/MiddleEnd/Interface/SHRenderable.h"
 #include "Graphics/MiddleEnd/Interface/SHMaterial.h"
+#include "Graphics/MiddleEnd/Interface/SHMaterialInstance.h"
 #include "SHSerializationTools.h"
+#include "Physics/Components/SHColliderComponent.h"
+#include "Graphics/MiddleEnd/Materials/SHMaterialSpec.h"
+#include "Tools/SHLog.h"
 
 namespace YAML
 {
     using namespace SHADE;
+
+    template<>
+  struct convert<SHVec4>
+  {
+    static constexpr const char* x = "x";
+    static constexpr const char* y = "y";
+    static constexpr const char* z = "z";
+    static constexpr const char* w = "w";
+
+    static Node encode(SHVec4 const& rhs)
+    {
+      Node node;
+      node.SetStyle(EmitterStyle::Flow);
+      node[x] = rhs.x;
+      node[y] = rhs.y;
+      node[z] = rhs.z;
+      node[w] = rhs.w;
+      return node;
+    }
+    static bool decode(Node const& node, SHVec4& rhs)
+    {
+      if (node[x].IsDefined())
+        rhs.x = node[x].as<float>();
+      if (node[y].IsDefined())
+        rhs.y = node[y].as<float>();
+      if (node[z].IsDefined())
+        rhs.z = node[z].as<float>();
+      if (node[w].IsDefined())
+        rhs.w = node[w].as<float>();
+      return true;
+    }
+  };
+
+  template<>
+  struct convert<SHVec3>
+  {
+    static constexpr const char* x = "x";
+    static constexpr const char* y = "y";
+    static constexpr const char* z = "z";
+
+    static Node encode(SHVec3 const& rhs)
+    {
+      Node node;
+      node.SetStyle(EmitterStyle::Flow);
+      node[x] = rhs.x;
+      node[y] = rhs.y;
+      node[z] = rhs.z;
+      return node;
+    }
+    static bool decode(Node const& node, SHVec3& rhs)
+    {
+      if (node[x].IsDefined())
+        rhs.x = node[x].as<float>();
+      if (node[y].IsDefined())
+        rhs.y = node[y].as<float>();
+      if (node[z].IsDefined())
+        rhs.z = node[z].as<float>();
+      return true;
+    }
+  };
+
+  template<>
+  struct convert<SHVec2>
+  {
+    static constexpr const char* x = "x";
+    static constexpr const char* y = "y";
+
+    static Node encode(SHVec2 const& rhs)
+    {
+      Node node;
+      node.SetStyle(EmitterStyle::Flow);
+      node[x] = rhs.x;
+      node[y] = rhs.y;
+      return node;
+    }
+    static bool decode(Node const& node, SHVec2& rhs)
+    {
+      if (node[x].IsDefined())
+        rhs.x = node[x].as<float>();
+      if (node[y].IsDefined())
+        rhs.y = node[y].as<float>();
+      return true;
+    }
+  };
+
+  template<>
+  struct convert<SHCollider>
+  {
+    static constexpr const char* IsTrigger = "Is Trigger";
+
+    static constexpr const char* Type = "Type";
+    static constexpr const char* HalfExtents = "Half Extents";
+    static constexpr const char* Radius = "Radius";
+
+    static constexpr const char* Friction = "Friction";
+    static constexpr const char* Bounciness = "Bounciness";
+    static constexpr const char* Density = "Density";
+    static constexpr const char* PositionOffset = "Position Offset";
+
+    static Node encode(SHCollider& rhs)
+    {
+      Node node;
+
+      node[IsTrigger] = rhs.IsTrigger();
+
+      rttr::type const shapeRttrType = rttr::type::get<SHCollider::Type>();
+      rttr::enumeration const enumAlign = shapeRttrType.get_enumeration();
+      SHCollider::Type colliderType = rhs.GetType();
+
+      node[Type] = enumAlign.value_to_name(colliderType).data();
+
+      switch (colliderType)
+      {
+      case SHCollider::Type::BOX:
+      {
+        auto const bb = reinterpret_cast<SHBoundingBox*>(rhs.GetShape());
+        node[HalfExtents] = bb->GetHalfExtents();
+      }
+      break;
+      case SHCollider::Type::SPHERE:
+      {
+        auto const bs = reinterpret_cast<SHBoundingSphere*>(rhs.GetShape());
+        node[Radius] = bs->GetRadius();
+      }
+      break;
+      case SHCollider::Type::CAPSULE: break;
+      default:;
+      }
+
+      node[Friction] = rhs.GetFriction();
+      node[Bounciness] = rhs.GetBounciness();
+      node[Density] = rhs.GetDensity();
+      node[PositionOffset] = rhs.GetPositionOffset();
+
+      return node;
+    }
+    static bool decode(Node const& node, SHCollider& rhs)
+    {
+      if (node[IsTrigger].IsDefined())
+        rhs.SetIsTrigger(node[IsTrigger].as<bool>());
+      if (!node[Type].IsDefined())
+        return false;
+      rttr::type const shapeRttrType = rttr::type::get<SHCollider::Type>();
+      rttr::enumeration const enumAlign = shapeRttrType.get_enumeration();
+      bool ok;
+      const SHCollider::Type colliderType = enumAlign.name_to_value(node[Type].as<std::string>()).convert<SHCollider::Type>(&ok);
+      if (!ok)
+        return false;
+      switch (colliderType)
+      {
+      case SHCollider::Type::BOX:
+        {
+          if(node[HalfExtents].IsDefined())
+            rhs.SetBoundingBox(node[HalfExtents].as<SHVec3>());
+        }
+        break;
+      case SHCollider::Type::SPHERE:
+        {
+          if(node[Radius].IsDefined())
+            rhs.SetBoundingSphere(node[Radius].as<float>());
+        }
+        break;
+      case SHCollider::Type::CAPSULE: break;
+      default:;
+      }
+      if (node[Friction].IsDefined())
+        rhs.SetFriction(node[Friction].as<float>());
+      if (node[Bounciness].IsDefined())
+        rhs.SetBounciness(rhs.GetBounciness());
+      if (node[Density].IsDefined())
+        rhs.SetDensity(node[Density].as<float>());
+      if (node[PositionOffset].IsDefined())
+        rhs.SetPositionOffset(node[PositionOffset].as<SHVec3>());
+      
+      return true;
+    }
+  };
+
+  template<>
+  struct convert<SHColliderComponent>
+  {
+    static constexpr const char* Colliders = "Colliders";
+    static Node encode(SHColliderComponent& rhs)
+    {
+      Node node, collidersNode;
+      auto const& colliders = rhs.GetColliders();
+      int const numColliders = static_cast<int>(colliders.size());
+      for (int i = 0; i < numColliders; ++i)
+      {
+        auto& collider = rhs.GetCollider(i);
+        Node colliderNode = convert<SHCollider>::encode(collider);
+        if (colliderNode.IsDefined())
+          collidersNode[i] = colliderNode;
+      }
+      node[Colliders] = collidersNode;
+      return node;
+    }
+    static bool decode(Node const& node, SHColliderComponent& rhs)
+    {
+      if (node[Colliders].IsDefined())
+      {
+        int numColliders{};
+        for (auto const& colliderNode : node[Colliders])
+        {
+          rttr::type const shapeRttrType = rttr::type::get<SHCollider::Type>();
+          rttr::enumeration const enumAlign = shapeRttrType.get_enumeration();
+          bool ok = false;
+          const SHCollider::Type colliderType = enumAlign.name_to_value(colliderNode[convert<SHCollider>::Type].as<std::string>()).convert<SHCollider::Type>(&ok);
+          if (!ok)
+            return false;
+          
+          switch (colliderType)
+          {
+          case SHCollider::Type::BOX: rhs.AddBoundingBox(); break;
+          case SHCollider::Type::SPHERE: rhs.AddBoundingSphere(); break;
+          case SHCollider::Type::CAPSULE: break;
+          default:;
+          }
+          YAML::convert<SHCollider>::decode(colliderNode, rhs.GetCollider(numColliders++));
+        }
+      }
+      return true;
+    }
+  };
+
     template<>
     struct convert<SHMaterial>
     {
@@ -46,13 +275,13 @@ namespace YAML
                         propNode = rhs.GetProperty<int>(VARIABLE->offset);
                         break;
                     case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR2:
-                        propNode = SHSerializationTools::ValToYAML(rhs.GetProperty<SHVec2>(VARIABLE->offset));
+                        propNode = rhs.GetProperty<SHVec2>(VARIABLE->offset);
                         break;
                     case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR3:
-                        propNode = SHSerializationTools::ValToYAML(rhs.GetProperty<SHVec3>(VARIABLE->offset));
+                        propNode = rhs.GetProperty<SHVec3>(VARIABLE->offset);
                         break;
                     case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR4:
-                        propNode = SHSerializationTools::ValToYAML(rhs.GetProperty<SHVec4>(VARIABLE->offset));
+                        propNode = rhs.GetProperty<SHVec4>(VARIABLE->offset);
                         break;
                     case SHADE::SHShaderBlockInterface::Variable::Type::OTHER:
                     default:
@@ -77,104 +306,45 @@ namespace YAML
             // Write Material
             YAML::Node node;
             
-            node[VERT_SHADER_YAML_TAG.data()] = 0; // SHResourceManager::GetAssetID<SHVkShaderModule>(vertexShader).value_or(0);
-            node[FRAG_SHADER_YAML_TAG.data()] = 0; // SHResourceManager::GetAssetID<SHVkShaderModule>(fragShader).value_or(0);
-            node[SUBPASS_YAML_TAG.data()]     = rhs.GetPipeline()->GetPipelineState().GetSubpass()->GetName();
+            node[VERT_SHADER_YAML_TAG.data()] = SHResourceManager::GetAssetID<SHVkShaderModule>(vertexShader).value_or(0);
+            node[FRAG_SHADER_YAML_TAG.data()] = SHResourceManager::GetAssetID<SHVkShaderModule>(fragShader).value_or(0);
+            node[SUBPASS_YAML_TAG.data()]     = rhs.GetPipeline()->GetPipelineState().GetSubpass()->GetName(); 
             node[PROPS_YAML_TAG.data()]       = propertiesNode;
 
             return node;
         }
-        static bool decode(YAML::Node const& node, SHMaterial& rhs)
-        {
-            /*
-            // Retrieve Shader Asset IDs
-            AssetID vertShaderId = 0;
-            AssetID fragShaderId = 0;
-            if (node[VERT_SHADER_YAML_TAG.data()])
-                vertShaderId = node[VERT_SHADER_YAML_TAG.data()].as<AssetID>();
-            if (node[FRAG_SHADER_YAML_TAG.data()])
-                fragShaderId = node[FRAG_SHADER_YAML_TAG.data()].as<AssetID>();
+    };
 
-            // Ensure that both shaders are present
-            if (vertShaderId == 0 || fragShaderId == 0)
-                return false; // No pipeline
+    template<>
+    struct convert<SHMaterialSpec>
+    {
+      static constexpr std::string_view VERT_SHADER_YAML_TAG = "VertexShader";
+      static constexpr std::string_view FRAG_SHADER_YAML_TAG = "FragmentShader";
+      static constexpr std::string_view SUBPASS_YAML_TAG = "SubPass";
+      static constexpr std::string_view PROPS_YAML_TAG = "Properties";
 
-            // Get Shader Modules
-            Handle<SHVkShaderModule> vertexShader, fragShader;
-            vertexShader = SHResourceManager::LoadOrGet<SHVkShaderModule>(vertShaderId);
-            fragShader = SHResourceManager::LoadOrGet<SHVkShaderModule>(fragShaderId);
+      static bool decode(YAML::Node const& node, SHMaterialSpec& rhs)
+      {
+        // Retrieve Shader Asset IDs
+        if (!node[VERT_SHADER_YAML_TAG.data()])
+          return false;
+        rhs.vertexShader = node[VERT_SHADER_YAML_TAG.data()].as<AssetID>();
+        if (!node[FRAG_SHADER_YAML_TAG.data()])
+          return false;
+        rhs.fragShader = node[FRAG_SHADER_YAML_TAG.data()].as<AssetID>();
 
-            // Get Pipeline Library
-            if (node[SUBPASS_YAML_TAG.data()])
-            {
-                auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
-                if (!gfxSystem)
-                    return false;
+        // Retrieve Subpass
+        if (!node[SUBPASS_YAML_TAG.data()])
+          return false;
+        rhs.subpassName = node[SUBPASS_YAML_TAG.data()].as<std::string>();
 
-                // Grab subpass from worldRenderer
-                auto renderPass = gfxSystem->GetPrimaryRenderpass();
-                if (!renderPass)
-                    return false;
-                auto subPass = renderPass->GetSubpass(node[SUBPASS_YAML_TAG.data()].as<std::string>());
-                if (!subPass)
-                    return false;
+        // Retrieve
+        if (!node[PROPS_YAML_TAG.data()])
+          return false;
+        rhs.properties = node[PROPS_YAML_TAG.data()];
 
-                // Set Pipeline
-                rhs.SetPipeline(renderPass->GetOrCreatePipeline
-                (
-                    std::make_pair(vertexShader, fragShader),
-                    subPass
-                ));
-            }
-            */
-
-            // TODO: Load Proper Material!
-            // Set default material 
-            auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
-            if (!gfxSystem)
-              return false;
-            rhs.SetPipeline(gfxSystem->GetDefaultMaterial()->GetPipeline());
-
-            if (node[PROPS_YAML_TAG.data()])
-            {
-                // Loop through all properties
-                Handle<SHShaderBlockInterface> pipelineProperties = rhs.GetShaderBlockInterface();
-                const YAML::Node& PROPS_NODE = node[PROPS_YAML_TAG.data()];
-                for (int i = 0; i < static_cast<int>(pipelineProperties->GetVariableCount()); ++i)
-                {
-                    const std::string& PROP_NAME = pipelineProperties->GetVariableName(i);
-                    const auto& PROP_NODE = PROPS_NODE[PROP_NAME.data()];
-                    if (PROP_NODE)
-                    {
-                        const std::string& VAR_NAME = pipelineProperties->GetVariableName(i);
-                        const SHShaderBlockInterface::Variable* VARIABLE = pipelineProperties->GetVariable(i);
-                        switch (VARIABLE->type)
-                        {
-                            case SHADE::SHShaderBlockInterface::Variable::Type::FLOAT:
-                                rhs.SetProperty(VARIABLE->offset, PROP_NODE.as<float>());
-                                break;
-                            case SHADE::SHShaderBlockInterface::Variable::Type::INT:
-                                rhs.SetProperty(VARIABLE->offset, PROP_NODE.as<int>());
-                                break;
-                            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR2:
-                                rhs.SetProperty(VARIABLE->offset, SHSerializationTools::YAMLToVec2(PROP_NODE));
-                                break;
-                            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR3:
-                                rhs.SetProperty(VARIABLE->offset, SHSerializationTools::YAMLToVec3(PROP_NODE));
-                                break;
-                            case SHADE::SHShaderBlockInterface::Variable::Type::VECTOR4:
-                                rhs.SetProperty(VARIABLE->offset, SHSerializationTools::YAMLToVec4(PROP_NODE));
-                                break;
-                            case SHADE::SHShaderBlockInterface::Variable::Type::OTHER:
-                            default:
-                                continue;
-                                break;
-                        }
-                    }
-                }
-            }
-            return true;
-        }
+        return true;
+      }
     };
 
     template<>
@@ -187,69 +357,62 @@ namespace YAML
         {
             YAML::Node node;
             node[MESH_YAML_TAG.data()] = SHResourceManager::GetAssetID<SHMesh>(rhs.GetMesh()).value_or(0);
-            node[MAT_YAML_TAG.data()] = 0;  // TODO: Asset ID            
+            node[MAT_YAML_TAG.data()] = SHResourceManager::GetAssetID<SHMaterial>(rhs.GetMaterial()->GetBaseMaterial()).value_or(0);
             return node;
         }
         static bool decode(YAML::Node const& node, SHRenderable& rhs)
         {
-            if (node[MESH_YAML_TAG.data()])
+            if (node[MESH_YAML_TAG.data()].IsDefined())
             {
                 rhs.SetMesh(SHResourceManager::LoadOrGet<SHMesh>(node[MESH_YAML_TAG.data()].as<AssetID>()));
             }
-            if (node[MAT_YAML_TAG.data()])
+            if (node[MAT_YAML_TAG.data()].IsDefined())
             {
-                // TODO: Convert Asset ID To Material HAndle
                 // Temporarily, use default material
                 auto gfxSystem = SHSystemManager::GetSystem<SHGraphicsSystem>();
                 if (!gfxSystem)
                   return false;
-                rhs.SetMaterial(gfxSystem->AddOrGetBaseMaterialInstance(gfxSystem->GetDefaultMaterial()));
+                Handle<SHMaterial> baseMat = SHResourceManager::LoadOrGet<SHMaterial>(node[MAT_YAML_TAG.data()].as<AssetID>());
+                if (!baseMat)
+                {
+                  baseMat = gfxSystem->GetDefaultMaterial();
+                  SHLog::Warning("[SHSerializationHelper] Unable to load specified material. Falling back to default material.");
+                }
+                rhs.SetMaterial(gfxSystem->AddOrGetBaseMaterialInstance(baseMat));
             }
             return true;
         }
     };
 }
 
-
 namespace SHADE
 {
   struct SHSerializationHelper
   {
-    template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
-    static std::string SerializeComponentToString(ComponentType* component)
-    {
-      return std::string();
-    }
 
-    template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
-    static void SerializeComponentToFile(ComponentType* component, std::filesystem::path const& path)
-    {
-    }
 
     static YAML::Node RTTRToNode(const rttr::variant& var)
     {
       YAML::Node node;
       auto varType = var.get_type();
+      if (varType.is_sequential_container())
+      {
+        for (auto const& elem : var.create_sequential_view())
+        {
+          node.push_back(RTTRToNode(elem));
+        }
+      }
       if (varType == rttr::type::get<SHVec4>())
       {
-        node.SetStyle(YAML::EmitterStyle::Flow);
-        node["X"] = var.convert<SHVec4>().x;
-        node["Y"] = var.convert<SHVec4>().y;
-        node["Z"] = var.convert<SHVec4>().z;
-        node["W"] = var.convert<SHVec4>().w;
+        node = YAML::convert<SHVec4>::encode(var.convert<SHVec4>());
       }
       else if (varType == rttr::type::get<SHVec3>())
       {
-        node.SetStyle(YAML::EmitterStyle::Flow);
-        node["X"] = var.convert<SHVec3>().x;
-        node["Y"] = var.convert<SHVec3>().y;
-        node["Z"] = var.convert<SHVec3>().z;
+        node = YAML::convert<SHVec3>::encode(var.convert<SHVec3>());
       }
       else if (varType == rttr::type::get<SHVec2>())
       {
-        node.SetStyle(YAML::EmitterStyle::Flow);
-        node["X"] = var.convert<SHVec3>().x;
-        node["Y"] = var.convert<SHVec3>().y;
+        node = YAML::convert<SHVec2>::encode(var.convert<SHVec2>());
       }
       else if (varType.is_arithmetic())
       {
@@ -300,7 +463,7 @@ namespace SHADE
       else
       {
         auto properties = var.get_type().get_properties();
-        for (auto property : properties)
+        for (auto const& property : properties)
         {
           node[property.get_name().data()] = RTTRToNode(property.get_value(var));
         }
@@ -308,6 +471,17 @@ namespace SHADE
       return node;
     }
 
+    template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
+    static std::string SerializeComponentToString(ComponentType* component)
+    {
+      return std::string();
+    }
+
+    template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
+    static void SerializeComponentToFile(ComponentType* component, std::filesystem::path const& path)
+    {
+    }
+
     template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
     static YAML::Node SerializeComponentToNode(ComponentType* component)
     {
@@ -327,15 +501,18 @@ namespace SHADE
       auto propType = prop.get_type();
       if (propType == rttr::type::get<SHVec4>())
       {
-        prop.set_value(component, SHSerializationTools::YAMLToVec4(propertyNode));
+        SHVec4 vec = propertyNode.as<SHVec4>();
+        prop.set_value(component, vec);
       }
       else if (propType == rttr::type::get<SHVec3>())
       {
-        prop.set_value(component, SHSerializationTools::YAMLToVec3(propertyNode));
+        SHVec3 vec = propertyNode.as<SHVec3>();
+        prop.set_value(component, vec);
       }
       else if (propType == rttr::type::get<SHVec2>())
       {
-        prop.set_value(component, SHSerializationTools::YAMLToVec2(propertyNode));
+        SHVec2 vec = propertyNode.as<SHVec2>();
+        prop.set_value(component, vec);
       }
       else if (propType.is_arithmetic())
       {
@@ -371,9 +548,10 @@ namespace SHADE
       else
       {
         auto properties = propType.get_properties();
-        for (auto property : properties)
+        for (auto const& property : properties)
         {
-          InitializeProperty(component, property, propertyNode[property.get_name().data()]);
+          if(propertyNode[property.get_name().data()].IsDefined())
+            InitializeProperty(component, property, propertyNode[property.get_name().data()]);
         }
       }
     }
@@ -381,7 +559,7 @@ namespace SHADE
     template <typename ComponentType, std::enable_if_t<std::is_base_of_v<SHComponent, ComponentType>, bool> = true>
     static void InitializeComponentFromNode(YAML::Node const& componentsNode, EntityID const& eid)
     {
-      auto component = SHComponentManager::GetComponent_s<ComponentType>(eid);
+      ComponentType* component = SHComponentManager::GetComponent_s<ComponentType>(eid);
       if (componentsNode.IsNull() && !component)
         return;
       auto rttrType = rttr::type::get<ComponentType>();
@@ -406,7 +584,7 @@ namespace SHADE
         return;
       auto rttrType = rttr::type::get<ComponentType>();
       auto componentNode = componentsNode[rttrType.get_name().data()];
-      if (componentsNode.IsNull())
+      if (!componentNode.IsDefined())
         return;
       YAML::convert<ComponentType>::decode(componentNode, *component);
     }
diff --git a/SHADE_Engine/src/Tools/Dialog/SHWinDialog.cpp b/SHADE_Engine/src/Tools/Dialog/SHWinDialog.cpp
new file mode 100644
index 00000000..bd13801a
--- /dev/null
+++ b/SHADE_Engine/src/Tools/Dialog/SHWinDialog.cpp
@@ -0,0 +1,71 @@
+#include "SHpch.h"
+#include "SHWinDialog.h"
+#include <Windows.h>
+#include <shobjidl.h>
+
+namespace SHADE
+{
+  void SHWinDialog::DisplayMessageBox(MessageBoxType const& messageBoxType, std::string const& title, std::string const& text)
+  {
+    if(messageBoxType == MessageBoxType::MB_MAX)
+      return;
+
+    UINT flags = MB_APPLMODAL | MB_SETFOREGROUND | MB_OK;
+    flags |= static_cast<UINT>(messageBoxType);
+
+    const std::wstring wTitle(title.begin(), title.end());
+    const std::wstring wText(text.begin(), text.end());
+
+    MessageBox(GetDesktopWindow(), wText.data(), wTitle.data(), flags);
+  }
+
+  std::vector<std::string> SHWinDialog::DisplayOpenDialog(OpenSaveConfig const& openSaveConfig)
+  {
+    const HWND hwnd = GetDesktopWindow();
+    HRESULT hResult = CoInitializeEx(nullptr, COINIT_APARTMENTTHREADED | COINIT_DISABLE_OLE1DDE);
+    if(SUCCEEDED(hResult))
+    {
+      IFileOpenDialog* pFileOpen;
+
+      //Create Dialog object
+      hResult = CoCreateInstance(CLSID_FileOpenDialog, nullptr, CLSCTX_ALL, IID_IFileOpenDialog, reinterpret_cast<LPVOID*>(pFileOpen));
+
+      if(SUCCEEDED(hResult))
+      {
+        //Show the open dialog box
+        hResult = pFileOpen->Show(hwnd);
+
+        //Get file name from the dialoh box
+        if(SUCCEEDED(hResult))
+        {
+          if(openSaveConfig.openMultiple)
+          {
+            IShellItemArray* pItemArray;
+            hResult = pFileOpen->GetResults(&pItemArray);
+            if(SUCCEEDED(hResult))
+            {
+              
+            }
+          }
+          else
+          {
+            IShellItem* pItem;
+            hResult = pFileOpen->GetResult(&pItem);
+            if(SUCCEEDED(hResult))
+            {
+              PWSTR pszFilePath;
+              hResult = pItem->GetDisplayName(SIGDN_FILESYSPATH, &pszFilePath);
+            }
+          }
+          
+        }
+      }
+    }
+    return {};
+  }
+
+  std::vector<std::string> SHWinDialog::DisplaySaveAsDialog(OpenSaveConfig const& openSaveConfig)
+  {
+    return{};
+  }
+}
diff --git a/SHADE_Engine/src/Tools/Dialog/SHWinDialog.h b/SHADE_Engine/src/Tools/Dialog/SHWinDialog.h
new file mode 100644
index 00000000..02fe07b9
--- /dev/null
+++ b/SHADE_Engine/src/Tools/Dialog/SHWinDialog.h
@@ -0,0 +1,36 @@
+#pragma once
+#include <string>
+#include <vector>
+
+namespace SHADE
+{
+  //https://learn.microsoft.com/en-us/windows/win32/api/winuser/nf-winuser-messagebox
+  enum class MessageBoxType
+  {
+    MB_ERROR    = 0x00000010L,
+    MB_QUESTION = 0x00000020L,
+    MB_WARNING  = 0x00000030L,
+    MB_INFO     = 0x00000040L,
+    MB_MAX      = 0
+  };
+
+  struct OpenSaveConfig
+  {
+    using Extension = std::string;
+    using Extensions = std::vector<Extension>;
+    using FileTypeDesc = std::pair<std::string, Extensions>;
+    using FilterList = std::vector<FileTypeDesc>;
+
+    std::string title = "Open";
+    bool openFolders = false;
+    bool openMultiple = false;
+    FilterList filterList{};
+  };
+
+  struct SHWinDialog
+  {
+    static void DisplayMessageBox(MessageBoxType const& messageBoxType, std::string const& title, std::string const& text);
+    static std::vector<std::string> DisplayOpenDialog(OpenSaveConfig const& openSaveConfig);
+    static std::vector<std::string> DisplaySaveAsDialog(OpenSaveConfig const& openSaveConfig);
+  };
+}
diff --git a/SHADE_Engine/src/Tools/SHDebugDraw.cpp b/SHADE_Engine/src/Tools/SHDebugDraw.cpp
new file mode 100644
index 00000000..a5b86c42
--- /dev/null
+++ b/SHADE_Engine/src/Tools/SHDebugDraw.cpp
@@ -0,0 +1,73 @@
+/************************************************************************************//*!
+\file           SHDebugDrawSystem.cpp
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Nov 2, 2022
+\brief          Contains the definition of functions of the SHDebugDrawSystem class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+// Precompiled Header
+#include "SHpch.h"
+// Primary Include
+#include "SHDebugDraw.h"
+// Project Includes
+#include "Math/Vector/SHVec4.h"
+#include "Math/SHColour.h"
+#include "Graphics/MiddleEnd/Interface/SHDebugDrawSystem.h"
+#include "ECS_Base/Managers/SHSystemManager.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Static Member Definitions                                                         */
+  /*-----------------------------------------------------------------------------------*/
+  SHDebugDrawSystem* SHDebugDraw::dbgDrawSys = nullptr;
+  
+  /*-----------------------------------------------------------------------------------*/
+  /* Lifecycle Functions                                                               */
+  /*-----------------------------------------------------------------------------------*/
+  void SHDebugDraw::Init(SHDebugDrawSystem* sys)
+  {
+    dbgDrawSys = sys;
+    if (dbgDrawSys == nullptr)
+    {
+      SHLOG_ERROR("[SHDebugDraw] Invalid SHDebugDrawSystem provided for initialization!");
+    }
+  }
+
+  /*-----------------------------------------------------------------------------------*/
+  /* Draw Functions                                                                    */
+  /*-----------------------------------------------------------------------------------*/
+  void SHDebugDraw::Line(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt)
+  {
+    dbgDrawSys->DrawLine(color, startPt, endPt);
+  }
+
+  void SHDebugDraw::Tri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3)
+  {
+    dbgDrawSys->DrawTri(color, pt1, pt2, pt3);
+  }
+
+  void SHDebugDraw::Quad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4)
+  {
+    dbgDrawSys->DrawQuad(color, pt1, pt2, pt3, pt4);
+  }
+
+  void SHDebugDraw::Poly(const SHVec4& color, std::initializer_list<SHVec3> pointList)
+  {
+    dbgDrawSys->DrawPoly(color, pointList);
+  }
+
+  void SHDebugDraw::Cube(const SHVec4& color, const SHVec3& pos, const SHVec3& size)
+  {
+    dbgDrawSys->DrawCube(color, pos, size);
+  }
+
+  void SHDebugDraw::Sphere(const SHVec4& color, const SHVec3& pos, double radius)
+  {
+    dbgDrawSys->DrawSphere(color, pos, radius);
+  }
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Tools/SHDebugDraw.h b/SHADE_Engine/src/Tools/SHDebugDraw.h
new file mode 100644
index 00000000..7ce44ec2
--- /dev/null
+++ b/SHADE_Engine/src/Tools/SHDebugDraw.h
@@ -0,0 +1,101 @@
+/************************************************************************************//*!
+\file           SHDebugDraw.h
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Nov 2, 2022
+\brief          Contains the definition of the SHDebugDraw static class.
+
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+
+// Project Includes
+#include "SH_API.h"
+
+namespace SHADE
+{
+  /*-----------------------------------------------------------------------------------*/
+  /* Forward Declarations                                                              */
+  /*-----------------------------------------------------------------------------------*/
+  class SHDebugDrawSystem;
+  class SHVec4;
+  class SHVec3;
+  class SHColour;
+  
+  /*-----------------------------------------------------------------------------------*/
+  /* Type Definitions                                                                  */
+  /*-----------------------------------------------------------------------------------*/
+  /// <summary>
+  /// Static helper class to make it easier to do debug drawing and enable support for
+  /// managed code to execute it withot dependency hell due to graphics system 
+  /// dependencies.
+  /// </summary>
+  class SH_API SHDebugDraw final
+  {
+    public:
+    /*---------------------------------------------------------------------------------*/
+    /* Lifecycle Functions                                                             */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Sets up the link with the SHDebugDrawSystem. Must be called after the 
+    /// SHDebugDrawSystem is spawned.
+    /// </summary>
+    static void Init(SHDebugDrawSystem* sys);
+
+    /*---------------------------------------------------------------------------------*/
+    /* Draw Functions                                                                  */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Renders a line between two points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the line.</param>
+    /// <param name="startPt">First point of the line.</param>
+    /// <param name="endPt">Second point of the line.</param>
+    static void Line(const SHVec4& color, const SHVec3& startPt, const SHVec3& endPt);
+    /// <summary>
+    /// Renders a triangle indicated by three points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the triangle.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the triangle.</param>
+    /// <param name="pt3">Third point of the triangle.</param>
+    static void Tri(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3);
+    /// <summary>
+    /// Renders a quadrilateral indicated by four points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the quadrilateral.</param>
+    /// <param name="pt1">First point of the triangle.</param>
+    /// <param name="pt2">Second point of the quadrilateral.</param>
+    /// <param name="pt3">Third point of the quadrilateral.</param>
+    /// <param name="pt4">Third point of the quadrilateral.</param>
+    static void Quad(const SHVec4& color, const SHVec3& pt1, const SHVec3& pt2, const SHVec3& pt3, const SHVec3& pt4);
+    /// <summary>
+    /// Renders a polygon indicated by the specified set of points in world space.
+    /// </summary>
+    /// <param name="color">Colour of the polygon.</param>
+    /// <param name="pointList">List of points for the polygon.</param>
+    static void Poly(const SHVec4& color, std::initializer_list<SHVec3> pointList);
+    /// <summary>
+    /// Renders a wireframe cube centered around the position specified in world space.
+    /// </summary>
+    /// <param name="color">Colour of the cube.</param>
+    /// <param name="pos">Position where the cube wil be centered at.</param>
+    /// <param name="size">Size of the rendered cube.</param>
+    static void Cube(const SHVec4& color, const SHVec3& pos, const SHVec3& size);
+    /// <summary>
+    /// Renders a wireframe sphere centered around the position specified in world space.
+    /// </summary>
+    /// <param name="color">Colour of the sphere.</param>
+    /// <param name="pos">Position where the sphere wil be centered at.</param>
+    /// <param name="size">Size of the rendered sphere.</param>
+    static void Sphere(const SHVec4& color, const SHVec3& pos, double radius);
+
+    private:
+    /*---------------------------------------------------------------------------------*/
+    /* Static Data Members                                                             */
+    /*---------------------------------------------------------------------------------*/
+    static SHDebugDrawSystem* dbgDrawSys;
+  };
+}
\ No newline at end of file
diff --git a/SHADE_Engine/src/Tools/SHLog.h b/SHADE_Engine/src/Tools/SHLog.h
index 89dd9206..91117da6 100644
--- a/SHADE_Engine/src/Tools/SHLog.h
+++ b/SHADE_Engine/src/Tools/SHLog.h
@@ -9,7 +9,7 @@ Copyright (C) 2022 DigiPen Institute of Technology.
 Reproduction or disclosure of this file or its contents without the prior written consent
 of DigiPen Institute of Technology is prohibited.
 *//*************************************************************************************/
-
+#pragma once
 // Standard Library
 #include <string>
 // Project Headers
diff --git a/SHADE_Managed/premake5.lua b/SHADE_Managed/premake5.lua
index 906511c1..b383f002 100644
--- a/SHADE_Managed/premake5.lua
+++ b/SHADE_Managed/premake5.lua
@@ -25,11 +25,16 @@ project "SHADE_Managed"
   includedirs
   {
     "%{prj.location}/src",
+  }
+  
+  externalincludedirs
+  {
     "%{IncludeDir.spdlog}/include",
     "%{IncludeDir.imgui}",
     "%{IncludeDir.imguizmo}",
     "%{IncludeDir.imnodes}",
     "%{IncludeDir.yamlcpp}",
+    "%{IncludeDir.SDL}\\include",
     "%{IncludeDir.RTTR}/include",
     "%{IncludeDir.dotnet}\\include",
     "%{IncludeDir.reactphysics3d}\\include",
@@ -38,13 +43,16 @@ project "SHADE_Managed"
 
   libdirs
   {
-    "%{IncludeDir.RTTR}/lib"
+    "%{IncludeDir.RTTR}/lib",
+    "%{IncludeDir.SDL}/lib"
   }
   
   links
   {
     "yaml-cpp",
     "imgui",
+    "SDL2.lib",
+    "SDL2main.lib",
     "SHADE_Engine",
     "SHADE_CSharp"
   }
diff --git a/SHADE_Managed/src/Components/Camera.cxx b/SHADE_Managed/src/Components/Camera.cxx
new file mode 100644
index 00000000..5e570cc1
--- /dev/null
+++ b/SHADE_Managed/src/Components/Camera.cxx
@@ -0,0 +1,127 @@
+#include "SHpch.h"
+
+#include "Camera.hxx"
+#include "ECS_Base/Managers/SHSystemManager.h"
+#include "Camera/SHCameraSystem.h"
+
+
+namespace SHADE
+{
+	Camera::Camera(Entity entity)
+		:Component(entity)
+	{
+
+	}
+
+
+	float Camera::Pitch::get()
+	{
+		return (GetNativeComponent()->GetPitch());
+	}
+
+	void Camera::Pitch::set(float val)
+	{
+		GetNativeComponent()->SetPitch(val);
+	}
+	float Camera::Yaw::get()
+	{
+		return (GetNativeComponent()->GetYaw());
+	}
+
+	void Camera::Yaw::set(float val)
+	{
+		GetNativeComponent()->SetYaw(val);
+	}
+	float Camera::Roll::get()
+	{
+		return (GetNativeComponent()->GetRoll());
+	}
+
+	void Camera::Roll::set(float val)
+	{
+		GetNativeComponent()->SetRoll(val);
+	}
+	float Camera::Width::get()
+	{
+		return (GetNativeComponent()->GetWidth());
+	}
+
+	void Camera::Width::set(float val)
+	{
+		GetNativeComponent()->SetWidth(val);
+	}
+	float Camera::Height::get()
+	{
+		return (GetNativeComponent()->GetHeight());
+	}
+
+	void Camera::Height::set(float val)
+	{
+		GetNativeComponent()->SetHeight(val);
+	}
+	float Camera::Near::get()
+	{
+		return (GetNativeComponent()->GetNear());
+	}
+
+	void Camera::Near::set(float val)
+	{
+		GetNativeComponent()->SetNear(val);
+	}
+	float Camera::Far::get()
+	{
+		return (GetNativeComponent()->GetFar());
+	}
+
+	void Camera::Far::set(float val)
+	{
+		GetNativeComponent()->SetFar(val);
+	}
+	float Camera::FOV::get()
+	{
+		return (GetNativeComponent()->GetFOV());
+	}
+
+	void Camera::FOV::set(float val)
+	{
+		GetNativeComponent()->SetFOV(val);
+	}
+
+	Vector3 Camera::Position::get()
+	{
+		return Convert::ToCLI(GetNativeComponent()->GetPosition());
+	}
+
+	void Camera::Position::set(Vector3 val)
+	{
+		GetNativeComponent()->SetPosition(Convert::ToNative(val));
+	}
+
+	void Camera::SetMainCamera(size_t directorIndex)
+	{
+		auto system = SHSystemManager::GetSystem<SHCameraSystem>();
+		system->SetMainCamera(GetNativeComponent()->GetEID(), directorIndex);
+	}
+
+	void Camera::SetMainCamera()
+	{
+		SetMainCamera(0);
+	}
+
+	void Camera::LookAt(Vector3 targetPosition)
+	{
+		auto system = SHSystemManager::GetSystem<SHCameraSystem>();
+		system->CameraLookAt(*GetNativeComponent(), Convert::ToNative(targetPosition));
+	}
+
+	Vector3 Camera::GetForward()
+	{
+		auto system = SHSystemManager::GetSystem<SHCameraSystem>();
+		SHVec3 forward, up, right;
+		system->GetCameraAxis(*GetNativeComponent(), forward, right, up);
+		return Convert::ToCLI(forward);
+		
+	}
+
+
+}
\ No newline at end of file
diff --git a/SHADE_Managed/src/Components/Camera.hxx b/SHADE_Managed/src/Components/Camera.hxx
new file mode 100644
index 00000000..257bff11
--- /dev/null
+++ b/SHADE_Managed/src/Components/Camera.hxx
@@ -0,0 +1,70 @@
+#pragma once
+
+// Project Includes
+#include "Components/Component.hxx"
+#include "Math/Vector3.hxx"
+#include "Math/Quaternion.hxx"
+// External Dependencies
+#include "Camera/SHCameraComponent.h"
+
+namespace SHADE
+{
+	public ref class Camera : public Component<SHCameraComponent>
+	{
+	internal:
+		Camera(Entity entity);
+
+	public:
+		property float Pitch
+		{
+			float get();
+			void set(float val);
+		}
+		property float Yaw
+		{
+			float get();
+			void set(float val);
+		}
+		property float Roll
+		{
+			float get();
+			void set(float val);
+		}
+		property float Width
+		{
+			float get();
+			void set(float val);
+		}
+		property float Height
+		{
+			float get();
+			void set(float val);
+		}
+		property float Near
+		{
+			float get();
+			void set(float val);
+		}
+		property float Far
+		{
+			float get();
+			void set(float val);
+		}
+		property float FOV
+		{
+			float get();
+			void set(float val);
+		}
+		property Vector3 Position
+		{
+			Vector3 get();
+			void set(Vector3 val);
+		}
+
+
+		void SetMainCamera(size_t directorIndex);
+		void SetMainCamera();
+		void LookAt(Vector3 targetPosition);
+		Vector3 GetForward();
+	};
+}
\ No newline at end of file
diff --git a/SHADE_Managed/src/Components/CameraArm.cxx b/SHADE_Managed/src/Components/CameraArm.cxx
new file mode 100644
index 00000000..67fcf6cf
--- /dev/null
+++ b/SHADE_Managed/src/Components/CameraArm.cxx
@@ -0,0 +1,51 @@
+#include "SHpch.h"
+#include "CameraArm.hxx"
+
+
+namespace SHADE
+{
+	CameraArm::CameraArm(Entity entity)
+		:Component(entity)
+	{
+
+	}
+
+	float CameraArm::Pitch::get()
+	{
+		return (GetNativeComponent()->GetPitch());
+	}
+
+	void CameraArm::Pitch::set(float val)
+	{
+		GetNativeComponent()->SetPitch(val);
+	}
+	float CameraArm::Yaw::get()
+	{
+		return (GetNativeComponent()->GetYaw());
+	}
+
+	void CameraArm::Yaw::set(float val)
+	{
+		GetNativeComponent()->SetYaw(val);
+	}
+
+	float CameraArm::ArmLength::get()
+	{
+		return (GetNativeComponent()->GetArmLength());
+	}
+
+	void CameraArm::ArmLength::set(float val)
+	{
+		GetNativeComponent()->SetArmLength(val);
+	}
+
+	bool CameraArm::LookAtCameraOrigin::get()
+	{
+		return GetNativeComponent()->lookAtCameraOrigin;
+	}
+
+	void CameraArm::LookAtCameraOrigin::set(bool val)
+	{
+		GetNativeComponent()->lookAtCameraOrigin = val;
+	}
+}
\ No newline at end of file
diff --git a/SHADE_Managed/src/Components/CameraArm.hxx b/SHADE_Managed/src/Components/CameraArm.hxx
new file mode 100644
index 00000000..771771cf
--- /dev/null
+++ b/SHADE_Managed/src/Components/CameraArm.hxx
@@ -0,0 +1,40 @@
+#pragma once
+
+// Project Includes
+#include "Components/Component.hxx"
+#include "Math/Vector3.hxx"
+
+// External Dependencies
+#include "Camera/SHCameraArmComponent.h"
+
+
+namespace SHADE
+{
+	public ref class CameraArm : public Component<SHCameraArmComponent>
+	{
+	internal:
+		CameraArm(Entity entity);
+	public:
+		property float Pitch
+		{
+			float get();
+			void set(float val);
+		}
+		property float Yaw
+		{
+			float get();
+			void set(float val);
+		}
+		property float ArmLength
+		{
+			float get();
+			void set(float val);
+		}
+		property bool LookAtCameraOrigin
+		{
+			bool get();
+			void set(bool val);
+		}
+
+	};
+}
\ No newline at end of file
diff --git a/SHADE_Managed/src/Components/Component.cxx b/SHADE_Managed/src/Components/Component.cxx
index a6afc5cc..7f56fad3 100644
--- a/SHADE_Managed/src/Components/Component.cxx
+++ b/SHADE_Managed/src/Components/Component.cxx
@@ -67,6 +67,11 @@ namespace SHADE
         ScriptStore::RemoveScript<T>(owner.GetEntity());
     }
 
+    BaseComponent::operator bool(BaseComponent^ c)
+    {
+        return c != nullptr;
+    }
+
     /*---------------------------------------------------------------------------------*/
     /* Constructors                                                                    */
     /*---------------------------------------------------------------------------------*/
diff --git a/SHADE_Managed/src/Components/Component.hxx b/SHADE_Managed/src/Components/Component.hxx
index 670e4e21..5ffa3952 100644
--- a/SHADE_Managed/src/Components/Component.hxx
+++ b/SHADE_Managed/src/Components/Component.hxx
@@ -101,6 +101,15 @@ namespace SHADE
         generic<typename T> where T : ref class, Script
         void RemoveScript();
 
+        /*-----------------------------------------------------------------------------*/
+        /* Operator Overloads                                                          */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Implicit conversion operator to enable checking if a component is null.
+        /// </summary>
+        /// <param name="c">Component to check.</param>
+        static operator bool(BaseComponent^ c);
+
       protected:
         /*-----------------------------------------------------------------------------*/
         /* Constructors                                                                */
diff --git a/SHADE_Managed/src/Components/RigidBody.cxx b/SHADE_Managed/src/Components/RigidBody.cxx
index 172b928b..12861600 100644
--- a/SHADE_Managed/src/Components/RigidBody.cxx
+++ b/SHADE_Managed/src/Components/RigidBody.cxx
@@ -148,6 +148,14 @@ namespace SHADE
     {
         return Convert::ToCLI(GetNativeComponent()->GetTorque());
     }
+    bool RigidBody::Interpolating::get()
+    {
+        return GetNativeComponent()->IsInterpolating();
+    }
+    void RigidBody::Interpolating::set(bool value)
+    {
+        GetNativeComponent()->SetInterpolate(value);
+    }
     
     /*---------------------------------------------------------------------------------*/
     /* Force Functions                                                                 */
diff --git a/SHADE_Managed/src/Components/RigidBody.hxx b/SHADE_Managed/src/Components/RigidBody.hxx
index b3e031ba..d3a30612 100644
--- a/SHADE_Managed/src/Components/RigidBody.hxx
+++ b/SHADE_Managed/src/Components/RigidBody.hxx
@@ -129,6 +129,11 @@ namespace SHADE
         {
             Vector3 get();
         }
+        property bool Interpolating
+        {
+            bool get();
+            void set(bool value);
+        }
         
         /*-----------------------------------------------------------------------------*/
         /* Force Functions                                                             */
diff --git a/SHADE_Managed/src/Components/Transform.cxx b/SHADE_Managed/src/Components/Transform.cxx
index 98f0da4f..927ce87f 100644
--- a/SHADE_Managed/src/Components/Transform.cxx
+++ b/SHADE_Managed/src/Components/Transform.cxx
@@ -87,15 +87,6 @@ namespace SHADE
     {
         GetNativeComponent()->SetWorldScale(Convert::ToNative(val));
     }
-    Transform^ Transform::Parent::get()
-    {
-        auto node = SHSceneManager::GetCurrentSceneGraph().GetNode(owner.GetEntity());
-        if (!node)
-            throw gcnew System::InvalidOperationException("[Transform] Unable to retrieve SceneGraphNode for an Entity.");
-
-        const auto PARENT = node->GetParent();
-        return PARENT ? gcnew Transform(PARENT->GetEntityID()) : nullptr;
-    }
 
     /*---------------------------------------------------------------------------------*/
     /* Constructors                                                                    */
@@ -103,21 +94,4 @@ namespace SHADE
     Transform::Transform(Entity entity)
     : Component(entity)
     {}
-
-    /*---------------------------------------------------------------------------------*/
-    /* Usage Functions                                                                 */
-    /*---------------------------------------------------------------------------------*/
-
-    void Transform::SetParent(Transform^ parent, bool worldPositionStays)
-    {
-        auto& sceneGraph = SHSceneManager::GetCurrentSceneGraph();
-        auto node = sceneGraph.GetNode(owner.GetEntity());
-        if (!node)
-            throw gcnew System::InvalidOperationException("[Transform] Unable to retrieve SceneGraphNode for an Entity.");
-
-        if (parent)
-            node->SetParent(sceneGraph.GetNode(parent->owner.GetEntity()));
-        else
-            sceneGraph.SetParent(parent->owner.GetEntity(), nullptr);
-    }
 }
diff --git a/SHADE_Managed/src/Components/Transform.hxx b/SHADE_Managed/src/Components/Transform.hxx
index bbe9fd19..942c6224 100644
--- a/SHADE_Managed/src/Components/Transform.hxx
+++ b/SHADE_Managed/src/Components/Transform.hxx
@@ -107,30 +107,6 @@ namespace SHADE
             Vector3 get();
             void set(Vector3 val);
         }
-        /// <summary>
-        /// Parent Transform that affects this Transform.
-        /// </summary>
-        property Transform^ Parent
-        {
-            Transform^ get();
-        }
-
-        /*-----------------------------------------------------------------------------*/
-        /* Usage Functions                                                             */
-        /*-----------------------------------------------------------------------------*/
-        /// <summary>
-        /// Sets the parent of this Transform component.
-        /// </summary>
-        /// <param name="parent">
-        /// Entity that contains the Transform component that this Transform will be
-        /// parented to. If null, unparenting will occur.
-        /// </param>
-        /// <param name="worldPositionStays">
-        /// If true, the transform values of this Transform component will retain their
-        /// pre-parent-change global transforms. The local transform values will be
-        /// modified to ensure that the global transforms do not change.
-        /// </param>
-        void SetParent(Transform^ parent, bool worldPositionStays);
     };
 }
 
diff --git a/SHADE_Managed/src/Editor/Editor.cxx b/SHADE_Managed/src/Editor/Editor.cxx
index 1097e203..55fe91da 100644
--- a/SHADE_Managed/src/Editor/Editor.cxx
+++ b/SHADE_Managed/src/Editor/Editor.cxx
@@ -260,7 +260,7 @@ namespace SHADE
 
             int val = safe_cast<int>(field->GetValue(object));
             int oldVal = val;
-            if (SHEditorUI::InputEnumCombo(Convert::ToNative(field->Name), val, nativeEnumNames))
+            if (SHEditorUI::InputEnumCombo(Convert::ToNative(field->Name), val, nativeEnumNames, &isHovered))
             {
                 field->SetValue(object, val); 
                 registerUndoAction(object, field, val, oldVal);
@@ -280,12 +280,23 @@ namespace SHADE
             // Actual Field
             std::string val = Convert::ToNative(stringVal);
             std::string oldVal = val;
-            if (SHEditorUI::InputTextField(Convert::ToNative(field->Name), val))
+            if (SHEditorUI::InputTextField(Convert::ToNative(field->Name), val, &isHovered))
             {
                 field->SetValue(object, Convert::ToCLI(val));
                 registerUndoAction(object, field, Convert::ToCLI(val), Convert::ToCLI(oldVal));
             }
         }
+        else if (field->FieldType == GameObject::typeid)
+        {
+            GameObject gameObj = safe_cast<GameObject>(field->GetValue(object));
+            uint32_t entityId = gameObj.GetEntity();
+            if (SHEditorUI::InputGameObjectField(Convert::ToNative(field->Name), entityId, &isHovered))
+            {
+                GameObject newVal = GameObject(entityId);
+                field->SetValue(object, newVal);
+                registerUndoAction(object, field, newVal, gameObj);
+            }
+        }
         else
         {
             array<System::Type^>^ interfaces = field->FieldType->GetInterfaces();
diff --git a/SHADE_Managed/src/Engine/Application.cxx b/SHADE_Managed/src/Engine/Application.cxx
new file mode 100644
index 00000000..c19bafa6
--- /dev/null
+++ b/SHADE_Managed/src/Engine/Application.cxx
@@ -0,0 +1,71 @@
+/************************************************************************************//*!
+\file           Application.cxx
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definitions of the functions in the static managed
+                Application class.
+
+                Note: This file is written in C++17/CLI.
+ 
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent 
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+// Precompiled Headers
+#include "SHpch.h"
+// Primary Header
+#include "Application.hxx"
+// External Dependencies
+#include "ECS_Base/Managers/SHSystemManager.h"
+#include "Editor/SHEditor.h"
+#include "Graphics/MiddleEnd/Interface/SHGraphicsSystemInterface.h"
+
+namespace SHADE
+{
+    /*---------------------------------------------------------------------------------*/
+    /* Properties                                                                      */
+    /*---------------------------------------------------------------------------------*/
+    bool Application::IsPlaying::get()
+    {
+        auto editor = SHSystemManager::GetSystem<SHEditor>();
+        if (editor)
+            return editor->editorState == SHEditor::State::PLAY
+                   ||
+                   editor->editorState == SHEditor::State::PAUSE;
+
+        return true;
+    }
+    bool Application::IsPaused::get()
+    {
+        auto editor = SHSystemManager::GetSystem<SHEditor>();
+        if (editor)
+            return editor->editorState == SHEditor::State::PAUSE;
+
+        return false;
+    }
+    int Application::WindowWidth::get()
+    {
+        return SHGraphicsSystemInterface::GetWindowWidth();
+    }
+    int Application::WindowHeight::get()
+    {
+        return SHGraphicsSystemInterface::GetWindowWidth();
+    }
+    bool Application::IsFullscreen::get()
+    {
+        return SHGraphicsSystemInterface::IsFullscreen();
+    }
+    /*void Application::IsFullscreen::set(bool value)
+    {
+        return SHGraphicsSystemInterface::SetFullscreen(value);
+    }*/
+
+    /*---------------------------------------------------------------------------------*/
+    /* Usage Functions                                                                 */
+    /*---------------------------------------------------------------------------------*/
+    void Application::Quit()
+    {
+        SHGraphicsSystemInterface::CloseWindow();
+    }
+}
diff --git a/SHADE_Managed/src/Engine/Application.hxx b/SHADE_Managed/src/Engine/Application.hxx
new file mode 100644
index 00000000..8629cf75
--- /dev/null
+++ b/SHADE_Managed/src/Engine/Application.hxx
@@ -0,0 +1,77 @@
+/************************************************************************************//*!
+\file           Application.hxx
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definitions of a managed static Application class.
+
+                Note: This file is written in C++17/CLI.
+ 
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent 
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+
+namespace SHADE
+{
+    /// <summary>
+    /// Static class that contains useful properties for querying the state of the
+    /// engine.
+    /// </summary>
+    public ref class Application abstract sealed
+    {
+      public:
+        /*-----------------------------------------------------------------------------*/
+        /* Properties                                                                  */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Whether or not the engine is playing. This will always be true on Publish.
+        /// On Debug/Release builds, this is true when the editor is in Play Mode. It
+        /// will also be true even if the editor is in Play Mode but is paused.
+        /// </summary>
+        static property bool IsPlaying
+        {
+            bool get();
+        }
+        /// <summary>
+        /// Whether or not the engine is in a paused state where script updates and
+        /// physics are not in play.
+        /// </summary>
+        static property bool IsPaused
+        {
+            bool get();
+        }
+        /// <summary>
+        /// Retrieves the designated width of the current window.
+        /// </summary>
+        static property int WindowWidth
+        {
+            int get();
+        }
+        /// <summary>
+        /// Retrieves the designated height of the current window.
+        /// </summary>
+        static property int WindowHeight
+        {
+            int get();
+        }
+        /// <summary>
+        /// Whether or not the application is currently in fullscreen mode or not.
+        /// </summary>
+        static property bool IsFullscreen
+        {
+            bool get();
+            // TODO: once implemented on SHADE_Engine
+            //void set(bool value); 
+        }
+
+        /*-----------------------------------------------------------------------------*/
+        /* Usage Functions                                                             */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Marks the application to stop at the end of the current frame.
+        /// </summary>
+        static void Quit();
+    };
+}
diff --git a/SHADE_Managed/src/Engine/ECS.cxx b/SHADE_Managed/src/Engine/ECS.cxx
index df67c788..3da39394 100644
--- a/SHADE_Managed/src/Engine/ECS.cxx
+++ b/SHADE_Managed/src/Engine/ECS.cxx
@@ -33,6 +33,8 @@ of DigiPen Institute of Technology is prohibited.
 #include "Components/Transform.hxx"
 #include "Components\RigidBody.hxx"
 #include "Components\Collider.hxx"
+#include "Components/Camera.hxx"
+#include "Components/CameraArm.hxx"
 
 namespace SHADE
 {
@@ -248,6 +250,8 @@ namespace SHADE
         componentMap.Add(createComponentSet<SHTransformComponent, Transform>());
         componentMap.Add(createComponentSet<SHColliderComponent, Collider>());
         componentMap.Add(createComponentSet<SHRigidBodyComponent, RigidBody>());
+        componentMap.Add(createComponentSet<SHCameraComponent, Camera>());
+        componentMap.Add(createComponentSet<SHCameraArmComponent, CameraArm>());
     }
     
     /*---------------------------------------------------------------------------------*/
diff --git a/SHADE_Managed/src/Engine/GameObject.cxx b/SHADE_Managed/src/Engine/GameObject.cxx
index 8c78e399..7ceabfed 100644
--- a/SHADE_Managed/src/Engine/GameObject.cxx
+++ b/SHADE_Managed/src/Engine/GameObject.cxx
@@ -17,9 +17,12 @@ of DigiPen Institute of Technology is prohibited.
 #include "GameObject.hxx"
 // External Dependencies
 #include "ECS_Base/Managers/SHEntityManager.h"
+#include "Scene/SHSceneGraph.h"
 // Project Headers
 #include "ECS.hxx"
+#include "Utility/Convert.hxx"
 #include "Scripts/ScriptStore.hxx"
+#include "Utility/Debug.hxx"
 
 namespace SHADE
 {
@@ -39,7 +42,13 @@ namespace SHADE
     System::Nullable<GameObject> GameObject::Find(System::String ^ name)
     {
         // Search the GameObjectLibrary for an Entity with the specified name
-        throw gcnew System::NotImplementedException();
+        const auto ENTITY_ID = SHEntityManager::GetEntityByName(Convert::ToNative(name));
+        if (ENTITY_ID == MAX_EID)
+        {
+            return {};
+        }
+
+        return GameObject(ENTITY_ID);
     }
     
     /*---------------------------------------------------------------------------------*/
@@ -56,7 +65,38 @@ namespace SHADE
     }
     bool GameObject::IsActiveInHierarchy::get()
     {
-        return true; // TODO: Update once we have an equivalent on the Entity object
+        auto node = SHSceneManager::GetCurrentSceneGraph().GetNode(GetEntity());
+        if (!node)
+        {
+            Debug::LogWarning("Attempting to access a GameObject's ActiveInHierarchy state which does not exist. Assuming inactive.");
+            return false;
+        }
+        return node->IsActive();
+    }
+    Entity GameObject::EntityId::get()
+    {
+        return entity;
+    }
+    GameObject^ GameObject::Parent::get()
+    {
+      const auto& SCENE_GRAPH = SHSceneManager::GetCurrentSceneGraph();
+      const auto* ROOT = SCENE_GRAPH.GetRoot();
+
+      const auto* NODE = SCENE_GRAPH.GetNode(entity);
+      if (NODE == nullptr)
+        throw gcnew System::InvalidOperationException("Unable to retrieve SceneGraphNode for Entity " + entity.ToString());
+
+      const auto* PARENT = NODE->GetParent();
+      return PARENT != ROOT ? gcnew GameObject(PARENT->GetEntityID()) : nullptr;
+    }
+    void GameObject::Parent::set(GameObject^ newParent)
+    {
+      const auto& SCENE_GRAPH = SHSceneManager::GetCurrentSceneGraph();
+
+      if (newParent == nullptr)
+        SCENE_GRAPH.SetParent(entity, nullptr);
+      else
+        SCENE_GRAPH.SetParent(entity, newParent->EntityId);
     }
     
     /*---------------------------------------------------------------------------------*/
@@ -141,11 +181,13 @@ namespace SHADE
     /* Constructors                                                                    */
     /*---------------------------------------------------------------------------------*/
     GameObject::GameObject(const SHEntity& entity)
-    : entity { entity.GetEID() }
+    : entity  { entity.GetEID() }
+    , children{ gcnew System::Collections::ArrayList }
     {}
 
     GameObject::GameObject(Entity entity)
-    : entity { entity }
+    : entity  { entity }
+    , children{ gcnew System::Collections::ArrayList }
     {}
     
     /*---------------------------------------------------------------------------------*/
diff --git a/SHADE_Managed/src/Engine/GameObject.hxx b/SHADE_Managed/src/Engine/GameObject.hxx
index 723d9cec..99296a91 100644
--- a/SHADE_Managed/src/Engine/GameObject.hxx
+++ b/SHADE_Managed/src/Engine/GameObject.hxx
@@ -86,6 +86,21 @@ namespace SHADE
         {
             bool get();
         }
+        /// <summary>
+        /// Native Entity ID value for this GameObject.
+        /// </summary>
+        property Entity EntityId
+        {
+            Entity get();
+        }
+        /// <summary>
+        /// The parent entity for this GameObject.
+        /// </summary>
+        property GameObject^ Parent
+        {
+          GameObject^ get();
+          void set(GameObject^);
+        }
 
         /*-----------------------------------------------------------------------------*/
         /* GameObject Property Functions                                               */
@@ -105,6 +120,7 @@ namespace SHADE
         /// Whether to activate or deactivate this GameObject.
         /// </param>
         void SetActive(bool active);
+        
 
         /*-----------------------------------------------------------------------------*/
         /* Component Access Functions                                                  */
@@ -235,7 +251,8 @@ namespace SHADE
         /*-----------------------------------------------------------------------------*/
         /* Data Members                                                                */
         /*-----------------------------------------------------------------------------*/
-        Entity entity;
+        Entity                            entity;
+        System::Collections::ArrayList^   children;
 
       public:
         /*-----------------------------------------------------------------------------*/
diff --git a/SHADE_Managed/src/Engine/Time.cxx b/SHADE_Managed/src/Engine/Time.cxx
index ff0628e7..36032e00 100644
--- a/SHADE_Managed/src/Engine/Time.cxx
+++ b/SHADE_Managed/src/Engine/Time.cxx
@@ -14,6 +14,9 @@ of DigiPen Institute of Technology is prohibited.
 *//*************************************************************************************/
 // Precompiled Headers
 #include "SHpch.h"
+// External Dependencies
+#include "FRC/SHFramerateController.h"
+#include "Physics/SHPhysicsSystemInterface.h"
 // Primary Header
 #include "Time.hxx"
 
@@ -26,4 +29,14 @@ namespace SHADE
     {
         return SHFrameRateController::GetRawDeltaTime();
     }
+
+
+    float Time::DeltaTimeF::get()
+    {
+      return static_cast<float>(SHFrameRateController::GetRawDeltaTime());
+    }
+    double Time::FixedDeltaTime::get()
+    {
+        return SHPhysicsSystemInterface::GetFixedDT();
+    }
 }
\ No newline at end of file
diff --git a/SHADE_Managed/src/Engine/Time.hxx b/SHADE_Managed/src/Engine/Time.hxx
index 969eea03..c0f0ed62 100644
--- a/SHADE_Managed/src/Engine/Time.hxx
+++ b/SHADE_Managed/src/Engine/Time.hxx
@@ -14,8 +14,6 @@ of DigiPen Institute of Technology is prohibited.
 *//*************************************************************************************/
 #pragma once
 
-#include "FRC/SHFramerateController.h"
-
 namespace SHADE
 {
     /// <summary>
@@ -29,13 +27,28 @@ namespace SHADE
         /*-----------------------------------------------------------------------------*/
         /// <summary>
         /// Time taken to process the previous frame.
-        /// Note, is affected by TimeScale. Use UnscaledDeltaTime if you wish to retrieve
-        /// real world time. This is also affected by MaxDeltaTime clamping that
-        /// UnscaledDeltaTime is subject to.
         /// </summary>
         static property double DeltaTime
         {
             double get();
         }
+        /*-----------------------------------------------------------------------------*/
+        /* Properties                                                                  */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Time taken to process the previous frame.
+        /// </summary>
+        static property float DeltaTimeF
+        {
+          float get();
+        }
+        /// <summary>
+        /// Time taken for Physics simulations. You should use this for operations 
+        /// within Script.FixedUpdate()
+        /// </summary>
+        static property double FixedDeltaTime
+        {
+            double get();
+        }
     };
 }
\ No newline at end of file
diff --git a/SHADE_Managed/src/Input/Input.cxx b/SHADE_Managed/src/Input/Input.cxx
index 0a386f3a..f0ea0edc 100644
--- a/SHADE_Managed/src/Input/Input.cxx
+++ b/SHADE_Managed/src/Input/Input.cxx
@@ -99,4 +99,11 @@ namespace SHADE
         return SHInputManager::GetKeyReleasedTime(static_cast<SHInputManager::SH_KEYCODE>(key));
     }
 
+    Vector2 Input::GetMouseVelocity()
+    {
+      double velX, velY;
+      SHInputManager::GetMouseVelocity(&velX, &velY);
+
+      return Convert::ToCLI(SHVec2{ (float)velX,(float)velY });
+    }
 }
\ No newline at end of file
diff --git a/SHADE_Managed/src/Input/Input.hxx b/SHADE_Managed/src/Input/Input.hxx
index f281e4c8..875054cc 100644
--- a/SHADE_Managed/src/Input/Input.hxx
+++ b/SHADE_Managed/src/Input/Input.hxx
@@ -31,10 +31,159 @@ namespace SHADE
         /// <summary>
         /// Represents the available supported keycodes that can be passed into the 
         /// key-based Input functions.
+        /// 
+        /// Attempting to follow https://docs.unity3d.com/ScriptReference/KeyCode.html
+        /// Win32 keycodes are shift-insensitive, i.e. 'A' and 'a' are the same keycode and '1' and '!' are the same keycode
         /// </summary>
         enum class KeyCode : int
         {
+            Backspace       = static_cast<int>(SHInputManager::SH_KEYCODE::BACKSPACE),
+            Delete          = static_cast<int>(SHInputManager::SH_KEYCODE::DEL),
+            Tab             = static_cast<int>(SHInputManager::SH_KEYCODE::TAB),
+            Clear           = static_cast<int>(SHInputManager::SH_KEYCODE::CLEAR),
+            Return          = static_cast<int>(SHInputManager::SH_KEYCODE::ENTER),
+            Pause           = static_cast<int>(SHInputManager::SH_KEYCODE::PAUSE),
+            Escape          = static_cast<int>(SHInputManager::SH_KEYCODE::ESCAPE),
             Space           = static_cast<int>(SHInputManager::SH_KEYCODE::SPACE),
+            Keypad0         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_0),
+            Keypad1         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_1),
+            Keypad2         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_2),
+            Keypad3         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_3),
+            Keypad4         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_4),
+            Keypad5         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_5),
+            Keypad6         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_6),
+            Keypad7         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_7),
+            Keypad8         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_8),
+            Keypad9         = static_cast<int>(SHInputManager::SH_KEYCODE::NUMPAD_9),
+            KeypadPeriod    = static_cast<int>(SHInputManager::SH_KEYCODE::DECIMAL),
+            KeypadDivide    = static_cast<int>(SHInputManager::SH_KEYCODE::DIVIDE),
+            KeypadMultiply  = static_cast<int>(SHInputManager::SH_KEYCODE::MULTIPLY),
+            KeypadMinus     = static_cast<int>(SHInputManager::SH_KEYCODE::SUBTRACT),
+            KeypadPlus      = static_cast<int>(SHInputManager::SH_KEYCODE::ADD),
+            KeypadEnter     = static_cast<int>(SHInputManager::SH_KEYCODE::ENTER),
+            //KeypadEquals
+            UpArrow         = static_cast<int>(SHInputManager::SH_KEYCODE::UP_ARROW),
+            DownArrow       = static_cast<int>(SHInputManager::SH_KEYCODE::DOWN_ARROW),
+            RightArrow      = static_cast<int>(SHInputManager::SH_KEYCODE::RIGHT_ARROW),
+            LeftArrow       = static_cast<int>(SHInputManager::SH_KEYCODE::LEFT_ARROW),
+            Insert          = static_cast<int>(SHInputManager::SH_KEYCODE::INSERT),
+            Home            = static_cast<int>(SHInputManager::SH_KEYCODE::HOME),
+            End             = static_cast<int>(SHInputManager::SH_KEYCODE::END),
+            PageUp          = static_cast<int>(SHInputManager::SH_KEYCODE::PAGE_UP),
+            PageDown        = static_cast<int>(SHInputManager::SH_KEYCODE::PAGE_DOWN),
+            F1              = static_cast<int>(SHInputManager::SH_KEYCODE::F1),
+            F2              = static_cast<int>(SHInputManager::SH_KEYCODE::F2),
+            F3              = static_cast<int>(SHInputManager::SH_KEYCODE::F3),
+            F4              = static_cast<int>(SHInputManager::SH_KEYCODE::F4),
+            F5              = static_cast<int>(SHInputManager::SH_KEYCODE::F5),
+            F6              = static_cast<int>(SHInputManager::SH_KEYCODE::F6),
+            F7              = static_cast<int>(SHInputManager::SH_KEYCODE::F7),
+            F8              = static_cast<int>(SHInputManager::SH_KEYCODE::F8),
+            F9              = static_cast<int>(SHInputManager::SH_KEYCODE::F9),
+            F10             = static_cast<int>(SHInputManager::SH_KEYCODE::F10),
+            F11             = static_cast<int>(SHInputManager::SH_KEYCODE::F11),
+            F12             = static_cast<int>(SHInputManager::SH_KEYCODE::F12),
+            F13             = static_cast<int>(SHInputManager::SH_KEYCODE::F13),
+            F14             = static_cast<int>(SHInputManager::SH_KEYCODE::F14),
+            F15             = static_cast<int>(SHInputManager::SH_KEYCODE::F15),
+            F16             = static_cast<int>(SHInputManager::SH_KEYCODE::F16),
+            F17             = static_cast<int>(SHInputManager::SH_KEYCODE::F17),
+            F18             = static_cast<int>(SHInputManager::SH_KEYCODE::F18),
+            F19             = static_cast<int>(SHInputManager::SH_KEYCODE::F19),
+            F20             = static_cast<int>(SHInputManager::SH_KEYCODE::F20),
+            F21             = static_cast<int>(SHInputManager::SH_KEYCODE::F21),
+            F22             = static_cast<int>(SHInputManager::SH_KEYCODE::F22),
+            F23             = static_cast<int>(SHInputManager::SH_KEYCODE::F23),
+            F24             = static_cast<int>(SHInputManager::SH_KEYCODE::F24),
+            Alpha0          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_0),
+            Alpha1          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_1),
+            Alpha2          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_2),
+            Alpha3          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_3),
+            Alpha4          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_4),
+            Alpha5          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_5),
+            Alpha6          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_6),
+            Alpha7          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_7),
+            Alpha8          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_8),
+            Alpha9          = static_cast<int>(SHInputManager::SH_KEYCODE::NUMBER_9),
+            //Exclaim
+            //DoubleQuote
+            //Hash
+            //Dollar
+            //Percent
+            //Ampersand
+            Quote           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_7),
+            //LeftParen
+            //RightParen
+            //Asterisk
+            //Plus
+            Comma           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_COMMA),
+            Minus           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_MINUS),
+            Period          = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_PERIOD),
+            Slash           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_2),
+            //Colon
+            Semicolon       = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_1),
+            //Less
+            Equals          = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_PLUS),
+            //Greater
+            //Question
+            //At
+            LeftBracket     = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_4),
+            Backslash       = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_5),
+            RightBracket    = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_6),
+            //Caret
+            //Underscore
+            BackQuote       = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_3),
+            A               = static_cast<int>(SHInputManager::SH_KEYCODE::A),
+            B               = static_cast<int>(SHInputManager::SH_KEYCODE::B),
+            C               = static_cast<int>(SHInputManager::SH_KEYCODE::C),
+            D               = static_cast<int>(SHInputManager::SH_KEYCODE::D),
+            E               = static_cast<int>(SHInputManager::SH_KEYCODE::E),
+            F               = static_cast<int>(SHInputManager::SH_KEYCODE::F),
+            G               = static_cast<int>(SHInputManager::SH_KEYCODE::G),
+            H               = static_cast<int>(SHInputManager::SH_KEYCODE::H),
+            I               = static_cast<int>(SHInputManager::SH_KEYCODE::I),
+            J               = static_cast<int>(SHInputManager::SH_KEYCODE::J),
+            K               = static_cast<int>(SHInputManager::SH_KEYCODE::K),
+            L               = static_cast<int>(SHInputManager::SH_KEYCODE::L),
+            M               = static_cast<int>(SHInputManager::SH_KEYCODE::M),
+            N               = static_cast<int>(SHInputManager::SH_KEYCODE::N),
+            O               = static_cast<int>(SHInputManager::SH_KEYCODE::O),
+            P               = static_cast<int>(SHInputManager::SH_KEYCODE::P),
+            Q               = static_cast<int>(SHInputManager::SH_KEYCODE::Q),
+            R               = static_cast<int>(SHInputManager::SH_KEYCODE::R),
+            S               = static_cast<int>(SHInputManager::SH_KEYCODE::S),
+            T               = static_cast<int>(SHInputManager::SH_KEYCODE::T),
+            U               = static_cast<int>(SHInputManager::SH_KEYCODE::U),
+            V               = static_cast<int>(SHInputManager::SH_KEYCODE::V),
+            W               = static_cast<int>(SHInputManager::SH_KEYCODE::W),
+            X               = static_cast<int>(SHInputManager::SH_KEYCODE::X),
+            Y               = static_cast<int>(SHInputManager::SH_KEYCODE::Y),
+            Z               = static_cast<int>(SHInputManager::SH_KEYCODE::Z),
+            //LeftCurlyBracket
+            //Pipe
+            //RightCurlyBracket
+            //Tilde
+            NumLock        = static_cast<int>(SHInputManager::SH_KEYCODE::NUM_LOCK),
+            CapsLock       = static_cast<int>(SHInputManager::SH_KEYCODE::CAPS_LOCK),
+            ScrollLock     = static_cast<int>(SHInputManager::SH_KEYCODE::SCROLL_LOCK),
+            RightShift     = static_cast<int>(SHInputManager::SH_KEYCODE::RIGHT_SHIFT),
+            LeftShift      = static_cast<int>(SHInputManager::SH_KEYCODE::LEFT_SHIFT),
+            RightControl   = static_cast<int>(SHInputManager::SH_KEYCODE::RIGHT_CTRL),
+            LeftControl    = static_cast<int>(SHInputManager::SH_KEYCODE::LEFT_CTRL),
+            RightAlt       = static_cast<int>(SHInputManager::SH_KEYCODE::RIGHT_ALT),
+            LeftAlt        = static_cast<int>(SHInputManager::SH_KEYCODE::LEFT_ALT),
+            LeftWindows    = static_cast<int>(SHInputManager::SH_KEYCODE::LEFT_WINDOWS),
+            RightWindows   = static_cast<int>(SHInputManager::SH_KEYCODE::RIGHT_WINDOWS),
+            //AltGr
+            Help           = static_cast<int>(SHInputManager::SH_KEYCODE::HELP),
+            Print          = static_cast<int>(SHInputManager::SH_KEYCODE::PRINT),
+            SysReq         = static_cast<int>(SHInputManager::SH_KEYCODE::PRINT_SCREEN),
+            //Break
+            //Menu
+            //Mouse buttons use mouse codes, which are enums declared later
+            //TODO Controller input
+#if 0
+            Space = static_cast<int>(SHInputManager::SH_KEYCODE::SPACE),
             //Apostrophe		= static_cast<int>(SHInputManager::SH_KEYCODE::APOSTROPHE),
             Comma           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_COMMA),
             Minus           = static_cast<int>(SHInputManager::SH_KEYCODE::OEM_MINUS),
@@ -190,7 +339,8 @@ namespace SHADE
             JoystickButton6       =  JoystickView,        
             JoystickButton7       =  JoystickMenu,        
             JoystickButton8       =  JoystickLeftStick,   
-            JoystickButton9       =  JoystickRightStick  
+            JoystickButton9       =  JoystickRightStick
+#endif
 
         };
         /// <summary>
@@ -321,5 +471,7 @@ namespace SHADE
         /// <param name="key">The key to check.</param>
         /// <returns>Time in seconds that the key was held.</returns>
         static double GetMouseReleasedTime(MouseCode mouseButton);
+
+        static Vector2 GetMouseVelocity();
     };
 }
\ No newline at end of file
diff --git a/SHADE_Managed/src/Math/Vector2.cxx b/SHADE_Managed/src/Math/Vector2.cxx
index b110d4f8..42080d60 100644
--- a/SHADE_Managed/src/Math/Vector2.cxx
+++ b/SHADE_Managed/src/Math/Vector2.cxx
@@ -236,6 +236,22 @@ namespace SHADE
             lhs.y * rhs.y
         );
     }
+    Vector2 Vector2::operator*(Vector2 lhs, double rhs)
+    {
+        return Vector2
+        (
+            lhs.x * static_cast<float>(rhs),
+            lhs.y * static_cast<float>(rhs)
+        );
+    }
+    Vector2 Vector2::operator/(Vector2 lhs, double rhs)
+    {
+        return Vector2
+        (
+            lhs.x / static_cast<float>(rhs),
+            lhs.y / static_cast<float>(rhs)
+        );
+    }
     Vector2 Vector2::operator*(Vector2 lhs, float rhs)
     {
         return Vector2
diff --git a/SHADE_Managed/src/Math/Vector2.hxx b/SHADE_Managed/src/Math/Vector2.hxx
index 94b1989f..4877696b 100644
--- a/SHADE_Managed/src/Math/Vector2.hxx
+++ b/SHADE_Managed/src/Math/Vector2.hxx
@@ -361,6 +361,22 @@ namespace SHADE
         /// <param name="lhs">Vector2 to multiply with.</param>
         /// <param name="rhs">Scalar to multiply with.</param>
         /// <returns>The result of the scalar multiplication.</returns>
+        static Vector2 operator*(Vector2 lhs, double rhs);
+        /// <summary>
+        /// Calculates the division of a Vector2 with a scalar value and returns 
+        /// the result.
+        /// </summary>
+        /// <param name="lhs">Scalar to divide with.</param>
+        /// <param name="rhs">Vector2 to divide with.</param>
+        /// <returns>The result of the scalar division.</returns>
+        static Vector2 operator/(Vector2 lhs, double rhs);
+        /// <summary>
+        /// Calculates the multiplication of a Vector2 with a scalar value and returns 
+        /// the result.
+        /// </summary>
+        /// <param name="lhs">Vector2 to multiply with.</param>
+        /// <param name="rhs">Scalar to multiply with.</param>
+        /// <returns>The result of the scalar multiplication.</returns>
         static Vector2 operator*(Vector2 lhs, float rhs);
         /// <summary>
         /// Calculates the division of a Vector2 with a scalar value and returns 
diff --git a/SHADE_Managed/src/Math/Vector3.cxx b/SHADE_Managed/src/Math/Vector3.cxx
index adbb4d3a..83adbb38 100644
--- a/SHADE_Managed/src/Math/Vector3.cxx
+++ b/SHADE_Managed/src/Math/Vector3.cxx
@@ -237,6 +237,24 @@ namespace SHADE
             lhs.z * rhs.z
         );
     }
+    Vector3 Vector3::operator*(Vector3 lhs, double rhs)
+    {
+        return Vector3
+        (
+            lhs.x * static_cast<float>(rhs),
+            lhs.y * static_cast<float>(rhs),
+            lhs.z * static_cast<float>(rhs)
+        );
+    }
+    Vector3 Vector3::operator/(Vector3 lhs, double rhs)
+    {
+        return Vector3
+        (
+            lhs.x / static_cast<float>(rhs),
+            lhs.y / static_cast<float>(rhs),
+            lhs.z / static_cast<float>(rhs)
+        );
+    }
     Vector3 Vector3::operator*(Vector3 lhs, float rhs)
     {
         return Vector3
diff --git a/SHADE_Managed/src/Math/Vector3.hxx b/SHADE_Managed/src/Math/Vector3.hxx
index 70cff88f..4cdf653e 100644
--- a/SHADE_Managed/src/Math/Vector3.hxx
+++ b/SHADE_Managed/src/Math/Vector3.hxx
@@ -375,6 +375,22 @@ namespace SHADE
         /// <param name="lhs">Vector3 to multiply with.</param>
         /// <param name="rhs">Scalar to multiply with.</param>
         /// <returns>The result of the scalar multiplication.</returns>
+        static Vector3 operator*(Vector3 lhs, double rhs);
+        /// <summary>
+        /// Calculates the division of a Vector3 with a scalar value and returns 
+        /// the result.
+        /// </summary>
+        /// <param name="lhs">Scalar to divide with.</param>
+        /// <param name="rhs">Vector3 to divide with.</param>
+        /// <returns>The result of the scalar division.</returns>
+        static Vector3 operator/(Vector3 lhs, double rhs);
+        /// <summary>
+        /// Calculates the multiplication of a Vector3 with a scalar value and returns 
+        /// the result.
+        /// </summary>
+        /// <param name="lhs">Vector3 to multiply with.</param>
+        /// <param name="rhs">Scalar to multiply with.</param>
+        /// <returns>The result of the scalar multiplication.</returns>
         static Vector3 operator*(Vector3 lhs, float rhs);
         /// <summary>
         /// Calculates the division of a Vector3 with a scalar value and returns 
diff --git a/SHADE_Managed/src/Physics/CollisionInfo.cxx b/SHADE_Managed/src/Physics/CollisionInfo.cxx
new file mode 100644
index 00000000..135760db
--- /dev/null
+++ b/SHADE_Managed/src/Physics/CollisionInfo.cxx
@@ -0,0 +1,36 @@
+/************************************************************************************//*!
+\file           CollisionInfo.cxx
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definition of the functions of the managed CollisionInfo 
+                struct.
+
+                Note: This file is written in C++17/CLI.
+ 
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent 
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#include "SHpch.h"
+#include "CollisionInfo.hxx"
+#include "Components/RigidBody.hxx"
+#include "Components/Collider.hxx"
+
+namespace SHADE
+{
+    Collider^ CollisionInfo::Collider::get()
+    {
+        return GameObject.GetComponent<SHADE::Collider^>();
+    }
+
+    CollisionShape^ CollisionInfo::CollisionShape::get()
+    {
+        throw gcnew System::NotImplementedException();
+    }
+
+    RigidBody^ CollisionInfo::RigidBody::get()
+    {
+        return GameObject.GetComponent<SHADE::RigidBody^>();
+    }
+}
diff --git a/SHADE_Managed/src/Physics/CollisionInfo.hxx b/SHADE_Managed/src/Physics/CollisionInfo.hxx
new file mode 100644
index 00000000..40cb9ccc
--- /dev/null
+++ b/SHADE_Managed/src/Physics/CollisionInfo.hxx
@@ -0,0 +1,66 @@
+/************************************************************************************//*!
+\file           CollisionInfo.hxx
+\author         Tng Kah Wei, kahwei.tng, 390009620
+\par            email: kahwei.tng\@digipen.edu
+\date           Oct 31, 2022
+\brief          Contains the definition of the managed CollisionInfo struct with the
+                definition of its properties and declaration of functions.
+
+                Note: This file is written in C++17/CLI.
+ 
+Copyright (C) 2022 DigiPen Institute of Technology.
+Reproduction or disclosure of this file or its contents without the prior written consent 
+of DigiPen Institute of Technology is prohibited.
+*//*************************************************************************************/
+#pragma once
+// Project Includes
+#include "Engine/GameObject.hxx"
+
+namespace SHADE
+{
+    /*---------------------------------------------------------------------------------*/
+    /* Forward Declarations                                                            */
+    /*---------------------------------------------------------------------------------*/
+    ref class RigidBody;
+    ref class Collider;
+    ref class CollisionShape;
+
+    /*---------------------------------------------------------------------------------*/
+    /* Type Definitions                                                                */
+    /*---------------------------------------------------------------------------------*/
+    /// <summary>
+    /// Struct that describes a collision
+    /// </summary>
+    public value struct CollisionInfo
+    {
+      public:
+        /*-----------------------------------------------------------------------------*/
+        /* Properties                                                                  */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// The GameObject whose collider you are colliding with.
+        /// </summary>
+        property GameObject GameObject;
+        /// <summary>
+        /// The Collider that you are colliding with.
+        /// </summary>
+        property Collider^ Collider
+        {
+            SHADE::Collider^ get();
+        }
+        /// <summary>
+        /// The CollisionShape of the Collider that you are colliding with.
+        /// </summary>
+        property CollisionShape^ CollisionShape
+        {
+            SHADE::CollisionShape^ get();
+        }
+        /// <summary>
+        /// The RigidBody that you are colliding with.
+        /// </summary>
+        property RigidBody^ RigidBody
+        {
+            SHADE::RigidBody^ get();
+        }
+    };
+}
diff --git a/SHADE_Managed/src/Scripts/Script.cxx b/SHADE_Managed/src/Scripts/Script.cxx
index ecd27325..e476d69d 100644
--- a/SHADE_Managed/src/Scripts/Script.cxx
+++ b/SHADE_Managed/src/Scripts/Script.cxx
@@ -18,6 +18,8 @@ of DigiPen Institute of Technology is prohibited.
 #include "Script.hxx"
 // Project Headers
 #include "Utility/Debug.hxx"
+#include "ScriptStore.hxx"
+#include "Engine/ECS.hxx"
 
 namespace SHADE
 {
@@ -49,8 +51,7 @@ namespace SHADE
     generic <typename T>
     void Script::RemoveComponent()
     {
-        throw gcnew System::NotImplementedException;
-        //ECS::RemoveComponent<T>(owner.GetNativeEntity());
+        owner.RemoveComponent<T>();
     }
 
     /*---------------------------------------------------------------------------------*/
@@ -59,37 +60,37 @@ namespace SHADE
     generic <typename T>
     T Script::AddScript()
     {
-        throw gcnew System::NotImplementedException;
-        //return ScriptStore::AddScript<T>(owner.GetEntity());
+        return ScriptStore::AddScript<T>(owner.GetEntity());
     }
     generic <typename T>
     T Script::GetScript()
     {
-        throw gcnew System::NotImplementedException;
-        //return ScriptStore::GetScript<T>(owner.GetEntity());
+        return ScriptStore::GetScript<T>(owner.GetEntity());
     }
 
     generic <typename T>
     T Script::GetScriptInChildren()
     {
-        throw gcnew System::NotImplementedException;
-        //return ScriptStore::GetScriptInChildren<T>(owner.GetEntity());
+        return ScriptStore::GetScriptInChildren<T>(owner.GetEntity());
     }
 
     generic <typename T>
     System::Collections::Generic::IEnumerable<T>^ Script::GetScripts()
     {
-        throw gcnew System::NotImplementedException;
-        //return ScriptStore::GetScripts<T>(owner.GetEntity());
+        return ScriptStore::GetScripts<T>(owner.GetEntity());
     }
 
     generic <typename T>
     void Script::RemoveScript()
     {
-        throw gcnew System::NotImplementedException;
-        //ScriptStore::RemoveScript<T>(owner.GetEntity());
+        ScriptStore::RemoveScript<T>(owner.GetEntity());
     }
-    
+
+    Script::operator bool(Script^ s)
+    {
+        return s != nullptr;
+    }
+
     /*---------------------------------------------------------------------------------*/
     /* "All-time" Lifecycle Functions                                                  */
     /*---------------------------------------------------------------------------------*/
@@ -146,6 +147,48 @@ namespace SHADE
         SAFE_NATIVE_CALL_END(this)
     }
 
+    void Script::OnCollisionEnter(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onCollisionEnter(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
+    void Script::OnCollisionStay(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onCollisionStay(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
+    void Script::OnCollisionExit(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onCollisionExit(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
+    void Script::OnTriggerEnter(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onTriggerEnter(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
+    void Script::OnTriggerStay(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onTriggerStay(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
+    void Script::OnTriggerExit(CollisionInfo collision)
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        onTriggerExit(collision);
+        SAFE_NATIVE_CALL_END(this)
+    }
+
     /*---------------------------------------------------------------------------------*/
     /* Constructors                                                                    */
     /*---------------------------------------------------------------------------------*/
@@ -168,4 +211,14 @@ namespace SHADE
     void Script::update() {}
     void Script::lateUpdate() {}
     void Script::onDestroy() {}
-}// namespace PlushieAPI
+
+    /*---------------------------------------------------------------------------------*/
+    /* Virtual Event Functions                                                         */
+    /*---------------------------------------------------------------------------------*/
+    void Script::onTriggerEnter(CollisionInfo) {}
+    void Script::onTriggerStay(CollisionInfo) {}
+    void Script::onTriggerExit(CollisionInfo) {}
+    void Script::onCollisionEnter(CollisionInfo) {}
+    void Script::onCollisionStay(CollisionInfo) {}
+    void Script::onCollisionExit(CollisionInfo) {}
+}
diff --git a/SHADE_Managed/src/Scripts/Script.hxx b/SHADE_Managed/src/Scripts/Script.hxx
index cef9f4cd..afeaa8a0 100644
--- a/SHADE_Managed/src/Scripts/Script.hxx
+++ b/SHADE_Managed/src/Scripts/Script.hxx
@@ -15,6 +15,7 @@ of DigiPen Institute of Technology is prohibited.
 
 // Project Includes
 #include "Engine/GameObject.hxx"
+#include "Physics/CollisionInfo.hxx"
 
 namespace SHADE
 {
@@ -153,6 +154,15 @@ namespace SHADE
         generic<typename T> where T : ref class, Script
         void RemoveScript();
 
+        /*-----------------------------------------------------------------------------*/
+        /* Operator Overloads                                                          */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Implicit conversion operator to enable checking if a component is null.
+        /// </summary>
+        /// <param name="c">Component to check.</param>
+        static operator bool(Script^ s);
+
       internal:
         /*-----------------------------------------------------------------------------*/
         /* "All-Time" Lifecycle Functions                                              */
@@ -204,6 +214,46 @@ namespace SHADE
         /// </summary>
         void OnDestroy();
 
+        /*-----------------------------------------------------------------------------*/
+        /* Event Functions                                                             */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Used to call onCollisionEnter(). This should be called when a collision is
+        /// detected between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnCollisionEnter(CollisionInfo collision);
+        /// <summary>
+        /// Used to call onCollisionStay(). This should be called when a collision is
+        /// persistent between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnCollisionStay(CollisionInfo collision);
+        /// <summary>
+        /// Used to call onCollisionExit(). This should be called when a collision ends
+        /// between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnCollisionExit(CollisionInfo collision);
+        /// <summary>
+        /// Used to call onTriggerEnter(). This should be called when a trigger-type 
+        /// collision is detected between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnTriggerEnter(CollisionInfo collision);
+        /// <summary>
+        /// Used to call onTriggerStay(). This should be called when a trigger-type 
+        /// collision is detected between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnTriggerStay(CollisionInfo collision);
+        /// <summary>
+        /// Used to call onTriggerExit(). This should be called when a trigger-type 
+        /// collision is detected between the attached GameObject and another GameObject.
+        /// </summary>
+        /// <param name="collision">Information on the collision event.</param>
+        void OnTriggerExit(CollisionInfo collision);
+
       protected:
         /*-----------------------------------------------------------------------------*/
         /* Constructors                                                                */
@@ -264,6 +314,46 @@ namespace SHADE
         /// </summary>
         virtual void onDestroy();
 
+        /*-----------------------------------------------------------------------------*/
+        /* Virtual Event Functions                                                     */
+        /*-----------------------------------------------------------------------------*/
+        /// <summary>
+        /// Called when the attached GameObject has a trigger Collider and collides with
+        /// another GameObject with a Collider in the first frame of collision.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onTriggerEnter(CollisionInfo info);
+        /// <summary>
+        /// Called when the attached GameObject has a trigger Collider and collides with
+        /// another GameObject with a Collider in subsequent frames of collision.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onTriggerStay(CollisionInfo info);
+        /// <summary>
+        /// Called when the attached GameObject has a trigger Collider and leaves a 
+        /// collision with another GameObject with a Collider2D.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onTriggerExit(CollisionInfo info);
+        /// <summary>
+        /// Called when the attached GameObject has a Collider and collides with
+        /// another GameObject with a Collider in the first frame of collision.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onCollisionEnter(CollisionInfo info);
+        /// <summary>
+        /// Called when the attached GameObject has a Collider and collides with
+        /// another GameObject with a Collider in subsequent frames of collision.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onCollisionStay(CollisionInfo info);
+        /// <summary>
+        /// Called when the attached GameObject has a Collider and leaves a 
+        /// collision with another GameObject with a Collider2D.
+        /// </summary>
+        /// <param name="info">Information on the collision event.</param>
+        virtual void onCollisionExit(CollisionInfo info);
+
       private:
         /*-----------------------------------------------------------------------------*/
         /* Data Members                                                                */
@@ -271,4 +361,4 @@ namespace SHADE
         GameObject owner;
     };
 
-} // namespace PlushieAPI
+}
diff --git a/SHADE_Managed/src/Scripts/ScriptStore.cxx b/SHADE_Managed/src/Scripts/ScriptStore.cxx
index b6bc1815..407d0fa8 100644
--- a/SHADE_Managed/src/Scripts/ScriptStore.cxx
+++ b/SHADE_Managed/src/Scripts/ScriptStore.cxx
@@ -27,6 +27,9 @@ of DigiPen Institute of Technology is prohibited.
 #include "Script.hxx"
 #include "Engine/Entity.hxx"
 #include "Serialisation/ReflectionUtilities.hxx"
+#include "Engine/Application.hxx"
+#include "Physics/SHPhysicsSystemInterface.h"
+#include "Physics/SHPhysicsUtils.h"
 
 namespace SHADE
 {
@@ -70,7 +73,7 @@ namespace SHADE
         SAFE_NATIVE_CALL_BEGIN
         Script^ script;
         return AddScriptViaNameWithRef(entity, scriptName, script);
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
         return false;
     }
 
@@ -300,7 +303,7 @@ namespace SHADE
             removeScript(script);
         }
         scriptList->Clear();
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     void ScriptStore::RemoveAllScriptsImmediately(Entity entity, bool callOnDestroy)
     {
@@ -325,7 +328,7 @@ namespace SHADE
             startList.Remove(script);
         }
         scriptList->Clear();
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     
     /*---------------------------------------------------------------------------------*/
@@ -364,7 +367,7 @@ namespace SHADE
         startList.AddRange(%inactiveStartList);
         inactiveStartList.Clear();
 
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     void ScriptStore::FrameCleanUp()
     {
@@ -372,8 +375,11 @@ namespace SHADE
         // Clear the queue
         while (disposalQueue.Count > 0)
         {
-            Script^ script = disposalQueue.Dequeue();
-            script->OnDestroy();
+            Script^ script = disposalQueue.Dequeue();            
+            if (Application::IsPlaying)
+            {
+                script->OnDestroy();
+            }
             auto entity = script->Owner.GetEntity();
             auto scriptList = scripts[script->Owner.GetEntity()];
             scriptList->Remove(script);
@@ -382,13 +388,13 @@ namespace SHADE
                 scripts.Remove(entity);
             }
         }
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     void ScriptStore::Exit()
     {
         SAFE_NATIVE_CALL_BEGIN
         // Run the deinit all scripts if needed
-        //if (Application::IsPlaying)
+        if (Application::IsPlaying)
         {
             Debug::Log("Running OnDestroy() for scripts.");
             for each (System::Collections::Generic::KeyValuePair<Entity, ScriptList^> entity in scripts)
@@ -406,7 +412,7 @@ namespace SHADE
         startList.Clear();
         disposalQueue.Clear();
         scriptTypeList = nullptr;
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
 
     /*---------------------------------------------------------------------------------*/
@@ -435,7 +441,7 @@ namespace SHADE
                 script->FixedUpdate();
             }
         }
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     void ScriptStore::ExecuteUpdate()
     {
@@ -452,7 +458,7 @@ namespace SHADE
                 script->Update();
             }
         }
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
     void ScriptStore::ExecuteLateUpdate()
     {
@@ -469,7 +475,95 @@ namespace SHADE
                 script->LateUpdate();
             }
         }
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
+    }
+
+    void ScriptStore::ExecuteCollisionFunctions()
+    {
+        SAFE_NATIVE_CALL_BEGIN
+        /* Collisions */
+        const auto& collisions = SHPhysicsSystemInterface::GetCollisionInfo();
+        for (const auto& collisionInfo : collisions)
+        {
+            auto entities = 
+            { 
+                std::make_pair(collisionInfo.GetEntityA(), collisionInfo.GetEntityB()),
+                std::make_pair(collisionInfo.GetEntityB(), collisionInfo.GetEntityA())
+            };
+            for (auto entity : entities)
+            {
+                // Don't bother if this object has no scripts or is inactive
+                if (!isEntityActive(entity.first) || !scripts.ContainsKey(entity.first))
+                    continue;
+
+                // Construct the collision state object
+                CollisionInfo info;
+                info.GameObject = GameObject(entity.second);
+
+                // Call all of the script's functions
+                auto entityScripts = scripts[entity.first];
+                if (entityScripts->Count > 0)
+                {
+                    for each (Script ^ script in entityScripts)
+                    {
+                        switch (collisionInfo.GetCollisionState())
+                        {
+                            case SHCollisionEvent::State::ENTER:
+                                script->OnCollisionEnter(info);
+                                break;
+                            case SHCollisionEvent::State::STAY:
+                                script->OnCollisionStay(info);
+                                break;
+                            case SHCollisionEvent::State::EXIT:
+                                script->OnCollisionExit(info);
+                                break;
+                        }
+                    }
+                }
+            }
+        }
+        /* Triggers */
+        const auto& triggers = SHPhysicsSystemInterface::GetTriggerInfo();
+        for (const auto& triggerInfo : triggers)
+        {
+            auto entities = 
+            { 
+                std::make_pair(triggerInfo.GetEntityA(), triggerInfo.GetEntityB()),
+                std::make_pair(triggerInfo.GetEntityB(), triggerInfo.GetEntityA())
+            };
+            for (auto entity : entities)
+            {
+                // Don't bother if this object has no scripts or is inactive
+                if (!isEntityActive(entity.first) || !scripts.ContainsKey(entity.first))
+                    continue;
+
+                // Construct the collision state object
+                CollisionInfo info;
+                info.GameObject = GameObject(entity.second);
+
+                // Call all of the script's functions
+                auto entityScripts = scripts[entity.first];
+                if (entityScripts->Count > 0)
+                {
+                    for each (Script ^ script in entityScripts)
+                    {
+                        switch (triggerInfo.GetCollisionState())
+                        {
+                            case SHCollisionEvent::State::ENTER:
+                                script->OnTriggerEnter(info);
+                                break;
+                            case SHCollisionEvent::State::STAY:
+                                script->OnTriggerStay(info);
+                                break;
+                            case SHCollisionEvent::State::EXIT:
+                                script->OnTriggerExit(info);
+                                break;
+                        }
+                    }
+                }
+            }
+        }
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
     }
 
     bool ScriptStore::SerialiseScripts(Entity entity, System::IntPtr yamlNodePtr)
@@ -505,7 +599,7 @@ namespace SHADE
         }
 
         return true;
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
         return false;
     }
 
@@ -555,7 +649,7 @@ namespace SHADE
         }
         return true;
 
-        SAFE_NATIVE_CALL_END_N("SHADE.ScriptStore")
+        SAFE_NATIVE_CALL_END_N("SHADE_Managed.ScriptStore")
         return false;
     }
 
@@ -663,14 +757,10 @@ namespace SHADE
 
     bool ScriptStore::isEntityActive(Entity entity)
     {
-        // Get native Entity
-        SHEntity* nativeEntity = SHEntityManager::GetEntityByID(entity);
-
-        // Entity Validity Check
-        if (nativeEntity == nullptr)
+        // Invalid entity
+        if (!EntityUtils::IsValid(entity))
             return false;
 
-        // Check active state
-        return nativeEntity->GetActive();
+        return GameObject(entity).IsActiveInHierarchy;
     }
 }
diff --git a/SHADE_Managed/src/Scripts/ScriptStore.hxx b/SHADE_Managed/src/Scripts/ScriptStore.hxx
index 9aa66fcd..a4c6e824 100644
--- a/SHADE_Managed/src/Scripts/ScriptStore.hxx
+++ b/SHADE_Managed/src/Scripts/ScriptStore.hxx
@@ -233,6 +233,10 @@ namespace SHADE
         /// Executes LateUpdate() for all scripts.
         /// </summary>
         static void ExecuteLateUpdate();
+        /// <summary>
+        /// Executes OnCollision*() and OnTrigger*() for all scripts.
+        /// </summary>
+        static void ExecuteCollisionFunctions();
 
         /*-----------------------------------------------------------------------------*/
         /* Serialisation Functions                                                     */
diff --git a/SHADE_Managed/src/Serialisation/ReflectionUtilities.cxx b/SHADE_Managed/src/Serialisation/ReflectionUtilities.cxx
index f114d01b..4b4e44fc 100644
--- a/SHADE_Managed/src/Serialisation/ReflectionUtilities.cxx
+++ b/SHADE_Managed/src/Serialisation/ReflectionUtilities.cxx
@@ -22,6 +22,7 @@ of DigiPen Institute of Technology is prohibited.
 #include "Math/Vector2.hxx"
 #include "Math/Vector3.hxx"
 #include "Utility/Debug.hxx"
+#include "Engine/GameObject.hxx"
 
 /*-------------------------------------------------------------------------------------*/
 /* Macro Functions                                                                     */
@@ -167,6 +168,11 @@ namespace SHADE
                 fieldNode.push_back(vec.y);
                 fieldNode.push_back(vec.z);
             }
+            else if (fieldInfo->FieldType == GameObject::typeid)
+            {
+                GameObject gameObj = safe_cast<GameObject>(fieldInfo->GetValue(object));
+                fieldNode = gameObj.GetEntity();
+            }
             else // Not any of the supported types
             {
                 Debug::LogWarning(Convert::ToNative(System::String::Format
@@ -242,6 +248,10 @@ namespace SHADE
                 );
             }
         }
+        else if (fieldInfo->FieldType == GameObject::typeid)
+        {
+            fieldInfo->SetValue(object, GameObject(node.as<uint32_t>()));
+        }
         else // Not any of the supported types
         {
             Debug::LogWarning(Convert::ToNative(System::String::Format
diff --git a/TempScriptsFolder/CameraControl.cs b/TempScriptsFolder/CameraControl.cs
new file mode 100644
index 00000000..fc900f46
--- /dev/null
+++ b/TempScriptsFolder/CameraControl.cs
@@ -0,0 +1,22 @@
+using System;
+using SHADE;
+
+namespace SHADE_Scripting
+{
+    public class CameraControl :Script
+    {
+        public float turnSpeed = 0.5f;
+
+        public CameraControl(GameObject go) : base(go) { }
+        protected override void update()
+        {
+            //Camera
+            Camera cam = GetComponent<Camera>();
+            Vector2 mouseVel = Input.GetMouseVelocity();
+
+            cam.Pitch -= mouseVel.y * turnSpeed * (float)Time.DeltaTime;
+            cam.Yaw += mouseVel.x * turnSpeed * (float)Time.DeltaTime;
+
+        }
+    }
+}
diff --git a/TempScriptsFolder/PhysicsTest.cs b/TempScriptsFolder/PhysicsTest.cs
index add5971d..cc01615d 100644
--- a/TempScriptsFolder/PhysicsTest.cs
+++ b/TempScriptsFolder/PhysicsTest.cs
@@ -38,6 +38,35 @@ public class PhysicsTest : Script
             RigidBody.AddForce(Force);
             Debug.Log($"Jump!");
         }
-        Debug.Log($"{Transform.LocalPosition.y}");
+    }
+
+    protected override void fixedUpdate()
+    {
+        Debug.Log("Fixed Update");
+    }
+
+    protected override void onCollisionEnter(CollisionInfo info)
+    {
+        Debug.Log($"Collision Enter: {info.GameObject.Name}");
+    }
+    protected override void onCollisionStay(CollisionInfo info)
+    {
+        Debug.Log($"Collision Stay: {info.GameObject.Name}");
+    }
+    protected override void onCollisionExit(CollisionInfo info)
+    {
+        Debug.Log($"Collision Exit: {info.GameObject.Name}");
+    }
+    protected override void onTriggerEnter(CollisionInfo info)
+    {
+        Debug.Log($"Trigger Enter: {info.GameObject.Name}");
+    }
+    protected override void onTriggerStay(CollisionInfo info)
+    {
+        Debug.Log($"Trigger Stay: {info.GameObject.Name}");
+    }
+    protected override void onTriggerExit(CollisionInfo info)
+    {
+        Debug.Log($"Trigger Exit: {info.GameObject.Name}");
     }
 }
\ No newline at end of file
diff --git a/TempScriptsFolder/PrintWhenActive.cs b/TempScriptsFolder/PrintWhenActive.cs
new file mode 100644
index 00000000..41afdd58
--- /dev/null
+++ b/TempScriptsFolder/PrintWhenActive.cs
@@ -0,0 +1,11 @@
+using SHADE;
+
+public class PrintWhenActive : Script
+{
+    public PrintWhenActive(GameObject gameObj) : base(gameObj) { }
+
+    protected override void update()
+    {
+        Debug.Log("Active!");
+    }
+}
\ No newline at end of file
diff --git a/TempScriptsFolder/ThirdPersonCamera.cs b/TempScriptsFolder/ThirdPersonCamera.cs
new file mode 100644
index 00000000..e3b043bd
--- /dev/null
+++ b/TempScriptsFolder/ThirdPersonCamera.cs
@@ -0,0 +1,55 @@
+using System;
+using System.Collections.Generic;
+using System.Linq;
+using System.Text;
+using System.Threading.Tasks;
+using SHADE;
+
+
+namespace SHADE_Scripting
+{
+    public class ThirdPersonCamera: Script
+    {
+
+        public float armLength = 4.0f;
+        public float turnSpeedPitch = 0.3f;
+        public float turnSpeedYaw = 0.5f;
+        public float pitchClamp = 45.0f;
+        public ThirdPersonCamera(GameObject go) : base(go) { }
+
+        protected override void awake()
+        {
+            if(!GetComponent<Camera>())
+            {
+                AddComponent<Camera>();
+            }
+            if (!GetComponent<CameraArm>())
+            {
+                AddComponent<CameraArm>();
+            }
+            GetComponent<CameraArm>().ArmLength = armLength;
+        }
+
+        protected override void update()
+        {
+            CameraArm arm = GetComponent<CameraArm>();
+            if(arm)
+            {
+                Vector2 vel = Input.GetMouseVelocity();
+                arm.Pitch -= vel.y * turnSpeedPitch * Time.DeltaTimeF;
+                arm.Yaw += vel.x * turnSpeedYaw * Time.DeltaTimeF;
+
+                if(arm.Pitch > pitchClamp)
+                {
+                    arm.Pitch = pitchClamp;
+                }
+                else if(arm.Pitch < -pitchClamp)
+                {
+                    arm.Pitch = -pitchClamp;
+                }
+
+            }
+        }
+
+    }
+}
diff --git a/TempShaderFolder/DeferredCompositeCs.glsl b/TempShaderFolder/DeferredCompositeCs.glsl
deleted file mode 100644
index c1caf0aa..00000000
--- a/TempShaderFolder/DeferredCompositeCs.glsl
+++ /dev/null
@@ -1,83 +0,0 @@
-#version 450
-
-struct DirectionalLightStruct
-{
-  vec3 direction;
-  uint isActive;
-  uint cullingMask;
-  vec4 diffuseColor;
-};
-
-struct AmbientLightStruct
-{
-  vec4 ambientColor;
-  float strength;
-  uint isActive;
-  uint cullingMask;
-};
-
-layout(local_size_x = 16, local_size_y = 16) in;
-layout(set = 4, binding = 0, rgba32f) uniform image2D positions;
-layout(set = 4, binding = 1, rgba32f) uniform image2D normals;
-layout(set = 4, binding = 2, rgba8) uniform image2D albedo;
-layout(set = 4, binding = 3, r32ui) uniform uimage2D lightLayerData;
-layout(set = 4, binding = 4, rgba8) uniform image2D targetImage;
-
-layout(set = 1, binding = 0) uniform LightCounts
-{
-  uint directionalLights;
-  uint pointLights;
-  uint spotLights;
-  uint ambientLights;
-
-} lightCounts;
-
-layout(std430, set = 1, binding = 1) buffer DirectionalLightData
-{
-  DirectionalLightStruct dLightData[];
-} DirLightData;
-
-layout(std430, set = 1, binding = 4) buffer AmbientLightData
-{
-  AmbientLightStruct aLightData[];
-} AmbLightData;
-
-void main()
-{ 
-  // convenient variables
-  ivec2 globalThread = ivec2(gl_GlobalInvocationID);
-
-  // Get the diffuse color of the pixel
-  vec3 pixelDiffuse = imageLoad (albedo, globalThread).rgb;
-
-  // Get position of fragment in world space
-  vec3 positionWorld = imageLoad (positions, globalThread).rgb;
-
-  // normal of fragment
-  vec3 normalWorld = imageLoad(normals, globalThread).rgb;
-
-  vec3 fragColor = vec3 (0.0f);
-
-  for (int i = 0; i < lightCounts.directionalLights; ++i)
-  {
-    // get normalized direction of light 
-    vec3 dLightNormalized = normalize (DirLightData.dLightData[i].direction);
-
-    // Get diffuse strength
-    float diffuseStrength = max (0, dot (dLightNormalized, normalWorld));
-
-    // Calculate the fragment color
-    fragColor += DirLightData.dLightData[i].diffuseColor.rgb * diffuseStrength.rrr * pixelDiffuse;
-  }
-
-  for (int i = 0; i < lightCounts.ambientLights; ++i)
-  {
-    // Just do some add
-    //fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (0.5f);
-    fragColor += pixelDiffuse.rgb * AmbLightData.aLightData[i].ambientColor.rgb * vec3 (AmbLightData.aLightData[i].strength);
-  }
-
-  // store result into result image
-  imageStore(targetImage, ivec2(gl_GlobalInvocationID.xy), vec4(fragColor, 1.0f));
-
-}
\ No newline at end of file
diff --git a/TempShaderFolder/DeferredCompositeCs.spv b/TempShaderFolder/DeferredCompositeCs.spv
deleted file mode 100644
index 03ef7ac5b615ad4dd42a57f4cad2daf5876ceb6a..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 4656
zcmZve33F6M5XT2Ln}i$W^Z+-+0|XJdM3EyVuml$p<noR$yPM6Em)*Ggf?O(Szyoi=
z&*5kALs@E-RsMhPO)q20Np-sW-#y(uJv}ceEFSE0ZjoE+R=8hXzSg+KLY!OXdNW?G
zoU82Wq_ti9_V31Hr7L8P_^gsoQM^Yq6U9voD@3b>gRRMAbh0?@EGW8jzf0*+)^cT{
zJT_LY9G|Gp&Q5gFYe{_~iJSF_THLNz)A&jqzy824ZdQ}ITIf)eN0`5;+)I?Bk+deG
z<otBI9@V6(&i<^nMlw;(Ory;!t!k9Ut>)-RX76<y#b@KI^<*TTnwsk<JNtUvW8zUV
zS+BLwdtFKTY^xKq`BJN$kf5la!2s`gY@2wq)t-rx+>?0QyI3dNw@dm|J8BHKl2$w0
zS8#j8<4i8PL*kXVF`W*#=9+0o74&DAVCP%aYDP)sLf&5eu!o+{w&G^$ErxRko!OSb
z^6tz0x!GuDGOl-b<mWmpJPGm_<v%Q}mc>1joi4s!@AjE~j^tO^t?OLco~x#LZP;1e
z+9gvPI5o$eA%FW1acZv4B^r;$>8Nu#s~LZ4uI1Nd?Nd+t-3j3fYZ!^rNN|=5J1aj!
zZsBfE3e&#qWabY(hHsunN2xa(>9q0`Tupd>PknAy@=(yfhiA@hGFyMUwQ_Fuaqf-<
zmTWlZUf2)(Id|9(?u6M1^IQGI!p4e%lW{Ix33~!Gzw>$FY1D4i)6tozQP){}-2-6>
zb5Mz{)!TXWvgVmLzfAOm2%Yz`Rn!yc1Clul_CfK`j*gv$o%a#i(XrE`ld6Q-X0eZD
z7<Mr78b(gA{s1d@Y`J(@og|*s#;lW@Sk!_}ZWb{|a`8X8!7Mj1&Chc4{WHvRmxK}j
zxOlH<w+J7bOKN6O9~k@aXFkLF(5a97>}NJuw%;(T&uYQX>RTt-{H(rB!pQfLIQ5l8
z_}Cm-eCh+U`k1G%K6L7{S(x|sP!H`t%g!u4Dk48KM?CXK$De#_bpp;XAPpUPy*#bn
zMbbA)*B`kI!(NikEPz4yFU@fM(!!toV8q0qJ0%wQA+Iy@7Jrpwa^k;1zv*X5M6C7V
z=oV{(<UB8DT;k|6c4CE#S~)ZM=>-d4@}u*{Smf9&P7M5sIpFpGiwQ=|t>P?viHSZ4
zpk+Gmj<rK};=hn-&h6A`ITtevW<=Z<rCYz*M_=}eSX-p=*63|W?0Z!hXU0x`blx5q
z_9I?q-#Vc~;=~&frxuGxFE*>&yen*5B%csRCr(+Mm|)~V=M7n&Q(h(}{%6EF59hb@
zT##({c~LTZ$!qpW$%{nP$2+t8d01m1dso<~kN3knBOiaii3dh~=&8rB-|#Z^U}qNQ
zMJ#6Ft~hy!VfS`VvU9hNqGS6}v|42PPm-yZdu7IXgZMz$n5kdH*^6Je$TJ|Kw)@_I
zFSVgR@Yn%;JMd*jS@iEuAw_X~d6P>-^ctOa!vABTURt1UTcGoQl=(A<djg$!!-3Ad
zjs-gYHLo95e)_Od#5=z!eU&&p13Rm#nd>zk6YFA+c#J-c%a3~2itxpDL?`E*VC3OV
zKQ7`uqvOxtQG6z~pV`?W!Uudzonkhh6oEr5^3h-7(>LtI<8Gc3@wP4g(~`sZ&v+kj
zi~p=-aEKMgFG<I4@t>2t-Rso9Llnl}DIFhhi~qc2aEKMg=U%aM7VdPnm$}cqqQ7*~
zed5dy{12V;fcQ%y7WRYU*x}U4eZ4Fq2KUJ<zv8hW^_lO>QPE)$IoN~GF%kH0@);6;
zO~k%qqQB*XzF$Os@*!KkQOV>R(yg8ne_h14hWOYl5BFISVPCFF(NBx$3EwSj^n&>X
zCq6#oA~4g>N~U-BRqHzOH$?b=FINp<=S0NCkMA}<#O5tvv)a!~w%RXBz9h2Rv0V`1
z%Y42m!fto_mdC(ZcDMLb!`mYAjr+5{<1ujPj_T)p?}~_p-Ol))Wais^-j|FYxcN*-
zW^Qi#I3Gv`!`EgCj5%RuxHmZanUhGw*>7n-devi-;_Sx;7S18}kBx5#_lm79PHZ?c
z+7O=>v9QPD*x{D@L&?Oj8NDnS%w{x^%#2$9nb8>$xXox&GW)=pQS>Ph`N@ZDy=qCO
zpO$}4GWnTV?){1=6>%nPaD2J<k44z+-miKLoMrcJcXdq|`S7!R*CkuN8<KB|EFU&{
zjxTfbi3q#R&8Hp%hb+%$lF5agz0A@rQ8*K~J%+E%1Q_?i9nmMa)%m$(>a>~oLNb`m
z1U9hn-sv~{H;La7&3k>B_?My;qA~UPuJ~6T1831YW}r{}YY}!k%Quoa3x9{`%eNvh
pmSNvX1|yDP-+OGa__!i-hd+qek3aT%qN?&zFL|;5qbLVO{{oeIr1Jm(

diff --git a/TempShaderFolder/TestCubeFs.spv b/TempShaderFolder/TestCubeFs.spv
deleted file mode 100644
index 2381b8347c412e9f822330db717bd1f1e41c24b0..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 2536
zcmZ9M-*Xg25XUFnU5Meg2#84BB#1xIh%q3FAi>1r@GMfsQs1^Vw?i_z**$mnQsmJ$
z{~-0nH~%VMtn&NWn+XeD)z{tM?&<07>AlXe<>SW8n0a%`d}F3`&KwhB4D!#{rt&W@
z|CXFLb7p(%hj{a+@8i@~qtcD*qKsXh+Gj4`H7Cq$bG|>^9<Ee%y0UibCYev0PICdd
z&zO^@D+%u>F30hT_>}m(_>%a#ctiY1d{$?PRk6}Ks?3;wl&Gsy{b9WR-NU%D<D^V#
z8&`WtYRkCT`Pq)@>ctqjRAQVZ`R*jywei~O&2cjNMS14PLrZy)PjdIPDEH%ECrRd>
zI$O#=kH7!qNq@K*kH+J;st+?8XD+vK>Pp?@4lH*yd3>D9N7*E82lN!t?zv}rP2c09
za<wa(IrP-u3H1lf${+LtTh?1eC9K<E%yDw?JcgO%Dm%%HPIa1D4wR8Qnd#J5H8%52
zvK^Zi_<QC}*|mLEPfDwaO|b>ZZ<BhfEXEs2oiw$8L8BroO37Kh2pF~a^8@xk=21L#
zCE0i{X<=-_j#W}oPdOq<-DOLcWL&6L9hJ~OJ}9LK5&bMl`r2f7%rzV$>IwS3&ld_}
zZun-z)}=?W)R(#4y?U4&+Hx9APWEq*uPT49*~4N|Z|1eD4+k4UjyHSx!Z|l;hS%3U
z>~feDHhbN+c@J#nfS>okW;d{T4|;@xy(pd9AL;gxYncF1!0>~eZDI5Wrcd`Mj(fo(
zG5Oz;oE7t-k}Hygh=Ka5G?L^T@ze&l?M2xTvCQstqjwwqd9NL_BK!{(Lmc-7{o^CO
z+svCYGh*)JKLDFv&g&PssPo*9eo-3rN8(G0=YIm5c}Du3lOz`WuD5w3FyiMWi6_^B
z`sbS?792^Alakbfj~v*%E7%3u^c#8mhPThihB(ig5ZkVSJ)njV&l^!gsFA(Ee_0##
zx+FD{qfNoSqR7i~5O-Dj8<N=EeMJ%iBR4iX2GRdjNpf@7f;47Lo%95bpPcLoz6I%#
zBsTdMC8;|SlOKCY490AhB_lD!eEAN^4L<dC&D+vv#Q4a8ecfZ+@s8Iy7v}YT%YQ>U
z_f6lSYd(?=g&C|$CqHjWzB`h{hxfhbZTiLkm1IXuebj@!;W7N1(#hBMv!|T7tscqE
z{y|{>3h7C%>z7?PCuV=xk$Z}yj#tIt_jQ8(#18Qnq!Z7Mg!qfn!HH*=u!(0@?~0jU
z$j@Bf^Z2@MV_qMKm&C;2W1i$D_CqoLZEvr5jQq@&Z<iec=L~b^8wMwad4D3N=8%`!
zuX+4O#nAIDG3UTT?YE`BT>GcOz^R?L`%D~a#~1n}=jYxZ^4*pFa=tHwfs>E7zb_8?
z@P#?E4_|u!mSV~Oz+>QnfA{^Y3*-I=;@>>>P&$3$<E{9v!KjZt`dUnVVNUE+-{Zuy
bci16*Af5P7Bk_;L;KZ|s*#Bum?}+~g6b;v3

diff --git a/TempShaderFolder/TestCubeVs.spv b/TempShaderFolder/TestCubeVs.spv
deleted file mode 100644
index d8c3c3d072f76728073803b4f4baa5c981426184..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 3296
zcmZ9O>2@1M5QW>;;t(f+5V8QlNH$BrV74R#LKfpiHYk>Y9kWMtq=_;x8tIJ2CgB&a
z0FT5|@rQG`-^`RVC+$<Gt8U$@uCA_8Qkh+vb8f~RcPHK0<?FPY72@2yt7m(wz1v=y
zrh}EsS3ZPs%2hHVoagn&s!B#ajM0xvPD);qyeYXPc~A1GWK(iq0<ogMS?&KQQB_f`
zcCXdxwAvfJ{$$ddrca`v7lm=q8-z*FPs76i-mwxdjQi2SpiHQVQLd$?GmhyDR^81V
z=_8*8N$8{Pco00!d}O8*&IRG%h)aD@IDC}0{gWWc*_^>0I|u2<+FVU}x$iLQZO7Bp
z$Nj+4%2&(!5XNaR43c%9dLb3JM4(n(mg$E<l6J>aVbu(ymV?8m9BPTj$;d~XS;=~<
z8l=~=9{)a0qQPF`<LN`O;MB6d`+X%29+NtY;~o6Hed*QgJ^W6dlsrGlr+ajRBoC4)
zG{@2Lji+H6j$@&78J{{cT$kJp|IjPty(Skm%eNMVll3s~%~2dvgzq4Vj(psU`Cw6h
zPy3o51&PmEm(>Esnph#y=_5F`98T`|R6Frrd%qM9#_ah$9}j~VnrjvBxgedIuzAmU
z$#P*c%lMfQ{LD2r3!53oX7;d|_p+a!V^be~z5{Ifv!$Bo6^k=jhQSA8H;foCYBdZU
zEI+@J<+I$@uO<0eTVh$SYMK4CcW_>K2Gb8jhP8AeapdI=^mg$XyD6K6pFVR(YCEGS
z;+nFs(a(xg*WQqDKWxszW-X{M^cxO%?yI`zq>}^Rb;V%wJ%TM4IjxTk*(ZdPpFHrf
zd0#O6{DKjS-{Mb8$A4b_7qxRXHN!un9UnOPu$d1q;^Cf^u;8E5j?e0USvu!o+j*}_
zC%?sClupb!F&o+uYH1ca?~J`z*u>JWCGBv)b8gkWA)WK^Q7<<03wA;FTiW50lX~CQ
zJ|h8#kIj68apt?)8xrE-FKfpK4j-HO2je~s?JE-J{=5bMvNU3w66~wm;Zig4*nBTw
z_&?JQA3ycp)XrI8cHX9R<8K$fhIZ@cj&yo-QSm=&Z)7?>%YWON1%@y8SKZIjIfHML
zbFl9h*n(`n1>)!vb^fBAGr-|vdkGl+2Ze5ZrB8e#Gm@)%J9xYSi*x@K!uNSYXkGg$
z33IzDl$qr_W$u~vn~K1OgP)l@FJUg3MRG827bM_tn8Q~j<Y3;(fepuUye6F-%%kPt
zn+CTWuS+KfGfWO_IPkgaI}+vxn|FI(!hGCS4GrxdNWfTz@gEH^dSlo}1xBB`x=m9%
z{{RyYAODKvFXhGeiG;J^P%CqHMZ)Y`&#>W9+oJYs5@ruRbN9IfzV!zij@|9LbnbRS
zFT`EHkWe$Z@a+{nxFH=MccHdh5-?Urzhv~~wgenuk%zll%&K%^z%AxW>EH+pUpZz?
zHZfopvo0MRVOdO9ci`LFkldD#8?L=uOZujS{!;Ij1TOfhV)^dAlF%<^fw`mhhW4)|
z@L9|VJTQxEOSd>?&EoDzCypA4g9m1D9qAUgBi-V<(uw2V#K8lzIk+p`;<#T^_BRr6
z>(g$5fwQbnyfydVE3ggiaIL0$(k*wn2m8W_VNnx2FpK+Ey2X`y@SSiwi#T{-7WaKA
zuH1tkia6^5JTQ9jKzm=}CCs+X^Ps@Z4rE`F{H++~`=JC5xXr~-dii^PBpZxn?-5D|
sqlbq5T42;?-}7(MiHDEB{5?mqIUkO_<48Kc$@3C=gAMOLopep|Kcj>49{>OV

diff --git a/bin/Debug/SHADE_CSharp.xml b/bin/Debug/SHADE_CSharp.xml
new file mode 100644
index 00000000..daeaa3c5
--- /dev/null
+++ b/bin/Debug/SHADE_CSharp.xml
@@ -0,0 +1,1029 @@
+<?xml version="1.0"?>
+<doc>
+    <assembly>
+        <name>SHADE_CSharp</name>
+    </assembly>
+    <members>
+        <member name="T:SHADE.ICallbackAction">
+            <summary>
+            Interface for a CallbackAction that all variants inherit from.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.IsRuntimeAction">
+            <summary>
+            Whether or not this CallbackAction is runtime assigned. If it is, then the
+            TargetMethodName and TargetObject properties are invalid.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.TargetMethodName">
+            <summary>
+            Name of the method that this CallbackAction is using.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.TargetObject">
+            <summary>
+            Object which the specified target method is called on.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`1">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 1 parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Action{`0})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.Invoke(`0)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`2">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 2 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Action{`0,`1})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.Invoke(`0,`1)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`3">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 3 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Action{`0,`1,`2})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.Invoke(`0,`1,`2)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`4">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 4 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Action{`0,`1,`2,`3})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.Invoke(`0,`1,`2,`3)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`5">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 5 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Action{`0,`1,`2,`3,`4})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.Invoke(`0,`1,`2,`3,`4)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`6">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 6 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Action{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.Invoke(`0,`1,`2,`3,`4,`5)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`7">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 7 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.Invoke(`0,`1,`2,`3,`4,`5,`6)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`8">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 8 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.Invoke(`0,`1,`2,`3,`4,`5,`6,`7)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`9">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 9 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`10">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 10 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8,`9)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.ICallbackEvent">
+            <summary>
+            Interface for a CallbackEvent that all variants inherit from.
+            </summary>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.RegisterAction">
+            <summary>
+            Registers an empty ICallbackAction.
+            </summary>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.RegisterAction(SHADE.ICallbackAction)">
+            <summary>
+            Registers an ICallbackAction with the event such that it will be called in
+            future
+            </summary>
+            <param name="action">ICallbackAction to register with.</param>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.DeregisterAction(SHADE.ICallbackAction)">
+            <summary>
+            Deregisters an ICallbackAction that was previously added. This should
+            only emit a warning if an action that was not previous added was 
+            provided.
+            </summary>
+            <param name="action">ICallbackAction to remove.</param>
+        </member>
+        <member name="P:SHADE.ICallbackEvent.Actions">
+            <summary>
+            Iterable set of ICallbackActions that were registered to this event.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`1">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`1.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(SHADE.CallbackAction{`0})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(System.Action{`0})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.Invoke(`0)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`2">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`2.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(SHADE.CallbackAction{`0,`1})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(System.Action{`0,`1})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.Invoke(`0,`1)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`3">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`3.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(SHADE.CallbackAction{`0,`1,`2})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(System.Action{`0,`1,`2})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.Invoke(`0,`1,`2)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`4">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`4.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(System.Action{`0,`1,`2,`3})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.Invoke(`0,`1,`2,`3)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`5">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`5.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(System.Action{`0,`1,`2,`3,`4})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.Invoke(`0,`1,`2,`3,`4)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`6">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`6.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.Invoke(`0,`1,`2,`3,`4,`5)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`7">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`7.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.Invoke(`0,`1,`2,`3,`4,`5,`6)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`8">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`8.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.Invoke(`0,`1,`2,`3,`4,`5,`6,`7)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`9">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`9.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`10">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`10.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8,`9)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+    </members>
+</doc>
diff --git a/bin/Debug/SHADE_Managed.xml b/bin/Debug/SHADE_Managed.xml
new file mode 100644
index 00000000..7b653116
--- /dev/null
+++ b/bin/Debug/SHADE_Managed.xml
@@ -0,0 +1,6250 @@
+<?xml version="1.0"?>
+<doc>
+    <assembly>
+        "SHADE_Managed"
+    </assembly>
+    <members>
+        <member name="M:SHADE.Input.GetMouseReleasedTime(SHADE.Input.MouseCode)">
+            <summary>
+Retrieves the duration that the specified key has not been held or was last
+not been held for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseHeldTime(SHADE.Input.MouseCode)">
+            <summary>
+Retrieves the duration that the specified key has been held or was last held
+for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyReleasedTime(SHADE.Input.KeyCode)">
+            <summary>
+Retrieves the duration that the specified key has not been held or was last
+not been held for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyHeldTime(SHADE.Input.KeyCode)">
+            <summary>
+Retrieves the duration that the specified key has been held or was last held
+for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.SetMousePosition(SHADE.Vector2)">
+            <summary>
+Sets the position of the mouse cursor relative to the top left corner of the
+window.
+</summary>
+            <param name="pos">
+Position of the mouse in window pixel coordinates to set.
+</param>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButtonUp(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is no longer pressed and was pressed
+before.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>
+True during the frame the user releases the given mouse button.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButtonDown(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is pressed and was not pressed before.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>
+True during the frame the user pressed the given mouse button.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButton(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is being held down.
+This will also be true if GetMouseButtonDown() is true.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>True while the user holds down the mouse button specified.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyUp(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is no longer pressed pressed and was pressed
+before.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>
+True during the frame the user releases the key identified by name.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyDown(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is pressed and was not pressed before.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>
+True during the frame the user starts pressing down the key specified.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKey(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is being held down.
+This will also be true if GetKeyDown() is true.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>True while the user holds down the key specified.</returns>
+        </member>
+        <member name="P:SHADE.Input.MouseScrollDelta">
+            <summary>
+Amnount of vertical mouse scroll in this frame.
+</summary>
+        </member>
+        <member name="P:SHADE.Input.MousePosition">
+            <summary>
+Mouse position in screen coordinates relative to the top left of the window.
+This value is a Vector3 for compatibility with functions that have Vector3 
+arguments. The z component of the Vector3 is always 0
+</summary>
+        </member>
+        <member name="T:SHADE.Input.MouseCode">
+            <summary>
+Represents the available supported mouse keycodes that can be passed into the 
+mouse-button-based Input functions.
+</summary>
+        </member>
+        <member name="T:SHADE.Input.KeyCode">
+            <summary>
+Represents the available supported keycodes that can be passed into the 
+key-based Input functions.
+
+Attempting to follow https://docs.unity3d.com/ScriptReference/KeyCode.html
+Win32 keycodes are shift-insensitive, i.e. 'A' and 'a' are the same keycode and '1' and '!' are the same keycode
+</summary>
+        </member>
+        <member name="T:SHADE.Input">
+            <summary>
+Static class responsible for providing access to Input-related functionality.
+</summary>
+        </member>
+        <member name="T:SHADE.SerializeField">
+            <summary>
+Simple attribute to mark that a field in a Script should be serialised.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.Exit">
+            <summary>
+Cleans up all required components for managed code.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.ReloadScriptAssembly">
+            <summary>
+Reloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+Equivalent to calling UnloadScriptAssembly() and then LoadScriptAssembly().
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.LoadScriptAssembly">
+            <summary>
+Loads the managed script assembly. Ensure this is only called after
+UnloadScriptAssembly() has been called.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.UnloadScriptAssembly">
+            <summary>
+Unloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.Init">
+            <summary>
+Initialises all required components for managed code.
+</summary>
+        </member>
+        <member name="F:SHADE.EngineInterface.ManagedLibraryName">
+            <summary>
+Name of the Managed Library that contains the C# scripts written externally.
+</summary>
+        </member>
+        <member name="T:SHADE.EngineInterface">
+            <summary>
+Static class that contains the functions for interfacing with the core
+PlushieEngine written in C++ for managing the lifecycle of managed code.
+</summary>
+        </member>
+        <member name="M:SHADE.DisposableAssemblyLoadContext.#ctor">
+            <summary>
+Default Constructor
+</summary>
+        </member>
+        <member name="T:SHADE.DisposableAssemblyLoadContext">
+            <summary>
+Custom AssemblyLoadContext marked as collectible so that it can be unloaded.
+</summary>
+        </member>
+        <member name="P:SHADE.Time.FixedDeltaTime">
+            <summary>
+Time taken for Physics simulations. You should use this for operations 
+within Script.FixedUpdate()
+</summary>
+        </member>
+        <member name="P:SHADE.Time.DeltaTime">
+            <summary>
+Time taken to process the previous frame.
+</summary>
+        </member>
+        <member name="T:SHADE.Time">
+            <summary>
+Static class that contains the functions for working with time.
+</summary>
+        </member>
+        <member name="T:SHADE.SHPhysicsSystemInterface">
+            <summary>
+Static class that wraps up certain functions in the SHPhysicsSystem so that 
+accessing it from SHADE_Managed would not cause issues due to C++20 features.
+</summary>
+        </member>
+        <member name="M:SHADE.TooltipAttribute.#ctor(System.String)">
+            <summary>
+Constructor for a Tooltip attribute that fills in the description.
+</summary>
+            <param name="description">Text to be shown when a field is hovered.</param>
+        </member>
+        <member name="P:SHADE.TooltipAttribute.Description">
+            <summary>
+Description that is to be shown in the Tooltip.
+</summary>
+        </member>
+        <member name="T:SHADE.TooltipAttribute">
+            <summary>
+Simple attribute to provide a field in a script with a tooltip.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.fileExists(std.filesystem.path!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Checks if a specified file exists.
+</summary>
+            <param name="filePath">File path to the file to check.</param>
+            <returns> True if the file exists </returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.deleteFolder(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deletes the folder and all files in it as specified by the file path.
+</summary>
+            <param name="filePath">File path to the file to delete.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.deleteFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deletes the file as specified by the file path.
+</summary>
+            <param name="filePath">File path to the file to delete.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.dumpBuildLog(std.basic_string_view&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Reads the file via the specified path that represents a build log of error
+and warning messages.
+</summary>
+            <param name="buildLogPath">
+File path to the build log of script builds done by BuildScriptAssembly() to
+dump and process.
+</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.registerEvents">
+            <summary>
+Registers events for the scripting system
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.loadFunctions">
+            <summary>
+Loads all the function pointers to CLR code that we need to execute.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.GenerateScriptsCsProjFile(std.filesystem.path!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Generates a .csproj file for editing and compiling the C# scripts.
+</summary>
+            <param name="path">File path to the generated file.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.BuildScriptAssembly(System.Boolean,System.Boolean)">
+            <summary>
+Utilises execution of a external batch file for invoking the dotnet build
+tool to compile C# scripts in the Assets folder into the SHADE_Scripting
+C# assembly DLL.
+</summary>
+            <param name="debug">
+Whether or not a debug build will be built. Only debug built C# assemblies
+can be debugged.
+</param>
+            <param name="reload">
+Whether or not we are reloading the assembly, if so, unload and then reload it.
+</param>
+            <returns>Whether or not the build succeeded.</returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RedoScriptInspectorChanges">
+            <summary>
+Performs a redo for script inspector changes if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.UndoScriptInspectorChanges">
+            <summary>
+Performs an undo for script inspector changes if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RenderScriptsInInspector(System.UInt32)">
+            <summary>
+Renders the set of attached Scripts for the specified Entity into the
+inspector. 
+<br />
+This function is meant for consumption from native code in the inspector
+rendering code.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.DeserialiseScripts(System.UInt32,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates scripts and sets fields for the specified Entity based on the specified 
+YAML node.
+</summary>
+            <param name="entity">The Entity to deserialise a Script on to.</param>
+            <param name="scriptsNode">
+YAML Node that contains the serialised script data.
+</param>
+            <return>True if successfully deserialised.</return>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.SerialiseScripts(System.UInt32,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Performs serialization of all scripts for the specified entity into the
+YAML::Node specified. This node will contain all serialised scripts after
+calling this function.
+</summary>
+            <param name="entity">The Entity to Serialise.</param>
+            <param name="scriptsNode">
+YAML Node that will store the serialised scripts.
+</param>
+            <return>True if successfully serialised.</return>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RemoveAllScriptsImmediately(System.UInt32,System.Boolean)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Unlike
+RemoveAllScripts(), this removes all the scripts immediately.
+Does not do anything if the specified Entity is invalid or does not have any
+Scripts attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+            <param name="callOnDestroy">
+Whether or not to call OnDestroy on the scripts. This is ignored if not in
+play mode.
+</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RemoveAllScripts(System.UInt32)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Does not do anything
+if the specified Entity is invalid or does not have any Scripts
+attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.AddScript(System.UInt32,std.basic_string_view&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Adds a Script to a specified Entity. Note that while you can call this
+multiple times on a specified Entity, it will work for all intents and
+purposes but GetScript&lt;T&gt;() (C# only) currently only
+gives you the first Script added of the specified type.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">Type name of the script to add.</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.Exit">
+            <summary>
+Shuts down the DotNetRuntime.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ExecuteCollisionFunctions">
+            <summary>
+Executes the OnCollision*()s and OnTrigger*()s of the Scripts that are attached 
+to Entities.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ExecuteFixedUpdates">
+            <summary>
+Executes the FixedUpdate()s of the Scripts that are attached to
+Entities.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ReloadScriptAssembly">
+            <summary>
+Reloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.LoadScriptAssembly">
+            <summary>
+Unloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.UnloadScriptAssembly">
+            <summary>
+Loads the managed script assembly. Ensure this is only called after
+UnloadScriptAssembly() has been called.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.Init">
+            <summary>
+Initialises the DotNetRuntime and retrieves function pointers to all
+functions on the CLR used to interface with the engine.
+</summary>
+        </member>
+        <member name="T:SHADE.SHScriptEngine">
+            <summary>
+Manages initialisation of the DotNetRuntime and interfacing with CLR code written
+and executed on .NET.
+</summary>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.Deserialise(System.Object,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deserialises a YAML node that contains a map of Scripts and copies the 
+deserialised data into the specified object if there are matching fields.
+</summary>
+            <param name="yamlNode">
+The JSON string that contains the data to copy into this Script object.
+</param>
+            <param name="object">The object to copy deserialised data into.</param>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.Serialise(System.Object,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a JSON node that represents the specified object and its associated
+serialisable fields. Public fields and fields marked with the SerialiseField
+attribute will be serialised.
+</summary>
+            <param name="object">The object to serialise.</param>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.FieldIsSerialisable(System.Reflection.FieldInfo)">
+            <summary>
+Checks if a specified field is a candidate for serialisation. This means that
+the field is public or private with the [SerialiseField] attribute.
+</summary>
+            <param name="fieldInfo">The field to check.</param>
+            <returns>
+True if the specified field is a candidate for serialisation.
+</returns>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.GetInstanceFields(System.Object)">
+            <summary>
+Retrieves a set of all non-static (instance) fields from a specified object.
+</summary>
+            <param name="object">The object to get non-static fields from.</param>
+            <returns>Immutable list of non-static fields.</returns>
+        </member>
+        <member name="T:SHADE.ReflectionUtilities">
+            <summary>
+Contains useful static functions for working with Reflection.
+</summary>
+        </member>
+        <member name="M:YAML.Dump(YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Converts the node to a YAML string. 
+</member>
+        <member name="M:YAML.op_LeftShift(std.basic_ostream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Emits the node to the given output stream. 
+</member>
+        <member name="M:YAML.op_LeftShift(YAML.Emitter*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Emits the node to the given {@link Emitter}. If there is an error in writing,
+{@link Emitter#good} will return false.
+
+</member>
+        <member name="M:YAML.LoadAllFromFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input file as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+ @throws {@link BadFile} if the file cannot be loaded.
+
+</member>
+        <member name="M:YAML.LoadAll(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input stream as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadAll(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+ Loads the input string as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadAll(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input string as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input file as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+ @throws {@link BadFile} if the file cannot be loaded.
+
+</member>
+        <member name="M:YAML.Load(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input stream as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Load(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+ Loads the input string as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Load(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input string as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Parser.HandleTagDirective(YAML.Token!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Handles a "TAG" directive, which should be of the form 'handle prefix',
+where 'handle' is converted to 'prefix' in the file.
+
+</member>
+        <member name="M:YAML.Parser.HandleYamlDirective(YAML.Token!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Handles a "YAML" directive, which should be of the form 'major.minor' (like
+a version number).
+
+</member>
+        <member name="M:YAML.Parser.ParseDirectives">
+Reads any directives that are next in the queue, setting the internal
+{@code m_pDirectives} state.
+
+</member>
+        <member name="M:YAML.Parser.HandleNextDocument(YAML.EventHandler*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Handles the next document by calling events on the {@code eventHandler}.
+
+ @throw a ParserException on error.
+ @return false if there are no more documents
+
+</member>
+        <member name="M:YAML.Parser.Load(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Resets the parser with the given input stream. Any existing state is
+erased.
+
+</member>
+        <member name="M:YAML.Parser.op_Explicit~System.Boolean">
+Evaluates to true if the parser has some valid input to be read. 
+</member>
+        <member name="M:YAML.Parser.#ctor(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Constructs a parser from the given input stream. The input stream must
+live as long as the parser.
+
+</member>
+        <member name="M:YAML.Parser.#ctor">
+Constructs an empty parser (with no input. 
+</member>
+        <member name="T:YAML.Parser">
+A parser turns a stream of bytes into one stream of "events" per YAML
+document in the input stream.
+
+</member>
+        <member name="M:SHADE.Editor.renderScriptContextMenu(System.UInt32,SHADE.Script)">
+            <summary>
+Renders a context menu when right clicked for the scripts
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+            <param name="script">The Script to render the inspector for.</param>
+        </member>
+        <member name="M:SHADE.Editor.renderFieldInInspector(System.Reflection.FieldInfo,System.Object)">
+            <summary>
+Renders a field specified into the inspector.
+</summary>
+            <param name="field">The field to render.</param>
+            <param name="object">
+The object that contains the data of the field to render.
+</param>
+        </member>
+        <member name="M:SHADE.Editor.renderScriptInInspector(System.UInt32,SHADE.Script,System.Int32)">
+            <summary>
+Renders a single specified Script's inspector.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+            <param name="script">The Script to render the inspector for.</param>
+            <param name="index">
+Indices used internally to differentiate each rendered Script
+inspector. This is required to open and close each Script's inspector
+independently from each other.
+</param>
+        </member>
+        <member name="M:SHADE.Editor.Redo">
+            <summary>
+Redoes the last script inspector change if there is any.
+</summary>
+        </member>
+        <member name="M:SHADE.Editor.Undo">
+            <summary>
+Undoes the last script inspector change if there is any.
+</summary>
+        </member>
+        <member name="M:SHADE.Editor.RenderScriptAddButton(System.UInt32)">
+            <summary>
+Renders a dropdown button that allows for the addition of PlushieScripts
+onto the specified Entity.
+</summary>
+            <param name="entity">The Entity to add PlushieScripts to.</param>
+        </member>
+        <member name="M:SHADE.Editor.RenderScriptsInInspector(System.UInt32)">
+            <summary>
+Renders the set of attached Scripts for the specified Entity into the
+inspector. 
+<br />
+This function is meant for consumption from native code in the inspector
+rendering code.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+        </member>
+        <member name="T:SHADE.Editor">
+            <summary>
+Static class for Editor-related functions
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.DeserialiseScripts(System.UInt32,System.IntPtr)">
+            <summary>
+Processes a YAML node that contains a list of multiple scripts to be loaded
+into the specified Entity.
+<br /><br />
+This function should only be called from native unmanaged code.
+</summary>
+            <param name="entity">
+The Entity to attach the deserialised Scripts to.
+</param>
+            <param name="yaml">
+Pointer to the YAML::Node that contains serialized script data.
+</param>
+            <returns />
+        </member>
+        <member name="M:SHADE.ScriptStore.SerialiseScripts(System.UInt32,System.IntPtr)">
+            <summary>
+Populates a YAML node with the scripts for a specified Entity.
+<br /><br />
+This function should only be called from native unmanaged code.
+</summary>
+            <param name="entity">The Entity to Serialise.</param>
+            <param name="yamlNode">
+Pointer to a YAML::Node that will be populated with all of the serialised
+scripts and their associated fields.
+</param>
+            <returns>
+True if serialisation is successful. False if the buffer is too small for
+the serialised output.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteCollisionFunctions">
+            <summary>
+Executes OnCollision*() and OnTrigger*() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteLateUpdate">
+            <summary>
+Executes LateUpdate() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteUpdate">
+            <summary>
+Executes Update() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteFixedUpdate">
+            <summary>
+Executes FixedUpdate() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetAvailableScriptList">
+            <summary>
+Retrieves a immutable list of available scripts that can be added.
+</summary>
+            <returns>Immutable list of available scripts that can be added.</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.Exit">
+            <summary>
+Cleans up data stored in the ScriptStore to free up memory for garbage
+collection.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.FrameCleanUp">
+            <summary>
+Cleans up scripts that were marked for deletion. This calls the OnDestroy()
+for these Scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.FrameSetUp">
+            <summary>
+Sets up scripts that were marked for initialization. This calls the Awake()
+and Start() for Scripts that have yet to have done so.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.Init">
+            <summary>
+Initializes the ScriptStore to allocate and pre-populate reflection data.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveAllScriptsImmediately(System.UInt32,System.Boolean)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Unlike
+RemoveAllScripts(), this removes all the scripts immediately.
+Does not do anything if the specified Entity is invalid or does not have any
+Scripts attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+            <param name="callOnDestroy">
+Whether or not to call OnDestroy on the scripts.This is ignored if not in
+play mode.
+</param>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveAllScripts(System.UInt32)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Does not do anything
+if the specified Entity is invalid or does not have any Scripts
+attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveScript(System.UInt32,SHADE.Script)">
+            <summary>
+Removes a specific script from the 
+</summary>
+            <param name="entity">The entity to remove the script from.</param>
+            <param name="script">The script to remove.</param>
+            <returns>True if successfully removed. False otherwise.</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveScript``1(System.UInt32)">
+            <summary>
+Removes all Scripts of the specified type from the specified Entity.
+</summary>
+            <typeparam name="T">
+Type of script to remove.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">The entity to remove the script from.</param>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetAllScripts(System.UInt32)">
+            <summary>
+Retrieves an immutable list of all scripts attached to a specified Entity.
+</summary>
+            <param name="entity">
+The entity which the scripts to retrieve are attached.
+</param>
+            <returns>
+Immutable list of references to scripts attached to the specified Entity.
+This can also be null if there are no scripts at all or an invalid Entity
+was specified.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScripts``1(System.UInt32)">
+            <summary>
+Retrieves a immutable list of scripts from the specified Entity that
+matches the specified type.
+<br />
+Note that this function allocates. It should be used sparingly.
+</summary>
+            <typeparam name="T">
+Type of scripts to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the scripts to retrieve are attached.
+</param>
+            <returns>
+Immutable list of references to scripts of the specified type.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScriptInChildren``1(System.UInt32)">
+            <summary>
+Retrieves the first Script from the specified Entity's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the script to retrieve is attached.
+</param>
+            <returns>
+Reference to the script. This can be null if no script of the specified
+type is attached.
+</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScript``1(System.UInt32)">
+            <summary>
+Retrieves the first Script from the specified Entity that matches the
+specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the script to retrieve is attached.
+</param>
+            <returns>
+Reference to the script. This can be null if no script of the specified
+type is attached.
+</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScriptViaNameWithRef(System.UInt32,System.String,SHADE.Script@)">
+            <summary>
+Adds a Script to a specified Entity.
+<br />
+This function is meant for consumption from native code or for serialisation
+purposes. If you are writing in C# or C++/CLI and not doing serialisation,
+use AddScript&lt;T&gt;() instead as it is faster.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">The entity to add a script to.</param>
+            <param name="createdScript">
+Out parameter handle to the Script that was created.
+</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScriptViaName(System.UInt32,System.String)">
+            <summary>
+Adds a Script to a specified Entity.
+<br />
+This function is meant for consumption from native code. If you are writing
+in C# or C++/CLI, use AddScript&lt;T&gt;() instead as it is faster.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">The entity to add a script to.</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScript``1(System.UInt32)">
+            <summary>
+Adds a Script to a specified Entity.
+</summary>
+            <typeparam name="T">
+Type of script to add.
+This needs to be a default constructable PlushieScript.
+</typeparam>
+            <param name="entity">The entity to add a script to.</param>
+            <returns>Reference to the script added.</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="T:SHADE.ScriptStore">
+            <summary>
+Responsible for managing all scripts attached to Entities as well as executing 
+all lifecycle functions of scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.Color.op_Inequality(SHADE.Color,SHADE.Color)">
+            <summary>
+Checks if two Colors are not approximately equal.
+</summary>
+            <param name="lhs">Color to compare.</param>
+            <param name="rhs">Another Color to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Equality(SHADE.Color,SHADE.Color)">
+            <summary>
+Checks if two Colors are approximately equal.
+</summary>
+            <param name="lhs">Color to compare.</param>
+            <param name="rhs">Another Color to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Division(SHADE.Color,System.Single)">
+            <summary>
+Calculates the division of a Color with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Color to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Multiply(SHADE.Color,System.Single)">
+            <summary>
+Calculates the multiplication of a Color with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Color to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Multiply(SHADE.Color,SHADE.Color)">
+            <summary>
+Calculates the component-wise multiplication of two Colors and returns the
+result.
+</summary>
+            <param name="lhs">Color to multiply with.</param>
+            <param name="rhs">Another Color to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Subtraction(SHADE.Color,SHADE.Color)">
+            <summary>
+Subtracts a Color from another Color and returns the result.
+</summary>
+            <param name="lhs">Color to subtract from.</param>
+            <param name="rhs">Another Color to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Addition(SHADE.Color,SHADE.Color)">
+            <summary>
+Adds two Colors together and returns the result.
+</summary>
+            <param name="lhs">Color to add.</param>
+            <param name="rhs">Another Color to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Color.LerpUnclamped(SHADE.Color,SHADE.Color,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="colA">The start Color, returned when t = 0.0.</param>
+            <param name="colB">The end Color, returned when t = 1.0.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Color.</returns>
+        </member>
+        <member name="M:SHADE.Color.Lerp(SHADE.Color,SHADE.Color,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="colA">The start Color, returned when t = 0.0.</param>
+            <param name="colB">The end Color, returned when t = 1.0.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Color.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Color.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Color.Equals(SHADE.Color)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="F:SHADE.Color.a">
+            <summary>
+Alpha component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.b">
+            <summary>
+Blue component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.g">
+            <summary>
+Green component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.r">
+            <summary>
+Red component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+            <param name="_blue">Blue component to set.</param>
+            <param name="_alpha">Alpha component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+            <param name="_blue">Blue component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+blue and alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+green, blue and alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Yellow">
+            <summary>
+Pure yellow, mix of pure red and green.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Magenta">
+            <summary>
+Pure magenta, mix of pure red and blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Cyan">
+            <summary>
+Pure cyan, mix of pure green and blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Blue">
+            <summary>
+Pure blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Green">
+            <summary>
+Pure green.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Red">
+            <summary>
+Pure red.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.White">
+            <summary>
+Pure white.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.DarkGray">
+            <summary>
+Dark Gray, darker than gray.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Gray">
+            <summary>
+Gray, halfway between black and white.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.LightGray">
+            <summary>
+Light Gray, lighter than gray.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Black">
+            <summary>
+Pure black.
+</summary>
+        </member>
+        <member name="T:SHADE.Color.Defaults">
+            <summary>
+A static class that contains a set of default Colors.
+</summary>
+        </member>
+        <member name="T:SHADE.Color">
+            <summary>
+CLR version of the the SHADE Engine's Color struct which describes a Color
+encoded using floating point numbers that range from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Button(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a inline button widget.
+<br />
+Wraps up ImGui::Button().
+</summary>
+            <param name="title">Text to display.</param>
+            <returns>True if button was pressed.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.SmallButton(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a small inline button widget.
+<br />
+Wraps up ImGui::SmallButton().
+</summary>
+            <param name="title">Text to display.</param>
+            <returns>True if button was pressed.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Text(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a visual text widget.
+<br />
+Wraps up ImGui::Text().
+</summary>
+            <param name="title">Text to display.</param>
+        </member>
+        <member name="M:SHADE.SHEditorUI.MenuItem(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a menu item in the list of items for a mini popup.
+<br />
+Wraps up ImGui::MenuItem().
+</summary>
+            <param name="label">Label used to identify this widget.</param>
+            <returns>Whether or not the menu item was selected.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.OpenPopup(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Opens the popup that was defined with the specified label.
+<br />
+Wraps up ImGui::OpenPopup().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.EndPopup">
+            <summary>
+Marks the end of a definition of a mini pop up that can show options.
+<br />
+Wraps up ImGui::EndPopup().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.BeginPopup(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Marks the start of a definition of a mini pop up that can show options.
+<br />
+Wraps up ImGui::BeginPopup().
+</summary>
+            <param name="label">Label used to identify this widget.</param>
+            <returns>Whether or not the pop up is open.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.CollapsingHeader(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a collapsing title header.
+<br />
+Wraps up ImGui::CollapsingHeader().
+</summary>
+            <param name="title">Label for the header.</param>
+            <returns>True if the header is open, false otherwise.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Unindent">
+            <summary>
+Unindents the widgets rendered after this call.
+<br />
+Wraps up ImGui::Unindent().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Indent">
+            <summary>
+Indents the widgets rendered after this call.
+<br />
+Wraps up ImGui::Indent().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PopID">
+            <summary>
+Marks the end of a stack of ImGui widgets from the last PushID() call.
+<br />
+Wraps up ImGui::PopID().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PushID(System.Int32)">
+            <summary>
+Marks the start of a stack of ImGui widgets with the specified id.
+<br />
+Wraps up ImGui::PushID().
+</summary>
+            <param name="id">Integer-based ID.</param>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PushID(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Marks the start of a stack of ImGui widgets with the specified id.
+<br />
+Wraps up ImGui::PushID().
+</summary>
+            <param name="id">String-based ID.</param>
+        </member>
+        <member name="F:SHADE.SHEditorUI.TEXT_FIELD_MAX_LENGTH">
+            <summary>
+Maximum length of a string supported by InputTextField()
+</summary>
+        </member>
+        <member name="T:SHADE.SHEditorUI">
+            <summary>
+Static class that contains useful functions for Editor UI using ImGui.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Redo">
+            <summary>
+Redoes the last undo-ed command if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Undo">
+            <summary>
+Undos the last added command if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Add(SHADE.UndoRedoStack.Command)">
+            <summary>
+Adds a command onto the stack.
+</summary>
+            <param name="command" />
+        </member>
+        <member name="P:SHADE.UndoRedoStack.RedoActionPresent">
+            <summary>
+True if there is a redoable action in the stack.
+</summary>
+        </member>
+        <member name="P:SHADE.UndoRedoStack.UndoActionPresent">
+            <summary>
+True if there is an undoable action in the stack.
+</summary>
+        </member>
+        <member name="T:SHADE.UndoRedoStack.Command">
+            <summary>
+Command for the stack that represents a data modification.
+</summary>
+        </member>
+        <member name="T:SHADE.UndoRedoStack">
+            <summary>
+Class that is able to store a stack of actions that can be done and redone.
+</summary>
+        </member>
+        <member name="M:SHADE.Collider.OnCollisionShapeChanged(System.UInt32)">
+            <summary>
+To be called from native code when a Collision Shape has been changed.
+</summary>
+            <param name="entity">
+The entity which has it's collision shape changed.
+</param>
+        </member>
+        <member name="M:SHADE.Collider.OnCollisionShapeRemoved(System.UInt32)">
+            <summary>
+To be called from native code when a collision shape has been removed.
+</summary>
+            <param name="entity">The entity which has it's collision shape removed.</param>
+        </member>
+        <member name="M:SHADE.Collider.GetCollisionShape``1(System.Int32)">
+            <summary>
+Retrieves a ColliderBound at the specified index in the ColliderBound list 
+and casts it to the appropriate type.
+</summary>
+            <typeparam name="T">Type of the ColliderBound to cast to.</typeparam>
+            <param name="index">Index to retrieve a ColliderBound from.</param>
+            <returns>ColliderBound for the specified index.</returns>
+        </member>
+        <member name="M:SHADE.Collider.GetCollisionShape(System.Int32)">
+            <summary>
+Retrieves a ColliderBound at the specified index in the ColliderBound list.
+</summary>
+            <param name="index">Index to retrieve a ColliderBound from.</param>
+            <returns>ColliderBound for the specified index.</returns>
+        </member>
+        <member name="P:SHADE.Collider.CollisionShapeCount">
+            <summary>
+Total number of ColliderShapes in the Collider component.
+</summary>
+        </member>
+        <member name="M:SHADE.Collider.#ctor(System.UInt32)">
+            <summary>
+Constructs a Collider Component that represents a native SHColliderComponent
+component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Collider">
+            <summary>
+CLR version of the the SHADE Engine's SHColliderComponent.
+A single Collider component can contain one or multiple Collider Bounds.
+</summary>
+        </member>
+        <member name="M:SHADE.SphereCollider.Raycast(SHADE.Ray,System.Single)">
+            <inheritdoc />
+        </member>
+        <member name="M:SHADE.SphereCollider.TestPoint(SHADE.Vector3)">
+            <inheritdoc />
+        </member>
+        <member name="P:SHADE.SphereCollider.Radius">
+            <summary>
+Radius of the Bounding Sphere formed by this bound.
+</summary>
+        </member>
+        <member name="P:SHADE.SphereCollider.Center">
+            <summary>
+Center of the Bounding Sphere formed by this bound.
+</summary>
+        </member>
+        <member name="T:SHADE.SphereCollider">
+            <summary>
+Sphere-shaped Collider Bound.
+</summary>
+        </member>
+        <member name="M:SHADE.BoxCollider.Raycast(SHADE.Ray,System.Single)">
+            <inheritdoc />
+        </member>
+        <member name="M:SHADE.BoxCollider.TestPoint(SHADE.Vector3)">
+            <inheritdoc />
+        </member>
+        <member name="P:SHADE.BoxCollider.Max">
+            <summary>
+Position of the top right front corner of the Bounding Box formed by this 
+bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.Min">
+            <summary>
+Position of the bottom left back corner of the Bounding Box formed by this 
+bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.HalfExtents">
+            <summary>
+Half of the scale of the Bounding Box formed by this bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.Center">
+            <summary>
+Center of the Bounding Box formed by this bound.
+</summary>
+        </member>
+        <member name="T:SHADE.BoxCollider">
+            <summary>
+Box-shaped Collider Bound.
+</summary>
+        </member>
+        <member name="M:SHADE.CollisionShape.Raycast(SHADE.Ray,System.Single)">
+            <summary>
+Computes a Raycast and checks if there is a collision with any object.
+</summary>
+            <param name="ray">The ray to cast.</param>
+            <param name="maxDistance">Maximum distance for the raycast check.</param>
+            <returns>True if the ray intersects with an object in the scene.</returns>
+        </member>
+        <member name="M:SHADE.CollisionShape.TestPoint(SHADE.Vector3)">
+            <summary>
+Checks if the specified point is within this shape's bounds.
+</summary>
+            <param name="point">Point to test with.</param>
+            <returns>True if the point is in the shape's bounds.</returns>
+        </member>
+        <member name="T:SHADE.CollisionShape">
+            <summary>
+Base interface for all Collider Shapes.
+</summary>
+        </member>
+        <member name="F:SHADE.SHPhysicsMaterial.density">
+@brief The density of the collider that determines the mass of the collision shape
+       if it is automatically computed. Must be a positive number.
+
+</member>
+        <member name="F:SHADE.SHPhysicsMaterial.bounciness">
+@brief The bounciness factor of the physics object., clamped between [0,1].<br />
+       0 means the object will never bounce.
+       1 means the object never loses energy on a bounce.
+
+</member>
+        <member name="F:SHADE.SHPhysicsMaterial.friction">
+@brief The friction coefficient of the physics object., clamped between [0,1].<br />
+       0 means the object will never experience friction.
+       1 means the friction force against the object is equal to the applied force.
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetDensity(System.Single)">
+@brief Sets the mass density of the physics material.
+@param newDensity The density value to set. Always made positive.
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetBounciness(System.Single)">
+@brief Sets the bounciness factor of the physics material.
+@param newBounciness The bounciness value to set. Clamped between [0,1].
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetFriction(System.Single)">
+@brief Sets the friction coefficient of the physics material.
+@param newFriction The friction value to set. Clamped between [0,1].
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.#ctor(System.Single,System.Single,System.Single)">
+@brief Default constructor for a physics material.
+@param friction    The friction of the material. Clamped between [0,1]. Defaults to 0.4.
+@param bounciness  The bounciness of the material. Clamped between [0,1].
+@param density     The mass density of the material. Always made positive.
+
+</member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.CloseWindow">
+            <summary>
+Closes the current window, and depending on the implementation, should also
+close the application.
+</summary>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.IsFullscreen">
+            <summary>
+Retrieves the current window fullscreen status.
+</summary>
+            <returns>The current window fullscreen status..</returns>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.GetWindowHeight">
+            <summary>
+Retrieves the current window height.
+</summary>
+            <returns>The current window height.</returns>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.GetWindowWidth">
+            <summary>
+Retrieves the current window width.
+</summary>
+            <returns>The current window width.</returns>
+        </member>
+        <member name="T:SHADE.SHGraphicsSystemInterface">
+            <summary>
+Static class that wraps up certain functions in the SHGraphicsSystem so that 
+accessing it from SHADE_Managed would not cause issues due to C++20 features.
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditor.Render">
+ @brief Perform ImGui and ImGui Backend Render
+
+
+</member>
+        <member name="M:SHADE.SHEditor.NewFrame">
+ @brief Start new frame for editor
+
+
+</member>
+        <member name="M:SHADE.SHEditor.InitBackend">
+ @brief Initialise Backend for ImGui (SDL and Vulkan backend)
+
+ @param sdlWindow Pointer to SDL_Window
+
+</member>
+        <member name="M:SHADE.SHEditor.SetStyle(&lt;unknown type&gt;)">
+ @brief Set the Style for the editor
+
+ @param style Desired style
+
+</member>
+        <member name="M:SHADE.SHEditor.Exit">
+ @brief Safely shutdown the editor
+
+
+</member>
+        <member name="M:SHADE.SHEditor.Update(System.Double)">
+ @brief Update the editor and add to ImGui DrawList
+
+ @param dt Delta-time of the frame
+
+</member>
+        <member name="M:SHADE.SHEditor.Init">
+ @brief Initialise the editor
+
+ @param sdlWindow pointer to SDL_Window object created in application
+
+</member>
+        <member name="T:SHADE.SHEditor.Style">
+ @brief Style options
+
+
+</member>
+        <member name="T:SHADE.SHEditor">
+ @brief SHEditor static class contains editor variables and implementation of editor functions.
+
+
+</member>
+        <member name="M:SDL_GetYUVConversionModeForResolution(System.Int32,System.Int32)">
+ Get the YUV conversion mode, returning the correct mode for the resolution
+ when the current conversion mode is SDL_YUV_CONVERSION_AUTOMATIC
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_GetYUVConversionMode">
+ Get the YUV conversion mode
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_SetYUVConversionMode(SDL_YUV_CONVERSION_MODE)">
+ Set the YUV conversion mode
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_LowerBlitScaled(SDL_Surface*,SDL_Rect*,SDL_Surface*,SDL_Rect*)">
+ Perform low-level surface scaled blitting only.
+
+ This is a semi-private function and it performs low-level surface blitting,
+ assuming the input rectangles have already been clipped.
+
+ \param src the SDL_Surface structure to be copied from
+ \param srcrect the SDL_Rect structure representing the rectangle to be
+                copied
+ \param dst the SDL_Surface structure that is the blit target
+ \param dstrect the SDL_Rect structure representing the rectangle that is
+                copied into
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitScaled
+
+</member>
+        <member name="M:SDL_UpperBlitScaled(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect*)">
+ Perform a scaled surface copy to a destination surface.
+
+ SDL_UpperBlitScaled() has been replaced by SDL_BlitScaled(), which is
+ merely a macro for this function with a less confusing name.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitScaled
+
+</member>
+        <member name="M:SDL_SoftStretchLinear(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Perform bilinear scaling between two surfaces of the same format, 32BPP.
+
+ \since This function is available since SDL 2.0.16.
+
+</member>
+        <member name="M:SDL_SoftStretch(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Perform a fast, low quality, stretch blit between two surfaces of the same
+ format.
+
+ Please use SDL_BlitScaled() instead.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_LowerBlit(SDL_Surface*,SDL_Rect*,SDL_Surface*,SDL_Rect*)">
+ Perform low-level surface blitting only.
+
+ This is a semi-private blit function and it performs low-level surface
+ blitting, assuming the input rectangles have already been clipped.
+
+ Unless you know what you're doing, you should be using SDL_BlitSurface()
+ instead.
+
+ \param src the SDL_Surface structure to be copied from
+ \param srcrect the SDL_Rect structure representing the rectangle to be
+                copied, or NULL to copy the entire surface
+ \param dst the SDL_Surface structure that is the blit target
+ \param dstrect the SDL_Rect structure representing the rectangle that is
+                copied into
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+
+</member>
+        <member name="M:SDL_UpperBlit(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect*)">
+ *  Performs a fast blit from the source surface to the destination surface.
+ *
+ *  This assumes that the source and destination rectangles are
+ *  the same size.  If either \c srcrect or \c dstrect are NULL, the entire
+ *  surface (\c src or \c dst) is copied.  The final blit rectangles are saved
+ *  in \c srcrect and \c dstrect after all clipping is performed.
+ *
+ *  \returns 0 if the blit is successful, otherwise it returns -1.
+ *
+ *  The blit function should not be called on a locked surface.
+ *
+ *  The blit semantics for surfaces with and without blending and colorkey
+ *  are defined as follows:
+ *  \verbatim
+    RGBA-&gt;RGB:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source alpha-channel and per-surface alpha)
+        SDL_SRCCOLORKEY ignored.
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB.
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        RGB values of the source color key, ignoring alpha in the
+        comparison.
+
+    RGB-&gt;RGBA:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source per-surface alpha)
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB, set destination alpha to source per-surface alpha value.
+      both:
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        source color key.
+
+    RGBA-&gt;RGBA:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source alpha-channel and per-surface alpha)
+        SDL_SRCCOLORKEY ignored.
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy all of RGBA to the destination.
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        RGB values of the source color key, ignoring alpha in the
+        comparison.
+
+    RGB-&gt;RGB:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source per-surface alpha)
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB.
+      both:
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        source color key.
+    \endverbatim
+ *
+ *  You should call SDL_BlitSurface() unless you know exactly how SDL
+ *  blitting works internally and how to use the other blit functions.
+
+ Perform a fast blit from the source surface to the destination surface.
+
+ SDL_UpperBlit() has been replaced by SDL_BlitSurface(), which is merely a
+ macro for this function with a less confusing name.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+
+</member>
+        <member name="M:SDL_FillRects(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32)">
+ Perform a fast fill of a set of rectangles with a specific color.
+
+ `color` should be a pixel of the format used by the surface, and can be
+ generated by SDL_MapRGB() or SDL_MapRGBA(). If the color value contains an
+ alpha component then the destination is simply filled with that alpha
+ information, no blending takes place.
+
+ If there is a clip rectangle set on the destination (set via
+ SDL_SetClipRect()), then this function will fill based on the intersection
+ of the clip rectangle and `rect`.
+
+ \param dst the SDL_Surface structure that is the drawing target
+ \param rects an array of SDL_Rects representing the rectangles to fill.
+ \param count the number of rectangles in the array
+ \param color the color to fill with
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FillRect
+
+</member>
+        <member name="M:SDL_FillRect(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.UInt32)">
+ Perform a fast fill of a rectangle with a specific color.
+
+ `color` should be a pixel of the format used by the surface, and can be
+ generated by SDL_MapRGB() or SDL_MapRGBA(). If the color value contains an
+ alpha component then the destination is simply filled with that alpha
+ information, no blending takes place.
+
+ If there is a clip rectangle set on the destination (set via
+ SDL_SetClipRect()), then this function will fill based on the intersection
+ of the clip rectangle and `rect`.
+
+ \param dst the SDL_Surface structure that is the drawing target
+ \param rect the SDL_Rect structure representing the rectangle to fill, or
+             NULL to fill the entire surface
+ \param color the color to fill with
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FillRects
+
+</member>
+        <member name="M:SDL_PremultiplyAlpha(System.Int32,System.Int32,System.UInt32,System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32,System.Void*,System.Int32)">
+ Premultiply the alpha on a block of pixels.
+
+ This is safe to use with src == dst, but not for other overlapping areas.
+
+ This function is currently only implemented for SDL_PIXELFORMAT_ARGB8888.
+
+ \param width the width of the block to convert, in pixels
+ \param height the height of the block to convert, in pixels
+ \param src_format an SDL_PixelFormatEnum value of the `src` pixels format
+ \param src a pointer to the source pixels
+ \param src_pitch the pitch of the source pixels, in bytes
+ \param dst_format an SDL_PixelFormatEnum value of the `dst` pixels format
+ \param dst a pointer to be filled in with premultiplied pixel data
+ \param dst_pitch the pitch of the destination pixels, in bytes
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.18.
+
+</member>
+        <member name="M:SDL_ConvertPixels(System.Int32,System.Int32,System.UInt32,System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32,System.Void*,System.Int32)">
+ Copy a block of pixels of one format to another format.
+
+ \param width the width of the block to copy, in pixels
+ \param height the height of the block to copy, in pixels
+ \param src_format an SDL_PixelFormatEnum value of the `src` pixels format
+ \param src a pointer to the source pixels
+ \param src_pitch the pitch of the source pixels, in bytes
+ \param dst_format an SDL_PixelFormatEnum value of the `dst` pixels format
+ \param dst a pointer to be filled in with new pixel data
+ \param dst_pitch the pitch of the destination pixels, in bytes
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_ConvertSurfaceFormat(SDL_Surface*,System.UInt32,System.UInt32)">
+ Copy an existing surface to a new surface of the specified format enum.
+
+ This function operates just like SDL_ConvertSurface(), but accepts an
+ SDL_PixelFormatEnum value instead of an SDL_PixelFormat structure. As such,
+ it might be easier to call but it doesn't have access to palette
+ information for the destination surface, in case that would be important.
+
+ \param src the existing SDL_Surface structure to convert
+ \param pixel_format the SDL_PixelFormatEnum that the new surface is
+                     optimized for
+ \param flags the flags are unused and should be set to 0; this is a
+              leftover from SDL 1.2's API
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+ \sa SDL_ConvertSurface
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_ConvertSurface(SDL_Surface*,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.UInt32)">
+ Copy an existing surface to a new surface of the specified format.
+
+ This function is used to optimize images for faster *repeat* blitting. This
+ is accomplished by converting the original and storing the result as a new
+ surface. The new, optimized surface can then be used as the source for
+ future blits, making them faster.
+
+ \param src the existing SDL_Surface structure to convert
+ \param fmt the SDL_PixelFormat structure that the new surface is optimized
+            for
+ \param flags the flags are unused and should be set to 0; this is a
+              leftover from SDL 1.2's API
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+ \sa SDL_ConvertSurfaceFormat
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_GetClipRect(SDL_Surface*,SDL_Rect*)">
+ Get the clipping rectangle for a surface.
+
+ When `surface` is the destination of a blit, only the area within the clip
+ rectangle is drawn into.
+
+ \param surface the SDL_Surface structure representing the surface to be
+                clipped
+ \param rect an SDL_Rect structure filled in with the clipping rectangle for
+             the surface
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_SetClipRect
+
+</member>
+        <member name="M:SDL_SetClipRect(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Set the clipping rectangle for a surface.
+
+ When `surface` is the destination of a blit, only the area within the clip
+ rectangle is drawn into.
+
+ Note that blits are automatically clipped to the edges of the source and
+ destination surfaces.
+
+ \param surface the SDL_Surface structure to be clipped
+ \param rect the SDL_Rect structure representing the clipping rectangle, or
+             NULL to disable clipping
+ \returns SDL_TRUE if the rectangle intersects the surface, otherwise
+          SDL_FALSE and blits will be completely clipped.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_GetClipRect
+
+</member>
+        <member name="M:SDL_GetSurfaceBlendMode(SDL_Surface*,SDL_BlendMode*)">
+ Get the blend mode used for blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param blendMode a pointer filled in with the current SDL_BlendMode
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_SetSurfaceBlendMode
+
+</member>
+        <member name="M:SDL_SetSurfaceBlendMode(SDL_Surface*,SDL_BlendMode)">
+ Set the blend mode used for blit operations.
+
+ To copy a surface to another surface (or texture) without blending with the
+ existing data, the blendmode of the SOURCE surface should be set to
+ `SDL_BLENDMODE_NONE`.
+
+ \param surface the SDL_Surface structure to update
+ \param blendMode the SDL_BlendMode to use for blit blending
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceBlendMode
+
+</member>
+        <member name="M:SDL_GetSurfaceAlphaMod(SDL_Surface*,System.Byte*)">
+ Get the additional alpha value used in blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param alpha a pointer filled in with the current alpha value
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceColorMod
+ \sa SDL_SetSurfaceAlphaMod
+
+</member>
+        <member name="M:SDL_SetSurfaceAlphaMod(SDL_Surface*,System.Byte)">
+ Set an additional alpha value used in blit operations.
+
+ When this surface is blitted, during the blit operation the source alpha
+ value is modulated by this alpha value according to the following formula:
+
+ `srcA = srcA * (alpha / 255)`
+
+ \param surface the SDL_Surface structure to update
+ \param alpha the alpha value multiplied into blit operations
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceAlphaMod
+ \sa SDL_SetSurfaceColorMod
+
+</member>
+        <member name="M:SDL_GetSurfaceColorMod(SDL_Surface*,System.Byte*,System.Byte*,System.Byte*)">
+ Get the additional color value multiplied into blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param r a pointer filled in with the current red color value
+ \param g a pointer filled in with the current green color value
+ \param b a pointer filled in with the current blue color value
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceAlphaMod
+ \sa SDL_SetSurfaceColorMod
+
+</member>
+        <member name="M:SDL_SetSurfaceColorMod(SDL_Surface*,System.Byte,System.Byte,System.Byte)">
+ Set an additional color value multiplied into blit operations.
+
+ When this surface is blitted, during the blit operation each source color
+ channel is modulated by the appropriate color value according to the
+ following formula:
+
+ `srcC = srcC * (color / 255)`
+
+ \param surface the SDL_Surface structure to update
+ \param r the red color value multiplied into blit operations
+ \param g the green color value multiplied into blit operations
+ \param b the blue color value multiplied into blit operations
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceColorMod
+ \sa SDL_SetSurfaceAlphaMod
+
+</member>
+        <member name="M:SDL_GetColorKey(SDL_Surface*,System.UInt32*)">
+ Get the color key (transparent pixel) for a surface.
+
+ The color key is a pixel of the format used by the surface, as generated by
+ SDL_MapRGB().
+
+ If the surface doesn't have color key enabled this function returns -1.
+
+ \param surface the SDL_Surface structure to query
+ \param key a pointer filled in with the transparent pixel
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_SetColorKey
+
+</member>
+        <member name="M:SDL_HasColorKey(SDL_Surface*)">
+ Returns whether the surface has a color key
+
+ It is safe to pass a NULL `surface` here; it will return SDL_FALSE.
+
+ \param surface the SDL_Surface structure to query
+ \return SDL_TRUE if the surface has a color key, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.9.
+
+ \sa SDL_SetColorKey
+ \sa SDL_GetColorKey
+
+</member>
+        <member name="M:SDL_SetColorKey(SDL_Surface*,System.Int32,System.UInt32)">
+ Set the color key (transparent pixel) in a surface.
+
+ The color key defines a pixel value that will be treated as transparent in
+ a blit. For example, one can use this to specify that cyan pixels should be
+ considered transparent, and therefore not rendered.
+
+ It is a pixel of the format used by the surface, as generated by
+ SDL_MapRGB().
+
+ RLE acceleration can substantially speed up blitting of images with large
+ horizontal runs of transparent pixels. See SDL_SetSurfaceRLE() for details.
+
+ \param surface the SDL_Surface structure to update
+ \param flag SDL_TRUE to enable color key, SDL_FALSE to disable color key
+ \param key the transparent pixel
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_GetColorKey
+
+</member>
+        <member name="M:SDL_HasSurfaceRLE(SDL_Surface*)">
+ Returns whether the surface is RLE enabled
+
+ It is safe to pass a NULL `surface` here; it will return SDL_FALSE.
+
+ \param surface the SDL_Surface structure to query
+ \returns SDL_TRUE if the surface is RLE enabled, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.14.
+
+ \sa SDL_SetSurfaceRLE
+
+</member>
+        <member name="M:SDL_SetSurfaceRLE(SDL_Surface*,System.Int32)">
+  Save a surface to a file.
+
+  Convenience macro.
+
+ Set the RLE acceleration hint for a surface.
+
+ If RLE is enabled, color key and alpha blending blits are much faster, but
+ the surface must be locked before directly accessing the pixels.
+
+ \param surface the SDL_Surface structure to optimize
+ \param flag 0 to disable, non-zero to enable RLE acceleration
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_LockSurface
+ \sa SDL_UnlockSurface
+
+</member>
+        <member name="M:SDL_SaveBMP_RW(SDL_Surface*,SDL_RWops*,System.Int32)">
+ Load a surface from a file.
+
+ Convenience macro.
+
+ Save a surface to a seekable SDL data stream in BMP format.
+
+ Surfaces with a 24-bit, 32-bit and paletted 8-bit format get saved in the
+ BMP directly. Other RGB formats with 8-bit or higher get converted to a
+ 24-bit surface or, if they have an alpha mask or a colorkey, to a 32-bit
+ surface before they are saved. YUV and paletted 1-bit and 4-bit formats are
+ not supported.
+
+ \param surface the SDL_Surface structure containing the image to be saved
+ \param dst a data stream to save to
+ \param freedst non-zero to close the stream after being written
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_LoadBMP_RW
+ \sa SDL_SaveBMP
+
+</member>
+        <member name="M:SDL_LoadBMP_RW(SDL_RWops*,System.Int32)">
+ Load a BMP image from a seekable SDL data stream.
+
+ The new surface should be freed with SDL_FreeSurface(). Not doing so will
+ result in a memory leak.
+
+ src is an open SDL_RWops buffer, typically loaded with SDL_RWFromFile.
+ Alternitavely, you might also use the macro SDL_LoadBMP to load a bitmap
+ from a file, convert it to an SDL_Surface and then close the file.
+
+ \param src the data stream for the surface
+ \param freesrc non-zero to close the stream after being read
+ \returns a pointer to a new SDL_Surface structure or NULL if there was an
+          error; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeSurface
+ \sa SDL_RWFromFile
+ \sa SDL_LoadBMP
+ \sa SDL_SaveBMP_RW
+
+</member>
+        <member name="M:SDL_UnlockSurface(SDL_Surface*)">
+ Release a surface after directly accessing the pixels.
+
+ \param surface the SDL_Surface structure to be unlocked
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_LockSurface
+
+</member>
+        <member name="M:SDL_LockSurface(SDL_Surface*)">
+ Set up a surface for directly accessing the pixels.
+
+ Between calls to SDL_LockSurface() / SDL_UnlockSurface(), you can write to
+ and read from `surface-&gt;pixels`, using the pixel format stored in
+ `surface-&gt;format`. Once you are done accessing the surface, you should use
+ SDL_UnlockSurface() to release it.
+
+ Not all surfaces require locking. If `SDL_MUSTLOCK(surface)` evaluates to
+ 0, then you can read and write to the surface at any time, and the pixel
+ format of the surface will not change.
+
+ \param surface the SDL_Surface structure to be locked
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_MUSTLOCK
+ \sa SDL_UnlockSurface
+
+</member>
+        <member name="M:SDL_SetSurfacePalette(SDL_Surface*,SDL_Palette*)">
+ Set the palette used by a surface.
+
+ A single palette can be shared with many surfaces.
+
+ \param surface the SDL_Surface structure to update
+ \param palette the SDL_Palette structure to use
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_FreeSurface(SDL_Surface*)">
+ Free an RGB surface.
+
+ It is safe to pass NULL to this function.
+
+ \param surface the SDL_Surface to free.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_LoadBMP
+ \sa SDL_LoadBMP_RW
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceWithFormatFrom(System.Void*,System.Int32,System.Int32,System.Int32,System.Int32,System.UInt32)">
+ Allocate a new RGB surface with with a specific pixel format and existing
+ pixel data.
+
+ This function operates mostly like SDL_CreateRGBSurfaceFrom(), except
+ instead of providing pixel color masks, you provide it with a predefined
+ format from SDL_PixelFormatEnum.
+
+ No copy is made of the pixel data. Pixel data is not managed automatically;
+ you must free the surface before you free the pixel data.
+
+ \param pixels a pointer to existing pixel data
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param pitch the pitch of the surface in bytes
+ \param format the SDL_PixelFormatEnum for the new surface's pixel format.
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.5.
+
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceFrom(System.Void*,System.Int32,System.Int32,System.Int32,System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Allocate a new RGB surface with existing pixel data.
+
+ This function operates mostly like SDL_CreateRGBSurface(), except it does
+ not allocate memory for the pixel data, instead the caller provides an
+ existing buffer of data for the surface to use.
+
+ No copy is made of the pixel data. Pixel data is not managed automatically;
+ you must free the surface before you free the pixel data.
+
+ \param pixels a pointer to existing pixel data
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param pitch the pitch of the surface in bytes
+ \param Rmask the red mask for the pixels
+ \param Gmask the green mask for the pixels
+ \param Bmask the blue mask for the pixels
+ \param Amask the alpha mask for the pixels
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceWithFormat(System.UInt32,System.Int32,System.Int32,System.Int32,System.UInt32)">
+ Allocate a new RGB surface with a specific pixel format.
+
+ This function operates mostly like SDL_CreateRGBSurface(), except instead
+ of providing pixel color masks, you provide it with a predefined format
+ from SDL_PixelFormatEnum.
+
+ \param flags the flags are unused and should be set to 0
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param format the SDL_PixelFormatEnum for the new surface's pixel format.
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.5.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurface(System.UInt32,System.Int32,System.Int32,System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Allocate a new RGB surface.
+
+ If `depth` is 4 or 8 bits, an empty palette is allocated for the surface.
+ If `depth` is greater than 8 bits, the pixel format is set using the
+ [RGBA]mask parameters.
+
+ The [RGBA]mask parameters are the bitmasks used to extract that color from
+ a pixel. For instance, `Rmask` being 0xFF000000 means the red data is
+ stored in the most significant byte. Using zeros for the RGB masks sets a
+ default value, based on the depth. For example:
+
+ ```c++
+ SDL_CreateRGBSurface(0,w,h,32,0,0,0,0);
+ ```
+
+ However, using zero for the Amask results in an Amask of 0.
+
+ By default surfaces with an alpha mask are set up for blending as with:
+
+ ```c++
+ SDL_SetSurfaceBlendMode(surface, SDL_BLENDMODE_BLEND)
+ ```
+
+ You can change this by calling SDL_SetSurfaceBlendMode() and selecting a
+ different `blendMode`.
+
+ \param flags the flags are unused and should be set to 0
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param Rmask the red mask for the pixels
+ \param Gmask the green mask for the pixels
+ \param Bmask the blue mask for the pixels
+ \param Amask the alpha mask for the pixels
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="F:SDL_Surface.refcount">
+Reference count -- used when freeing surface 
+</member>
+        <member name="F:SDL_Surface.map">
+info for fast blit mapping to other surfaces 
+</member>
+        <member name="F:SDL_Surface.clip_rect">
+clipping information 
+</member>
+        <member name="F:SDL_Surface.list_blitmap">
+list of BlitMap that hold a reference to this surface 
+</member>
+        <member name="F:SDL_Surface.locked">
+information needed for surfaces requiring locks 
+</member>
+        <member name="F:SDL_Surface.userdata">
+Application data associated with the surface 
+</member>
+        <member name="T:SDL_Surface">
+ \brief A collection of pixels used in software blitting.
+
+ \note  This structure should be treated as read-only, except for \c pixels,
+        which, if not NULL, contains the raw pixel data for the surface.
+
+
+\brief The type of function used for surface blitting functions.
+
+</member>
+        <member name="M:SDL_ComposeCustomBlendMode(SDL_BlendFactor,SDL_BlendFactor,SDL_BlendOperation,SDL_BlendFactor,SDL_BlendFactor,SDL_BlendOperation)">
+ Compose a custom blend mode for renderers.
+
+ The functions SDL_SetRenderDrawBlendMode and SDL_SetTextureBlendMode accept
+ the SDL_BlendMode returned by this function if the renderer supports it.
+
+ A blend mode controls how the pixels from a drawing operation (source) get
+ combined with the pixels from the render target (destination). First, the
+ components of the source and destination pixels get multiplied with their
+ blend factors. Then, the blend operation takes the two products and
+ calculates the result that will get stored in the render target.
+
+ Expressed in pseudocode, it would look like this:
+
+ ```c
+ dstRGB = colorOperation(srcRGB * srcColorFactor, dstRGB * dstColorFactor);
+ dstA = alphaOperation(srcA * srcAlphaFactor, dstA * dstAlphaFactor);
+ ```
+
+ Where the functions `colorOperation(src, dst)` and `alphaOperation(src,
+ dst)` can return one of the following:
+
+ - `src + dst`
+ - `src - dst`
+ - `dst - src`
+ - `min(src, dst)`
+ - `max(src, dst)`
+
+ The red, green, and blue components are always multiplied with the first,
+ second, and third components of the SDL_BlendFactor, respectively. The
+ fourth component is not used.
+
+ The alpha component is always multiplied with the fourth component of the
+ SDL_BlendFactor. The other components are not used in the alpha
+ calculation.
+
+ Support for these blend modes varies for each renderer. To check if a
+ specific SDL_BlendMode is supported, create a renderer and pass it to
+ either SDL_SetRenderDrawBlendMode or SDL_SetTextureBlendMode. They will
+ return with an error if the blend mode is not supported.
+
+ This list describes the support of custom blend modes for each renderer in
+ SDL 2.0.6. All renderers support the four blend modes listed in the
+ SDL_BlendMode enumeration.
+
+ - **direct3d**: Supports all operations with all factors. However, some
+   factors produce unexpected results with `SDL_BLENDOPERATION_MINIMUM` and
+   `SDL_BLENDOPERATION_MAXIMUM`.
+ - **direct3d11**: Same as Direct3D 9.
+ - **opengl**: Supports the `SDL_BLENDOPERATION_ADD` operation with all
+   factors. OpenGL versions 1.1, 1.2, and 1.3 do not work correctly with SDL
+   2.0.6.
+ - **opengles**: Supports the `SDL_BLENDOPERATION_ADD` operation with all
+   factors. Color and alpha factors need to be the same. OpenGL ES 1
+   implementation specific: May also support `SDL_BLENDOPERATION_SUBTRACT`
+   and `SDL_BLENDOPERATION_REV_SUBTRACT`. May support color and alpha
+   operations being different from each other. May support color and alpha
+   factors being different from each other.
+ - **opengles2**: Supports the `SDL_BLENDOPERATION_ADD`,
+   `SDL_BLENDOPERATION_SUBTRACT`, `SDL_BLENDOPERATION_REV_SUBTRACT`
+   operations with all factors.
+ - **psp**: No custom blend mode support.
+ - **software**: No custom blend mode support.
+
+ Some renderers do not provide an alpha component for the default render
+ target. The `SDL_BLENDFACTOR_DST_ALPHA` and
+ `SDL_BLENDFACTOR_ONE_MINUS_DST_ALPHA` factors do not have an effect in this
+ case.
+
+ \param srcColorFactor the SDL_BlendFactor applied to the red, green, and
+                       blue components of the source pixels
+ \param dstColorFactor the SDL_BlendFactor applied to the red, green, and
+                       blue components of the destination pixels
+ \param colorOperation the SDL_BlendOperation used to combine the red,
+                       green, and blue components of the source and
+                       destination pixels
+ \param srcAlphaFactor the SDL_BlendFactor applied to the alpha component of
+                       the source pixels
+ \param dstAlphaFactor the SDL_BlendFactor applied to the alpha component of
+                       the destination pixels
+ \param alphaOperation the SDL_BlendOperation used to combine the alpha
+                       component of the source and destination pixels
+ \returns an SDL_BlendMode that represents the chosen factors and
+          operations.
+
+ \since This function is available since SDL 2.0.6.
+
+ \sa SDL_SetRenderDrawBlendMode
+ \sa SDL_GetRenderDrawBlendMode
+ \sa SDL_SetTextureBlendMode
+ \sa SDL_GetTextureBlendMode
+
+</member>
+        <member name="M:SDL_IntersectFRectAndLine(SDL_FRect!System.Runtime.CompilerServices.IsConst*,System.Single*,System.Single*,System.Single*,System.Single*)">
+ Calculate the intersection of a rectangle and line segment with float
+ precision.
+
+ This function is used to clip a line segment to a rectangle. A line segment
+ contained entirely within the rectangle or that does not intersect will
+ remain unchanged. A line segment that crosses the rectangle at either or
+ both ends will be clipped to the boundary of the rectangle and the new
+ coordinates saved in `X1`, `Y1`, `X2`, and/or `Y2` as necessary.
+
+ \param rect an SDL_FRect structure representing the rectangle to intersect
+ \param X1 a pointer to the starting X-coordinate of the line
+ \param Y1 a pointer to the starting Y-coordinate of the line
+ \param X2 a pointer to the ending X-coordinate of the line
+ \param Y2 a pointer to the ending Y-coordinate of the line
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_EncloseFPoints(SDL_FPoint!System.Runtime.CompilerServices.IsConst*,System.Int32,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate a minimal rectangle enclosing a set of points with float
+ precision.
+
+ If `clip` is not NULL then only points inside of the clipping rectangle are
+ considered.
+
+ \param points an array of SDL_FPoint structures representing points to be
+               enclosed
+ \param count the number of structures in the `points` array
+ \param clip an SDL_FRect used for clipping or NULL to enclose all points
+ \param result an SDL_FRect structure filled in with the minimal enclosing
+               rectangle
+ \returns SDL_TRUE if any points were enclosed or SDL_FALSE if all the
+          points were outside of the clipping rectangle.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_UnionFRect(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate the union of two rectangles with float precision.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \param result an SDL_FRect structure filled in with the union of rectangles
+               `A` and `B`
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_IntersectFRect(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate the intersection of two rectangles with float precision.
+
+ If `result` is NULL then this function will return SDL_FALSE.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \param result an SDL_FRect structure filled in with the intersection of
+               rectangles `A` and `B`
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+ \sa SDL_HasIntersectionF
+
+</member>
+        <member name="M:SDL_HasIntersectionF(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+ Determine whether two rectangles intersect with float precision.
+
+ If either pointer is NULL the function will return SDL_FALSE.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+ \sa SDL_IntersectRect
+
+</member>
+        <member name="M:SDL_FRectEquals(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+ Returns true if the two rectangles are equal, using a default epsilon.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_FRectEqualsEpsilon(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,System.Single!System.Runtime.CompilerServices.IsConst)">
+ Returns true if the two rectangles are equal, within some given epsilon.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_FRectEmpty(SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the rectangle has no area.
+
+</member>
+        <member name="M:SDL_PointInFRect(SDL_FPoint!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if point resides inside a rectangle.
+
+</member>
+        <member name="M:SDL_IntersectRectAndLine(SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.Int32*,System.Int32*,System.Int32*,System.Int32*)">
+ Calculate the intersection of a rectangle and line segment.
+
+ This function is used to clip a line segment to a rectangle. A line segment
+ contained entirely within the rectangle or that does not intersect will
+ remain unchanged. A line segment that crosses the rectangle at either or
+ both ends will be clipped to the boundary of the rectangle and the new
+ coordinates saved in `X1`, `Y1`, `X2`, and/or `Y2` as necessary.
+
+ \param rect an SDL_Rect structure representing the rectangle to intersect
+ \param X1 a pointer to the starting X-coordinate of the line
+ \param Y1 a pointer to the starting Y-coordinate of the line
+ \param X2 a pointer to the ending X-coordinate of the line
+ \param Y2 a pointer to the ending Y-coordinate of the line
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_EnclosePoints(SDL_Point!System.Runtime.CompilerServices.IsConst*,System.Int32,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate a minimal rectangle enclosing a set of points.
+
+ If `clip` is not NULL then only points inside of the clipping rectangle are
+ considered.
+
+ \param points an array of SDL_Point structures representing points to be
+               enclosed
+ \param count the number of structures in the `points` array
+ \param clip an SDL_Rect used for clipping or NULL to enclose all points
+ \param result an SDL_Rect structure filled in with the minimal enclosing
+               rectangle
+ \returns SDL_TRUE if any points were enclosed or SDL_FALSE if all the
+          points were outside of the clipping rectangle.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_UnionRect(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate the union of two rectangles.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \param result an SDL_Rect structure filled in with the union of rectangles
+               `A` and `B`
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_IntersectRect(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate the intersection of two rectangles.
+
+ If `result` is NULL then this function will return SDL_FALSE.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \param result an SDL_Rect structure filled in with the intersection of
+               rectangles `A` and `B`
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_HasIntersection
+
+</member>
+        <member name="M:SDL_HasIntersection(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Determine whether two rectangles intersect.
+
+ If either pointer is NULL the function will return SDL_FALSE.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_IntersectRect
+
+</member>
+        <member name="M:SDL_RectEquals(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the two rectangles are equal.
+
+</member>
+        <member name="M:SDL_RectEmpty(SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the rectangle has no area.
+
+</member>
+        <member name="M:SDL_PointInRect(SDL_Point!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if point resides inside a rectangle.
+
+</member>
+        <member name="T:SDL_FRect">
+ A rectangle, with the origin at the upper left (floating point).
+
+ \sa SDL_FRectEmpty
+ \sa SDL_FRectEquals
+ \sa SDL_FRectEqualsEpsilon
+ \sa SDL_HasIntersectionF
+ \sa SDL_IntersectFRect
+ \sa SDL_IntersectFRectAndLine
+ \sa SDL_UnionFRect
+ \sa SDL_EncloseFPoints
+ \sa SDL_PointInFRect
+
+</member>
+        <member name="T:SDL_Rect">
+ A rectangle, with the origin at the upper left (integer).
+
+ \sa SDL_RectEmpty
+ \sa SDL_RectEquals
+ \sa SDL_HasIntersection
+ \sa SDL_IntersectRect
+ \sa SDL_IntersectRectAndLine
+ \sa SDL_UnionRect
+ \sa SDL_EnclosePoints
+
+</member>
+        <member name="T:SDL_FPoint">
+ The structure that defines a point (floating point)
+
+ \sa SDL_EncloseFPoints
+ \sa SDL_PointInFRect
+
+</member>
+        <member name="M:SDL_WriteBE64(SDL_RWops*,System.UInt64)">
+ Use this function to write 64 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE64
+
+</member>
+        <member name="M:SDL_WriteLE64(SDL_RWops*,System.UInt64)">
+ Use this function to write 64 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE64
+
+</member>
+        <member name="M:SDL_WriteBE32(SDL_RWops*,System.UInt32)">
+ Use this function to write 32 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE32
+
+</member>
+        <member name="M:SDL_WriteLE32(SDL_RWops*,System.UInt32)">
+ Use this function to write 32 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE32
+
+</member>
+        <member name="M:SDL_WriteBE16(SDL_RWops*,System.UInt16)">
+ Use this function to write 16 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE16
+
+</member>
+        <member name="M:SDL_WriteLE16(SDL_RWops*,System.UInt16)">
+ Use this function to write 16 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE16
+
+</member>
+        <member name="M:SDL_WriteU8(SDL_RWops*,System.Byte)">
+  \name Write endian functions
+
+  Write an item of native format to the specified endianness.
+
+ Use this function to write a byte to an SDL_RWops.
+
+ \param dst the SDL_RWops to write to
+ \param value the byte value to write
+ \returns 1 on success or 0 on failure; call SDL_GetError() for more
+          information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadU8
+
+</member>
+        <member name="M:SDL_ReadBE64(SDL_RWops*)">
+ Use this function to read 64 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 64 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE64
+
+</member>
+        <member name="M:SDL_ReadLE64(SDL_RWops*)">
+ Use this function to read 64 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 64 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE64
+
+</member>
+        <member name="M:SDL_ReadBE32(SDL_RWops*)">
+ Use this function to read 32 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 32 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE32
+
+</member>
+        <member name="M:SDL_ReadLE32(SDL_RWops*)">
+ Use this function to read 32 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 32 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE32
+
+</member>
+        <member name="M:SDL_ReadBE16(SDL_RWops*)">
+ Use this function to read 16 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 16 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE16
+
+</member>
+        <member name="M:SDL_ReadLE16(SDL_RWops*)">
+ Use this function to read 16 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 16 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE16
+
+</member>
+        <member name="M:SDL_ReadU8(SDL_RWops*)">
+  \name Read endian functions
+
+  Read an item of the specified endianness and return in native format.
+
+ Use this function to read a byte from an SDL_RWops.
+
+ \param src the SDL_RWops to read from
+ \returns the read byte on success or 0 on failure; call SDL_GetError() for
+          more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteU8
+
+</member>
+        <member name="M:SDL_LoadFile(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.UInt64*)">
+ Load all the data from a file path.
+
+ The data is allocated with a zero byte at the end (null terminated) for
+ convenience. This extra byte is not included in the value reported via
+ `datasize`.
+
+ The data should be freed with SDL_free().
+
+ Prior to SDL 2.0.10, this function was a macro wrapping around
+ SDL_LoadFile_RW.
+
+ \param file the path to read all available data from
+ \param datasize if not NULL, will store the number of bytes read
+ \returns the data, or NULL if there was an error.
+
+ \since This function is available since SDL 2.0.10.
+
+</member>
+        <member name="M:SDL_LoadFile_RW(SDL_RWops*,System.UInt64*,System.Int32)">
+ Load all the data from an SDL data stream.
+
+ The data is allocated with a zero byte at the end (null terminated) for
+ convenience. This extra byte is not included in the value reported via
+ `datasize`.
+
+ The data should be freed with SDL_free().
+
+ \param src the SDL_RWops to read all available data from
+ \param datasize if not NULL, will store the number of bytes read
+ \param freesrc if non-zero, calls SDL_RWclose() on `src` before returning
+ \returns the data, or NULL if there was an error.
+
+ \since This function is available since SDL 2.0.6.
+
+</member>
+        <member name="M:SDL_RWclose(SDL_RWops*)">
+ Close and free an allocated SDL_RWops structure.
+
+ SDL_RWclose() closes and cleans up the SDL_RWops stream. It releases any
+ resources used by the stream and frees the SDL_RWops itself with
+ SDL_FreeRW(). This returns 0 on success, or -1 if the stream failed to
+ flush to its output (e.g. to disk).
+
+ Note that if this fails to flush the stream to disk, this function reports
+ an error, but the SDL_RWops is still invalid once this function returns.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context SDL_RWops structure to close
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWwrite(SDL_RWops*,System.Void!System.Runtime.CompilerServices.IsConst*,System.UInt64,System.UInt64)">
+ Write to an SDL_RWops data stream.
+
+ This function writes exactly `num` objects each of size `size` from the
+ area pointed at by `ptr` to the stream. If this fails for any reason, it'll
+ return less than `num` to demonstrate how far the write progressed. On
+ success, it returns `num`.
+
+ SDL_RWwrite is actually a function wrapper that calls the SDL_RWops's
+ `write` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param ptr a pointer to a buffer containing data to write
+ \param size the size of an object to write, in bytes
+ \param num the number of objects to write
+ \returns the number of objects written, which will be less than **num** on
+          error; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+
+</member>
+        <member name="M:SDL_RWread(SDL_RWops*,System.Void*,System.UInt64,System.UInt64)">
+ Read from a data source.
+
+ This function reads up to `maxnum` objects each of size `size` from the
+ data source to the area pointed at by `ptr`. This function may read less
+ objects than requested. It will return zero when there has been an error or
+ the data stream is completely read.
+
+ SDL_RWread() is actually a function wrapper that calls the SDL_RWops's
+ `read` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param ptr a pointer to a buffer to read data into
+ \param size the size of each object to read, in bytes
+ \param maxnum the maximum number of objects to be read
+ \returns the number of objects read, or 0 at error or end of file; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWtell(SDL_RWops*)">
+ Determine the current read/write offset in an SDL_RWops data stream.
+
+ SDL_RWtell is actually a wrapper function that calls the SDL_RWops's `seek`
+ method, with an offset of 0 bytes from `RW_SEEK_CUR`, to simplify
+ application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a SDL_RWops data stream object from which to get the current
+                offset
+ \returns the current offset in the stream, or -1 if the information can not
+          be determined.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWseek(SDL_RWops*,System.Int64,System.Int32)">
+ Seek within an SDL_RWops data stream.
+
+ This function seeks to byte `offset`, relative to `whence`.
+
+ `whence` may be any of the following values:
+
+ - `RW_SEEK_SET`: seek from the beginning of data
+ - `RW_SEEK_CUR`: seek relative to current read point
+ - `RW_SEEK_END`: seek relative to the end of data
+
+ If this stream can not seek, it will return -1.
+
+ SDL_RWseek() is actually a wrapper function that calls the SDL_RWops's
+ `seek` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param offset an offset in bytes, relative to **whence** location; can be
+               negative
+ \param whence any of `RW_SEEK_SET`, `RW_SEEK_CUR`, `RW_SEEK_END`
+ \returns the final offset in the data stream after the seek or -1 on error.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWsize(SDL_RWops*)">
+ Use this function to get the size of the data stream in an SDL_RWops.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context the SDL_RWops to get the size of the data stream from
+ \returns the size of the data stream in the SDL_RWops on success, -1 if
+          unknown or a negative error code on failure; call SDL_GetError()
+          for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+</member>
+        <member name="M:SDL_FreeRW(SDL_RWops*)">
+ Use this function to free an SDL_RWops structure allocated by
+ SDL_AllocRW().
+
+ Applications do not need to use this function unless they are providing
+ their own SDL_RWops implementation. If you just need a SDL_RWops to
+ read/write a common data source, you should use the built-in
+ implementations in SDL, like SDL_RWFromFile() or SDL_RWFromMem(), etc, and
+ call the **close** method on those SDL_RWops pointers when you are done
+ with them.
+
+ Only use SDL_FreeRW() on pointers returned by SDL_AllocRW(). The pointer is
+ invalid as soon as this function returns. Any extra memory allocated during
+ creation of the SDL_RWops is not freed by SDL_FreeRW(); the programmer must
+ be responsible for managing that memory in their **close** method.
+
+ \param area the SDL_RWops structure to be freed
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocRW
+
+</member>
+        <member name="M:SDL_AllocRW">
+ Use this function to allocate an empty, unpopulated SDL_RWops structure.
+
+ Applications do not need to use this function unless they are providing
+ their own SDL_RWops implementation. If you just need a SDL_RWops to
+ read/write a common data source, you should use the built-in
+ implementations in SDL, like SDL_RWFromFile() or SDL_RWFromMem(), etc.
+
+ You must free the returned pointer with SDL_FreeRW(). Depending on your
+ operating system and compiler, there may be a difference between the
+ malloc() and free() your program uses and the versions SDL calls
+ internally. Trying to mix the two can cause crashing such as segmentation
+ faults. Since all SDL_RWops must free themselves when their **close**
+ method is called, all SDL_RWops must be allocated through this function, so
+ they can all be freed correctly with SDL_FreeRW().
+
+ \returns a pointer to the allocated memory on success, or NULL on failure;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeRW
+
+</member>
+        <member name="M:SDL_RWFromConstMem(System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32)">
+ Use this function to prepare a read-only memory buffer for use with RWops.
+
+ This function sets up an SDL_RWops struct based on a memory area of a
+ certain size. It assumes the memory area is not writable.
+
+ Attempting to write to this RWops stream will report an error without
+ writing to the memory buffer.
+
+ This memory buffer is not copied by the RWops; the pointer you provide must
+ remain valid until you close the stream. Closing the stream will not free
+ the original buffer.
+
+ If you need to write to a memory buffer, you should use SDL_RWFromMem()
+ with a writable buffer of memory instead.
+
+ \param mem a pointer to a read-only buffer to feed an SDL_RWops stream
+ \param size the buffer size, in bytes
+ \returns a pointer to a new SDL_RWops structure, or NULL if it fails; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+
+</member>
+        <member name="M:SDL_RWFromMem(System.Void*,System.Int32)">
+ Use this function to prepare a read-write memory buffer for use with
+ SDL_RWops.
+
+ This function sets up an SDL_RWops struct based on a memory area of a
+ certain size, for both read and write access.
+
+ This memory buffer is not copied by the RWops; the pointer you provide must
+ remain valid until you close the stream. Closing the stream will not free
+ the original buffer.
+
+ If you need to make sure the RWops never writes to the memory buffer, you
+ should use SDL_RWFromConstMem() with a read-only buffer of memory instead.
+
+ \param mem a pointer to a buffer to feed an SDL_RWops stream
+ \param size the buffer size, in bytes
+ \returns a pointer to a new SDL_RWops structure, or NULL if it fails; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWFromFP(System.Void*,SDL_bool)">
+ Use this function to create an SDL_RWops structure from a standard I/O file
+ pointer (stdio.h's `FILE*`).
+
+ This function is not available on Windows, since files opened in an
+ application on that platform cannot be used by a dynamically linked
+ library.
+
+ On some platforms, the first parameter is a `void*`, on others, it's a
+ `FILE*`, depending on what system headers are available to SDL. It is
+ always intended to be the `FILE*` type from the C runtime's stdio.h.
+
+ \param fp the `FILE*` that feeds the SDL_RWops stream
+ \param autoclose SDL_TRUE to close the `FILE*` when closing the SDL_RWops,
+                  SDL_FALSE to leave the `FILE*` open when the RWops is
+                  closed
+ \returns a pointer to the SDL_RWops structure that is created, or NULL on
+          failure; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWFromFile(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+  \name RWFrom functions
+
+  Functions to create SDL_RWops structures from various data streams.
+
+ Use this function to create a new SDL_RWops structure for reading from
+ and/or writing to a named file.
+
+ The `mode` string is treated roughly the same as in a call to the C
+ library's fopen(), even if SDL doesn't happen to use fopen() behind the
+ scenes.
+
+ Available `mode` strings:
+
+ - "r": Open a file for reading. The file must exist.
+ - "w": Create an empty file for writing. If a file with the same name
+   already exists its content is erased and the file is treated as a new
+   empty file.
+ - "a": Append to a file. Writing operations append data at the end of the
+   file. The file is created if it does not exist.
+ - "r+": Open a file for update both reading and writing. The file must
+   exist.
+ - "w+": Create an empty file for both reading and writing. If a file with
+   the same name already exists its content is erased and the file is
+   treated as a new empty file.
+ - "a+": Open a file for reading and appending. All writing operations are
+   performed at the end of the file, protecting the previous content to be
+   overwritten. You can reposition (fseek, rewind) the internal pointer to
+   anywhere in the file for reading, but writing operations will move it
+   back to the end of file. The file is created if it does not exist.
+
+ **NOTE**: In order to open a file as a binary file, a "b" character has to
+ be included in the `mode` string. This additional "b" character can either
+ be appended at the end of the string (thus making the following compound
+ modes: "rb", "wb", "ab", "r+b", "w+b", "a+b") or be inserted between the
+ letter and the "+" sign for the mixed modes ("rb+", "wb+", "ab+").
+ Additional characters may follow the sequence, although they should have no
+ effect. For example, "t" is sometimes appended to make explicit the file is
+ a text file.
+
+ This function supports Unicode filenames, but they must be encoded in UTF-8
+ format, regardless of the underlying operating system.
+
+ As a fallback, SDL_RWFromFile() will transparently open a matching filename
+ in an Android app's `assets`.
+
+ Closing the SDL_RWops will close the file handle SDL is holding internally.
+
+ \param file a UTF-8 string representing the filename to open
+ \param mode an ASCII string representing the mode to be used for opening
+             the file.
+ \returns a pointer to the SDL_RWops structure that is created, or NULL on
+          failure; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="T:SDL_RWops">
+Return the size of the file in this rwops, or -1 if unknown
+
+
+  Seek to \c offset relative to \c whence, one of stdio's whence values:
+  RW_SEEK_SET, RW_SEEK_CUR, RW_SEEK_END
+
+  \return the final offset in the data stream, or -1 on error.
+
+
+  Read up to \c maxnum objects each of size \c size from the data
+  stream to the area pointed at by \c ptr.
+
+  \return the number of objects read, or 0 at error or end of file.
+
+
+  Write exactly \c num objects each of size \c size from the area
+  pointed at by \c ptr to data stream.
+
+  \return the number of objects written, or 0 at error or end of file.
+
+
+  Close and free an allocated SDL_RWops structure.
+
+  \return 0 if successful or -1 on write error when flushing data.
+
+</member>
+        <member name="M:SDL_ClearError">
+ Clear any previous error message for this thread.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetError
+ \sa SDL_SetError
+
+</member>
+        <member name="M:SDL_GetErrorMsg(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte*,System.Int32)">
+ Get the last error message that was set for the current thread.
+
+ This allows the caller to copy the error string into a provided buffer, but
+ otherwise operates exactly the same as SDL_GetError().
+
+ \param errstr A buffer to fill with the last error message that was set for
+               the current thread
+ \param maxlen The size of the buffer pointed to by the errstr parameter
+ \returns the pointer passed in as the `errstr` parameter.
+
+ \since This function is available since SDL 2.0.14.
+
+ \sa SDL_GetError
+
+</member>
+        <member name="M:SDL_GetError">
+ Retrieve a message about the last error that occurred on the current
+ thread.
+
+ It is possible for multiple errors to occur before calling SDL_GetError().
+ Only the last error is returned.
+
+ The message is only applicable when an SDL function has signaled an error.
+ You must check the return values of SDL function calls to determine when to
+ appropriately call SDL_GetError(). You should *not* use the results of
+ SDL_GetError() to decide if an error has occurred! Sometimes SDL will set
+ an error string even when reporting success.
+
+ SDL will *not* clear the error string for successful API calls. You *must*
+ check return values for failure cases before you can assume the error
+ string applies.
+
+ Error strings are set per-thread, so an error set in a different thread
+ will not interfere with the current thread's operation.
+
+ The returned string is internally allocated and must not be freed by the
+ application.
+
+ \returns a message with information about the specific error that occurred,
+          or an empty string if there hasn't been an error message set since
+          the last call to SDL_ClearError(). The message is only applicable
+          when an SDL function has signaled an error. You must check the
+          return values of SDL function calls to determine when to
+          appropriately call SDL_GetError().
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ClearError
+ \sa SDL_SetError
+
+</member>
+        <member name="M:SDL_CalculateGammaRamp(System.Single,System.UInt16*)">
+ Calculate a 256 entry gamma ramp for a gamma value.
+
+ \param gamma a gamma value where 0.0 is black and 1.0 is identity
+ \param ramp an array of 256 values filled in with the gamma ramp
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_SetWindowGammaRamp
+
+</member>
+        <member name="M:SDL_GetRGBA(System.UInt32,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte*,System.Byte*,System.Byte*,System.Byte*)">
+ Get RGBA values from a pixel in the specified format.
+
+ This function uses the entire 8-bit [0..255] range when converting color
+ components from pixel formats with less than 8-bits per RGB component
+ (e.g., a completely white pixel in 16-bit RGB565 format would return [0xff,
+ 0xff, 0xff] not [0xf8, 0xfc, 0xf8]).
+
+ If the surface has no alpha component, the alpha will be returned as 0xff
+ (100% opaque).
+
+ \param pixel a pixel value
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r a pointer filled in with the red component
+ \param g a pointer filled in with the green component
+ \param b a pointer filled in with the blue component
+ \param a a pointer filled in with the alpha component
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_MapRGB
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_GetRGB(System.UInt32,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte*,System.Byte*,System.Byte*)">
+ Get RGB values from a pixel in the specified format.
+
+ This function uses the entire 8-bit [0..255] range when converting color
+ components from pixel formats with less than 8-bits per RGB component
+ (e.g., a completely white pixel in 16-bit RGB565 format would return [0xff,
+ 0xff, 0xff] not [0xf8, 0xfc, 0xf8]).
+
+ \param pixel a pixel value
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r a pointer filled in with the red component
+ \param g a pointer filled in with the green component
+ \param b a pointer filled in with the blue component
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGB
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_MapRGBA(SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte,System.Byte,System.Byte,System.Byte)">
+ Map an RGBA quadruple to a pixel value for a given pixel format.
+
+ This function maps the RGBA color value to the specified pixel format and
+ returns the pixel value best approximating the given RGBA color value for
+ the given pixel format.
+
+ If the specified pixel format has no alpha component the alpha value will
+ be ignored (as it will be in formats with a palette).
+
+ If the format has a palette (8-bit) the index of the closest matching color
+ in the palette will be returned.
+
+ If the pixel format bpp (color depth) is less than 32-bpp then the unused
+ upper bits of the return value can safely be ignored (e.g., with a 16-bpp
+ format the return value can be assigned to a Uint16, and similarly a Uint8
+ for an 8-bpp format).
+
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r the red component of the pixel in the range 0-255
+ \param g the green component of the pixel in the range 0-255
+ \param b the blue component of the pixel in the range 0-255
+ \param a the alpha component of the pixel in the range 0-255
+ \returns a pixel value
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGB
+
+</member>
+        <member name="M:SDL_MapRGB(SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte,System.Byte,System.Byte)">
+ Map an RGB triple to an opaque pixel value for a given pixel format.
+
+ This function maps the RGB color value to the specified pixel format and
+ returns the pixel value best approximating the given RGB color value for
+ the given pixel format.
+
+ If the format has a palette (8-bit) the index of the closest matching color
+ in the palette will be returned.
+
+ If the specified pixel format has an alpha component it will be returned as
+ all 1 bits (fully opaque).
+
+ If the pixel format bpp (color depth) is less than 32-bpp then the unused
+ upper bits of the return value can safely be ignored (e.g., with a 16-bpp
+ format the return value can be assigned to a Uint16, and similarly a Uint8
+ for an 8-bpp format).
+
+ \param format an SDL_PixelFormat structure describing the pixel format
+ \param r the red component of the pixel in the range 0-255
+ \param g the green component of the pixel in the range 0-255
+ \param b the blue component of the pixel in the range 0-255
+ \returns a pixel value
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_FreePalette(SDL_Palette*)">
+ Free a palette created with SDL_AllocPalette().
+
+ \param palette the SDL_Palette structure to be freed
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+
+</member>
+        <member name="M:SDL_SetPaletteColors(SDL_Palette*,SDL_Color!System.Runtime.CompilerServices.IsConst*,System.Int32,System.Int32)">
+ Set a range of colors in a palette.
+
+ \param palette the SDL_Palette structure to modify
+ \param colors an array of SDL_Color structures to copy into the palette
+ \param firstcolor the index of the first palette entry to modify
+ \param ncolors the number of entries to modify
+ \returns 0 on success or a negative error code if not all of the colors
+          could be set; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_SetPixelFormatPalette(SDL_PixelFormat*,SDL_Palette*)">
+ Set the palette for a pixel format structure.
+
+ \param format the SDL_PixelFormat structure that will use the palette
+ \param palette the SDL_Palette structure that will be used
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+ \sa SDL_FreePalette
+
+</member>
+        <member name="M:SDL_AllocPalette(System.Int32)">
+ Create a palette structure with the specified number of color entries.
+
+ The palette entries are initialized to white.
+
+ \param ncolors represents the number of color entries in the color palette
+ \returns a new SDL_Palette structure on success or NULL on failure (e.g. if
+          there wasn't enough memory); call SDL_GetError() for more
+          information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreePalette
+
+</member>
+        <member name="M:SDL_FreeFormat(SDL_PixelFormat*)">
+ Free an SDL_PixelFormat structure allocated by SDL_AllocFormat().
+
+ \param format the SDL_PixelFormat structure to free
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+
+</member>
+        <member name="M:SDL_AllocFormat(System.UInt32)">
+ Create an SDL_PixelFormat structure corresponding to a pixel format.
+
+ Returned structure may come from a shared global cache (i.e. not newly
+ allocated), and hence should not be modified, especially the palette. Weird
+ errors such as `Blit combination not supported` may occur.
+
+ \param pixel_format one of the SDL_PixelFormatEnum values
+ \returns the new SDL_PixelFormat structure or NULL on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeFormat
+
+</member>
+        <member name="M:SDL_MasksToPixelFormatEnum(System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Convert a bpp value and RGBA masks to an enumerated pixel format.
+
+ This will return `SDL_PIXELFORMAT_UNKNOWN` if the conversion wasn't
+ possible.
+
+ \param bpp a bits per pixel value; usually 15, 16, or 32
+ \param Rmask the red mask for the format
+ \param Gmask the green mask for the format
+ \param Bmask the blue mask for the format
+ \param Amask the alpha mask for the format
+ \returns one of the SDL_PixelFormatEnum values
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_PixelFormatEnumToMasks
+
+</member>
+        <member name="M:SDL_PixelFormatEnumToMasks(System.UInt32,System.Int32*,System.UInt32*,System.UInt32*,System.UInt32*,System.UInt32*)">
+ Convert one of the enumerated pixel formats to a bpp value and RGBA masks.
+
+ \param format one of the SDL_PixelFormatEnum values
+ \param bpp a bits per pixel value; usually 15, 16, or 32
+ \param Rmask a pointer filled in with the red mask for the format
+ \param Gmask a pointer filled in with the green mask for the format
+ \param Bmask a pointer filled in with the blue mask for the format
+ \param Amask a pointer filled in with the alpha mask for the format
+ \returns SDL_TRUE on success or SDL_FALSE if the conversion wasn't
+          possible; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_MasksToPixelFormatEnum
+
+</member>
+        <member name="M:SDL_GetPixelFormatName(System.UInt32)">
+ Get the human readable name of a pixel format.
+
+ \param format the pixel format to query
+ \returns the human readable name of the specified pixel format or
+          `SDL_PIXELFORMAT_UNKNOWN` if the format isn't recognized.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="T:SDL_PixelFormat">
+\note Everything in the pixel format structure is read-only.
+
+</member>
+        <member name="T:SDL_Color">
+The bits of this structure can be directly reinterpreted as an integer-packed
+color which uses the SDL_PIXELFORMAT_RGBA32 format (SDL_PIXELFORMAT_ABGR8888
+on little-endian systems and SDL_PIXELFORMAT_RGBA8888 on big-endian systems).
+
+</member>
+        <member name="M:SDL_size_add_overflow(System.UInt64,System.UInt64,System.UInt64*)">
+ If a + b would overflow, return -1. Otherwise store a + b via ret
+ and return 0.
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_size_mul_overflow(System.UInt64,System.UInt64,System.UInt64*)">
+ If a * b would overflow, return -1. Otherwise store a * b via ret
+ and return 0.
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_iconv_string(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.UInt64)">
+ This function converts a string between encodings in one pass, returning a
+ string that must be freed with SDL_free() or NULL on error.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_GetNumAllocations">
+ Get the number of outstanding (unfreed) allocations
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_SetMemoryFunctions(=FUNC:System.Void*(System.UInt64),=FUNC:System.Void*(System.UInt64,System.UInt64),=FUNC:System.Void*(System.Void*,System.UInt64),=FUNC:System.Void(System.Void*))">
+ Replace SDL's memory allocation functions with a custom set
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_GetMemoryFunctions(=FUNC:System.Void*(System.UInt64)*,=FUNC:System.Void*(System.UInt64,System.UInt64)*,=FUNC:System.Void*(System.Void*,System.UInt64)*,=FUNC:System.Void(System.Void*)*)">
+ Get the current set of SDL memory functions
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_GetOriginalMemoryFunctions(=FUNC:System.Void*(System.UInt64)*,=FUNC:System.Void*(System.UInt64,System.UInt64)*,=FUNC:System.Void*(System.Void*,System.UInt64)*,=FUNC:System.Void(System.Void*)*)">
+ Get the original set of SDL memory functions
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_malloc(System.UInt64)">
+\endcond 
+  \file begin_code.h
+
+  This file sets things up for C dynamic library function definitions,
+  static inlined functions, and structures aligned at 4-byte alignment.
+  If you don't like ugly C preprocessor code, don't look at this file. :)
+
+</member>
+        <member name="D:SDL_compile_time_assert_uint8">
+\name Floating-point constants
+
+\cond 
+</member>
+        <member name="D:Uint64">
+\brief An unsigned 64-bit integer type.
+
+</member>
+        <member name="D:Sint64">
+\brief A signed 64-bit integer type.
+
+</member>
+        <member name="D:Uint32">
+\brief An unsigned 32-bit integer type.
+
+</member>
+        <member name="D:Sint32">
+\brief A signed 32-bit integer type.
+
+</member>
+        <member name="D:Uint16">
+\brief An unsigned 16-bit integer type.
+
+</member>
+        <member name="D:Sint16">
+\brief A signed 16-bit integer type.
+
+</member>
+        <member name="D:Uint8">
+\brief An unsigned 8-bit integer type.
+
+</member>
+        <member name="D:Sint8">
+\brief A signed 8-bit integer type.
+
+</member>
+        <member name="D:int8_t">
+  \file close_code.h
+
+  This file reverses the effects of begin_code.h and should be included
+  after you finish any function and structure declarations in your headers
+
+</member>
+        <member name="M:SDL_GetPlatform">
+  \file SDL_stdinc.h
+
+  This is a general header that includes C language support.
+
+  \file SDL_platform.h
+
+  Try to get a standard set of platform defines.
+
+  \file begin_code.h
+
+  This file sets things up for C dynamic library function definitions,
+  static inlined functions, and structures aligned at 4-byte alignment.
+  If you don't like ugly C preprocessor code, don't look at this file. :)
+
+ Get the name of the platform.
+
+ Here are the names returned for some (but not all) supported platforms:
+
+ - "Windows"
+ - "Mac OS X"
+ - "Linux"
+ - "iOS"
+ - "Android"
+
+ \returns the name of the platform. If the correct platform name is not
+          available, returns a string beginning with the text "Unknown".
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SHADE.SHSystem.Exit">
+*!*************************************************************************
+</member>
+        <member name="M:SHADE.Application.Quit">
+            <summary>
+Marks the application to stop at the end of the current frame.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsFullscreen">
+            <summary>
+Whether or not the application is currently in fullscreen mode or not.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.WindowHeight">
+            <summary>
+Retrieves the designated height of the current window.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.WindowWidth">
+            <summary>
+Retrieves the designated width of the current window.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsPaused">
+            <summary>
+Whether or not the engine is in a paused state where script updates and
+physics are not in play.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsPlaying">
+            <summary>
+Whether or not the engine is playing. This will always be true on Publish.
+On Debug/Release builds, this is true when the editor is in Play Mode. It
+will also be true even if the editor is in Play Mode but is paused.
+</summary>
+        </member>
+        <member name="T:SHADE.Application">
+            <summary>
+Static class that contains useful properties for querying the state of the
+engine.
+</summary>
+        </member>
+        <member name="M:SHADE.Transform.SetParent(SHADE.Transform,System.Boolean)">
+            <summary>
+Sets the parent of this Transform component.
+</summary>
+            <param name="parent">
+Entity that contains the Transform component that this Transform will be
+parented to. If null, unparenting will occur.
+</param>
+            <param name="worldPositionStays">
+If true, the transform values of this Transform component will retain their
+pre-parent-change global transforms. The local transform values will be
+modified to ensure that the global transforms do not change.
+</param>
+        </member>
+        <member name="P:SHADE.Transform.Parent">
+            <summary>
+Parent Transform that affects this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalScale">
+            <summary>
+Global scale stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalEulerAngles">
+            <summary>
+Global euler angle rotations stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalRotation">
+            <summary>
+Global rotation quaternion stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalPosition">
+            <summary>
+Global position stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalScale">
+            <summary>
+Local scale stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalEulerAngles">
+            <summary>
+Local euler angle rotations stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalRotation">
+            <summary>
+Local rotation quaternion stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalPosition">
+            <summary>
+Local position stored by this Transform.
+</summary>
+        </member>
+        <member name="M:SHADE.Transform.#ctor(System.UInt32)">
+            <summary>
+Constructs a Transform Component that represents a native Transform component
+tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Transform">
+            <summary>
+CLR version of the SHADE Engine's TransformComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.Math.CompareFloat(System.Single,System.Single,System.Single)">
+            <summary>
+Compares if two float values are close enough to be the same with the
+specified tolerance value.
+</summary>
+            <param name="a">One of the values to compare.</param>
+            <param name="b">The other value to compare.</param>
+            <param name="tolerance">Tolerance for floating point comparison.</param>
+            <returns>True if a and b are practically the same.</returns>
+        </member>
+        <member name="M:SHADE.Math.CompareFloat(System.Single,System.Single)">
+            <summary>
+Compares if two float values are close enough to be the same with a tolerance
+of Epsilon.
+</summary>
+            <param name="a">One of the values to compare.</param>
+            <param name="b">The other value to compare.</param>
+            <returns>True if a and b are practically the same.</returns>
+        </member>
+        <member name="M:SHADE.Math.InverseLerp(System.Single,System.Single,System.Single)">
+            <summary>
+Calculates the linear parameter t that produces the interpolant value within
+the range [a, b].
+</summary>
+            <param name="a">Start value.</param>
+            <param name="b">End value.</param>
+            <param name="value">Value between start and end.</param>
+            <returns>Percentage of value between start and end.</returns>
+        </member>
+        <member name="M:SHADE.Math.LerpUnclamped(System.Single,System.Single,System.Single)">
+            <summary>
+Linearly interpolates between a and b by t. 
+The parameter t is not clamped and a value based on a and b is supported. 
+If t is less than zero, or greater than one, then LerpUnclamped will result 
+in a return value outside the range a to b.
+</summary>
+            <param name="a">The start value.</param>
+            <param name="b">The end value.</param>
+            <param name="t">The interpolation value between the two float.</param>
+            <returns>The interpolated float result between the two float values.</returns>
+        </member>
+        <member name="M:SHADE.Math.Lerp(System.Single,System.Single,System.Single)">
+            <summary>
+Linearly interpolates between a and b by t. 
+The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">The start value.</param>
+            <param name="b">The end value.</param>
+            <param name="t">The interpolation value between the two float.</param>
+            <returns>The interpolated float result between the two float values.</returns>
+        </member>
+        <member name="M:SHADE.Math.RadiansToDegrees(System.Single)">
+            <summary>
+Converts an angle from radian representation to degree representation.
+</summary>
+            <param name="radians">Radian-based angle to convert.</param>
+            <returns>The specified angle in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Math.DegreesToRadians(System.Single)">
+            <summary>
+Converts an angle from degree representation to radian representation.
+</summary>
+            <param name="degrees">Degree-based angle to convert.</param>
+            <returns>The specified angle in radians.</returns>
+        </member>
+        <member name="M:SHADE.Math.Wrap(System.Single,System.Single,System.Single)">
+            <summary>
+Wraps a value if they get to low or too high. 
+</summary>
+            <param name="value">Value to wrap.</param>
+            <param name="min">Minimum value to wrap at.</param>
+            <param name="max">Maximum value to wrap at.</param>
+            <returns>Wrapped value.</returns>
+        </member>
+        <member name="F:SHADE.Math.Epsilon">
+            <summary>
+Small value used for single precision floating point comparisons.
+</summary>
+        </member>
+        <member name="F:SHADE.Math.Rad2Deg">
+            <summary>
+Radians-to-degrees conversion constant
+</summary>
+        </member>
+        <member name="F:SHADE.Math.Deg2Rad">
+            <summary>
+Degrees-to-radians conversion constant
+</summary>
+        </member>
+        <member name="T:SHADE.Math">
+            <summary>
+Contains utility Math functions.
+</summary>
+        </member>
+        <member name="M:SHADE.Debug.LogExceptionNative(std.exception!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a native exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Native exception to log.</param>
+            <param name="throwerName">Name of the one responsible for the exception.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogExceptionNative(System.Exception,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="throwerName">Name of the one responsible for the exception.</param>
+            <param name="exception">Exception to log.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(std.exception!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Object)">
+            <summary>
+Logs a native exception that is formatted nicely to the output.
+Equivalent to calling
+LogException(exception, Convert::ToNative(thrower-&gt;GetType()-&gt;Name));
+</summary>
+            <param name="exception">Native exception to log.</param>
+            <param name="thrower">
+Object that threw the exception to label the exception message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(System.Exception,System.Object)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Exception to log.</param>
+            <param name="thrower">
+Object that threw the exception to label the exception message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(System.Exception)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Exception to log.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String,System.String)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogErrorNative(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String,System.Object)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="thrower">
+Object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String)">
+            <summary>
+Logs a error message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a error message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,System.String)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,System.Object)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="thrower">
+Object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String)">
+            <summary>
+Logs a warning message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a warning message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,System.String)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,System.Object)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="owner">
+Object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String)">
+            <summary>
+Logs a message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="T:SHADE.Debug">
+            <summary>
+Static class that contains the functions for working with time.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.LightLayer">
+            <summary>
+Material used to render this Renderable.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.Material">
+            <summary>
+Material used to render this Renderable.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.Mesh">
+            <summary>
+Mesh used to render this Renderable.
+</summary>
+        </member>
+        <member name="M:SHADE.Renderable.#ctor(System.UInt32)">
+            <summary>
+Constructs a Renderable Component that represents a native Renderable 
+component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Renderable">
+            <summary>
+CLR version of the SHADE Engine's SHRenderableComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.Material.GetProperty``1(System.String)">
+            <summary>
+Retrieves the value of a specified property on the material.
+</summary>
+            <typeparam name="T">Type of property to get.</typeparam>
+            <param name="name">Name of the property to get.</param>
+            <returns>Value of that property on the material.</returns>
+            <exception cref="!:System.InvalidOperationException">
+If this Material object is invalid.
+</exception>
+            <exception cref="!:System.ArgumentException">
+If the name or type was specified that does not match the material's shader's
+defined properties.
+</exception>
+        </member>
+        <member name="M:SHADE.Material.SetProperty``1(System.String,``0)">
+            <summary>
+Set the value of a specific property.
+</summary>
+            <typeparam name="T">Type of property to set.</typeparam>
+            <param name="name">Name of the property to set.</param>
+            <param name="value">Value to set te property to.</param>
+            <exception cref="!:System.InvalidOperationException">
+If this Material object is invalid.
+</exception>
+            <exception cref="!:System.ArgumentException">
+If the name or type was specified that does not match the material's shader's
+defined properties.
+</exception>
+        </member>
+        <member name="M:SHADE.Material.#ctor(SHADE.Handle&lt;SHADE.SHMaterialInstance&gt;)">
+            <summary>
+Constructor for the Material
+</summary>
+            <param name="material">Handle to the native material object.</param>
+        </member>
+        <member name="T:SHADE.Material">
+            <summary>
+Managed counterpart of the native MaterialInstance object containing material 
+data that can be fed to Renderables for rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Mesh.#ctor(SHADE.Handle&lt;SHADE.SHMesh&gt;)">
+            <summary>
+Constructor for the Mesh
+</summary>
+            <param name="mesh">Handle to the mesh object.</param>
+        </member>
+        <member name="T:SHADE.Mesh">
+            <summary>
+Managed counterpart of the native Mesh object containing vertex data that can
+be fed to Renderables for rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.SHMatrix.Decompose(SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHQuaternion*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+@brief Decomposes a transformation matrix into translation, orientation and scale.
+@param[out] scale        The scaling factor of the matrix.
+@param[out] orientation  The orientation of the matrix.
+@param[out] translation  The translation of the matrix.
+@return True if decomposition was successful.
+
+</member>
+        <member name="M:SHADE.SHMatrix.Decompose(SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+@brief Decomposes a transformation matrix into translation, euler angles and scale.
+@param[out] scale        The scaling factor of the matrix.
+@param[out] rotation     The euler angles of the matrix.
+@param[out] translation  The translation of the matrix.
+@return True if decomposition was successful.
+
+</member>
+        <member name="T:SHADE.SHMatrix">
+@brief Interface for a Column-Major Row Vector 4x4 Matrix.
+
+</member>
+        <member name="M:SHADE.RigidBody.#ctor(System.UInt32)">
+            <summary>
+Constructs a RigidBody Component that represents a native 
+SHRigidBodyComponent component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.RigidBody">
+            <summary>
+CLR version of the the SHADE Engine's SHRigidBodyComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.ECS.createManagedComponent``1(System.UInt32)">
+            <summary>
+Creates an instance of the Managed representation of a Component with a
+native Entity.
+</summary>
+            <typeparam name="T">Type of Component to create.</typeparam>
+            <param name="entity">Native Entity that this Component is tied to.</param>
+            <returns>The created Managed representation of the Component.</returns>
+        </member>
+        <member name="M:SHADE.ECS.#cctor">
+            <summary>
+Static constructor to initialize static data
+</summary>
+        </member>
+        <member name="T:SHADE.ECS.ComponentSet">
+            <summary>
+Pointer to a function for Component manipulation operations.
+</summary>
+            <summary>
+Contains a set of Component related data used for resolving operations for
+each Component.
+</summary>
+        </member>
+        <member name="M:SHADE.ECS.RemoveComponent``1(System.UInt32)">
+            <summary>
+Removes a Component from the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to remove.</typeparam>
+            <param name="entity">
+Entity object that should have the specified Component removed from/
+</param>
+        </member>
+        <member name="M:SHADE.ECS.HasComponent``1(System.UInt32)">
+            <summary>
+Checks if the specified Entity has the specified Component.
+</summary>
+            <typeparam name="T">Type of the Component to check for.</typeparam>
+            <param name="entity">Entity object to check for the Component.</param>
+            <returns>
+True if the specified Entity has the specified Component. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.EnsureComponent``1(System.UInt32)">
+            <summary>
+Ensures a Component on the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to ensure.</typeparam>
+            <param name="entity"> Entity object to ensure the Component on. </param>
+            <returns>Reference to the Component.</returns>
+        </member>
+        <member name="M:SHADE.ECS.GetComponentInChildren``1(System.UInt32)">
+            <summary>
+Retrieves the first Component from the specified GameObjectt's children that
+matches the specified type.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <param name="entity"> Entity object to get the Component from. </param>
+            <returns>
+Reference to the Component or null if the Entity does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.GetComponent``1(System.UInt32)">
+            <summary>
+Gets a Component from the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <param name="entity"> Entity object to get the Component from. </param>
+            <returns>
+Reference to the Component or null if the Entity does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.AddComponent``1(System.UInt32)">
+            <summary>
+Adds a Component to the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to add.</typeparam>
+            <param name="entity">
+Entity object that should have the specified Component added to.
+</param>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="T:SHADE.ECS">
+            <summary>
+Static class which contains functions that map Pls::ECS's Component manipulation
+functions to managed generic functions.
+</summary>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.Equals(SHADE.BaseComponent)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="F:SHADE.BaseComponent.owner">
+            <summary>
+Entity that this Component belongs to.
+</summary>
+        </member>
+        <member name="M:SHADE.BaseComponent.#ctor(System.UInt32)">
+            <summary>
+Constructor for BaseComponent to tie it to a specific Entity.
+Constructors of derived Components should call this Constructor.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="M:SHADE.BaseComponent.op_Implicit(SHADE.BaseComponent)~System.Boolean">
+            <summary>
+Implicit conversion operator to enable checking if a component is null.
+</summary>
+            <param name="c">Component to check.</param>
+        </member>
+        <member name="M:SHADE.BaseComponent.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">Type of PLushieScripts to remove.</typeparam>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetScripts``1">
+            <summary>
+Retrieves a immutable list of Scripts of the specified type from this
+GameObject.
+</summary>
+            <typeparam name="T">Type of Scripts to Get.</typeparam>
+            <returns>Immutable list of Scripts of the specified type.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetScript``1">
+            <summary>
+Retrieves a Script of the specified type from this GameObject.
+If multiple Scripts of the same specified type are added on the same
+GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.AddScript``1">
+            <summary>
+Adds a Script of the specified type to this GameObject.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the created Script.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.RemoveComponent``1">
+            <summary>
+Removes a Component from this GameObject. If no Component exists to begin
+with, nothing happens.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetComponent``1">
+            <summary>
+Gets a Component from this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if this GameObject does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.AddComponent``1">
+            <summary>
+Adds a Component to this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to add. </typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="P:SHADE.BaseComponent.Owner">
+            <summary>
+Retrieves the GameObject that this Component belongs to.
+</summary>
+        </member>
+        <member name="T:SHADE.BaseComponent">
+            <summary>
+Class that serves as the base for a wrapper class to Components in native code.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onCollisionExit(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and leaves a 
+collision with another GameObject with a Collider2D.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onCollisionStay(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and collides with
+another GameObject with a Collider in subsequent frames of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onCollisionEnter(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and collides with
+another GameObject with a Collider in the first frame of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerExit(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and leaves a 
+collision with another GameObject with a Collider2D.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerStay(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and collides with
+another GameObject with a Collider in subsequent frames of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerEnter(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and collides with
+another GameObject with a Collider in the first frame of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onDestroy">
+            <summary>
+Called just before the end of the frame where the attached GameObject or
+this script is destroyed directly or indirectly due to destruction of the
+owner.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.lateUpdate">
+            <summary>
+Called every frame after physics and collision resolution but before
+rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.update">
+            <summary>
+Called every frame before physics and collision resolution.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.fixedUpdate">
+            <summary>
+Called every frame in sync with Physics update steps and thus in most cases
+will execute more than update() will. This will be called immediately before
+a Physics update step.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.start">
+            <summary>
+Called on the first frame that the attached GameObject is active but always
+after Awake().
+</summary>
+        </member>
+        <member name="M:SHADE.Script.awake">
+            <summary>
+Called on the first frame that the attached GameObject is active if they are
+a part of the scene.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onDetatched">
+            <summary>
+Called immediately once this script is detached from a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onAttached">
+            <summary>
+Called immediately once this script is attached to a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.#ctor(SHADE.GameObject)">
+            <summary>
+Constructor for Script to tie it to a specific GameObject.
+Constructors of derived Scripts should call this Constructor.
+</summary>
+            <param name="gameObj">
+GameObject that this Script will be tied to.
+</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerExit(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerExit(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerStay(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerStay(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerEnter(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerEnter(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionExit(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionExit(). This should be called when a collision ends
+between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionStay(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionStay(). This should be called when a collision is
+persistent between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionEnter(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionEnter(). This should be called when a collision is
+detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnDestroy">
+            <summary>
+Used to call onDestroy(). This should be called at the end of the frame
+where the attached GameObject or this script is destroyed directly or
+indirectly due to destruction of the owner.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.LateUpdate">
+            <summary>
+Used to call lateUpdate(). This should be called every frame after physics
+and collision resolution but before rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Update">
+            <summary>
+Used to call update(). This should be called every frame before physics and
+collision resolution.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.FixedUpdate">
+            <summary>
+Used to call fixedUpdate(). This should be called in sync with Physics
+update steps and thus in most cases will execute more than Update() will.
+This will be called immediately before a Physics update step.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Start">
+            <summary>
+Used to call start(). This should be called on the first frame that the
+attached GameObject is active but always after Awake().
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Awake">
+            <summary>
+Used to call awake(). This should be called on the first frame that the
+attached GameObject is active if they are a part of the scene.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.OnDetached">
+            <summary>
+Used to call onDetached(). This is called immediately when this script is
+detached from a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.OnAttached">
+            <summary>
+Used to call onAttached(). This is called immediately when this script is
+attached to a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.op_Implicit(SHADE.Script)~System.Boolean">
+            <summary>
+Implicit conversion operator to enable checking if a component is null.
+</summary>
+            <param name="c">Component to check.</param>
+        </member>
+        <member name="M:SHADE.Script.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">
+Type of script to remove.
+This needs to be a default constructable Script.
+</typeparam>
+        </member>
+        <member name="M:SHADE.Script.GetScripts``1">
+            <summary>
+Retrieves a immutable list of scripts from the specified Entity that
+matches the specified type.
+<br />
+Note that this function allocates. It should be used sparingly.
+</summary>
+            <typeparam name="T">
+Type of scripts to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>
+Immutable list of references to scripts of the specified type.
+</returns>
+        </member>
+        <member name="M:SHADE.Script.GetScriptInChildren``1">
+            <summary>
+Retrieves the first Script from this GameObject's children that matches the
+specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.GetScript``1">
+            <summary>
+Retrieves the first Script from this GameObject that matches the specified
+type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.AddScript``1">
+            <summary>
+Adds a Script to this GameObject.
+</summary>
+            <typeparam name="T">
+Type of script to add.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.RemoveComponent``1">
+            <summary>
+Removes a Component from the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to remove. Must be derived from BaseComponent.
+</typeparam>
+        </member>
+        <member name="M:SHADE.Script.EnsureComponent``1">
+            <summary>
+Ensures a Component on the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to ensure. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component.</returns>
+        </member>
+        <member name="M:SHADE.Script.GetComponentInChildren``1">
+            <summary>
+Retrieves the first Component from this GameObject's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">
+Type of the Component to get. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was retrieved.</returns>
+        </member>
+        <member name="M:SHADE.Script.GetComponent``1">
+            <summary>
+Gets a Component from the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to get. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was retrieved.</returns>
+        </member>
+        <member name="M:SHADE.Script.AddComponent``1">
+            <summary>
+Adds a Component to the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to add. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="P:SHADE.Script.Owner">
+            <summary>
+GameObject that this Script belongs to.
+</summary>
+        </member>
+        <member name="T:SHADE.Script">
+            <summary>
+Class that forms the basis of all "script"-objects that can be attached to
+Entities to update each Entity's Components via C# code.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.RigidBody">
+            <summary>
+The RigidBody that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.CollisionShape">
+            <summary>
+The CollisionShape of the Collider that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.Collider">
+            <summary>
+The Collider that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.GameObject">
+            <summary>
+The GameObject whose collider you are colliding with.
+</summary>
+        </member>
+        <member name="T:SHADE.CollisionInfo">
+            <summary>
+Struct that describes a collision
+</summary>
+        </member>
+        <member name="M:SHADE.GameObject.op_Inequality(SHADE.GameObject,SHADE.GameObject)">
+            <summary>
+Checks if two GameObject references are different.
+</summary>
+            <param name="lhs">GameObject to check.</param>
+            <param name="rhs">Another GameObject to check with.</param>
+            <returns>True if both Components are different.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.op_Equality(SHADE.GameObject,SHADE.GameObject)">
+            <summary>
+Checks if two GameObject references are the same.
+</summary>
+            <param name="lhs">GameObject to check.</param>
+            <param name="rhs">Another GameObject to check with.</param>
+            <returns>True if both Components are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Equals(SHADE.GameObject)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetNativeEntity">
+            <summary>
+Retrieves the native Entity object that this GameObject represents.
+</summary>
+            <returns>Native Entity object that this GameObject represents.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetEntity">
+            <summary>
+Retrieves the CLR Entity object that this GameObject represents.
+</summary>
+            <returns>Entity object that this GameObject represents.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.#ctor(System.UInt32)">
+            <summary>
+Constructor for the GameObject.
+</summary>
+            <param name="entity">
+Managed numerical representation of the ECS Entity that this GameObject
+should represent.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.#ctor(SHADE.SHEntity!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Constructor for the GameObject.
+</summary>
+            <param name="entity">
+The ECS Entity that this GameObject should represent.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">Type of PLushieScripts to remove.</typeparam>
+        </member>
+        <member name="M:SHADE.GameObject.GetScripts``1">
+            <summary>
+Retrieves a immutable list of Scripts of the specified type from this
+GameObject.
+</summary>
+            <typeparam name="T">Type of Scripts to retrieve.</typeparam>
+            <returns>Immutable list of Scripts of the specified type.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetScriptInChildren``1">
+            <summary>
+Retrieves a Script of the specified type from child GameObjects.
+If multiple Scripts of the same specified type are added on the same
+child GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to retrieve.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetScript``1">
+            <summary>
+Retrieves a Script of the specified type from this GameObject.
+If multiple Scripts of the same specified type are added on the same
+GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to retrieve.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.AddScript``1">
+            <summary>
+Adds a Script of the specified type to this GameObject.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the created Script.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.RemoveComponent``1">
+            <summary>
+Removes a Component from this GameObject. If no Component exists to begin
+with, nothing happens.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+        </member>
+        <member name="M:SHADE.GameObject.EnsureComponent``1">
+            <summary>
+Ensures a Component on this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to ensure.</typeparam>
+            <returns>
+Reference to the Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetComponentInChildren``1">
+            <summary>
+Retrieves the first Component from this GameObject's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if neither of this GameObject's children
+does not have the specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetComponent``1">
+            <summary>
+Gets a Component from this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if this GameObject does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.AddComponent``1">
+            <summary>
+Adds a Component to this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to add. </typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.SetActive(System.Boolean)">
+            <summary>
+Sets the active state of this GameObject.
+<br />
+The actual "activeness" of this GameObject is still dependent on the parents'
+active states.
+</summary>
+            <param name="active">
+Whether to activate or deactivate this GameObject.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.SetName(System.String)">
+            <summary>
+Sets the name of this GameObject.
+</summary>
+            <param name="name">The name to set.</param>
+        </member>
+        <member name="P:SHADE.GameObject.EntityId">
+            <summary>
+Native Entity ID value for this GameObject.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.IsActiveInHierarchy">
+            <summary>
+Whether or not this Entity is active in the Scene hierarchy.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.IsActiveSelf">
+            <summary>
+Whether or not this Entity alone, is active. This does not mean that this 
+object is active in the scene. For example, if this Entity's parent is not
+active, then this Entity would also be not active.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.Name">
+            <summary>
+Name of the object that this Entity represents.
+</summary>
+        </member>
+        <member name="M:SHADE.GameObject.Find(System.String)">
+            <summary>
+Retrieves a GameObject with the specified name. If there are multiple
+GameObjects with the same name, the first found GameObject will be retrieved.
+There is no guaranteed order of which GameObject is considered "first".
+</summary>
+            <param name="name">Name of the GameObject to find.</param>
+            <returns>GameObject that has the specified name. Null if not found.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Destroy(SHADE.GameObject)">
+            <summary>
+Destroys the specified GameObject. Note that the specified GameObject will no 
+longer be a valid GameObject after this function is called.
+</summary>
+            <param name="obj">The GameObject to be destroyed.</param>
+        </member>
+        <member name="M:SHADE.GameObject.Create">
+            <summary>
+Creates a new GameObject in the current Scene. If multiple Scenes are loaded,
+and you would like to create an object in a specific Scene, call the Scene's
+CreateGameObject().
+</summary>
+            <returns>GameObject that represents the newly created GameObject.</returns>
+        </member>
+        <member name="T:SHADE.GameObject">
+            <summary>
+Lightweight object for an PlushieEngine Entity that allows for easy access 
+to Component and Script operations.
+</summary>
+        </member>
+        <member name="M:SHADE.RangeAttribute.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor for a Tooltip attribute that fills in the description.
+</summary>
+            <param name="description">Text to be shown when a field is hovered.</param>
+        </member>
+        <member name="P:SHADE.RangeAttribute.Max">
+            <summary>
+Maximum value for the Ranged field.
+</summary>
+        </member>
+        <member name="P:SHADE.RangeAttribute.Min">
+            <summary>
+Minimum value for the Ranged field.
+</summary>
+        </member>
+        <member name="T:SHADE.RangeAttribute">
+            <summary>
+Simple attribute to constrain the range of values for a field on the editor.
+</summary>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native std::Stringto a managed String.
+</summary>
+            <param name="str">The native std::string to convert from.</param>
+            <returns>Managed copy of a native std::string.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(System.String)">
+            <summary>
+Converts from a managed String to a native std::string.
+</summary>
+            <param name="str">The managed String to convert from.</param>
+            <returns>Native copy of a managed String.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHRay!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector2 to a managed Vector2.
+</summary>
+            <param name="vec">The native Vector2 to convert from.</param>
+            <returns>Managed copy of a native Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHQuaternion!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Quaternion to a managed Quaternion.
+</summary>
+            <param name="quat">The native Quaternion to convert from.</param>
+            <returns>Managed copy of a native Quaternion.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Quaternion)">
+            <summary>
+Converts from a managed Quaternion to a native Quaternion.
+</summary>
+            <param name="quat">The managed Quaternion to convert from.</param>
+            <returns>Native copy of a managed Quaternion.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHVec2!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector2 to a managed Vector2.
+</summary>
+            <param name="vec">The native Vector2 to convert from.</param>
+            <returns>Managed copy of a native Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Vector2)">
+            <summary>
+Converts from a managed Vector2 to a native Vector2.
+</summary>
+            <param name="vec">The managed Vector2 to convert from.</param>
+            <returns>Native copy of a managed Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHVec3!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector3 to a managed Vector3.
+</summary>
+            <param name="vec">The native Vector3 to convert from.</param>
+            <returns>Managed copy of a native Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Vector3)">
+            <summary>
+Converts from a managed Vector3 to a native Vector3.
+</summary>
+            <param name="vec">The managed Vector3 to convert from.</param>
+            <returns>Native copy of a managed Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHEntity)">
+            <summary>
+Converts from a native Entity to a managed Entity (UInt32).
+</summary>
+            <param name="entity">Native Entity to convert from.</param>
+            <returns>Managed representation of the specified Entity.</returns>
+        </member>
+        <member name="T:SHADE.Convert">
+            <summary>
+Provides functions easy and consistent syntax for converting between custom
+managed and native types that are aligned.
+</summary>
+        </member>
+        <member name="M:SHADE.GenericHandle.op_Implicit~System.Boolean">
+            <summary>
+Converts to true if this is a valid Handle.
+</summary>
+        </member>
+        <member name="P:SHADE.GenericHandle.Library">
+            <summary>
+The library that the handle was issued by.
+</summary>
+        </member>
+        <member name="P:SHADE.GenericHandle.Id">
+            <summary>
+The internal ID of the handle.
+</summary>
+        </member>
+        <member name="M:SHADE.Ray.#ctor(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a ray starting at origin along direction.
+</summary>
+            <param name="origin">Source of the ray.</param>
+            <param name="direction">Direction the ray travels in.</param>
+        </member>
+        <member name="F:SHADE.Ray.Direction">
+            <summary>
+The direction that a ray travels in.
+</summary>
+        </member>
+        <member name="F:SHADE.Ray.Origin">
+            <summary>
+The start point of the ray.
+</summary>
+        </member>
+        <member name="T:SHADE.Ray">
+            <summary>
+CLR version of the the SHADE Engine's Ray class that represents a ray in
+3-Dimensional space.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.op_Equality(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Are two quaternions equal to each other?
+</summary>
+            <param name="lhs">Left-hand side quaternion.</param>
+            <param name="rhs">Right-hand side quaternion.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.op_Multiply(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Combines rotations lhs and rhs.
+</summary>
+            <param name="lhs">Left-hand side quaternion.</param>
+            <param name="rhs">Right-hand side quaternion.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.SlerpUnclamped(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Spherically interpolates between a and b by t. The parameter t is not clamped.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Slerp(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Spherically interpolates between quaternions a and b by ratio t. The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">Start value, returned when t = 0.</param>
+            <param name="b">End value, returned when t = 1.</param>
+            <param name="t">Interpolation ratio.</param>
+            <returns> A quaternion spherically interpolated between quaternions a and b.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.RotateTowards(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Rotates a rotation from towards to. <br />
+The from quaternion is rotated towards to by an angular step of maxDegreesDelta (but note that the rotation will not overshoot).
+Negative values of maxDegreesDelta will move away from to until the rotation is exactly the opposite direction.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Normalize(SHADE.Quaternion)">
+            <summary>
+Converts this quaternion to one with the same orientation but with a magnitude of 1.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.LookRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation with the specified forward and upwards directions. <br />
+Z axis will be aligned with forward, X axis aligned with cross product between forward and upwards, and Y axis aligned with cross product between Z and X.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.LerpUnclamped(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Interpolates between a and b by t and normalizes the result afterwards. The parameter t is not clamped.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Lerp(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Interpolates between a and b by t and normalizes the result afterwards. The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">Start value, returned when t = 0.</param>
+            <param name="b">End value, returned when t = 1.</param>
+            <param name="t">Interpolation ratio.</param>
+            <returns> A quaternion interpolated between quaternions a and b.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Inverse(SHADE.Quaternion)">
+            <summary>
+Returns the Inverse of rotation.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.FromToRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates from fromDirection to toDirection.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Euler(System.Single,System.Single,System.Single)">
+            <summary>
+Returns a rotation that rotates y degrees around the y axis, x degrees around the x axis, and z degrees around the z axis; applied in that order.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Dot(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+The dot product between two rotations.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.AngleAxis(System.Single,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates angle degrees around axis.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Angle(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Returns the angle in degrees between two rotations a and b.<br /></summary>
+            <returns>The angle in degrees between the two vectors. </returns>
+        </member>
+        <member name="M:SHADE.Quaternion.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Equals(SHADE.Quaternion)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.ToAngleAxis(System.ValueType!System.Single!System.Runtime.CompilerServices.IsBoxed@,System.ValueType!SHADE.Vector3!System.Runtime.CompilerServices.IsBoxed@)">
+            <summary>
+Converts a rotation to angle-axis representation (angles in degrees).
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.SetLookRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation with the specified forward and upwards directions. <br />
+The result is applied to this quaternion.
+If used to orient a Transform, the Z axis will be aligned with forward and the Y axis with upwards, assuming these vectors are orthogonal.
+Logs an error if the forward direction is zero.
+</summary>
+            <param name="view">The direction to look in.</param>
+            <param name="up">The vector that defines in which direction up is.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.SetFromToRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates from fromDirection to toDirection. <br />
+Use this to create a rotation which starts at the first Vector (fromDirection) and rotates to the second Vector (toDirection).
+These Vectors must be set up in a script.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.#ctor(System.Single,System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Quaternion with the specified components.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+            <param name="_z">Z-coordinate to set.</param>
+            <param name="_z">W-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Quaternion.w">
+            <summary>
+W-component of the Quaternion. Do not directly modify quaternions.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.z">
+            <summary>
+Z-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.y">
+            <summary>
+Y-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.x">
+            <summary>
+X-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.Identity">
+            <summary>
+Shorthand for writing Quaternion(0, 0, 0, 1).
+</summary>
+        </member>
+        <member name="T:SHADE.Quaternion">
+            <summary>
+CLR version of SHADE's Quaternion class that represents an orientation.
+Designed to closely match Unity's Quaternion struct.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector3.op_Explicit(SHADE.Vector2)~SHADE.Vector3">
+            <summary>
+Explicit conversion operator to enable explicit casting from a Vector2 to a
+Vector3.
+</summary>
+            <param name="vec">Vector2 to convert from.</param>
+        </member>
+        <member name="M:SHADE.Vector3.op_Explicit(SHADE.Vector3)~SHADE.Vector2">
+            <summary>
+Explicit conversion operator to enable explicit casting from a Vector3 to a
+Vector2.
+</summary>
+            <param name="vec">Vector3 to convert from.</param>
+        </member>
+        <member name="M:SHADE.Vector3.op_Inequality(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two Vector3s are not approximately equal. This is equivalent to 
+calling !Vector3.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector3 to compare.</param>
+            <param name="rhs">Another Vector3 to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Equality(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two Vector3s are approximately equal. This is equivalent to 
+calling Vector3.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector3 to compare.</param>
+            <param name="rhs">Another Vector3 to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Division(SHADE.Vector3,System.Single)">
+            <summary>
+Calculates the division of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector3 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,System.Single)">
+            <summary>
+Calculates the multiplication of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Division(SHADE.Vector3,System.Double)">
+            <summary>
+Calculates the division of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector3 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,System.Double)">
+            <summary>
+Calculates the multiplication of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Calculates the component-wise multiplication of two Vector3s and returns the
+result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Another Vector3 to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Subtraction(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Subtracts a Vector3 from another Vector3 and returns the result.
+</summary>
+            <param name="lhs">Vector3 to subtract from.</param>
+            <param name="rhs">Another Vector3 to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Addition(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Adds two Vector3s together and returns the result.
+</summary>
+            <param name="lhs">Vector3 to add.</param>
+            <param name="rhs">Another Vector3 to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Vector3.MoveTowards(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Moves a point current towards target.
+Similar to Lerp(), however, the function will ensure that the distance never
+exceeds maxDistanceDelta. Negative values of maxDistanceDelta pushes the
+vector away from target
+</summary>
+            <param name="current">The current position of the point.</param>
+            <param name="target">The target position to move to.</param>
+            <param name="maxDistanceDelta">Maximum distance moved per call.</param>
+            <returns>Vector representing the moved point.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.LerpUnclamped(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="a">The start Vector3, returned when t = 0.0f.</param>
+            <param name="b">The end Vector3, returned when t = 1.0f.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Lerp(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="a">The start Vector3, returned when t = 0.0f.</param>
+            <param name="b">The end Vector3, returned when t = 1.0f.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Max(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 that is made from the largest components of 
+the two specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate maximum Vector3 with.</param>
+            <param name="rhs">Another Vector3 to calculate maximum Vector3 with.</param>
+            <returns>
+The Vector3 that contains the largest components of the two specified 
+Vector3s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Min(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 that is made from the smallest components of 
+the two specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate minimum Vector3 with.</param>
+            <param name="rhs">Another Vector3 to calculate minimum Vector3 with.</param>
+            <returns>
+The Vector3 that contains the smallest components of the two specified
+Vector3s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.RotateDegrees(SHADE.Vector3,System.Single)">
+            <summary>
+Rotates a Vector3 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector3 to rotate.</param>
+            <param name="degrees">
+Angle to rotate the vector by in an anti-clockwise direction in degrees.
+</param>
+            <returns>The Vector3 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.RotateRadians(SHADE.Vector3,System.Single)">
+            <summary>
+Rotates a Vector3 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector3 to rotate.</param>
+            <param name="radians">
+Angle to rotate the vector by in an anti-clockwise direction in radians.
+</param>
+            <returns>The Vector3 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Reflect(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Reflects a Vector3 across another Vector3.
+</summary>
+            <param name="vec">A Vector3 to reflect.</param>
+            <param name="normal">A normal to reflect the Vector3 across.</param>
+            <returns>The Vector3 that represents vec reflected across normal.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Project(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 projection.
+</summary>
+            <param name="vec">Vector3 to project.</param>
+            <param name="direction">Vector3 to project onto.</param>
+            <returns>The Vector3 that represents the projected vec onto direction.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Cross(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns the cross product of 2 specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate cross product with.</param>
+            <param name="rhs">Another Vector3 to calculate cross product with.</param>
+            <returns>The cross product of the two Vector3s.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Dot(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns the dot product of 2 specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate dot product with.</param>
+            <param name="rhs">Another Vector3 to calculate dot product with.</param>
+            <returns>Scalar value representing the dot product of the two Vector3s.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNear(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Checks if two specified Vector3s are near in value.
+</summary>
+            <param name="lhs">Vector3 to check if is near in value.</param>
+            <param name="rhs">Another Vector3 to check if is near in value.</param>
+            <param name="tolerance">Amount of tolerance to do the comparison with.</param>
+            <returns>
+True if the two Vector3s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNear(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two specified Vector3s are near in value.
+</summary>
+            <param name="lhs">Vector3 to check if is near in value.</param>
+            <param name="rhs">Another Vector3 to check if is near in value.</param>
+            <returns>
+True if the two Vector3s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Equals(SHADE.Vector3)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNearPoint(SHADE.Vector3,System.Single)">
+            <summary>
+Checks if a specified point is near this Vector3 that represents a point.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <param name="tolerance">
+The amount of tolerance before we consider these points as "near".
+</param>
+            <returns>
+True if this Vector3 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNearPoint(SHADE.Vector3)">
+            <summary>
+Checks if a specified point is near this Vector3 that represents a point with
+a tolerance value of PLS_EPSILON.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <returns>
+True if this Vector3 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Angle2DFromRightDegrees">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -180.0f and 180.0f.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Angle2DFromRightRadians">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -Math.PI and Math.PI.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in radians.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetSqrMagnitude">
+            <summary>
+Calculates and returns the squared magnitude of this Vector3.
+</summary>
+            <returns>Returns the squared length of this Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetMagnitude">
+            <summary>
+Calculates and returns the magnitude of this Vector3. Note that this function
+incurs a performance cost from the square root calculation. If you do not 
+need the precise magnitude, consider using GetSqrMagnitude() instead.
+</summary>
+            <returns>Returns the length of this Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetNormalised">
+            <summary>
+Creates a copy of this Vector3 and returns a normalized version. 
+</summary>
+            <returns>
+Returns a normalised copy of this Vector3. 
+If this Vector3 is a zero vector, a zero vector will be returned.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Normalise">
+            <summary>
+Normalises this current Vector3. This changes the data of this Vector3. 
+If you would like to get a copy, use GetNormalised() instead. 
+This function does nothing to a zero vector.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(SHADE.Vector2)">
+            <summary>
+Conversion constructor to construct a Vector3 using a Vector2.
+</summary>
+            <param name="vec" />
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+            <param name="_z">Z-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components with the 
+Z-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components with the 
+Y and Z-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Vector3.z">
+            <summary>
+Z-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.y">
+            <summary>
+Y-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.x">
+            <summary>
+X-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Zero">
+            <summary>
+Shorthand for writing Vector3(0, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Up">
+            <summary>
+Shorthand for writing Vector3(0, 1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Right">
+            <summary>
+Shorthand for writing Vector3(1, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.PositiveInfinity">
+            <summary>
+Shorthand for writing Vector3(float.PositiveInfinity, 
+float.PositiveInfinity, float.PositiveInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.One">
+            <summary>
+Shorthand for writing Vector3(1, 1, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.NegativeInfinity">
+            <summary>
+Shorthand for writing Vector3(float.NegativeInfinity, 
+float.NegativeInfinity, float.NegativeInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Left">
+            <summary>
+Shorthand for writing Vector3(-1, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Forward">
+            <summary>
+Shorthand for writing Vector3(0, 0, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Down">
+            <summary>
+Shorthand for writing Vector3(0, -1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Back">
+            <summary>
+Shorthand for writing Vector3(0, 0, -1).
+</summary>
+        </member>
+        <member name="T:SHADE.Vector3">
+            <summary>
+CLR version of SHADE Engine's Vector3 class that represents a 3-Dimensional Vector.
+Designed to closely match Unity's Vector3 struct.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector2.op_Inequality(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two Vector2s are not approximately equal. This is equivalent to 
+calling !Vector2.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector2 to compare.</param>
+            <param name="rhs">Another Vector2 to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Equality(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two Vector2s are approximately equal. This is equivalent to 
+calling Vector2.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector2 to compare.</param>
+            <param name="rhs">Another Vector2 to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Division(SHADE.Vector2,System.Single)">
+            <summary>
+Calculates the division of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector2 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,System.Single)">
+            <summary>
+Calculates the multiplication of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Division(SHADE.Vector2,System.Double)">
+            <summary>
+Calculates the division of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector2 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,System.Double)">
+            <summary>
+Calculates the multiplication of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Calculates the component-wise multiplication of two Vector2s and returns the
+result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Another Vector2 to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Subtraction(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Subtracts a Vector2 from another Vector2 and returns the result.
+</summary>
+            <param name="lhs">Vector2 to subtract from.</param>
+            <param name="rhs">Another Vector2 to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Addition(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Adds two Vector2s together and returns the result.
+</summary>
+            <param name="lhs">Vector2 to add.</param>
+            <param name="rhs">Another Vector2 to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Vector2.MoveTowards(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Moves a point current towards target.
+Similar to Lerp(), however, the function will ensure that the distance never
+exceeds maxDistanceDelta. Negative values of maxDistanceDelta pushes the
+vector away from target
+</summary>
+            <param name="current">The current position of the point.</param>
+            <param name="target">The target position to move to.</param>
+            <param name="maxDistanceDelta">Maximum distance moved per call.</param>
+            <returns>Vector representing the moved point.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.LerpUnclamped(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="a">The start Vector2, returned when t = 0.0f.</param>
+            <param name="b">The end Vector2, returned when t = 1.0f.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Lerp(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="a">The start Vector2, returned when t = 0.0f.</param>
+            <param name="b">The end Vector2, returned when t = 1.0f.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Max(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 that is made from the largest components of 
+the two specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate maximum Vector2 with.</param>
+            <param name="rhs">Another Vector2 to calculate maximum Vector2 with.</param>
+            <returns>
+The Vector2 that contains the largest components of the two specified 
+Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Min(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 that is made from the smallest components of 
+the two specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate minimum Vector2 with.</param>
+            <param name="rhs">Another Vector2 to calculate minimum Vector2 with.</param>
+            <returns>
+The Vector2 that contains the smallest components of the two specified
+Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.RotateDegrees(SHADE.Vector2,System.Single)">
+            <summary>
+Rotates a Vector2 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector2 to rotate.</param>
+            <param name="degrees">
+Angle to rotate the vector by in an anti-clockwise direction in degrees.
+</param>
+            <returns>The Vector2 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.RotateRadians(SHADE.Vector2,System.Single)">
+            <summary>
+Rotates a Vector2 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector2 to rotate.</param>
+            <param name="radians">
+Angle to rotate the vector by in an anti-clockwise direction in radians.
+</param>
+            <returns>The Vector2 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Reflect(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Reflects a Vector2 across another Vector2.
+</summary>
+            <param name="vec">A Vector2 to reflect.</param>
+            <param name="normal">A normal to reflect the Vector2 across.</param>
+            <returns>The Vector2 that represents vec reflected across normal.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Project(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 projection.
+</summary>
+            <param name="vec">Vector2 to project.</param>
+            <param name="direction">Vector2 to project onto.</param>
+            <returns>The Vector2 that represents the projected vec onto direction.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Perpendicular(SHADE.Vector2,System.Boolean)">
+            <summary>
+Computes a perpendicular Vector2 to the specified Vector2.
+</summary>
+            <param name="lhs">Vector2 to find a perpendicular of.</param>
+            <param name="inward">
+Whether the inward perpendicular Vector is retrieved. If true, the
+resultant vector is rotated 90-degrees in a counter-clockwise.
+</param>
+            <returns>The perpendicular Vector2 relative to the specified Vector2.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Perpendicular(SHADE.Vector2)">
+            <summary>
+Computes the inward perpendicular Vector2 to the specified Vector2.
+Equivalent to calling Perpendicular(lhs, true). This means, the
+resultant Vector2 is rotated 90-degrees in a counter-clockwise.
+</summary>
+            <param name="lhs">Vector2 to find a perpendicular of.</param>
+            <returns>
+The perpendicular Vector2 relative to the specified Vector2.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Dot(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns the dot product of 2 specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate dot product with.</param>
+            <param name="rhs">Another Vector2 to calculate dot product with.</param>
+            <returns>
+Scalar value representing the dot product of the two Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNear(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Checks if two specified Vector2s are near in value.
+</summary>
+            <param name="lhs">Vector2 to check if is near in value.</param>
+            <param name="rhs">Another Vector2 to check if is near in value.</param>
+            <param name="tolerance">
+Amount of tolerance to do the comparison with.
+</param>
+            <returns>
+True if the two Vector2s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNear(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two specified Vector2s are near in value.
+</summary>
+            <param name="lhs">Vector2 to check if is near in value.</param>
+            <param name="rhs">Another Vector2 to check if is near in value.</param>
+            <returns>
+True if the two Vector2s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Equals(SHADE.Vector2)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNearPoint(SHADE.Vector2,System.Single)">
+            <summary>
+Checks if a specified point is near this Vector2 that represents a point.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <param name="tolerance">
+The amount of tolerance before we consider these points as "near".
+</param>
+            <returns>
+True if this Vector2 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNearPoint(SHADE.Vector2)">
+            <summary>
+Checks if a specified point is near this Vector2 that represents a point with
+a tolerance value of PLS_EPSILON.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <returns>
+True if this Vector2 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.AngleFromRightDegrees">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -180.0f and 180.0f.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.AngleFromRightRadians">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -Math.PI and Math.PI.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in radians.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetSqrMagnitude">
+            <summary>
+Calculates and returns the squared magnitude of this Vector2.
+</summary>
+            <returns>Returns the squared length of this Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetMagnitude">
+            <summary>
+Calculates and returns the magnitude of this Vector2. Note that this function
+incurs a performance cost from the square root calculation. If you do not 
+need the precise magnitude, consider using GetSqrMagnitude() instead.
+</summary>
+            <returns>Returns the length of this Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetNormalised">
+            <summary>
+Creates a copy of this Vector2 and returns a normalized version. 
+</summary>
+            <returns>
+Returns a normalised copy of this Vector2. 
+If this Vector2 is a zero vector, a zero vector will be returned.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Normalise">
+            <summary>
+Normalises this current Vector2. This changes the data of this Vector2. 
+If you would like to get a copy, use GetNormalised() instead. 
+This function does nothing to a zero vector.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector2.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector2 with the specified components..
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector2.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Vector2 with the specified components with the 
+Y-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Vector2.y">
+            <summary>
+Y-component of the Vector2.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.x">
+            <summary>
+X-component of the Vector2.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Zero">
+            <summary>
+Shorthand for writing Vector2(0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Up">
+            <summary>
+Shorthand for writing Vector2(0, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Right">
+            <summary>
+Shorthand for writing Vector2(1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.PositiveInfinity">
+            <summary>
+Shorthand for writing Vector2(float.PositiveInfinity, 
+float.PositiveInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.One">
+            <summary>
+Shorthand for writing Vector2(1, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.NegativeInfinity">
+            <summary>
+Shorthand for writing Vector2(float.NegativeInfinity, 
+float.NegativeInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Left">
+            <summary>
+Shorthand for writing Vector2(-1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Down">
+            <summary>
+Shorthand for writing Vector2(0, -1).
+</summary>
+        </member>
+        <member name="T:SHADE.Vector2">
+            <summary>
+CLR version of SHADE Engine's Vector2 class that represents a 2-Dimensional Vector.
+Designed to closely match Unity's Vector2 struct.
+</summary>
+        </member>
+        <member name="M:SHADE.EntityUtils.IsValid(System.ValueType!System.UInt32!System.Runtime.CompilerServices.IsBoxed)">
+            <summary>
+Checks if the specified entity is valid. This is done by checking if it
+matches Pls::Entity::INVALID.
+</summary>
+            <param name="entity">The Entity to check.</param>
+            <returns>True if the specified Entity is valid.</returns>
+        </member>
+        <member name="T:SHADE.EntityUtils">
+            <summary>
+Static class that contains useful utility functions for working with Entity.
+</summary>
+        </member>
+        <member name="T:SHADE.SHResourceHub">
+            <summary>
+Manages all resources in multiple ResourceLibraries.
+</summary>
+        </member>
+        <member name="T:SHADE.SHResourceLibraryBase">
+            <summary>
+Base class for SHResourceLibrary that holds information about the library type.
+</summary>
+        </member>
+        <member name="T:SHADE.Handle{System.Void}">
+            <summary>
+Template Specialization for Handle that represents a type-less Handle.
+</summary>
+        </member>
+        <member name="M:SHADE.HandleBase.op_Implicit~System.Boolean">
+            <summary>
+Converts to true if this is a valid Handle.
+</summary>
+        </member>
+        <member name="T:SHADE.HandleBase.Id">
+            <summary>
+Native ID type of a handle
+</summary>
+        </member>
+        <member name="T:SHADE.HandleBase">
+            <summary>
+Base implementation of the Handle that is not templated to allow for holding
+generic non-type-specific Handles.
+</summary>
+        </member>
+        <member name="T:SHADE.BadHandleCastException">
+            <summary>
+Exception thrown when a generic Handle is being casted to the wrong type.
+</summary>
+        </member>
+        <member name="T:SHADE.InvalidHandleException">
+            <summary>
+Exception thrown when an invalid Handle was dereferenced.
+</summary>
+        </member>
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SDL_acos(System.Double)'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputCheckbox(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputUnsignedInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputFloat(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputDouble(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputAngle(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32,System.Int32,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32,System.UInt32,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single,System.Single,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double,System.Double,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec2(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec2*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec3(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*,System.Single)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputTextField(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputEnumCombo(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.vector<std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>,std.allocator<std.basic_string<System.SByte!System.Runtime.Co'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputCheckbox(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputUnsignedInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputFloat(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputDouble(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputAngle(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32,System.Int32,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32,System.UInt32,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single,System.Single,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double,System.Double,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec2(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec2*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec3(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*,System.Single)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputTextField(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputEnumCombo(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.vector<std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>,std.allocator<std.basic_string<System.SByte!System.Runtime.Co'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+    </members>
+</doc>
\ No newline at end of file
diff --git a/bin/Release/SHADE_CSharp.xml b/bin/Release/SHADE_CSharp.xml
new file mode 100644
index 00000000..daeaa3c5
--- /dev/null
+++ b/bin/Release/SHADE_CSharp.xml
@@ -0,0 +1,1029 @@
+<?xml version="1.0"?>
+<doc>
+    <assembly>
+        <name>SHADE_CSharp</name>
+    </assembly>
+    <members>
+        <member name="T:SHADE.ICallbackAction">
+            <summary>
+            Interface for a CallbackAction that all variants inherit from.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.IsRuntimeAction">
+            <summary>
+            Whether or not this CallbackAction is runtime assigned. If it is, then the
+            TargetMethodName and TargetObject properties are invalid.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.TargetMethodName">
+            <summary>
+            Name of the method that this CallbackAction is using.
+            </summary>
+        </member>
+        <member name="P:SHADE.ICallbackAction.TargetObject">
+            <summary>
+            Object which the specified target method is called on.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`1">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 1 parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`1.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.#ctor(System.Action{`0})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`1.Invoke(`0)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`2">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 2 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`2.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.#ctor(System.Action{`0,`1})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`2.Invoke(`0,`1)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`3">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 3 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`3.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.#ctor(System.Action{`0,`1,`2})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`3.Invoke(`0,`1,`2)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`4">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 4 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`4.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.#ctor(System.Action{`0,`1,`2,`3})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`4.Invoke(`0,`1,`2,`3)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`5">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 5 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`5.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.#ctor(System.Action{`0,`1,`2,`3,`4})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`5.Invoke(`0,`1,`2,`3,`4)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`6">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 6 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`6.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.#ctor(System.Action{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`6.Invoke(`0,`1,`2,`3,`4,`5)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`7">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 7 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`7.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`7.Invoke(`0,`1,`2,`3,`4,`5,`6)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`8">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 8 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`8.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`8.Invoke(`0,`1,`2,`3,`4,`5,`6,`7)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`9">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 9 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`9.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`9.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackAction`10">
+            <summary>
+            Represents a function call that can be serialised and put togetheer with scripts.
+            This variant accepts functions with 10 parameters.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.TargetObject">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.TargetMethodName">
+            <inheritdoc/>
+        </member>
+        <member name="P:SHADE.CallbackAction`10.IsRuntimeAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor">
+            <summary>
+            Constructs an empty Callback action.
+            </summary>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to the specified static 
+            method.
+            </summary>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs a CallbackAction that represents a call to a specified member 
+            method on the specified target.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+            <exception cref="T:System.ArgumentException">
+            Thrown if a method that is not compatible with the target is specified. The method's
+            source type must match the target's type.
+            </exception>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.#ctor(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Constructs a Callback action based on an action.
+            </summary>
+            <param name="action">Action that wraps a function to be called.</param>
+        </member>
+        <member name="M:SHADE.CallbackAction`10.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8,`9)">
+            <summary>
+            Invokes the CallbackAction's stored method/action with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.ICallbackEvent">
+            <summary>
+            Interface for a CallbackEvent that all variants inherit from.
+            </summary>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.RegisterAction">
+            <summary>
+            Registers an empty ICallbackAction.
+            </summary>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.RegisterAction(SHADE.ICallbackAction)">
+            <summary>
+            Registers an ICallbackAction with the event such that it will be called in
+            future
+            </summary>
+            <param name="action">ICallbackAction to register with.</param>
+        </member>
+        <member name="M:SHADE.ICallbackEvent.DeregisterAction(SHADE.ICallbackAction)">
+            <summary>
+            Deregisters an ICallbackAction that was previously added. This should
+            only emit a warning if an action that was not previous added was 
+            provided.
+            </summary>
+            <param name="action">ICallbackAction to remove.</param>
+        </member>
+        <member name="P:SHADE.ICallbackEvent.Actions">
+            <summary>
+            Iterable set of ICallbackActions that were registered to this event.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`1">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`1.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(SHADE.CallbackAction{`0})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(System.Action{`0})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`1.Invoke(`0)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`2">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`2.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(SHADE.CallbackAction{`0,`1})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(System.Action{`0,`1})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`2.Invoke(`0,`1)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`3">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`3.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(SHADE.CallbackAction{`0,`1,`2})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(System.Action{`0,`1,`2})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`3.Invoke(`0,`1,`2)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`4">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`4.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(System.Action{`0,`1,`2,`3})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`4.Invoke(`0,`1,`2,`3)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`5">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`5.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(System.Action{`0,`1,`2,`3,`4})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`5.Invoke(`0,`1,`2,`3,`4)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`6">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`6.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`6.Invoke(`0,`1,`2,`3,`4,`5)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`7">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`7.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`7.Invoke(`0,`1,`2,`3,`4,`5,`6)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`8">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`8.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`8.Invoke(`0,`1,`2,`3,`4,`5,`6,`7)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`9">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`9.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`9.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+        <member name="T:SHADE.CallbackEvent`10">
+            <summary>
+            A container of CallbackActions that is correlated to a specific scenario as
+            specified by the user of this class.
+            This variant accepts CallbackEvents with 1 generic parameter.
+            </summary>
+        </member>
+        <member name="P:SHADE.CallbackEvent`10.Actions">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(SHADE.CallbackAction{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Adds a CallbackAction into the event.
+            </summary>
+            <param name="action">CallbackAction to add.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(System.Action{`0,`1,`2,`3,`4,`5,`6,`7,`8,`9})">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="action">System.Action to add as a CallbackAction.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.RegisterAction(System.Object,System.Reflection.MethodInfo)">
+            <summary>
+            Constructs and adds a CallbackACtion into the event.
+            </summary>
+            <param name="target">Object to call the method on.</param>
+            <param name="method">Method to call.</param>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.DeregisterAction(SHADE.ICallbackAction)">
+            <inheritdoc/>
+        </member>
+        <member name="M:SHADE.CallbackEvent`10.Invoke(`0,`1,`2,`3,`4,`5,`6,`7,`8,`9)">
+            <summary>
+            Invokes all stored CallbackActions with the specified parameters.
+            </summary>
+        </member>
+    </members>
+</doc>
diff --git a/bin/Release/SHADE_Managed.xml b/bin/Release/SHADE_Managed.xml
new file mode 100644
index 00000000..7b653116
--- /dev/null
+++ b/bin/Release/SHADE_Managed.xml
@@ -0,0 +1,6250 @@
+<?xml version="1.0"?>
+<doc>
+    <assembly>
+        "SHADE_Managed"
+    </assembly>
+    <members>
+        <member name="M:SHADE.Input.GetMouseReleasedTime(SHADE.Input.MouseCode)">
+            <summary>
+Retrieves the duration that the specified key has not been held or was last
+not been held for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseHeldTime(SHADE.Input.MouseCode)">
+            <summary>
+Retrieves the duration that the specified key has been held or was last held
+for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyReleasedTime(SHADE.Input.KeyCode)">
+            <summary>
+Retrieves the duration that the specified key has not been held or was last
+not been held for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyHeldTime(SHADE.Input.KeyCode)">
+            <summary>
+Retrieves the duration that the specified key has been held or was last held
+for.
+</summary>
+            <param name="key">The key to check.</param>
+            <returns>Time in seconds that the key was held.</returns>
+        </member>
+        <member name="M:SHADE.Input.SetMousePosition(SHADE.Vector2)">
+            <summary>
+Sets the position of the mouse cursor relative to the top left corner of the
+window.
+</summary>
+            <param name="pos">
+Position of the mouse in window pixel coordinates to set.
+</param>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButtonUp(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is no longer pressed and was pressed
+before.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>
+True during the frame the user releases the given mouse button.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButtonDown(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is pressed and was not pressed before.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>
+True during the frame the user pressed the given mouse button.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetMouseButton(SHADE.Input.MouseCode)">
+            <summary>
+Checks if a specified mouse button is being held down.
+This will also be true if GetMouseButtonDown() is true.
+</summary>
+            <param name="mouseButton">MouseCode of the mouse button to check.</param>
+            <returns>True while the user holds down the mouse button specified.</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyUp(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is no longer pressed pressed and was pressed
+before.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>
+True during the frame the user releases the key identified by name.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKeyDown(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is pressed and was not pressed before.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>
+True during the frame the user starts pressing down the key specified.
+</returns>
+        </member>
+        <member name="M:SHADE.Input.GetKey(SHADE.Input.KeyCode)">
+            <summary>
+Checks if a specified key is being held down.
+This will also be true if GetKeyDown() is true.
+</summary>
+            <param name="key">KeyCode of the key to check.</param>
+            <returns>True while the user holds down the key specified.</returns>
+        </member>
+        <member name="P:SHADE.Input.MouseScrollDelta">
+            <summary>
+Amnount of vertical mouse scroll in this frame.
+</summary>
+        </member>
+        <member name="P:SHADE.Input.MousePosition">
+            <summary>
+Mouse position in screen coordinates relative to the top left of the window.
+This value is a Vector3 for compatibility with functions that have Vector3 
+arguments. The z component of the Vector3 is always 0
+</summary>
+        </member>
+        <member name="T:SHADE.Input.MouseCode">
+            <summary>
+Represents the available supported mouse keycodes that can be passed into the 
+mouse-button-based Input functions.
+</summary>
+        </member>
+        <member name="T:SHADE.Input.KeyCode">
+            <summary>
+Represents the available supported keycodes that can be passed into the 
+key-based Input functions.
+
+Attempting to follow https://docs.unity3d.com/ScriptReference/KeyCode.html
+Win32 keycodes are shift-insensitive, i.e. 'A' and 'a' are the same keycode and '1' and '!' are the same keycode
+</summary>
+        </member>
+        <member name="T:SHADE.Input">
+            <summary>
+Static class responsible for providing access to Input-related functionality.
+</summary>
+        </member>
+        <member name="T:SHADE.SerializeField">
+            <summary>
+Simple attribute to mark that a field in a Script should be serialised.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.Exit">
+            <summary>
+Cleans up all required components for managed code.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.ReloadScriptAssembly">
+            <summary>
+Reloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+Equivalent to calling UnloadScriptAssembly() and then LoadScriptAssembly().
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.LoadScriptAssembly">
+            <summary>
+Loads the managed script assembly. Ensure this is only called after
+UnloadScriptAssembly() has been called.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.UnloadScriptAssembly">
+            <summary>
+Unloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.EngineInterface.Init">
+            <summary>
+Initialises all required components for managed code.
+</summary>
+        </member>
+        <member name="F:SHADE.EngineInterface.ManagedLibraryName">
+            <summary>
+Name of the Managed Library that contains the C# scripts written externally.
+</summary>
+        </member>
+        <member name="T:SHADE.EngineInterface">
+            <summary>
+Static class that contains the functions for interfacing with the core
+PlushieEngine written in C++ for managing the lifecycle of managed code.
+</summary>
+        </member>
+        <member name="M:SHADE.DisposableAssemblyLoadContext.#ctor">
+            <summary>
+Default Constructor
+</summary>
+        </member>
+        <member name="T:SHADE.DisposableAssemblyLoadContext">
+            <summary>
+Custom AssemblyLoadContext marked as collectible so that it can be unloaded.
+</summary>
+        </member>
+        <member name="P:SHADE.Time.FixedDeltaTime">
+            <summary>
+Time taken for Physics simulations. You should use this for operations 
+within Script.FixedUpdate()
+</summary>
+        </member>
+        <member name="P:SHADE.Time.DeltaTime">
+            <summary>
+Time taken to process the previous frame.
+</summary>
+        </member>
+        <member name="T:SHADE.Time">
+            <summary>
+Static class that contains the functions for working with time.
+</summary>
+        </member>
+        <member name="T:SHADE.SHPhysicsSystemInterface">
+            <summary>
+Static class that wraps up certain functions in the SHPhysicsSystem so that 
+accessing it from SHADE_Managed would not cause issues due to C++20 features.
+</summary>
+        </member>
+        <member name="M:SHADE.TooltipAttribute.#ctor(System.String)">
+            <summary>
+Constructor for a Tooltip attribute that fills in the description.
+</summary>
+            <param name="description">Text to be shown when a field is hovered.</param>
+        </member>
+        <member name="P:SHADE.TooltipAttribute.Description">
+            <summary>
+Description that is to be shown in the Tooltip.
+</summary>
+        </member>
+        <member name="T:SHADE.TooltipAttribute">
+            <summary>
+Simple attribute to provide a field in a script with a tooltip.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.fileExists(std.filesystem.path!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Checks if a specified file exists.
+</summary>
+            <param name="filePath">File path to the file to check.</param>
+            <returns> True if the file exists </returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.deleteFolder(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deletes the folder and all files in it as specified by the file path.
+</summary>
+            <param name="filePath">File path to the file to delete.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.deleteFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deletes the file as specified by the file path.
+</summary>
+            <param name="filePath">File path to the file to delete.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.dumpBuildLog(std.basic_string_view&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Reads the file via the specified path that represents a build log of error
+and warning messages.
+</summary>
+            <param name="buildLogPath">
+File path to the build log of script builds done by BuildScriptAssembly() to
+dump and process.
+</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.registerEvents">
+            <summary>
+Registers events for the scripting system
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.loadFunctions">
+            <summary>
+Loads all the function pointers to CLR code that we need to execute.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.GenerateScriptsCsProjFile(std.filesystem.path!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Generates a .csproj file for editing and compiling the C# scripts.
+</summary>
+            <param name="path">File path to the generated file.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.BuildScriptAssembly(System.Boolean,System.Boolean)">
+            <summary>
+Utilises execution of a external batch file for invoking the dotnet build
+tool to compile C# scripts in the Assets folder into the SHADE_Scripting
+C# assembly DLL.
+</summary>
+            <param name="debug">
+Whether or not a debug build will be built. Only debug built C# assemblies
+can be debugged.
+</param>
+            <param name="reload">
+Whether or not we are reloading the assembly, if so, unload and then reload it.
+</param>
+            <returns>Whether or not the build succeeded.</returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RedoScriptInspectorChanges">
+            <summary>
+Performs a redo for script inspector changes if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.UndoScriptInspectorChanges">
+            <summary>
+Performs an undo for script inspector changes if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RenderScriptsInInspector(System.UInt32)">
+            <summary>
+Renders the set of attached Scripts for the specified Entity into the
+inspector. 
+<br />
+This function is meant for consumption from native code in the inspector
+rendering code.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.DeserialiseScripts(System.UInt32,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates scripts and sets fields for the specified Entity based on the specified 
+YAML node.
+</summary>
+            <param name="entity">The Entity to deserialise a Script on to.</param>
+            <param name="scriptsNode">
+YAML Node that contains the serialised script data.
+</param>
+            <return>True if successfully deserialised.</return>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.SerialiseScripts(System.UInt32,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Performs serialization of all scripts for the specified entity into the
+YAML::Node specified. This node will contain all serialised scripts after
+calling this function.
+</summary>
+            <param name="entity">The Entity to Serialise.</param>
+            <param name="scriptsNode">
+YAML Node that will store the serialised scripts.
+</param>
+            <return>True if successfully serialised.</return>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RemoveAllScriptsImmediately(System.UInt32,System.Boolean)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Unlike
+RemoveAllScripts(), this removes all the scripts immediately.
+Does not do anything if the specified Entity is invalid or does not have any
+Scripts attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+            <param name="callOnDestroy">
+Whether or not to call OnDestroy on the scripts. This is ignored if not in
+play mode.
+</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.RemoveAllScripts(System.UInt32)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Does not do anything
+if the specified Entity is invalid or does not have any Scripts
+attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.AddScript(System.UInt32,std.basic_string_view&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Adds a Script to a specified Entity. Note that while you can call this
+multiple times on a specified Entity, it will work for all intents and
+purposes but GetScript&lt;T&gt;() (C# only) currently only
+gives you the first Script added of the specified type.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">Type name of the script to add.</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.Exit">
+            <summary>
+Shuts down the DotNetRuntime.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ExecuteCollisionFunctions">
+            <summary>
+Executes the OnCollision*()s and OnTrigger*()s of the Scripts that are attached 
+to Entities.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ExecuteFixedUpdates">
+            <summary>
+Executes the FixedUpdate()s of the Scripts that are attached to
+Entities.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.ReloadScriptAssembly">
+            <summary>
+Reloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.LoadScriptAssembly">
+            <summary>
+Unloads the managed script assembly.
+Take note that this will clear all existing scripts, ensure that the scene
+is saved before doing so.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.UnloadScriptAssembly">
+            <summary>
+Loads the managed script assembly. Ensure this is only called after
+UnloadScriptAssembly() has been called.
+</summary>
+        </member>
+        <member name="M:SHADE.SHScriptEngine.Init">
+            <summary>
+Initialises the DotNetRuntime and retrieves function pointers to all
+functions on the CLR used to interface with the engine.
+</summary>
+        </member>
+        <member name="T:SHADE.SHScriptEngine">
+            <summary>
+Manages initialisation of the DotNetRuntime and interfacing with CLR code written
+and executed on .NET.
+</summary>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.Deserialise(System.Object,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Deserialises a YAML node that contains a map of Scripts and copies the 
+deserialised data into the specified object if there are matching fields.
+</summary>
+            <param name="yamlNode">
+The JSON string that contains the data to copy into this Script object.
+</param>
+            <param name="object">The object to copy deserialised data into.</param>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.Serialise(System.Object,YAML.Node*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a JSON node that represents the specified object and its associated
+serialisable fields. Public fields and fields marked with the SerialiseField
+attribute will be serialised.
+</summary>
+            <param name="object">The object to serialise.</param>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.FieldIsSerialisable(System.Reflection.FieldInfo)">
+            <summary>
+Checks if a specified field is a candidate for serialisation. This means that
+the field is public or private with the [SerialiseField] attribute.
+</summary>
+            <param name="fieldInfo">The field to check.</param>
+            <returns>
+True if the specified field is a candidate for serialisation.
+</returns>
+        </member>
+        <member name="M:SHADE.ReflectionUtilities.GetInstanceFields(System.Object)">
+            <summary>
+Retrieves a set of all non-static (instance) fields from a specified object.
+</summary>
+            <param name="object">The object to get non-static fields from.</param>
+            <returns>Immutable list of non-static fields.</returns>
+        </member>
+        <member name="T:SHADE.ReflectionUtilities">
+            <summary>
+Contains useful static functions for working with Reflection.
+</summary>
+        </member>
+        <member name="M:YAML.Dump(YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Converts the node to a YAML string. 
+</member>
+        <member name="M:YAML.op_LeftShift(std.basic_ostream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Emits the node to the given output stream. 
+</member>
+        <member name="M:YAML.op_LeftShift(YAML.Emitter*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,YAML.Node!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Emits the node to the given {@link Emitter}. If there is an error in writing,
+{@link Emitter#good} will return false.
+
+</member>
+        <member name="M:YAML.LoadAllFromFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input file as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+ @throws {@link BadFile} if the file cannot be loaded.
+
+</member>
+        <member name="M:YAML.LoadAll(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input stream as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadAll(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+ Loads the input string as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadAll(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input string as a list of YAML documents.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.LoadFile(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input file as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+ @throws {@link BadFile} if the file cannot be loaded.
+
+</member>
+        <member name="M:YAML.Load(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input stream as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Load(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+ Loads the input string as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Load(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Loads the input string as a single YAML document.
+
+ @throws {@link ParserException} if it is malformed.
+
+</member>
+        <member name="M:YAML.Parser.HandleTagDirective(YAML.Token!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Handles a "TAG" directive, which should be of the form 'handle prefix',
+where 'handle' is converted to 'prefix' in the file.
+
+</member>
+        <member name="M:YAML.Parser.HandleYamlDirective(YAML.Token!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Handles a "YAML" directive, which should be of the form 'major.minor' (like
+a version number).
+
+</member>
+        <member name="M:YAML.Parser.ParseDirectives">
+Reads any directives that are next in the queue, setting the internal
+{@code m_pDirectives} state.
+
+</member>
+        <member name="M:YAML.Parser.HandleNextDocument(YAML.EventHandler*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+ Handles the next document by calling events on the {@code eventHandler}.
+
+ @throw a ParserException on error.
+ @return false if there are no more documents
+
+</member>
+        <member name="M:YAML.Parser.Load(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Resets the parser with the given input stream. Any existing state is
+erased.
+
+</member>
+        <member name="M:YAML.Parser.op_Explicit~System.Boolean">
+Evaluates to true if the parser has some valid input to be read. 
+</member>
+        <member name="M:YAML.Parser.#ctor(std.basic_istream&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte}&gt;*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+Constructs a parser from the given input stream. The input stream must
+live as long as the parser.
+
+</member>
+        <member name="M:YAML.Parser.#ctor">
+Constructs an empty parser (with no input. 
+</member>
+        <member name="T:YAML.Parser">
+A parser turns a stream of bytes into one stream of "events" per YAML
+document in the input stream.
+
+</member>
+        <member name="M:SHADE.Editor.renderScriptContextMenu(System.UInt32,SHADE.Script)">
+            <summary>
+Renders a context menu when right clicked for the scripts
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+            <param name="script">The Script to render the inspector for.</param>
+        </member>
+        <member name="M:SHADE.Editor.renderFieldInInspector(System.Reflection.FieldInfo,System.Object)">
+            <summary>
+Renders a field specified into the inspector.
+</summary>
+            <param name="field">The field to render.</param>
+            <param name="object">
+The object that contains the data of the field to render.
+</param>
+        </member>
+        <member name="M:SHADE.Editor.renderScriptInInspector(System.UInt32,SHADE.Script,System.Int32)">
+            <summary>
+Renders a single specified Script's inspector.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+            <param name="script">The Script to render the inspector for.</param>
+            <param name="index">
+Indices used internally to differentiate each rendered Script
+inspector. This is required to open and close each Script's inspector
+independently from each other.
+</param>
+        </member>
+        <member name="M:SHADE.Editor.Redo">
+            <summary>
+Redoes the last script inspector change if there is any.
+</summary>
+        </member>
+        <member name="M:SHADE.Editor.Undo">
+            <summary>
+Undoes the last script inspector change if there is any.
+</summary>
+        </member>
+        <member name="M:SHADE.Editor.RenderScriptAddButton(System.UInt32)">
+            <summary>
+Renders a dropdown button that allows for the addition of PlushieScripts
+onto the specified Entity.
+</summary>
+            <param name="entity">The Entity to add PlushieScripts to.</param>
+        </member>
+        <member name="M:SHADE.Editor.RenderScriptsInInspector(System.UInt32)">
+            <summary>
+Renders the set of attached Scripts for the specified Entity into the
+inspector. 
+<br />
+This function is meant for consumption from native code in the inspector
+rendering code.
+</summary>
+            <param name="entity">The Entity to render the Scripts of.</param>
+        </member>
+        <member name="T:SHADE.Editor">
+            <summary>
+Static class for Editor-related functions
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.DeserialiseScripts(System.UInt32,System.IntPtr)">
+            <summary>
+Processes a YAML node that contains a list of multiple scripts to be loaded
+into the specified Entity.
+<br /><br />
+This function should only be called from native unmanaged code.
+</summary>
+            <param name="entity">
+The Entity to attach the deserialised Scripts to.
+</param>
+            <param name="yaml">
+Pointer to the YAML::Node that contains serialized script data.
+</param>
+            <returns />
+        </member>
+        <member name="M:SHADE.ScriptStore.SerialiseScripts(System.UInt32,System.IntPtr)">
+            <summary>
+Populates a YAML node with the scripts for a specified Entity.
+<br /><br />
+This function should only be called from native unmanaged code.
+</summary>
+            <param name="entity">The Entity to Serialise.</param>
+            <param name="yamlNode">
+Pointer to a YAML::Node that will be populated with all of the serialised
+scripts and their associated fields.
+</param>
+            <returns>
+True if serialisation is successful. False if the buffer is too small for
+the serialised output.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteCollisionFunctions">
+            <summary>
+Executes OnCollision*() and OnTrigger*() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteLateUpdate">
+            <summary>
+Executes LateUpdate() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteUpdate">
+            <summary>
+Executes Update() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.ExecuteFixedUpdate">
+            <summary>
+Executes FixedUpdate() for all scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetAvailableScriptList">
+            <summary>
+Retrieves a immutable list of available scripts that can be added.
+</summary>
+            <returns>Immutable list of available scripts that can be added.</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.Exit">
+            <summary>
+Cleans up data stored in the ScriptStore to free up memory for garbage
+collection.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.FrameCleanUp">
+            <summary>
+Cleans up scripts that were marked for deletion. This calls the OnDestroy()
+for these Scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.FrameSetUp">
+            <summary>
+Sets up scripts that were marked for initialization. This calls the Awake()
+and Start() for Scripts that have yet to have done so.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.Init">
+            <summary>
+Initializes the ScriptStore to allocate and pre-populate reflection data.
+</summary>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveAllScriptsImmediately(System.UInt32,System.Boolean)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Unlike
+RemoveAllScripts(), this removes all the scripts immediately.
+Does not do anything if the specified Entity is invalid or does not have any
+Scripts attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+            <param name="callOnDestroy">
+Whether or not to call OnDestroy on the scripts.This is ignored if not in
+play mode.
+</param>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveAllScripts(System.UInt32)">
+            <summary>
+Removes all Scripts attached to the specified Entity. Does not do anything
+if the specified Entity is invalid or does not have any Scripts
+attached.
+</summary>
+            <param name="entity">The entity to remove the scripts from.</param>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveScript(System.UInt32,SHADE.Script)">
+            <summary>
+Removes a specific script from the 
+</summary>
+            <param name="entity">The entity to remove the script from.</param>
+            <param name="script">The script to remove.</param>
+            <returns>True if successfully removed. False otherwise.</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.RemoveScript``1(System.UInt32)">
+            <summary>
+Removes all Scripts of the specified type from the specified Entity.
+</summary>
+            <typeparam name="T">
+Type of script to remove.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">The entity to remove the script from.</param>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetAllScripts(System.UInt32)">
+            <summary>
+Retrieves an immutable list of all scripts attached to a specified Entity.
+</summary>
+            <param name="entity">
+The entity which the scripts to retrieve are attached.
+</param>
+            <returns>
+Immutable list of references to scripts attached to the specified Entity.
+This can also be null if there are no scripts at all or an invalid Entity
+was specified.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScripts``1(System.UInt32)">
+            <summary>
+Retrieves a immutable list of scripts from the specified Entity that
+matches the specified type.
+<br />
+Note that this function allocates. It should be used sparingly.
+</summary>
+            <typeparam name="T">
+Type of scripts to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the scripts to retrieve are attached.
+</param>
+            <returns>
+Immutable list of references to scripts of the specified type.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScriptInChildren``1(System.UInt32)">
+            <summary>
+Retrieves the first Script from the specified Entity's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the script to retrieve is attached.
+</param>
+            <returns>
+Reference to the script. This can be null if no script of the specified
+type is attached.
+</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.GetScript``1(System.UInt32)">
+            <summary>
+Retrieves the first Script from the specified Entity that matches the
+specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <param name="entity">
+The entity which the script to retrieve is attached.
+</param>
+            <returns>
+Reference to the script. This can be null if no script of the specified
+type is attached.
+</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScriptViaNameWithRef(System.UInt32,System.String,SHADE.Script@)">
+            <summary>
+Adds a Script to a specified Entity.
+<br />
+This function is meant for consumption from native code or for serialisation
+purposes. If you are writing in C# or C++/CLI and not doing serialisation,
+use AddScript&lt;T&gt;() instead as it is faster.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">The entity to add a script to.</param>
+            <param name="createdScript">
+Out parameter handle to the Script that was created.
+</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScriptViaName(System.UInt32,System.String)">
+            <summary>
+Adds a Script to a specified Entity.
+<br />
+This function is meant for consumption from native code. If you are writing
+in C# or C++/CLI, use AddScript&lt;T&gt;() instead as it is faster.
+</summary>
+            <param name="entity">The entity to add a script to.</param>
+            <param name="scriptName">The entity to add a script to.</param>
+            <returns>
+True if successfully added. False otherwise with the error logged to the
+console.
+</returns>
+        </member>
+        <member name="M:SHADE.ScriptStore.AddScript``1(System.UInt32)">
+            <summary>
+Adds a Script to a specified Entity.
+</summary>
+            <typeparam name="T">
+Type of script to add.
+This needs to be a default constructable PlushieScript.
+</typeparam>
+            <param name="entity">The entity to add a script to.</param>
+            <returns>Reference to the script added.</returns>
+            <exception cref="!:ArgumentException">
+If the specified Entity is invalid.
+</exception>
+        </member>
+        <member name="T:SHADE.ScriptStore">
+            <summary>
+Responsible for managing all scripts attached to Entities as well as executing 
+all lifecycle functions of scripts.
+</summary>
+        </member>
+        <member name="M:SHADE.Color.op_Inequality(SHADE.Color,SHADE.Color)">
+            <summary>
+Checks if two Colors are not approximately equal.
+</summary>
+            <param name="lhs">Color to compare.</param>
+            <param name="rhs">Another Color to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Equality(SHADE.Color,SHADE.Color)">
+            <summary>
+Checks if two Colors are approximately equal.
+</summary>
+            <param name="lhs">Color to compare.</param>
+            <param name="rhs">Another Color to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Division(SHADE.Color,System.Single)">
+            <summary>
+Calculates the division of a Color with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Color to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Multiply(SHADE.Color,System.Single)">
+            <summary>
+Calculates the multiplication of a Color with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Color to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Multiply(SHADE.Color,SHADE.Color)">
+            <summary>
+Calculates the component-wise multiplication of two Colors and returns the
+result.
+</summary>
+            <param name="lhs">Color to multiply with.</param>
+            <param name="rhs">Another Color to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Subtraction(SHADE.Color,SHADE.Color)">
+            <summary>
+Subtracts a Color from another Color and returns the result.
+</summary>
+            <param name="lhs">Color to subtract from.</param>
+            <param name="rhs">Another Color to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Color.op_Addition(SHADE.Color,SHADE.Color)">
+            <summary>
+Adds two Colors together and returns the result.
+</summary>
+            <param name="lhs">Color to add.</param>
+            <param name="rhs">Another Color to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Color.LerpUnclamped(SHADE.Color,SHADE.Color,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="colA">The start Color, returned when t = 0.0.</param>
+            <param name="colB">The end Color, returned when t = 1.0.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Color.</returns>
+        </member>
+        <member name="M:SHADE.Color.Lerp(SHADE.Color,SHADE.Color,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="colA">The start Color, returned when t = 0.0.</param>
+            <param name="colB">The end Color, returned when t = 1.0.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Color.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Color.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Color.Equals(SHADE.Color)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="F:SHADE.Color.a">
+            <summary>
+Alpha component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.b">
+            <summary>
+Blue component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.g">
+            <summary>
+Green component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="F:SHADE.Color.r">
+            <summary>
+Red component of the colour. Ranges from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+            <param name="_blue">Blue component to set.</param>
+            <param name="_alpha">Alpha component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+            <param name="_blue">Blue component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+blue and alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+            <param name="_green">Green component to set.</param>
+        </member>
+        <member name="M:SHADE.Color.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Color with the specified components with the
+green, blue and alpha component set to 1.0f.
+</summary>
+            <param name="_red">Red component to set.</param>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Yellow">
+            <summary>
+Pure yellow, mix of pure red and green.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Magenta">
+            <summary>
+Pure magenta, mix of pure red and blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Cyan">
+            <summary>
+Pure cyan, mix of pure green and blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Blue">
+            <summary>
+Pure blue.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Green">
+            <summary>
+Pure green.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Red">
+            <summary>
+Pure red.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.White">
+            <summary>
+Pure white.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.DarkGray">
+            <summary>
+Dark Gray, darker than gray.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Gray">
+            <summary>
+Gray, halfway between black and white.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.LightGray">
+            <summary>
+Light Gray, lighter than gray.
+</summary>
+        </member>
+        <member name="P:SHADE.Color.Defaults.Black">
+            <summary>
+Pure black.
+</summary>
+        </member>
+        <member name="T:SHADE.Color.Defaults">
+            <summary>
+A static class that contains a set of default Colors.
+</summary>
+        </member>
+        <member name="T:SHADE.Color">
+            <summary>
+CLR version of the the SHADE Engine's Color struct which describes a Color
+encoded using floating point numbers that range from 0.0f to 1.0f.
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Button(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a inline button widget.
+<br />
+Wraps up ImGui::Button().
+</summary>
+            <param name="title">Text to display.</param>
+            <returns>True if button was pressed.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.SmallButton(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a small inline button widget.
+<br />
+Wraps up ImGui::SmallButton().
+</summary>
+            <param name="title">Text to display.</param>
+            <returns>True if button was pressed.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Text(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a visual text widget.
+<br />
+Wraps up ImGui::Text().
+</summary>
+            <param name="title">Text to display.</param>
+        </member>
+        <member name="M:SHADE.SHEditorUI.MenuItem(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a menu item in the list of items for a mini popup.
+<br />
+Wraps up ImGui::MenuItem().
+</summary>
+            <param name="label">Label used to identify this widget.</param>
+            <returns>Whether or not the menu item was selected.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.OpenPopup(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Opens the popup that was defined with the specified label.
+<br />
+Wraps up ImGui::OpenPopup().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.EndPopup">
+            <summary>
+Marks the end of a definition of a mini pop up that can show options.
+<br />
+Wraps up ImGui::EndPopup().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.BeginPopup(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Marks the start of a definition of a mini pop up that can show options.
+<br />
+Wraps up ImGui::BeginPopup().
+</summary>
+            <param name="label">Label used to identify this widget.</param>
+            <returns>Whether or not the pop up is open.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.CollapsingHeader(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Creates a collapsing title header.
+<br />
+Wraps up ImGui::CollapsingHeader().
+</summary>
+            <param name="title">Label for the header.</param>
+            <returns>True if the header is open, false otherwise.</returns>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Unindent">
+            <summary>
+Unindents the widgets rendered after this call.
+<br />
+Wraps up ImGui::Unindent().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.Indent">
+            <summary>
+Indents the widgets rendered after this call.
+<br />
+Wraps up ImGui::Indent().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PopID">
+            <summary>
+Marks the end of a stack of ImGui widgets from the last PushID() call.
+<br />
+Wraps up ImGui::PopID().
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PushID(System.Int32)">
+            <summary>
+Marks the start of a stack of ImGui widgets with the specified id.
+<br />
+Wraps up ImGui::PushID().
+</summary>
+            <param name="id">Integer-based ID.</param>
+        </member>
+        <member name="M:SHADE.SHEditorUI.PushID(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Marks the start of a stack of ImGui widgets with the specified id.
+<br />
+Wraps up ImGui::PushID().
+</summary>
+            <param name="id">String-based ID.</param>
+        </member>
+        <member name="F:SHADE.SHEditorUI.TEXT_FIELD_MAX_LENGTH">
+            <summary>
+Maximum length of a string supported by InputTextField()
+</summary>
+        </member>
+        <member name="T:SHADE.SHEditorUI">
+            <summary>
+Static class that contains useful functions for Editor UI using ImGui.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Redo">
+            <summary>
+Redoes the last undo-ed command if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Undo">
+            <summary>
+Undos the last added command if it exists.
+</summary>
+        </member>
+        <member name="M:SHADE.UndoRedoStack.Add(SHADE.UndoRedoStack.Command)">
+            <summary>
+Adds a command onto the stack.
+</summary>
+            <param name="command" />
+        </member>
+        <member name="P:SHADE.UndoRedoStack.RedoActionPresent">
+            <summary>
+True if there is a redoable action in the stack.
+</summary>
+        </member>
+        <member name="P:SHADE.UndoRedoStack.UndoActionPresent">
+            <summary>
+True if there is an undoable action in the stack.
+</summary>
+        </member>
+        <member name="T:SHADE.UndoRedoStack.Command">
+            <summary>
+Command for the stack that represents a data modification.
+</summary>
+        </member>
+        <member name="T:SHADE.UndoRedoStack">
+            <summary>
+Class that is able to store a stack of actions that can be done and redone.
+</summary>
+        </member>
+        <member name="M:SHADE.Collider.OnCollisionShapeChanged(System.UInt32)">
+            <summary>
+To be called from native code when a Collision Shape has been changed.
+</summary>
+            <param name="entity">
+The entity which has it's collision shape changed.
+</param>
+        </member>
+        <member name="M:SHADE.Collider.OnCollisionShapeRemoved(System.UInt32)">
+            <summary>
+To be called from native code when a collision shape has been removed.
+</summary>
+            <param name="entity">The entity which has it's collision shape removed.</param>
+        </member>
+        <member name="M:SHADE.Collider.GetCollisionShape``1(System.Int32)">
+            <summary>
+Retrieves a ColliderBound at the specified index in the ColliderBound list 
+and casts it to the appropriate type.
+</summary>
+            <typeparam name="T">Type of the ColliderBound to cast to.</typeparam>
+            <param name="index">Index to retrieve a ColliderBound from.</param>
+            <returns>ColliderBound for the specified index.</returns>
+        </member>
+        <member name="M:SHADE.Collider.GetCollisionShape(System.Int32)">
+            <summary>
+Retrieves a ColliderBound at the specified index in the ColliderBound list.
+</summary>
+            <param name="index">Index to retrieve a ColliderBound from.</param>
+            <returns>ColliderBound for the specified index.</returns>
+        </member>
+        <member name="P:SHADE.Collider.CollisionShapeCount">
+            <summary>
+Total number of ColliderShapes in the Collider component.
+</summary>
+        </member>
+        <member name="M:SHADE.Collider.#ctor(System.UInt32)">
+            <summary>
+Constructs a Collider Component that represents a native SHColliderComponent
+component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Collider">
+            <summary>
+CLR version of the the SHADE Engine's SHColliderComponent.
+A single Collider component can contain one or multiple Collider Bounds.
+</summary>
+        </member>
+        <member name="M:SHADE.SphereCollider.Raycast(SHADE.Ray,System.Single)">
+            <inheritdoc />
+        </member>
+        <member name="M:SHADE.SphereCollider.TestPoint(SHADE.Vector3)">
+            <inheritdoc />
+        </member>
+        <member name="P:SHADE.SphereCollider.Radius">
+            <summary>
+Radius of the Bounding Sphere formed by this bound.
+</summary>
+        </member>
+        <member name="P:SHADE.SphereCollider.Center">
+            <summary>
+Center of the Bounding Sphere formed by this bound.
+</summary>
+        </member>
+        <member name="T:SHADE.SphereCollider">
+            <summary>
+Sphere-shaped Collider Bound.
+</summary>
+        </member>
+        <member name="M:SHADE.BoxCollider.Raycast(SHADE.Ray,System.Single)">
+            <inheritdoc />
+        </member>
+        <member name="M:SHADE.BoxCollider.TestPoint(SHADE.Vector3)">
+            <inheritdoc />
+        </member>
+        <member name="P:SHADE.BoxCollider.Max">
+            <summary>
+Position of the top right front corner of the Bounding Box formed by this 
+bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.Min">
+            <summary>
+Position of the bottom left back corner of the Bounding Box formed by this 
+bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.HalfExtents">
+            <summary>
+Half of the scale of the Bounding Box formed by this bound.
+</summary>
+        </member>
+        <member name="P:SHADE.BoxCollider.Center">
+            <summary>
+Center of the Bounding Box formed by this bound.
+</summary>
+        </member>
+        <member name="T:SHADE.BoxCollider">
+            <summary>
+Box-shaped Collider Bound.
+</summary>
+        </member>
+        <member name="M:SHADE.CollisionShape.Raycast(SHADE.Ray,System.Single)">
+            <summary>
+Computes a Raycast and checks if there is a collision with any object.
+</summary>
+            <param name="ray">The ray to cast.</param>
+            <param name="maxDistance">Maximum distance for the raycast check.</param>
+            <returns>True if the ray intersects with an object in the scene.</returns>
+        </member>
+        <member name="M:SHADE.CollisionShape.TestPoint(SHADE.Vector3)">
+            <summary>
+Checks if the specified point is within this shape's bounds.
+</summary>
+            <param name="point">Point to test with.</param>
+            <returns>True if the point is in the shape's bounds.</returns>
+        </member>
+        <member name="T:SHADE.CollisionShape">
+            <summary>
+Base interface for all Collider Shapes.
+</summary>
+        </member>
+        <member name="F:SHADE.SHPhysicsMaterial.density">
+@brief The density of the collider that determines the mass of the collision shape
+       if it is automatically computed. Must be a positive number.
+
+</member>
+        <member name="F:SHADE.SHPhysicsMaterial.bounciness">
+@brief The bounciness factor of the physics object., clamped between [0,1].<br />
+       0 means the object will never bounce.
+       1 means the object never loses energy on a bounce.
+
+</member>
+        <member name="F:SHADE.SHPhysicsMaterial.friction">
+@brief The friction coefficient of the physics object., clamped between [0,1].<br />
+       0 means the object will never experience friction.
+       1 means the friction force against the object is equal to the applied force.
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetDensity(System.Single)">
+@brief Sets the mass density of the physics material.
+@param newDensity The density value to set. Always made positive.
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetBounciness(System.Single)">
+@brief Sets the bounciness factor of the physics material.
+@param newBounciness The bounciness value to set. Clamped between [0,1].
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.SetFriction(System.Single)">
+@brief Sets the friction coefficient of the physics material.
+@param newFriction The friction value to set. Clamped between [0,1].
+
+</member>
+        <member name="M:SHADE.SHPhysicsMaterial.#ctor(System.Single,System.Single,System.Single)">
+@brief Default constructor for a physics material.
+@param friction    The friction of the material. Clamped between [0,1]. Defaults to 0.4.
+@param bounciness  The bounciness of the material. Clamped between [0,1].
+@param density     The mass density of the material. Always made positive.
+
+</member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.CloseWindow">
+            <summary>
+Closes the current window, and depending on the implementation, should also
+close the application.
+</summary>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.IsFullscreen">
+            <summary>
+Retrieves the current window fullscreen status.
+</summary>
+            <returns>The current window fullscreen status..</returns>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.GetWindowHeight">
+            <summary>
+Retrieves the current window height.
+</summary>
+            <returns>The current window height.</returns>
+        </member>
+        <member name="M:SHADE.SHGraphicsSystemInterface.GetWindowWidth">
+            <summary>
+Retrieves the current window width.
+</summary>
+            <returns>The current window width.</returns>
+        </member>
+        <member name="T:SHADE.SHGraphicsSystemInterface">
+            <summary>
+Static class that wraps up certain functions in the SHGraphicsSystem so that 
+accessing it from SHADE_Managed would not cause issues due to C++20 features.
+</summary>
+        </member>
+        <member name="M:SHADE.SHEditor.Render">
+ @brief Perform ImGui and ImGui Backend Render
+
+
+</member>
+        <member name="M:SHADE.SHEditor.NewFrame">
+ @brief Start new frame for editor
+
+
+</member>
+        <member name="M:SHADE.SHEditor.InitBackend">
+ @brief Initialise Backend for ImGui (SDL and Vulkan backend)
+
+ @param sdlWindow Pointer to SDL_Window
+
+</member>
+        <member name="M:SHADE.SHEditor.SetStyle(&lt;unknown type&gt;)">
+ @brief Set the Style for the editor
+
+ @param style Desired style
+
+</member>
+        <member name="M:SHADE.SHEditor.Exit">
+ @brief Safely shutdown the editor
+
+
+</member>
+        <member name="M:SHADE.SHEditor.Update(System.Double)">
+ @brief Update the editor and add to ImGui DrawList
+
+ @param dt Delta-time of the frame
+
+</member>
+        <member name="M:SHADE.SHEditor.Init">
+ @brief Initialise the editor
+
+ @param sdlWindow pointer to SDL_Window object created in application
+
+</member>
+        <member name="T:SHADE.SHEditor.Style">
+ @brief Style options
+
+
+</member>
+        <member name="T:SHADE.SHEditor">
+ @brief SHEditor static class contains editor variables and implementation of editor functions.
+
+
+</member>
+        <member name="M:SDL_GetYUVConversionModeForResolution(System.Int32,System.Int32)">
+ Get the YUV conversion mode, returning the correct mode for the resolution
+ when the current conversion mode is SDL_YUV_CONVERSION_AUTOMATIC
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_GetYUVConversionMode">
+ Get the YUV conversion mode
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_SetYUVConversionMode(SDL_YUV_CONVERSION_MODE)">
+ Set the YUV conversion mode
+
+ \since This function is available since SDL 2.0.8.
+
+</member>
+        <member name="M:SDL_LowerBlitScaled(SDL_Surface*,SDL_Rect*,SDL_Surface*,SDL_Rect*)">
+ Perform low-level surface scaled blitting only.
+
+ This is a semi-private function and it performs low-level surface blitting,
+ assuming the input rectangles have already been clipped.
+
+ \param src the SDL_Surface structure to be copied from
+ \param srcrect the SDL_Rect structure representing the rectangle to be
+                copied
+ \param dst the SDL_Surface structure that is the blit target
+ \param dstrect the SDL_Rect structure representing the rectangle that is
+                copied into
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitScaled
+
+</member>
+        <member name="M:SDL_UpperBlitScaled(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect*)">
+ Perform a scaled surface copy to a destination surface.
+
+ SDL_UpperBlitScaled() has been replaced by SDL_BlitScaled(), which is
+ merely a macro for this function with a less confusing name.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitScaled
+
+</member>
+        <member name="M:SDL_SoftStretchLinear(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Perform bilinear scaling between two surfaces of the same format, 32BPP.
+
+ \since This function is available since SDL 2.0.16.
+
+</member>
+        <member name="M:SDL_SoftStretch(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Perform a fast, low quality, stretch blit between two surfaces of the same
+ format.
+
+ Please use SDL_BlitScaled() instead.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_LowerBlit(SDL_Surface*,SDL_Rect*,SDL_Surface*,SDL_Rect*)">
+ Perform low-level surface blitting only.
+
+ This is a semi-private blit function and it performs low-level surface
+ blitting, assuming the input rectangles have already been clipped.
+
+ Unless you know what you're doing, you should be using SDL_BlitSurface()
+ instead.
+
+ \param src the SDL_Surface structure to be copied from
+ \param srcrect the SDL_Rect structure representing the rectangle to be
+                copied, or NULL to copy the entire surface
+ \param dst the SDL_Surface structure that is the blit target
+ \param dstrect the SDL_Rect structure representing the rectangle that is
+                copied into
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+
+</member>
+        <member name="M:SDL_UpperBlit(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Surface*,SDL_Rect*)">
+ *  Performs a fast blit from the source surface to the destination surface.
+ *
+ *  This assumes that the source and destination rectangles are
+ *  the same size.  If either \c srcrect or \c dstrect are NULL, the entire
+ *  surface (\c src or \c dst) is copied.  The final blit rectangles are saved
+ *  in \c srcrect and \c dstrect after all clipping is performed.
+ *
+ *  \returns 0 if the blit is successful, otherwise it returns -1.
+ *
+ *  The blit function should not be called on a locked surface.
+ *
+ *  The blit semantics for surfaces with and without blending and colorkey
+ *  are defined as follows:
+ *  \verbatim
+    RGBA-&gt;RGB:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source alpha-channel and per-surface alpha)
+        SDL_SRCCOLORKEY ignored.
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB.
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        RGB values of the source color key, ignoring alpha in the
+        comparison.
+
+    RGB-&gt;RGBA:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source per-surface alpha)
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB, set destination alpha to source per-surface alpha value.
+      both:
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        source color key.
+
+    RGBA-&gt;RGBA:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source alpha-channel and per-surface alpha)
+        SDL_SRCCOLORKEY ignored.
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy all of RGBA to the destination.
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        RGB values of the source color key, ignoring alpha in the
+        comparison.
+
+    RGB-&gt;RGB:
+      Source surface blend mode set to SDL_BLENDMODE_BLEND:
+        alpha-blend (using the source per-surface alpha)
+      Source surface blend mode set to SDL_BLENDMODE_NONE:
+        copy RGB.
+      both:
+        if SDL_SRCCOLORKEY set, only copy the pixels matching the
+        source color key.
+    \endverbatim
+ *
+ *  You should call SDL_BlitSurface() unless you know exactly how SDL
+ *  blitting works internally and how to use the other blit functions.
+
+ Perform a fast blit from the source surface to the destination surface.
+
+ SDL_UpperBlit() has been replaced by SDL_BlitSurface(), which is merely a
+ macro for this function with a less confusing name.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+
+</member>
+        <member name="M:SDL_FillRects(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32)">
+ Perform a fast fill of a set of rectangles with a specific color.
+
+ `color` should be a pixel of the format used by the surface, and can be
+ generated by SDL_MapRGB() or SDL_MapRGBA(). If the color value contains an
+ alpha component then the destination is simply filled with that alpha
+ information, no blending takes place.
+
+ If there is a clip rectangle set on the destination (set via
+ SDL_SetClipRect()), then this function will fill based on the intersection
+ of the clip rectangle and `rect`.
+
+ \param dst the SDL_Surface structure that is the drawing target
+ \param rects an array of SDL_Rects representing the rectangles to fill.
+ \param count the number of rectangles in the array
+ \param color the color to fill with
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FillRect
+
+</member>
+        <member name="M:SDL_FillRect(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.UInt32)">
+ Perform a fast fill of a rectangle with a specific color.
+
+ `color` should be a pixel of the format used by the surface, and can be
+ generated by SDL_MapRGB() or SDL_MapRGBA(). If the color value contains an
+ alpha component then the destination is simply filled with that alpha
+ information, no blending takes place.
+
+ If there is a clip rectangle set on the destination (set via
+ SDL_SetClipRect()), then this function will fill based on the intersection
+ of the clip rectangle and `rect`.
+
+ \param dst the SDL_Surface structure that is the drawing target
+ \param rect the SDL_Rect structure representing the rectangle to fill, or
+             NULL to fill the entire surface
+ \param color the color to fill with
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FillRects
+
+</member>
+        <member name="M:SDL_PremultiplyAlpha(System.Int32,System.Int32,System.UInt32,System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32,System.Void*,System.Int32)">
+ Premultiply the alpha on a block of pixels.
+
+ This is safe to use with src == dst, but not for other overlapping areas.
+
+ This function is currently only implemented for SDL_PIXELFORMAT_ARGB8888.
+
+ \param width the width of the block to convert, in pixels
+ \param height the height of the block to convert, in pixels
+ \param src_format an SDL_PixelFormatEnum value of the `src` pixels format
+ \param src a pointer to the source pixels
+ \param src_pitch the pitch of the source pixels, in bytes
+ \param dst_format an SDL_PixelFormatEnum value of the `dst` pixels format
+ \param dst a pointer to be filled in with premultiplied pixel data
+ \param dst_pitch the pitch of the destination pixels, in bytes
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.18.
+
+</member>
+        <member name="M:SDL_ConvertPixels(System.Int32,System.Int32,System.UInt32,System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32,System.UInt32,System.Void*,System.Int32)">
+ Copy a block of pixels of one format to another format.
+
+ \param width the width of the block to copy, in pixels
+ \param height the height of the block to copy, in pixels
+ \param src_format an SDL_PixelFormatEnum value of the `src` pixels format
+ \param src a pointer to the source pixels
+ \param src_pitch the pitch of the source pixels, in bytes
+ \param dst_format an SDL_PixelFormatEnum value of the `dst` pixels format
+ \param dst a pointer to be filled in with new pixel data
+ \param dst_pitch the pitch of the destination pixels, in bytes
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_ConvertSurfaceFormat(SDL_Surface*,System.UInt32,System.UInt32)">
+ Copy an existing surface to a new surface of the specified format enum.
+
+ This function operates just like SDL_ConvertSurface(), but accepts an
+ SDL_PixelFormatEnum value instead of an SDL_PixelFormat structure. As such,
+ it might be easier to call but it doesn't have access to palette
+ information for the destination surface, in case that would be important.
+
+ \param src the existing SDL_Surface structure to convert
+ \param pixel_format the SDL_PixelFormatEnum that the new surface is
+                     optimized for
+ \param flags the flags are unused and should be set to 0; this is a
+              leftover from SDL 1.2's API
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+ \sa SDL_ConvertSurface
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_ConvertSurface(SDL_Surface*,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.UInt32)">
+ Copy an existing surface to a new surface of the specified format.
+
+ This function is used to optimize images for faster *repeat* blitting. This
+ is accomplished by converting the original and storing the result as a new
+ surface. The new, optimized surface can then be used as the source for
+ future blits, making them faster.
+
+ \param src the existing SDL_Surface structure to convert
+ \param fmt the SDL_PixelFormat structure that the new surface is optimized
+            for
+ \param flags the flags are unused and should be set to 0; this is a
+              leftover from SDL 1.2's API
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+ \sa SDL_ConvertSurfaceFormat
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_GetClipRect(SDL_Surface*,SDL_Rect*)">
+ Get the clipping rectangle for a surface.
+
+ When `surface` is the destination of a blit, only the area within the clip
+ rectangle is drawn into.
+
+ \param surface the SDL_Surface structure representing the surface to be
+                clipped
+ \param rect an SDL_Rect structure filled in with the clipping rectangle for
+             the surface
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_SetClipRect
+
+</member>
+        <member name="M:SDL_SetClipRect(SDL_Surface*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Set the clipping rectangle for a surface.
+
+ When `surface` is the destination of a blit, only the area within the clip
+ rectangle is drawn into.
+
+ Note that blits are automatically clipped to the edges of the source and
+ destination surfaces.
+
+ \param surface the SDL_Surface structure to be clipped
+ \param rect the SDL_Rect structure representing the clipping rectangle, or
+             NULL to disable clipping
+ \returns SDL_TRUE if the rectangle intersects the surface, otherwise
+          SDL_FALSE and blits will be completely clipped.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_GetClipRect
+
+</member>
+        <member name="M:SDL_GetSurfaceBlendMode(SDL_Surface*,SDL_BlendMode*)">
+ Get the blend mode used for blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param blendMode a pointer filled in with the current SDL_BlendMode
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_SetSurfaceBlendMode
+
+</member>
+        <member name="M:SDL_SetSurfaceBlendMode(SDL_Surface*,SDL_BlendMode)">
+ Set the blend mode used for blit operations.
+
+ To copy a surface to another surface (or texture) without blending with the
+ existing data, the blendmode of the SOURCE surface should be set to
+ `SDL_BLENDMODE_NONE`.
+
+ \param surface the SDL_Surface structure to update
+ \param blendMode the SDL_BlendMode to use for blit blending
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceBlendMode
+
+</member>
+        <member name="M:SDL_GetSurfaceAlphaMod(SDL_Surface*,System.Byte*)">
+ Get the additional alpha value used in blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param alpha a pointer filled in with the current alpha value
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceColorMod
+ \sa SDL_SetSurfaceAlphaMod
+
+</member>
+        <member name="M:SDL_SetSurfaceAlphaMod(SDL_Surface*,System.Byte)">
+ Set an additional alpha value used in blit operations.
+
+ When this surface is blitted, during the blit operation the source alpha
+ value is modulated by this alpha value according to the following formula:
+
+ `srcA = srcA * (alpha / 255)`
+
+ \param surface the SDL_Surface structure to update
+ \param alpha the alpha value multiplied into blit operations
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceAlphaMod
+ \sa SDL_SetSurfaceColorMod
+
+</member>
+        <member name="M:SDL_GetSurfaceColorMod(SDL_Surface*,System.Byte*,System.Byte*,System.Byte*)">
+ Get the additional color value multiplied into blit operations.
+
+ \param surface the SDL_Surface structure to query
+ \param r a pointer filled in with the current red color value
+ \param g a pointer filled in with the current green color value
+ \param b a pointer filled in with the current blue color value
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceAlphaMod
+ \sa SDL_SetSurfaceColorMod
+
+</member>
+        <member name="M:SDL_SetSurfaceColorMod(SDL_Surface*,System.Byte,System.Byte,System.Byte)">
+ Set an additional color value multiplied into blit operations.
+
+ When this surface is blitted, during the blit operation each source color
+ channel is modulated by the appropriate color value according to the
+ following formula:
+
+ `srcC = srcC * (color / 255)`
+
+ \param surface the SDL_Surface structure to update
+ \param r the red color value multiplied into blit operations
+ \param g the green color value multiplied into blit operations
+ \param b the blue color value multiplied into blit operations
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetSurfaceColorMod
+ \sa SDL_SetSurfaceAlphaMod
+
+</member>
+        <member name="M:SDL_GetColorKey(SDL_Surface*,System.UInt32*)">
+ Get the color key (transparent pixel) for a surface.
+
+ The color key is a pixel of the format used by the surface, as generated by
+ SDL_MapRGB().
+
+ If the surface doesn't have color key enabled this function returns -1.
+
+ \param surface the SDL_Surface structure to query
+ \param key a pointer filled in with the transparent pixel
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_SetColorKey
+
+</member>
+        <member name="M:SDL_HasColorKey(SDL_Surface*)">
+ Returns whether the surface has a color key
+
+ It is safe to pass a NULL `surface` here; it will return SDL_FALSE.
+
+ \param surface the SDL_Surface structure to query
+ \return SDL_TRUE if the surface has a color key, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.9.
+
+ \sa SDL_SetColorKey
+ \sa SDL_GetColorKey
+
+</member>
+        <member name="M:SDL_SetColorKey(SDL_Surface*,System.Int32,System.UInt32)">
+ Set the color key (transparent pixel) in a surface.
+
+ The color key defines a pixel value that will be treated as transparent in
+ a blit. For example, one can use this to specify that cyan pixels should be
+ considered transparent, and therefore not rendered.
+
+ It is a pixel of the format used by the surface, as generated by
+ SDL_MapRGB().
+
+ RLE acceleration can substantially speed up blitting of images with large
+ horizontal runs of transparent pixels. See SDL_SetSurfaceRLE() for details.
+
+ \param surface the SDL_Surface structure to update
+ \param flag SDL_TRUE to enable color key, SDL_FALSE to disable color key
+ \param key the transparent pixel
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_GetColorKey
+
+</member>
+        <member name="M:SDL_HasSurfaceRLE(SDL_Surface*)">
+ Returns whether the surface is RLE enabled
+
+ It is safe to pass a NULL `surface` here; it will return SDL_FALSE.
+
+ \param surface the SDL_Surface structure to query
+ \returns SDL_TRUE if the surface is RLE enabled, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.14.
+
+ \sa SDL_SetSurfaceRLE
+
+</member>
+        <member name="M:SDL_SetSurfaceRLE(SDL_Surface*,System.Int32)">
+  Save a surface to a file.
+
+  Convenience macro.
+
+ Set the RLE acceleration hint for a surface.
+
+ If RLE is enabled, color key and alpha blending blits are much faster, but
+ the surface must be locked before directly accessing the pixels.
+
+ \param surface the SDL_Surface structure to optimize
+ \param flag 0 to disable, non-zero to enable RLE acceleration
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_BlitSurface
+ \sa SDL_LockSurface
+ \sa SDL_UnlockSurface
+
+</member>
+        <member name="M:SDL_SaveBMP_RW(SDL_Surface*,SDL_RWops*,System.Int32)">
+ Load a surface from a file.
+
+ Convenience macro.
+
+ Save a surface to a seekable SDL data stream in BMP format.
+
+ Surfaces with a 24-bit, 32-bit and paletted 8-bit format get saved in the
+ BMP directly. Other RGB formats with 8-bit or higher get converted to a
+ 24-bit surface or, if they have an alpha mask or a colorkey, to a 32-bit
+ surface before they are saved. YUV and paletted 1-bit and 4-bit formats are
+ not supported.
+
+ \param surface the SDL_Surface structure containing the image to be saved
+ \param dst a data stream to save to
+ \param freedst non-zero to close the stream after being written
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_LoadBMP_RW
+ \sa SDL_SaveBMP
+
+</member>
+        <member name="M:SDL_LoadBMP_RW(SDL_RWops*,System.Int32)">
+ Load a BMP image from a seekable SDL data stream.
+
+ The new surface should be freed with SDL_FreeSurface(). Not doing so will
+ result in a memory leak.
+
+ src is an open SDL_RWops buffer, typically loaded with SDL_RWFromFile.
+ Alternitavely, you might also use the macro SDL_LoadBMP to load a bitmap
+ from a file, convert it to an SDL_Surface and then close the file.
+
+ \param src the data stream for the surface
+ \param freesrc non-zero to close the stream after being read
+ \returns a pointer to a new SDL_Surface structure or NULL if there was an
+          error; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeSurface
+ \sa SDL_RWFromFile
+ \sa SDL_LoadBMP
+ \sa SDL_SaveBMP_RW
+
+</member>
+        <member name="M:SDL_UnlockSurface(SDL_Surface*)">
+ Release a surface after directly accessing the pixels.
+
+ \param surface the SDL_Surface structure to be unlocked
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_LockSurface
+
+</member>
+        <member name="M:SDL_LockSurface(SDL_Surface*)">
+ Set up a surface for directly accessing the pixels.
+
+ Between calls to SDL_LockSurface() / SDL_UnlockSurface(), you can write to
+ and read from `surface-&gt;pixels`, using the pixel format stored in
+ `surface-&gt;format`. Once you are done accessing the surface, you should use
+ SDL_UnlockSurface() to release it.
+
+ Not all surfaces require locking. If `SDL_MUSTLOCK(surface)` evaluates to
+ 0, then you can read and write to the surface at any time, and the pixel
+ format of the surface will not change.
+
+ \param surface the SDL_Surface structure to be locked
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_MUSTLOCK
+ \sa SDL_UnlockSurface
+
+</member>
+        <member name="M:SDL_SetSurfacePalette(SDL_Surface*,SDL_Palette*)">
+ Set the palette used by a surface.
+
+ A single palette can be shared with many surfaces.
+
+ \param surface the SDL_Surface structure to update
+ \param palette the SDL_Palette structure to use
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_FreeSurface(SDL_Surface*)">
+ Free an RGB surface.
+
+ It is safe to pass NULL to this function.
+
+ \param surface the SDL_Surface to free.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_LoadBMP
+ \sa SDL_LoadBMP_RW
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceWithFormatFrom(System.Void*,System.Int32,System.Int32,System.Int32,System.Int32,System.UInt32)">
+ Allocate a new RGB surface with with a specific pixel format and existing
+ pixel data.
+
+ This function operates mostly like SDL_CreateRGBSurfaceFrom(), except
+ instead of providing pixel color masks, you provide it with a predefined
+ format from SDL_PixelFormatEnum.
+
+ No copy is made of the pixel data. Pixel data is not managed automatically;
+ you must free the surface before you free the pixel data.
+
+ \param pixels a pointer to existing pixel data
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param pitch the pitch of the surface in bytes
+ \param format the SDL_PixelFormatEnum for the new surface's pixel format.
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.5.
+
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceFrom(System.Void*,System.Int32,System.Int32,System.Int32,System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Allocate a new RGB surface with existing pixel data.
+
+ This function operates mostly like SDL_CreateRGBSurface(), except it does
+ not allocate memory for the pixel data, instead the caller provides an
+ existing buffer of data for the surface to use.
+
+ No copy is made of the pixel data. Pixel data is not managed automatically;
+ you must free the surface before you free the pixel data.
+
+ \param pixels a pointer to existing pixel data
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param pitch the pitch of the surface in bytes
+ \param Rmask the red mask for the pixels
+ \param Gmask the green mask for the pixels
+ \param Bmask the blue mask for the pixels
+ \param Amask the alpha mask for the pixels
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurfaceWithFormat(System.UInt32,System.Int32,System.Int32,System.Int32,System.UInt32)">
+ Allocate a new RGB surface with a specific pixel format.
+
+ This function operates mostly like SDL_CreateRGBSurface(), except instead
+ of providing pixel color masks, you provide it with a predefined format
+ from SDL_PixelFormatEnum.
+
+ \param flags the flags are unused and should be set to 0
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param format the SDL_PixelFormatEnum for the new surface's pixel format.
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.5.
+
+ \sa SDL_CreateRGBSurface
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="M:SDL_CreateRGBSurface(System.UInt32,System.Int32,System.Int32,System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Allocate a new RGB surface.
+
+ If `depth` is 4 or 8 bits, an empty palette is allocated for the surface.
+ If `depth` is greater than 8 bits, the pixel format is set using the
+ [RGBA]mask parameters.
+
+ The [RGBA]mask parameters are the bitmasks used to extract that color from
+ a pixel. For instance, `Rmask` being 0xFF000000 means the red data is
+ stored in the most significant byte. Using zeros for the RGB masks sets a
+ default value, based on the depth. For example:
+
+ ```c++
+ SDL_CreateRGBSurface(0,w,h,32,0,0,0,0);
+ ```
+
+ However, using zero for the Amask results in an Amask of 0.
+
+ By default surfaces with an alpha mask are set up for blending as with:
+
+ ```c++
+ SDL_SetSurfaceBlendMode(surface, SDL_BLENDMODE_BLEND)
+ ```
+
+ You can change this by calling SDL_SetSurfaceBlendMode() and selecting a
+ different `blendMode`.
+
+ \param flags the flags are unused and should be set to 0
+ \param width the width of the surface
+ \param height the height of the surface
+ \param depth the depth of the surface in bits
+ \param Rmask the red mask for the pixels
+ \param Gmask the green mask for the pixels
+ \param Bmask the blue mask for the pixels
+ \param Amask the alpha mask for the pixels
+ \returns the new SDL_Surface structure that is created or NULL if it fails;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_CreateRGBSurfaceFrom
+ \sa SDL_CreateRGBSurfaceWithFormat
+ \sa SDL_FreeSurface
+
+</member>
+        <member name="F:SDL_Surface.refcount">
+Reference count -- used when freeing surface 
+</member>
+        <member name="F:SDL_Surface.map">
+info for fast blit mapping to other surfaces 
+</member>
+        <member name="F:SDL_Surface.clip_rect">
+clipping information 
+</member>
+        <member name="F:SDL_Surface.list_blitmap">
+list of BlitMap that hold a reference to this surface 
+</member>
+        <member name="F:SDL_Surface.locked">
+information needed for surfaces requiring locks 
+</member>
+        <member name="F:SDL_Surface.userdata">
+Application data associated with the surface 
+</member>
+        <member name="T:SDL_Surface">
+ \brief A collection of pixels used in software blitting.
+
+ \note  This structure should be treated as read-only, except for \c pixels,
+        which, if not NULL, contains the raw pixel data for the surface.
+
+
+\brief The type of function used for surface blitting functions.
+
+</member>
+        <member name="M:SDL_ComposeCustomBlendMode(SDL_BlendFactor,SDL_BlendFactor,SDL_BlendOperation,SDL_BlendFactor,SDL_BlendFactor,SDL_BlendOperation)">
+ Compose a custom blend mode for renderers.
+
+ The functions SDL_SetRenderDrawBlendMode and SDL_SetTextureBlendMode accept
+ the SDL_BlendMode returned by this function if the renderer supports it.
+
+ A blend mode controls how the pixels from a drawing operation (source) get
+ combined with the pixels from the render target (destination). First, the
+ components of the source and destination pixels get multiplied with their
+ blend factors. Then, the blend operation takes the two products and
+ calculates the result that will get stored in the render target.
+
+ Expressed in pseudocode, it would look like this:
+
+ ```c
+ dstRGB = colorOperation(srcRGB * srcColorFactor, dstRGB * dstColorFactor);
+ dstA = alphaOperation(srcA * srcAlphaFactor, dstA * dstAlphaFactor);
+ ```
+
+ Where the functions `colorOperation(src, dst)` and `alphaOperation(src,
+ dst)` can return one of the following:
+
+ - `src + dst`
+ - `src - dst`
+ - `dst - src`
+ - `min(src, dst)`
+ - `max(src, dst)`
+
+ The red, green, and blue components are always multiplied with the first,
+ second, and third components of the SDL_BlendFactor, respectively. The
+ fourth component is not used.
+
+ The alpha component is always multiplied with the fourth component of the
+ SDL_BlendFactor. The other components are not used in the alpha
+ calculation.
+
+ Support for these blend modes varies for each renderer. To check if a
+ specific SDL_BlendMode is supported, create a renderer and pass it to
+ either SDL_SetRenderDrawBlendMode or SDL_SetTextureBlendMode. They will
+ return with an error if the blend mode is not supported.
+
+ This list describes the support of custom blend modes for each renderer in
+ SDL 2.0.6. All renderers support the four blend modes listed in the
+ SDL_BlendMode enumeration.
+
+ - **direct3d**: Supports all operations with all factors. However, some
+   factors produce unexpected results with `SDL_BLENDOPERATION_MINIMUM` and
+   `SDL_BLENDOPERATION_MAXIMUM`.
+ - **direct3d11**: Same as Direct3D 9.
+ - **opengl**: Supports the `SDL_BLENDOPERATION_ADD` operation with all
+   factors. OpenGL versions 1.1, 1.2, and 1.3 do not work correctly with SDL
+   2.0.6.
+ - **opengles**: Supports the `SDL_BLENDOPERATION_ADD` operation with all
+   factors. Color and alpha factors need to be the same. OpenGL ES 1
+   implementation specific: May also support `SDL_BLENDOPERATION_SUBTRACT`
+   and `SDL_BLENDOPERATION_REV_SUBTRACT`. May support color and alpha
+   operations being different from each other. May support color and alpha
+   factors being different from each other.
+ - **opengles2**: Supports the `SDL_BLENDOPERATION_ADD`,
+   `SDL_BLENDOPERATION_SUBTRACT`, `SDL_BLENDOPERATION_REV_SUBTRACT`
+   operations with all factors.
+ - **psp**: No custom blend mode support.
+ - **software**: No custom blend mode support.
+
+ Some renderers do not provide an alpha component for the default render
+ target. The `SDL_BLENDFACTOR_DST_ALPHA` and
+ `SDL_BLENDFACTOR_ONE_MINUS_DST_ALPHA` factors do not have an effect in this
+ case.
+
+ \param srcColorFactor the SDL_BlendFactor applied to the red, green, and
+                       blue components of the source pixels
+ \param dstColorFactor the SDL_BlendFactor applied to the red, green, and
+                       blue components of the destination pixels
+ \param colorOperation the SDL_BlendOperation used to combine the red,
+                       green, and blue components of the source and
+                       destination pixels
+ \param srcAlphaFactor the SDL_BlendFactor applied to the alpha component of
+                       the source pixels
+ \param dstAlphaFactor the SDL_BlendFactor applied to the alpha component of
+                       the destination pixels
+ \param alphaOperation the SDL_BlendOperation used to combine the alpha
+                       component of the source and destination pixels
+ \returns an SDL_BlendMode that represents the chosen factors and
+          operations.
+
+ \since This function is available since SDL 2.0.6.
+
+ \sa SDL_SetRenderDrawBlendMode
+ \sa SDL_GetRenderDrawBlendMode
+ \sa SDL_SetTextureBlendMode
+ \sa SDL_GetTextureBlendMode
+
+</member>
+        <member name="M:SDL_IntersectFRectAndLine(SDL_FRect!System.Runtime.CompilerServices.IsConst*,System.Single*,System.Single*,System.Single*,System.Single*)">
+ Calculate the intersection of a rectangle and line segment with float
+ precision.
+
+ This function is used to clip a line segment to a rectangle. A line segment
+ contained entirely within the rectangle or that does not intersect will
+ remain unchanged. A line segment that crosses the rectangle at either or
+ both ends will be clipped to the boundary of the rectangle and the new
+ coordinates saved in `X1`, `Y1`, `X2`, and/or `Y2` as necessary.
+
+ \param rect an SDL_FRect structure representing the rectangle to intersect
+ \param X1 a pointer to the starting X-coordinate of the line
+ \param Y1 a pointer to the starting Y-coordinate of the line
+ \param X2 a pointer to the ending X-coordinate of the line
+ \param Y2 a pointer to the ending Y-coordinate of the line
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_EncloseFPoints(SDL_FPoint!System.Runtime.CompilerServices.IsConst*,System.Int32,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate a minimal rectangle enclosing a set of points with float
+ precision.
+
+ If `clip` is not NULL then only points inside of the clipping rectangle are
+ considered.
+
+ \param points an array of SDL_FPoint structures representing points to be
+               enclosed
+ \param count the number of structures in the `points` array
+ \param clip an SDL_FRect used for clipping or NULL to enclose all points
+ \param result an SDL_FRect structure filled in with the minimal enclosing
+               rectangle
+ \returns SDL_TRUE if any points were enclosed or SDL_FALSE if all the
+          points were outside of the clipping rectangle.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_UnionFRect(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate the union of two rectangles with float precision.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \param result an SDL_FRect structure filled in with the union of rectangles
+               `A` and `B`
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_IntersectFRect(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect*)">
+ Calculate the intersection of two rectangles with float precision.
+
+ If `result` is NULL then this function will return SDL_FALSE.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \param result an SDL_FRect structure filled in with the intersection of
+               rectangles `A` and `B`
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+ \sa SDL_HasIntersectionF
+
+</member>
+        <member name="M:SDL_HasIntersectionF(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+ Determine whether two rectangles intersect with float precision.
+
+ If either pointer is NULL the function will return SDL_FALSE.
+
+ \param A an SDL_FRect structure representing the first rectangle
+ \param B an SDL_FRect structure representing the second rectangle
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.22.
+
+ \sa SDL_IntersectRect
+
+</member>
+        <member name="M:SDL_FRectEquals(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+ Returns true if the two rectangles are equal, using a default epsilon.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_FRectEqualsEpsilon(SDL_FRect!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*,System.Single!System.Runtime.CompilerServices.IsConst)">
+ Returns true if the two rectangles are equal, within some given epsilon.
+
+ \since This function is available since SDL 2.0.22.
+
+</member>
+        <member name="M:SDL_FRectEmpty(SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the rectangle has no area.
+
+</member>
+        <member name="M:SDL_PointInFRect(SDL_FPoint!System.Runtime.CompilerServices.IsConst*,SDL_FRect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if point resides inside a rectangle.
+
+</member>
+        <member name="M:SDL_IntersectRectAndLine(SDL_Rect!System.Runtime.CompilerServices.IsConst*,System.Int32*,System.Int32*,System.Int32*,System.Int32*)">
+ Calculate the intersection of a rectangle and line segment.
+
+ This function is used to clip a line segment to a rectangle. A line segment
+ contained entirely within the rectangle or that does not intersect will
+ remain unchanged. A line segment that crosses the rectangle at either or
+ both ends will be clipped to the boundary of the rectangle and the new
+ coordinates saved in `X1`, `Y1`, `X2`, and/or `Y2` as necessary.
+
+ \param rect an SDL_Rect structure representing the rectangle to intersect
+ \param X1 a pointer to the starting X-coordinate of the line
+ \param Y1 a pointer to the starting Y-coordinate of the line
+ \param X2 a pointer to the ending X-coordinate of the line
+ \param Y2 a pointer to the ending Y-coordinate of the line
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_EnclosePoints(SDL_Point!System.Runtime.CompilerServices.IsConst*,System.Int32,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate a minimal rectangle enclosing a set of points.
+
+ If `clip` is not NULL then only points inside of the clipping rectangle are
+ considered.
+
+ \param points an array of SDL_Point structures representing points to be
+               enclosed
+ \param count the number of structures in the `points` array
+ \param clip an SDL_Rect used for clipping or NULL to enclose all points
+ \param result an SDL_Rect structure filled in with the minimal enclosing
+               rectangle
+ \returns SDL_TRUE if any points were enclosed or SDL_FALSE if all the
+          points were outside of the clipping rectangle.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_UnionRect(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate the union of two rectangles.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \param result an SDL_Rect structure filled in with the union of rectangles
+               `A` and `B`
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_IntersectRect(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect*)">
+ Calculate the intersection of two rectangles.
+
+ If `result` is NULL then this function will return SDL_FALSE.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \param result an SDL_Rect structure filled in with the intersection of
+               rectangles `A` and `B`
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_HasIntersection
+
+</member>
+        <member name="M:SDL_HasIntersection(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+ Determine whether two rectangles intersect.
+
+ If either pointer is NULL the function will return SDL_FALSE.
+
+ \param A an SDL_Rect structure representing the first rectangle
+ \param B an SDL_Rect structure representing the second rectangle
+ \returns SDL_TRUE if there is an intersection, SDL_FALSE otherwise.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_IntersectRect
+
+</member>
+        <member name="M:SDL_RectEquals(SDL_Rect!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the two rectangles are equal.
+
+</member>
+        <member name="M:SDL_RectEmpty(SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if the rectangle has no area.
+
+</member>
+        <member name="M:SDL_PointInRect(SDL_Point!System.Runtime.CompilerServices.IsConst*,SDL_Rect!System.Runtime.CompilerServices.IsConst*)">
+Returns true if point resides inside a rectangle.
+
+</member>
+        <member name="T:SDL_FRect">
+ A rectangle, with the origin at the upper left (floating point).
+
+ \sa SDL_FRectEmpty
+ \sa SDL_FRectEquals
+ \sa SDL_FRectEqualsEpsilon
+ \sa SDL_HasIntersectionF
+ \sa SDL_IntersectFRect
+ \sa SDL_IntersectFRectAndLine
+ \sa SDL_UnionFRect
+ \sa SDL_EncloseFPoints
+ \sa SDL_PointInFRect
+
+</member>
+        <member name="T:SDL_Rect">
+ A rectangle, with the origin at the upper left (integer).
+
+ \sa SDL_RectEmpty
+ \sa SDL_RectEquals
+ \sa SDL_HasIntersection
+ \sa SDL_IntersectRect
+ \sa SDL_IntersectRectAndLine
+ \sa SDL_UnionRect
+ \sa SDL_EnclosePoints
+
+</member>
+        <member name="T:SDL_FPoint">
+ The structure that defines a point (floating point)
+
+ \sa SDL_EncloseFPoints
+ \sa SDL_PointInFRect
+
+</member>
+        <member name="M:SDL_WriteBE64(SDL_RWops*,System.UInt64)">
+ Use this function to write 64 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE64
+
+</member>
+        <member name="M:SDL_WriteLE64(SDL_RWops*,System.UInt64)">
+ Use this function to write 64 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE64
+
+</member>
+        <member name="M:SDL_WriteBE32(SDL_RWops*,System.UInt32)">
+ Use this function to write 32 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE32
+
+</member>
+        <member name="M:SDL_WriteLE32(SDL_RWops*,System.UInt32)">
+ Use this function to write 32 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE32
+
+</member>
+        <member name="M:SDL_WriteBE16(SDL_RWops*,System.UInt16)">
+ Use this function to write 16 bits in native format to a SDL_RWops as
+ big-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in big-endian format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteLE16
+
+</member>
+        <member name="M:SDL_WriteLE16(SDL_RWops*,System.UInt16)">
+ Use this function to write 16 bits in native format to a SDL_RWops as
+ little-endian data.
+
+ SDL byteswaps the data only if necessary, so the application always
+ specifies native format, and the data written will be in little-endian
+ format.
+
+ \param dst the stream to which data will be written
+ \param value the data to be written, in native format
+ \returns 1 on successful write, 0 on error.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteBE16
+
+</member>
+        <member name="M:SDL_WriteU8(SDL_RWops*,System.Byte)">
+  \name Write endian functions
+
+  Write an item of native format to the specified endianness.
+
+ Use this function to write a byte to an SDL_RWops.
+
+ \param dst the SDL_RWops to write to
+ \param value the byte value to write
+ \returns 1 on success or 0 on failure; call SDL_GetError() for more
+          information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadU8
+
+</member>
+        <member name="M:SDL_ReadBE64(SDL_RWops*)">
+ Use this function to read 64 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 64 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE64
+
+</member>
+        <member name="M:SDL_ReadLE64(SDL_RWops*)">
+ Use this function to read 64 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 64 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE64
+
+</member>
+        <member name="M:SDL_ReadBE32(SDL_RWops*)">
+ Use this function to read 32 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 32 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE32
+
+</member>
+        <member name="M:SDL_ReadLE32(SDL_RWops*)">
+ Use this function to read 32 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 32 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE32
+
+</member>
+        <member name="M:SDL_ReadBE16(SDL_RWops*)">
+ Use this function to read 16 bits of big-endian data from an SDL_RWops and
+ return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 16 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadLE16
+
+</member>
+        <member name="M:SDL_ReadLE16(SDL_RWops*)">
+ Use this function to read 16 bits of little-endian data from an SDL_RWops
+ and return in native format.
+
+ SDL byteswaps the data only if necessary, so the data returned will be in
+ the native byte order.
+
+ \param src the stream from which to read data
+ \returns 16 bits of data in the native byte order of the platform.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ReadBE16
+
+</member>
+        <member name="M:SDL_ReadU8(SDL_RWops*)">
+  \name Read endian functions
+
+  Read an item of the specified endianness and return in native format.
+
+ Use this function to read a byte from an SDL_RWops.
+
+ \param src the SDL_RWops to read from
+ \returns the read byte on success or 0 on failure; call SDL_GetError() for
+          more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_WriteU8
+
+</member>
+        <member name="M:SDL_LoadFile(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.UInt64*)">
+ Load all the data from a file path.
+
+ The data is allocated with a zero byte at the end (null terminated) for
+ convenience. This extra byte is not included in the value reported via
+ `datasize`.
+
+ The data should be freed with SDL_free().
+
+ Prior to SDL 2.0.10, this function was a macro wrapping around
+ SDL_LoadFile_RW.
+
+ \param file the path to read all available data from
+ \param datasize if not NULL, will store the number of bytes read
+ \returns the data, or NULL if there was an error.
+
+ \since This function is available since SDL 2.0.10.
+
+</member>
+        <member name="M:SDL_LoadFile_RW(SDL_RWops*,System.UInt64*,System.Int32)">
+ Load all the data from an SDL data stream.
+
+ The data is allocated with a zero byte at the end (null terminated) for
+ convenience. This extra byte is not included in the value reported via
+ `datasize`.
+
+ The data should be freed with SDL_free().
+
+ \param src the SDL_RWops to read all available data from
+ \param datasize if not NULL, will store the number of bytes read
+ \param freesrc if non-zero, calls SDL_RWclose() on `src` before returning
+ \returns the data, or NULL if there was an error.
+
+ \since This function is available since SDL 2.0.6.
+
+</member>
+        <member name="M:SDL_RWclose(SDL_RWops*)">
+ Close and free an allocated SDL_RWops structure.
+
+ SDL_RWclose() closes and cleans up the SDL_RWops stream. It releases any
+ resources used by the stream and frees the SDL_RWops itself with
+ SDL_FreeRW(). This returns 0 on success, or -1 if the stream failed to
+ flush to its output (e.g. to disk).
+
+ Note that if this fails to flush the stream to disk, this function reports
+ an error, but the SDL_RWops is still invalid once this function returns.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context SDL_RWops structure to close
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWwrite(SDL_RWops*,System.Void!System.Runtime.CompilerServices.IsConst*,System.UInt64,System.UInt64)">
+ Write to an SDL_RWops data stream.
+
+ This function writes exactly `num` objects each of size `size` from the
+ area pointed at by `ptr` to the stream. If this fails for any reason, it'll
+ return less than `num` to demonstrate how far the write progressed. On
+ success, it returns `num`.
+
+ SDL_RWwrite is actually a function wrapper that calls the SDL_RWops's
+ `write` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param ptr a pointer to a buffer containing data to write
+ \param size the size of an object to write, in bytes
+ \param num the number of objects to write
+ \returns the number of objects written, which will be less than **num** on
+          error; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+
+</member>
+        <member name="M:SDL_RWread(SDL_RWops*,System.Void*,System.UInt64,System.UInt64)">
+ Read from a data source.
+
+ This function reads up to `maxnum` objects each of size `size` from the
+ data source to the area pointed at by `ptr`. This function may read less
+ objects than requested. It will return zero when there has been an error or
+ the data stream is completely read.
+
+ SDL_RWread() is actually a function wrapper that calls the SDL_RWops's
+ `read` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param ptr a pointer to a buffer to read data into
+ \param size the size of each object to read, in bytes
+ \param maxnum the maximum number of objects to be read
+ \returns the number of objects read, or 0 at error or end of file; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWtell(SDL_RWops*)">
+ Determine the current read/write offset in an SDL_RWops data stream.
+
+ SDL_RWtell is actually a wrapper function that calls the SDL_RWops's `seek`
+ method, with an offset of 0 bytes from `RW_SEEK_CUR`, to simplify
+ application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a SDL_RWops data stream object from which to get the current
+                offset
+ \returns the current offset in the stream, or -1 if the information can not
+          be determined.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWseek(SDL_RWops*,System.Int64,System.Int32)">
+ Seek within an SDL_RWops data stream.
+
+ This function seeks to byte `offset`, relative to `whence`.
+
+ `whence` may be any of the following values:
+
+ - `RW_SEEK_SET`: seek from the beginning of data
+ - `RW_SEEK_CUR`: seek relative to current read point
+ - `RW_SEEK_END`: seek relative to the end of data
+
+ If this stream can not seek, it will return -1.
+
+ SDL_RWseek() is actually a wrapper function that calls the SDL_RWops's
+ `seek` method appropriately, to simplify application development.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context a pointer to an SDL_RWops structure
+ \param offset an offset in bytes, relative to **whence** location; can be
+               negative
+ \param whence any of `RW_SEEK_SET`, `RW_SEEK_CUR`, `RW_SEEK_END`
+ \returns the final offset in the data stream after the seek or -1 on error.
+
+ \since This function is available since SDL 2.0.10.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWsize(SDL_RWops*)">
+ Use this function to get the size of the data stream in an SDL_RWops.
+
+ Prior to SDL 2.0.10, this function was a macro.
+
+ \param context the SDL_RWops to get the size of the data stream from
+ \returns the size of the data stream in the SDL_RWops on success, -1 if
+          unknown or a negative error code on failure; call SDL_GetError()
+          for more information.
+
+ \since This function is available since SDL 2.0.10.
+
+</member>
+        <member name="M:SDL_FreeRW(SDL_RWops*)">
+ Use this function to free an SDL_RWops structure allocated by
+ SDL_AllocRW().
+
+ Applications do not need to use this function unless they are providing
+ their own SDL_RWops implementation. If you just need a SDL_RWops to
+ read/write a common data source, you should use the built-in
+ implementations in SDL, like SDL_RWFromFile() or SDL_RWFromMem(), etc, and
+ call the **close** method on those SDL_RWops pointers when you are done
+ with them.
+
+ Only use SDL_FreeRW() on pointers returned by SDL_AllocRW(). The pointer is
+ invalid as soon as this function returns. Any extra memory allocated during
+ creation of the SDL_RWops is not freed by SDL_FreeRW(); the programmer must
+ be responsible for managing that memory in their **close** method.
+
+ \param area the SDL_RWops structure to be freed
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocRW
+
+</member>
+        <member name="M:SDL_AllocRW">
+ Use this function to allocate an empty, unpopulated SDL_RWops structure.
+
+ Applications do not need to use this function unless they are providing
+ their own SDL_RWops implementation. If you just need a SDL_RWops to
+ read/write a common data source, you should use the built-in
+ implementations in SDL, like SDL_RWFromFile() or SDL_RWFromMem(), etc.
+
+ You must free the returned pointer with SDL_FreeRW(). Depending on your
+ operating system and compiler, there may be a difference between the
+ malloc() and free() your program uses and the versions SDL calls
+ internally. Trying to mix the two can cause crashing such as segmentation
+ faults. Since all SDL_RWops must free themselves when their **close**
+ method is called, all SDL_RWops must be allocated through this function, so
+ they can all be freed correctly with SDL_FreeRW().
+
+ \returns a pointer to the allocated memory on success, or NULL on failure;
+          call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeRW
+
+</member>
+        <member name="M:SDL_RWFromConstMem(System.Void!System.Runtime.CompilerServices.IsConst*,System.Int32)">
+ Use this function to prepare a read-only memory buffer for use with RWops.
+
+ This function sets up an SDL_RWops struct based on a memory area of a
+ certain size. It assumes the memory area is not writable.
+
+ Attempting to write to this RWops stream will report an error without
+ writing to the memory buffer.
+
+ This memory buffer is not copied by the RWops; the pointer you provide must
+ remain valid until you close the stream. Closing the stream will not free
+ the original buffer.
+
+ If you need to write to a memory buffer, you should use SDL_RWFromMem()
+ with a writable buffer of memory instead.
+
+ \param mem a pointer to a read-only buffer to feed an SDL_RWops stream
+ \param size the buffer size, in bytes
+ \returns a pointer to a new SDL_RWops structure, or NULL if it fails; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+
+</member>
+        <member name="M:SDL_RWFromMem(System.Void*,System.Int32)">
+ Use this function to prepare a read-write memory buffer for use with
+ SDL_RWops.
+
+ This function sets up an SDL_RWops struct based on a memory area of a
+ certain size, for both read and write access.
+
+ This memory buffer is not copied by the RWops; the pointer you provide must
+ remain valid until you close the stream. Closing the stream will not free
+ the original buffer.
+
+ If you need to make sure the RWops never writes to the memory buffer, you
+ should use SDL_RWFromConstMem() with a read-only buffer of memory instead.
+
+ \param mem a pointer to a buffer to feed an SDL_RWops stream
+ \param size the buffer size, in bytes
+ \returns a pointer to a new SDL_RWops structure, or NULL if it fails; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWFromFP(System.Void*,SDL_bool)">
+ Use this function to create an SDL_RWops structure from a standard I/O file
+ pointer (stdio.h's `FILE*`).
+
+ This function is not available on Windows, since files opened in an
+ application on that platform cannot be used by a dynamically linked
+ library.
+
+ On some platforms, the first parameter is a `void*`, on others, it's a
+ `FILE*`, depending on what system headers are available to SDL. It is
+ always intended to be the `FILE*` type from the C runtime's stdio.h.
+
+ \param fp the `FILE*` that feeds the SDL_RWops stream
+ \param autoclose SDL_TRUE to close the `FILE*` when closing the SDL_RWops,
+                  SDL_FALSE to leave the `FILE*` open when the RWops is
+                  closed
+ \returns a pointer to the SDL_RWops structure that is created, or NULL on
+          failure; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFile
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="M:SDL_RWFromFile(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*)">
+  \name RWFrom functions
+
+  Functions to create SDL_RWops structures from various data streams.
+
+ Use this function to create a new SDL_RWops structure for reading from
+ and/or writing to a named file.
+
+ The `mode` string is treated roughly the same as in a call to the C
+ library's fopen(), even if SDL doesn't happen to use fopen() behind the
+ scenes.
+
+ Available `mode` strings:
+
+ - "r": Open a file for reading. The file must exist.
+ - "w": Create an empty file for writing. If a file with the same name
+   already exists its content is erased and the file is treated as a new
+   empty file.
+ - "a": Append to a file. Writing operations append data at the end of the
+   file. The file is created if it does not exist.
+ - "r+": Open a file for update both reading and writing. The file must
+   exist.
+ - "w+": Create an empty file for both reading and writing. If a file with
+   the same name already exists its content is erased and the file is
+   treated as a new empty file.
+ - "a+": Open a file for reading and appending. All writing operations are
+   performed at the end of the file, protecting the previous content to be
+   overwritten. You can reposition (fseek, rewind) the internal pointer to
+   anywhere in the file for reading, but writing operations will move it
+   back to the end of file. The file is created if it does not exist.
+
+ **NOTE**: In order to open a file as a binary file, a "b" character has to
+ be included in the `mode` string. This additional "b" character can either
+ be appended at the end of the string (thus making the following compound
+ modes: "rb", "wb", "ab", "r+b", "w+b", "a+b") or be inserted between the
+ letter and the "+" sign for the mixed modes ("rb+", "wb+", "ab+").
+ Additional characters may follow the sequence, although they should have no
+ effect. For example, "t" is sometimes appended to make explicit the file is
+ a text file.
+
+ This function supports Unicode filenames, but they must be encoded in UTF-8
+ format, regardless of the underlying operating system.
+
+ As a fallback, SDL_RWFromFile() will transparently open a matching filename
+ in an Android app's `assets`.
+
+ Closing the SDL_RWops will close the file handle SDL is holding internally.
+
+ \param file a UTF-8 string representing the filename to open
+ \param mode an ASCII string representing the mode to be used for opening
+             the file.
+ \returns a pointer to the SDL_RWops structure that is created, or NULL on
+          failure; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_RWclose
+ \sa SDL_RWFromConstMem
+ \sa SDL_RWFromFP
+ \sa SDL_RWFromMem
+ \sa SDL_RWread
+ \sa SDL_RWseek
+ \sa SDL_RWtell
+ \sa SDL_RWwrite
+
+</member>
+        <member name="T:SDL_RWops">
+Return the size of the file in this rwops, or -1 if unknown
+
+
+  Seek to \c offset relative to \c whence, one of stdio's whence values:
+  RW_SEEK_SET, RW_SEEK_CUR, RW_SEEK_END
+
+  \return the final offset in the data stream, or -1 on error.
+
+
+  Read up to \c maxnum objects each of size \c size from the data
+  stream to the area pointed at by \c ptr.
+
+  \return the number of objects read, or 0 at error or end of file.
+
+
+  Write exactly \c num objects each of size \c size from the area
+  pointed at by \c ptr to data stream.
+
+  \return the number of objects written, or 0 at error or end of file.
+
+
+  Close and free an allocated SDL_RWops structure.
+
+  \return 0 if successful or -1 on write error when flushing data.
+
+</member>
+        <member name="M:SDL_ClearError">
+ Clear any previous error message for this thread.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetError
+ \sa SDL_SetError
+
+</member>
+        <member name="M:SDL_GetErrorMsg(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte*,System.Int32)">
+ Get the last error message that was set for the current thread.
+
+ This allows the caller to copy the error string into a provided buffer, but
+ otherwise operates exactly the same as SDL_GetError().
+
+ \param errstr A buffer to fill with the last error message that was set for
+               the current thread
+ \param maxlen The size of the buffer pointed to by the errstr parameter
+ \returns the pointer passed in as the `errstr` parameter.
+
+ \since This function is available since SDL 2.0.14.
+
+ \sa SDL_GetError
+
+</member>
+        <member name="M:SDL_GetError">
+ Retrieve a message about the last error that occurred on the current
+ thread.
+
+ It is possible for multiple errors to occur before calling SDL_GetError().
+ Only the last error is returned.
+
+ The message is only applicable when an SDL function has signaled an error.
+ You must check the return values of SDL function calls to determine when to
+ appropriately call SDL_GetError(). You should *not* use the results of
+ SDL_GetError() to decide if an error has occurred! Sometimes SDL will set
+ an error string even when reporting success.
+
+ SDL will *not* clear the error string for successful API calls. You *must*
+ check return values for failure cases before you can assume the error
+ string applies.
+
+ Error strings are set per-thread, so an error set in a different thread
+ will not interfere with the current thread's operation.
+
+ The returned string is internally allocated and must not be freed by the
+ application.
+
+ \returns a message with information about the specific error that occurred,
+          or an empty string if there hasn't been an error message set since
+          the last call to SDL_ClearError(). The message is only applicable
+          when an SDL function has signaled an error. You must check the
+          return values of SDL function calls to determine when to
+          appropriately call SDL_GetError().
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_ClearError
+ \sa SDL_SetError
+
+</member>
+        <member name="M:SDL_CalculateGammaRamp(System.Single,System.UInt16*)">
+ Calculate a 256 entry gamma ramp for a gamma value.
+
+ \param gamma a gamma value where 0.0 is black and 1.0 is identity
+ \param ramp an array of 256 values filled in with the gamma ramp
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_SetWindowGammaRamp
+
+</member>
+        <member name="M:SDL_GetRGBA(System.UInt32,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte*,System.Byte*,System.Byte*,System.Byte*)">
+ Get RGBA values from a pixel in the specified format.
+
+ This function uses the entire 8-bit [0..255] range when converting color
+ components from pixel formats with less than 8-bits per RGB component
+ (e.g., a completely white pixel in 16-bit RGB565 format would return [0xff,
+ 0xff, 0xff] not [0xf8, 0xfc, 0xf8]).
+
+ If the surface has no alpha component, the alpha will be returned as 0xff
+ (100% opaque).
+
+ \param pixel a pixel value
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r a pointer filled in with the red component
+ \param g a pointer filled in with the green component
+ \param b a pointer filled in with the blue component
+ \param a a pointer filled in with the alpha component
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_MapRGB
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_GetRGB(System.UInt32,SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte*,System.Byte*,System.Byte*)">
+ Get RGB values from a pixel in the specified format.
+
+ This function uses the entire 8-bit [0..255] range when converting color
+ components from pixel formats with less than 8-bits per RGB component
+ (e.g., a completely white pixel in 16-bit RGB565 format would return [0xff,
+ 0xff, 0xff] not [0xf8, 0xfc, 0xf8]).
+
+ \param pixel a pixel value
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r a pointer filled in with the red component
+ \param g a pointer filled in with the green component
+ \param b a pointer filled in with the blue component
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGB
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_MapRGBA(SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte,System.Byte,System.Byte,System.Byte)">
+ Map an RGBA quadruple to a pixel value for a given pixel format.
+
+ This function maps the RGBA color value to the specified pixel format and
+ returns the pixel value best approximating the given RGBA color value for
+ the given pixel format.
+
+ If the specified pixel format has no alpha component the alpha value will
+ be ignored (as it will be in formats with a palette).
+
+ If the format has a palette (8-bit) the index of the closest matching color
+ in the palette will be returned.
+
+ If the pixel format bpp (color depth) is less than 32-bpp then the unused
+ upper bits of the return value can safely be ignored (e.g., with a 16-bpp
+ format the return value can be assigned to a Uint16, and similarly a Uint8
+ for an 8-bpp format).
+
+ \param format an SDL_PixelFormat structure describing the format of the
+               pixel
+ \param r the red component of the pixel in the range 0-255
+ \param g the green component of the pixel in the range 0-255
+ \param b the blue component of the pixel in the range 0-255
+ \param a the alpha component of the pixel in the range 0-255
+ \returns a pixel value
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGB
+
+</member>
+        <member name="M:SDL_MapRGB(SDL_PixelFormat!System.Runtime.CompilerServices.IsConst*,System.Byte,System.Byte,System.Byte)">
+ Map an RGB triple to an opaque pixel value for a given pixel format.
+
+ This function maps the RGB color value to the specified pixel format and
+ returns the pixel value best approximating the given RGB color value for
+ the given pixel format.
+
+ If the format has a palette (8-bit) the index of the closest matching color
+ in the palette will be returned.
+
+ If the specified pixel format has an alpha component it will be returned as
+ all 1 bits (fully opaque).
+
+ If the pixel format bpp (color depth) is less than 32-bpp then the unused
+ upper bits of the return value can safely be ignored (e.g., with a 16-bpp
+ format the return value can be assigned to a Uint16, and similarly a Uint8
+ for an 8-bpp format).
+
+ \param format an SDL_PixelFormat structure describing the pixel format
+ \param r the red component of the pixel in the range 0-255
+ \param g the green component of the pixel in the range 0-255
+ \param b the blue component of the pixel in the range 0-255
+ \returns a pixel value
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_GetRGB
+ \sa SDL_GetRGBA
+ \sa SDL_MapRGBA
+
+</member>
+        <member name="M:SDL_FreePalette(SDL_Palette*)">
+ Free a palette created with SDL_AllocPalette().
+
+ \param palette the SDL_Palette structure to be freed
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+
+</member>
+        <member name="M:SDL_SetPaletteColors(SDL_Palette*,SDL_Color!System.Runtime.CompilerServices.IsConst*,System.Int32,System.Int32)">
+ Set a range of colors in a palette.
+
+ \param palette the SDL_Palette structure to modify
+ \param colors an array of SDL_Color structures to copy into the palette
+ \param firstcolor the index of the first palette entry to modify
+ \param ncolors the number of entries to modify
+ \returns 0 on success or a negative error code if not all of the colors
+          could be set; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+ \sa SDL_CreateRGBSurface
+
+</member>
+        <member name="M:SDL_SetPixelFormatPalette(SDL_PixelFormat*,SDL_Palette*)">
+ Set the palette for a pixel format structure.
+
+ \param format the SDL_PixelFormat structure that will use the palette
+ \param palette the SDL_Palette structure that will be used
+ \returns 0 on success or a negative error code on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocPalette
+ \sa SDL_FreePalette
+
+</member>
+        <member name="M:SDL_AllocPalette(System.Int32)">
+ Create a palette structure with the specified number of color entries.
+
+ The palette entries are initialized to white.
+
+ \param ncolors represents the number of color entries in the color palette
+ \returns a new SDL_Palette structure on success or NULL on failure (e.g. if
+          there wasn't enough memory); call SDL_GetError() for more
+          information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreePalette
+
+</member>
+        <member name="M:SDL_FreeFormat(SDL_PixelFormat*)">
+ Free an SDL_PixelFormat structure allocated by SDL_AllocFormat().
+
+ \param format the SDL_PixelFormat structure to free
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_AllocFormat
+
+</member>
+        <member name="M:SDL_AllocFormat(System.UInt32)">
+ Create an SDL_PixelFormat structure corresponding to a pixel format.
+
+ Returned structure may come from a shared global cache (i.e. not newly
+ allocated), and hence should not be modified, especially the palette. Weird
+ errors such as `Blit combination not supported` may occur.
+
+ \param pixel_format one of the SDL_PixelFormatEnum values
+ \returns the new SDL_PixelFormat structure or NULL on failure; call
+          SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_FreeFormat
+
+</member>
+        <member name="M:SDL_MasksToPixelFormatEnum(System.Int32,System.UInt32,System.UInt32,System.UInt32,System.UInt32)">
+ Convert a bpp value and RGBA masks to an enumerated pixel format.
+
+ This will return `SDL_PIXELFORMAT_UNKNOWN` if the conversion wasn't
+ possible.
+
+ \param bpp a bits per pixel value; usually 15, 16, or 32
+ \param Rmask the red mask for the format
+ \param Gmask the green mask for the format
+ \param Bmask the blue mask for the format
+ \param Amask the alpha mask for the format
+ \returns one of the SDL_PixelFormatEnum values
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_PixelFormatEnumToMasks
+
+</member>
+        <member name="M:SDL_PixelFormatEnumToMasks(System.UInt32,System.Int32*,System.UInt32*,System.UInt32*,System.UInt32*,System.UInt32*)">
+ Convert one of the enumerated pixel formats to a bpp value and RGBA masks.
+
+ \param format one of the SDL_PixelFormatEnum values
+ \param bpp a bits per pixel value; usually 15, 16, or 32
+ \param Rmask a pointer filled in with the red mask for the format
+ \param Gmask a pointer filled in with the green mask for the format
+ \param Bmask a pointer filled in with the blue mask for the format
+ \param Amask a pointer filled in with the alpha mask for the format
+ \returns SDL_TRUE on success or SDL_FALSE if the conversion wasn't
+          possible; call SDL_GetError() for more information.
+
+ \since This function is available since SDL 2.0.0.
+
+ \sa SDL_MasksToPixelFormatEnum
+
+</member>
+        <member name="M:SDL_GetPixelFormatName(System.UInt32)">
+ Get the human readable name of a pixel format.
+
+ \param format the pixel format to query
+ \returns the human readable name of the specified pixel format or
+          `SDL_PIXELFORMAT_UNKNOWN` if the format isn't recognized.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="T:SDL_PixelFormat">
+\note Everything in the pixel format structure is read-only.
+
+</member>
+        <member name="T:SDL_Color">
+The bits of this structure can be directly reinterpreted as an integer-packed
+color which uses the SDL_PIXELFORMAT_RGBA32 format (SDL_PIXELFORMAT_ABGR8888
+on little-endian systems and SDL_PIXELFORMAT_RGBA8888 on big-endian systems).
+
+</member>
+        <member name="M:SDL_size_add_overflow(System.UInt64,System.UInt64,System.UInt64*)">
+ If a + b would overflow, return -1. Otherwise store a + b via ret
+ and return 0.
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_size_mul_overflow(System.UInt64,System.UInt64,System.UInt64*)">
+ If a * b would overflow, return -1. Otherwise store a * b via ret
+ and return 0.
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_iconv_string(System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte!System.Runtime.CompilerServices.IsConst*,System.UInt64)">
+ This function converts a string between encodings in one pass, returning a
+ string that must be freed with SDL_free() or NULL on error.
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SDL_GetNumAllocations">
+ Get the number of outstanding (unfreed) allocations
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_SetMemoryFunctions(=FUNC:System.Void*(System.UInt64),=FUNC:System.Void*(System.UInt64,System.UInt64),=FUNC:System.Void*(System.Void*,System.UInt64),=FUNC:System.Void(System.Void*))">
+ Replace SDL's memory allocation functions with a custom set
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_GetMemoryFunctions(=FUNC:System.Void*(System.UInt64)*,=FUNC:System.Void*(System.UInt64,System.UInt64)*,=FUNC:System.Void*(System.Void*,System.UInt64)*,=FUNC:System.Void(System.Void*)*)">
+ Get the current set of SDL memory functions
+
+ \since This function is available since SDL 2.0.7.
+
+</member>
+        <member name="M:SDL_GetOriginalMemoryFunctions(=FUNC:System.Void*(System.UInt64)*,=FUNC:System.Void*(System.UInt64,System.UInt64)*,=FUNC:System.Void*(System.Void*,System.UInt64)*,=FUNC:System.Void(System.Void*)*)">
+ Get the original set of SDL memory functions
+
+ \since This function is available since SDL 2.24.0.
+
+</member>
+        <member name="M:SDL_malloc(System.UInt64)">
+\endcond 
+  \file begin_code.h
+
+  This file sets things up for C dynamic library function definitions,
+  static inlined functions, and structures aligned at 4-byte alignment.
+  If you don't like ugly C preprocessor code, don't look at this file. :)
+
+</member>
+        <member name="D:SDL_compile_time_assert_uint8">
+\name Floating-point constants
+
+\cond 
+</member>
+        <member name="D:Uint64">
+\brief An unsigned 64-bit integer type.
+
+</member>
+        <member name="D:Sint64">
+\brief A signed 64-bit integer type.
+
+</member>
+        <member name="D:Uint32">
+\brief An unsigned 32-bit integer type.
+
+</member>
+        <member name="D:Sint32">
+\brief A signed 32-bit integer type.
+
+</member>
+        <member name="D:Uint16">
+\brief An unsigned 16-bit integer type.
+
+</member>
+        <member name="D:Sint16">
+\brief A signed 16-bit integer type.
+
+</member>
+        <member name="D:Uint8">
+\brief An unsigned 8-bit integer type.
+
+</member>
+        <member name="D:Sint8">
+\brief A signed 8-bit integer type.
+
+</member>
+        <member name="D:int8_t">
+  \file close_code.h
+
+  This file reverses the effects of begin_code.h and should be included
+  after you finish any function and structure declarations in your headers
+
+</member>
+        <member name="M:SDL_GetPlatform">
+  \file SDL_stdinc.h
+
+  This is a general header that includes C language support.
+
+  \file SDL_platform.h
+
+  Try to get a standard set of platform defines.
+
+  \file begin_code.h
+
+  This file sets things up for C dynamic library function definitions,
+  static inlined functions, and structures aligned at 4-byte alignment.
+  If you don't like ugly C preprocessor code, don't look at this file. :)
+
+ Get the name of the platform.
+
+ Here are the names returned for some (but not all) supported platforms:
+
+ - "Windows"
+ - "Mac OS X"
+ - "Linux"
+ - "iOS"
+ - "Android"
+
+ \returns the name of the platform. If the correct platform name is not
+          available, returns a string beginning with the text "Unknown".
+
+ \since This function is available since SDL 2.0.0.
+
+</member>
+        <member name="M:SHADE.SHSystem.Exit">
+*!*************************************************************************
+</member>
+        <member name="M:SHADE.Application.Quit">
+            <summary>
+Marks the application to stop at the end of the current frame.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsFullscreen">
+            <summary>
+Whether or not the application is currently in fullscreen mode or not.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.WindowHeight">
+            <summary>
+Retrieves the designated height of the current window.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.WindowWidth">
+            <summary>
+Retrieves the designated width of the current window.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsPaused">
+            <summary>
+Whether or not the engine is in a paused state where script updates and
+physics are not in play.
+</summary>
+        </member>
+        <member name="P:SHADE.Application.IsPlaying">
+            <summary>
+Whether or not the engine is playing. This will always be true on Publish.
+On Debug/Release builds, this is true when the editor is in Play Mode. It
+will also be true even if the editor is in Play Mode but is paused.
+</summary>
+        </member>
+        <member name="T:SHADE.Application">
+            <summary>
+Static class that contains useful properties for querying the state of the
+engine.
+</summary>
+        </member>
+        <member name="M:SHADE.Transform.SetParent(SHADE.Transform,System.Boolean)">
+            <summary>
+Sets the parent of this Transform component.
+</summary>
+            <param name="parent">
+Entity that contains the Transform component that this Transform will be
+parented to. If null, unparenting will occur.
+</param>
+            <param name="worldPositionStays">
+If true, the transform values of this Transform component will retain their
+pre-parent-change global transforms. The local transform values will be
+modified to ensure that the global transforms do not change.
+</param>
+        </member>
+        <member name="P:SHADE.Transform.Parent">
+            <summary>
+Parent Transform that affects this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalScale">
+            <summary>
+Global scale stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalEulerAngles">
+            <summary>
+Global euler angle rotations stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalRotation">
+            <summary>
+Global rotation quaternion stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.GlobalPosition">
+            <summary>
+Global position stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalScale">
+            <summary>
+Local scale stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalEulerAngles">
+            <summary>
+Local euler angle rotations stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalRotation">
+            <summary>
+Local rotation quaternion stored by this Transform.
+</summary>
+        </member>
+        <member name="P:SHADE.Transform.LocalPosition">
+            <summary>
+Local position stored by this Transform.
+</summary>
+        </member>
+        <member name="M:SHADE.Transform.#ctor(System.UInt32)">
+            <summary>
+Constructs a Transform Component that represents a native Transform component
+tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Transform">
+            <summary>
+CLR version of the SHADE Engine's TransformComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.Math.CompareFloat(System.Single,System.Single,System.Single)">
+            <summary>
+Compares if two float values are close enough to be the same with the
+specified tolerance value.
+</summary>
+            <param name="a">One of the values to compare.</param>
+            <param name="b">The other value to compare.</param>
+            <param name="tolerance">Tolerance for floating point comparison.</param>
+            <returns>True if a and b are practically the same.</returns>
+        </member>
+        <member name="M:SHADE.Math.CompareFloat(System.Single,System.Single)">
+            <summary>
+Compares if two float values are close enough to be the same with a tolerance
+of Epsilon.
+</summary>
+            <param name="a">One of the values to compare.</param>
+            <param name="b">The other value to compare.</param>
+            <returns>True if a and b are practically the same.</returns>
+        </member>
+        <member name="M:SHADE.Math.InverseLerp(System.Single,System.Single,System.Single)">
+            <summary>
+Calculates the linear parameter t that produces the interpolant value within
+the range [a, b].
+</summary>
+            <param name="a">Start value.</param>
+            <param name="b">End value.</param>
+            <param name="value">Value between start and end.</param>
+            <returns>Percentage of value between start and end.</returns>
+        </member>
+        <member name="M:SHADE.Math.LerpUnclamped(System.Single,System.Single,System.Single)">
+            <summary>
+Linearly interpolates between a and b by t. 
+The parameter t is not clamped and a value based on a and b is supported. 
+If t is less than zero, or greater than one, then LerpUnclamped will result 
+in a return value outside the range a to b.
+</summary>
+            <param name="a">The start value.</param>
+            <param name="b">The end value.</param>
+            <param name="t">The interpolation value between the two float.</param>
+            <returns>The interpolated float result between the two float values.</returns>
+        </member>
+        <member name="M:SHADE.Math.Lerp(System.Single,System.Single,System.Single)">
+            <summary>
+Linearly interpolates between a and b by t. 
+The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">The start value.</param>
+            <param name="b">The end value.</param>
+            <param name="t">The interpolation value between the two float.</param>
+            <returns>The interpolated float result between the two float values.</returns>
+        </member>
+        <member name="M:SHADE.Math.RadiansToDegrees(System.Single)">
+            <summary>
+Converts an angle from radian representation to degree representation.
+</summary>
+            <param name="radians">Radian-based angle to convert.</param>
+            <returns>The specified angle in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Math.DegreesToRadians(System.Single)">
+            <summary>
+Converts an angle from degree representation to radian representation.
+</summary>
+            <param name="degrees">Degree-based angle to convert.</param>
+            <returns>The specified angle in radians.</returns>
+        </member>
+        <member name="M:SHADE.Math.Wrap(System.Single,System.Single,System.Single)">
+            <summary>
+Wraps a value if they get to low or too high. 
+</summary>
+            <param name="value">Value to wrap.</param>
+            <param name="min">Minimum value to wrap at.</param>
+            <param name="max">Maximum value to wrap at.</param>
+            <returns>Wrapped value.</returns>
+        </member>
+        <member name="F:SHADE.Math.Epsilon">
+            <summary>
+Small value used for single precision floating point comparisons.
+</summary>
+        </member>
+        <member name="F:SHADE.Math.Rad2Deg">
+            <summary>
+Radians-to-degrees conversion constant
+</summary>
+        </member>
+        <member name="F:SHADE.Math.Deg2Rad">
+            <summary>
+Degrees-to-radians conversion constant
+</summary>
+        </member>
+        <member name="T:SHADE.Math">
+            <summary>
+Contains utility Math functions.
+</summary>
+        </member>
+        <member name="M:SHADE.Debug.LogExceptionNative(std.exception!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a native exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Native exception to log.</param>
+            <param name="throwerName">Name of the one responsible for the exception.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogExceptionNative(System.Exception,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="throwerName">Name of the one responsible for the exception.</param>
+            <param name="exception">Exception to log.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(std.exception!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Object)">
+            <summary>
+Logs a native exception that is formatted nicely to the output.
+Equivalent to calling
+LogException(exception, Convert::ToNative(thrower-&gt;GetType()-&gt;Name));
+</summary>
+            <param name="exception">Native exception to log.</param>
+            <param name="thrower">
+Object that threw the exception to label the exception message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(System.Exception,System.Object)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Exception to log.</param>
+            <param name="thrower">
+Object that threw the exception to label the exception message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogException(System.Exception)">
+            <summary>
+Logs an exception that is formatted nicely to the output.
+</summary>
+            <param name="exception">Exception to log.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String,System.String)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogErrorNative(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String,System.Object)">
+            <summary>
+Logs a error message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="thrower">
+Object that threw the error to label the error message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(System.String)">
+            <summary>
+Logs a error message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogError(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a error message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,System.String)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String,System.Object)">
+            <summary>
+Logs a warning message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="thrower">
+Object that threw the warning to label the warning message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(System.String)">
+            <summary>
+Logs a warning message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.LogWarning(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a warning message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,System.String)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="throwerName">
+Name of the object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String,System.Object)">
+            <summary>
+Logs a message to the output with a label such that it looks like this:
+"[Label] Message"
+</summary>
+            <param name="str">The string to output.</param>
+            <param name="owner">
+Object that sent the message to label the message.
+The name of the object will be used.
+</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(System.String)">
+            <summary>
+Logs a message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="M:SHADE.Debug.Log(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Logs a message to the output.
+</summary>
+            <param name="str">The string to output.</param>
+        </member>
+        <member name="T:SHADE.Debug">
+            <summary>
+Static class that contains the functions for working with time.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.LightLayer">
+            <summary>
+Material used to render this Renderable.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.Material">
+            <summary>
+Material used to render this Renderable.
+</summary>
+        </member>
+        <member name="P:SHADE.Renderable.Mesh">
+            <summary>
+Mesh used to render this Renderable.
+</summary>
+        </member>
+        <member name="M:SHADE.Renderable.#ctor(System.UInt32)">
+            <summary>
+Constructs a Renderable Component that represents a native Renderable 
+component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.Renderable">
+            <summary>
+CLR version of the SHADE Engine's SHRenderableComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.Material.GetProperty``1(System.String)">
+            <summary>
+Retrieves the value of a specified property on the material.
+</summary>
+            <typeparam name="T">Type of property to get.</typeparam>
+            <param name="name">Name of the property to get.</param>
+            <returns>Value of that property on the material.</returns>
+            <exception cref="!:System.InvalidOperationException">
+If this Material object is invalid.
+</exception>
+            <exception cref="!:System.ArgumentException">
+If the name or type was specified that does not match the material's shader's
+defined properties.
+</exception>
+        </member>
+        <member name="M:SHADE.Material.SetProperty``1(System.String,``0)">
+            <summary>
+Set the value of a specific property.
+</summary>
+            <typeparam name="T">Type of property to set.</typeparam>
+            <param name="name">Name of the property to set.</param>
+            <param name="value">Value to set te property to.</param>
+            <exception cref="!:System.InvalidOperationException">
+If this Material object is invalid.
+</exception>
+            <exception cref="!:System.ArgumentException">
+If the name or type was specified that does not match the material's shader's
+defined properties.
+</exception>
+        </member>
+        <member name="M:SHADE.Material.#ctor(SHADE.Handle&lt;SHADE.SHMaterialInstance&gt;)">
+            <summary>
+Constructor for the Material
+</summary>
+            <param name="material">Handle to the native material object.</param>
+        </member>
+        <member name="T:SHADE.Material">
+            <summary>
+Managed counterpart of the native MaterialInstance object containing material 
+data that can be fed to Renderables for rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Mesh.#ctor(SHADE.Handle&lt;SHADE.SHMesh&gt;)">
+            <summary>
+Constructor for the Mesh
+</summary>
+            <param name="mesh">Handle to the mesh object.</param>
+        </member>
+        <member name="T:SHADE.Mesh">
+            <summary>
+Managed counterpart of the native Mesh object containing vertex data that can
+be fed to Renderables for rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.SHMatrix.Decompose(SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHQuaternion*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+@brief Decomposes a transformation matrix into translation, orientation and scale.
+@param[out] scale        The scaling factor of the matrix.
+@param[out] orientation  The orientation of the matrix.
+@param[out] translation  The translation of the matrix.
+@return True if decomposition was successful.
+
+</member>
+        <member name="M:SHADE.SHMatrix.Decompose(SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+@brief Decomposes a transformation matrix into translation, euler angles and scale.
+@param[out] scale        The scaling factor of the matrix.
+@param[out] rotation     The euler angles of the matrix.
+@param[out] translation  The translation of the matrix.
+@return True if decomposition was successful.
+
+</member>
+        <member name="T:SHADE.SHMatrix">
+@brief Interface for a Column-Major Row Vector 4x4 Matrix.
+
+</member>
+        <member name="M:SHADE.RigidBody.#ctor(System.UInt32)">
+            <summary>
+Constructs a RigidBody Component that represents a native 
+SHRigidBodyComponent component tied to the specified Entity.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="T:SHADE.RigidBody">
+            <summary>
+CLR version of the the SHADE Engine's SHRigidBodyComponent.
+</summary>
+        </member>
+        <member name="M:SHADE.ECS.createManagedComponent``1(System.UInt32)">
+            <summary>
+Creates an instance of the Managed representation of a Component with a
+native Entity.
+</summary>
+            <typeparam name="T">Type of Component to create.</typeparam>
+            <param name="entity">Native Entity that this Component is tied to.</param>
+            <returns>The created Managed representation of the Component.</returns>
+        </member>
+        <member name="M:SHADE.ECS.#cctor">
+            <summary>
+Static constructor to initialize static data
+</summary>
+        </member>
+        <member name="T:SHADE.ECS.ComponentSet">
+            <summary>
+Pointer to a function for Component manipulation operations.
+</summary>
+            <summary>
+Contains a set of Component related data used for resolving operations for
+each Component.
+</summary>
+        </member>
+        <member name="M:SHADE.ECS.RemoveComponent``1(System.UInt32)">
+            <summary>
+Removes a Component from the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to remove.</typeparam>
+            <param name="entity">
+Entity object that should have the specified Component removed from/
+</param>
+        </member>
+        <member name="M:SHADE.ECS.HasComponent``1(System.UInt32)">
+            <summary>
+Checks if the specified Entity has the specified Component.
+</summary>
+            <typeparam name="T">Type of the Component to check for.</typeparam>
+            <param name="entity">Entity object to check for the Component.</param>
+            <returns>
+True if the specified Entity has the specified Component. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.EnsureComponent``1(System.UInt32)">
+            <summary>
+Ensures a Component on the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to ensure.</typeparam>
+            <param name="entity"> Entity object to ensure the Component on. </param>
+            <returns>Reference to the Component.</returns>
+        </member>
+        <member name="M:SHADE.ECS.GetComponentInChildren``1(System.UInt32)">
+            <summary>
+Retrieves the first Component from the specified GameObjectt's children that
+matches the specified type.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <param name="entity"> Entity object to get the Component from. </param>
+            <returns>
+Reference to the Component or null if the Entity does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.GetComponent``1(System.UInt32)">
+            <summary>
+Gets a Component from the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <param name="entity"> Entity object to get the Component from. </param>
+            <returns>
+Reference to the Component or null if the Entity does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.ECS.AddComponent``1(System.UInt32)">
+            <summary>
+Adds a Component to the specified Entity.
+</summary>
+            <typeparam name="T">Type of the Component to add.</typeparam>
+            <param name="entity">
+Entity object that should have the specified Component added to.
+</param>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="T:SHADE.ECS">
+            <summary>
+Static class which contains functions that map Pls::ECS's Component manipulation
+functions to managed generic functions.
+</summary>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.Equals(SHADE.BaseComponent)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="F:SHADE.BaseComponent.owner">
+            <summary>
+Entity that this Component belongs to.
+</summary>
+        </member>
+        <member name="M:SHADE.BaseComponent.#ctor(System.UInt32)">
+            <summary>
+Constructor for BaseComponent to tie it to a specific Entity.
+Constructors of derived Components should call this Constructor.
+</summary>
+            <param name="entity">Entity that this Component will be tied to.</param>
+        </member>
+        <member name="M:SHADE.BaseComponent.op_Implicit(SHADE.BaseComponent)~System.Boolean">
+            <summary>
+Implicit conversion operator to enable checking if a component is null.
+</summary>
+            <param name="c">Component to check.</param>
+        </member>
+        <member name="M:SHADE.BaseComponent.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">Type of PLushieScripts to remove.</typeparam>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetScripts``1">
+            <summary>
+Retrieves a immutable list of Scripts of the specified type from this
+GameObject.
+</summary>
+            <typeparam name="T">Type of Scripts to Get.</typeparam>
+            <returns>Immutable list of Scripts of the specified type.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetScript``1">
+            <summary>
+Retrieves a Script of the specified type from this GameObject.
+If multiple Scripts of the same specified type are added on the same
+GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.AddScript``1">
+            <summary>
+Adds a Script of the specified type to this GameObject.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the created Script.</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.RemoveComponent``1">
+            <summary>
+Removes a Component from this GameObject. If no Component exists to begin
+with, nothing happens.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+        </member>
+        <member name="M:SHADE.BaseComponent.GetComponent``1">
+            <summary>
+Gets a Component from this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if this GameObject does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.BaseComponent.AddComponent``1">
+            <summary>
+Adds a Component to this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to add. </typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="P:SHADE.BaseComponent.Owner">
+            <summary>
+Retrieves the GameObject that this Component belongs to.
+</summary>
+        </member>
+        <member name="T:SHADE.BaseComponent">
+            <summary>
+Class that serves as the base for a wrapper class to Components in native code.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onCollisionExit(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and leaves a 
+collision with another GameObject with a Collider2D.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onCollisionStay(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and collides with
+another GameObject with a Collider in subsequent frames of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onCollisionEnter(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a Collider and collides with
+another GameObject with a Collider in the first frame of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerExit(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and leaves a 
+collision with another GameObject with a Collider2D.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerStay(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and collides with
+another GameObject with a Collider in subsequent frames of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onTriggerEnter(SHADE.CollisionInfo)">
+            <summary>
+Called when the attached GameObject has a trigger Collider and collides with
+another GameObject with a Collider in the first frame of collision.
+</summary>
+            <param name="info">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.onDestroy">
+            <summary>
+Called just before the end of the frame where the attached GameObject or
+this script is destroyed directly or indirectly due to destruction of the
+owner.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.lateUpdate">
+            <summary>
+Called every frame after physics and collision resolution but before
+rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.update">
+            <summary>
+Called every frame before physics and collision resolution.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.fixedUpdate">
+            <summary>
+Called every frame in sync with Physics update steps and thus in most cases
+will execute more than update() will. This will be called immediately before
+a Physics update step.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.start">
+            <summary>
+Called on the first frame that the attached GameObject is active but always
+after Awake().
+</summary>
+        </member>
+        <member name="M:SHADE.Script.awake">
+            <summary>
+Called on the first frame that the attached GameObject is active if they are
+a part of the scene.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onDetatched">
+            <summary>
+Called immediately once this script is detached from a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.onAttached">
+            <summary>
+Called immediately once this script is attached to a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.#ctor(SHADE.GameObject)">
+            <summary>
+Constructor for Script to tie it to a specific GameObject.
+Constructors of derived Scripts should call this Constructor.
+</summary>
+            <param name="gameObj">
+GameObject that this Script will be tied to.
+</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerExit(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerExit(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerStay(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerStay(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnTriggerEnter(SHADE.CollisionInfo)">
+            <summary>
+Used to call onTriggerEnter(). This should be called when a trigger-type 
+collision is detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionExit(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionExit(). This should be called when a collision ends
+between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionStay(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionStay(). This should be called when a collision is
+persistent between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnCollisionEnter(SHADE.CollisionInfo)">
+            <summary>
+Used to call onCollisionEnter(). This should be called when a collision is
+detected between the attached GameObject and another GameObject.
+</summary>
+            <param name="collision">Information on the collision event.</param>
+        </member>
+        <member name="M:SHADE.Script.OnDestroy">
+            <summary>
+Used to call onDestroy(). This should be called at the end of the frame
+where the attached GameObject or this script is destroyed directly or
+indirectly due to destruction of the owner.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.LateUpdate">
+            <summary>
+Used to call lateUpdate(). This should be called every frame after physics
+and collision resolution but before rendering.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Update">
+            <summary>
+Used to call update(). This should be called every frame before physics and
+collision resolution.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.FixedUpdate">
+            <summary>
+Used to call fixedUpdate(). This should be called in sync with Physics
+update steps and thus in most cases will execute more than Update() will.
+This will be called immediately before a Physics update step.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Start">
+            <summary>
+Used to call start(). This should be called on the first frame that the
+attached GameObject is active but always after Awake().
+</summary>
+        </member>
+        <member name="M:SHADE.Script.Awake">
+            <summary>
+Used to call awake(). This should be called on the first frame that the
+attached GameObject is active if they are a part of the scene.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.OnDetached">
+            <summary>
+Used to call onDetached(). This is called immediately when this script is
+detached from a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.OnAttached">
+            <summary>
+Used to call onAttached(). This is called immediately when this script is
+attached to a GameObject.
+</summary>
+        </member>
+        <member name="M:SHADE.Script.op_Implicit(SHADE.Script)~System.Boolean">
+            <summary>
+Implicit conversion operator to enable checking if a component is null.
+</summary>
+            <param name="c">Component to check.</param>
+        </member>
+        <member name="M:SHADE.Script.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">
+Type of script to remove.
+This needs to be a default constructable Script.
+</typeparam>
+        </member>
+        <member name="M:SHADE.Script.GetScripts``1">
+            <summary>
+Retrieves a immutable list of scripts from the specified Entity that
+matches the specified type.
+<br />
+Note that this function allocates. It should be used sparingly.
+</summary>
+            <typeparam name="T">
+Type of scripts to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>
+Immutable list of references to scripts of the specified type.
+</returns>
+        </member>
+        <member name="M:SHADE.Script.GetScriptInChildren``1">
+            <summary>
+Retrieves the first Script from this GameObject's children that matches the
+specified type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.GetScript``1">
+            <summary>
+Retrieves the first Script from this GameObject that matches the specified
+type.
+</summary>
+            <typeparam name="T">
+Type of script to get.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.AddScript``1">
+            <summary>
+Adds a Script to this GameObject.
+</summary>
+            <typeparam name="T">
+Type of script to add.
+This needs to be a default constructable Script.
+</typeparam>
+            <returns>Reference to the script added</returns>
+        </member>
+        <member name="M:SHADE.Script.RemoveComponent``1">
+            <summary>
+Removes a Component from the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to remove. Must be derived from BaseComponent.
+</typeparam>
+        </member>
+        <member name="M:SHADE.Script.EnsureComponent``1">
+            <summary>
+Ensures a Component on the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to ensure. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component.</returns>
+        </member>
+        <member name="M:SHADE.Script.GetComponentInChildren``1">
+            <summary>
+Retrieves the first Component from this GameObject's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">
+Type of the Component to get. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was retrieved.</returns>
+        </member>
+        <member name="M:SHADE.Script.GetComponent``1">
+            <summary>
+Gets a Component from the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to get. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was retrieved.</returns>
+        </member>
+        <member name="M:SHADE.Script.AddComponent``1">
+            <summary>
+Adds a Component to the GameObject that this Script belongs to.
+</summary>
+            <typeparam name="T">
+Type of the Component to add. Must be derived from BaseComponent.
+</typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="P:SHADE.Script.Owner">
+            <summary>
+GameObject that this Script belongs to.
+</summary>
+        </member>
+        <member name="T:SHADE.Script">
+            <summary>
+Class that forms the basis of all "script"-objects that can be attached to
+Entities to update each Entity's Components via C# code.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.RigidBody">
+            <summary>
+The RigidBody that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.CollisionShape">
+            <summary>
+The CollisionShape of the Collider that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.Collider">
+            <summary>
+The Collider that you are colliding with.
+</summary>
+        </member>
+        <member name="P:SHADE.CollisionInfo.GameObject">
+            <summary>
+The GameObject whose collider you are colliding with.
+</summary>
+        </member>
+        <member name="T:SHADE.CollisionInfo">
+            <summary>
+Struct that describes a collision
+</summary>
+        </member>
+        <member name="M:SHADE.GameObject.op_Inequality(SHADE.GameObject,SHADE.GameObject)">
+            <summary>
+Checks if two GameObject references are different.
+</summary>
+            <param name="lhs">GameObject to check.</param>
+            <param name="rhs">Another GameObject to check with.</param>
+            <returns>True if both Components are different.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.op_Equality(SHADE.GameObject,SHADE.GameObject)">
+            <summary>
+Checks if two GameObject references are the same.
+</summary>
+            <param name="lhs">GameObject to check.</param>
+            <param name="rhs">Another GameObject to check with.</param>
+            <returns>True if both Components are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Equals(SHADE.GameObject)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetNativeEntity">
+            <summary>
+Retrieves the native Entity object that this GameObject represents.
+</summary>
+            <returns>Native Entity object that this GameObject represents.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetEntity">
+            <summary>
+Retrieves the CLR Entity object that this GameObject represents.
+</summary>
+            <returns>Entity object that this GameObject represents.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.#ctor(System.UInt32)">
+            <summary>
+Constructor for the GameObject.
+</summary>
+            <param name="entity">
+Managed numerical representation of the ECS Entity that this GameObject
+should represent.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.#ctor(SHADE.SHEntity!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Constructor for the GameObject.
+</summary>
+            <param name="entity">
+The ECS Entity that this GameObject should represent.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.RemoveScript``1">
+            <summary>
+Removes all Scripts of the specified type from this GameObject.
+</summary>
+            <typeparam name="T">Type of PLushieScripts to remove.</typeparam>
+        </member>
+        <member name="M:SHADE.GameObject.GetScripts``1">
+            <summary>
+Retrieves a immutable list of Scripts of the specified type from this
+GameObject.
+</summary>
+            <typeparam name="T">Type of Scripts to retrieve.</typeparam>
+            <returns>Immutable list of Scripts of the specified type.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetScriptInChildren``1">
+            <summary>
+Retrieves a Script of the specified type from child GameObjects.
+If multiple Scripts of the same specified type are added on the same
+child GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to retrieve.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetScript``1">
+            <summary>
+Retrieves a Script of the specified type from this GameObject.
+If multiple Scripts of the same specified type are added on the same
+GameObject, this will retrieve the first one added.
+</summary>
+            <typeparam name="T">Type of Script to retrieve.</typeparam>
+            <returns>Reference to the Script to retrieve.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.AddScript``1">
+            <summary>
+Adds a Script of the specified type to this GameObject.
+</summary>
+            <typeparam name="T">Type of Script to add.</typeparam>
+            <returns>Reference to the created Script.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.RemoveComponent``1">
+            <summary>
+Removes a Component from this GameObject. If no Component exists to begin
+with, nothing happens.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+        </member>
+        <member name="M:SHADE.GameObject.EnsureComponent``1">
+            <summary>
+Ensures a Component on this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to ensure.</typeparam>
+            <returns>
+Reference to the Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetComponentInChildren``1">
+            <summary>
+Retrieves the first Component from this GameObject's children that matches
+the specified type.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if neither of this GameObject's children
+does not have the specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.GetComponent``1">
+            <summary>
+Gets a Component from this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to get.</typeparam>
+            <returns>
+Reference to the Component or null if this GameObject does not have the
+specified Component.
+</returns>
+        </member>
+        <member name="M:SHADE.GameObject.AddComponent``1">
+            <summary>
+Adds a Component to this GameObject.
+</summary>
+            <typeparam name="T">Type of the Component to add. </typeparam>
+            <returns>Reference to the Component that was added.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.SetActive(System.Boolean)">
+            <summary>
+Sets the active state of this GameObject.
+<br />
+The actual "activeness" of this GameObject is still dependent on the parents'
+active states.
+</summary>
+            <param name="active">
+Whether to activate or deactivate this GameObject.
+</param>
+        </member>
+        <member name="M:SHADE.GameObject.SetName(System.String)">
+            <summary>
+Sets the name of this GameObject.
+</summary>
+            <param name="name">The name to set.</param>
+        </member>
+        <member name="P:SHADE.GameObject.EntityId">
+            <summary>
+Native Entity ID value for this GameObject.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.IsActiveInHierarchy">
+            <summary>
+Whether or not this Entity is active in the Scene hierarchy.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.IsActiveSelf">
+            <summary>
+Whether or not this Entity alone, is active. This does not mean that this 
+object is active in the scene. For example, if this Entity's parent is not
+active, then this Entity would also be not active.
+</summary>
+        </member>
+        <member name="P:SHADE.GameObject.Name">
+            <summary>
+Name of the object that this Entity represents.
+</summary>
+        </member>
+        <member name="M:SHADE.GameObject.Find(System.String)">
+            <summary>
+Retrieves a GameObject with the specified name. If there are multiple
+GameObjects with the same name, the first found GameObject will be retrieved.
+There is no guaranteed order of which GameObject is considered "first".
+</summary>
+            <param name="name">Name of the GameObject to find.</param>
+            <returns>GameObject that has the specified name. Null if not found.</returns>
+        </member>
+        <member name="M:SHADE.GameObject.Destroy(SHADE.GameObject)">
+            <summary>
+Destroys the specified GameObject. Note that the specified GameObject will no 
+longer be a valid GameObject after this function is called.
+</summary>
+            <param name="obj">The GameObject to be destroyed.</param>
+        </member>
+        <member name="M:SHADE.GameObject.Create">
+            <summary>
+Creates a new GameObject in the current Scene. If multiple Scenes are loaded,
+and you would like to create an object in a specific Scene, call the Scene's
+CreateGameObject().
+</summary>
+            <returns>GameObject that represents the newly created GameObject.</returns>
+        </member>
+        <member name="T:SHADE.GameObject">
+            <summary>
+Lightweight object for an PlushieEngine Entity that allows for easy access 
+to Component and Script operations.
+</summary>
+        </member>
+        <member name="M:SHADE.RangeAttribute.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor for a Tooltip attribute that fills in the description.
+</summary>
+            <param name="description">Text to be shown when a field is hovered.</param>
+        </member>
+        <member name="P:SHADE.RangeAttribute.Max">
+            <summary>
+Maximum value for the Ranged field.
+</summary>
+        </member>
+        <member name="P:SHADE.RangeAttribute.Min">
+            <summary>
+Minimum value for the Ranged field.
+</summary>
+        </member>
+        <member name="T:SHADE.RangeAttribute">
+            <summary>
+Simple attribute to constrain the range of values for a field on the editor.
+</summary>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(std.basic_string&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator&lt;System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte&gt;&gt;!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native std::Stringto a managed String.
+</summary>
+            <param name="str">The native std::string to convert from.</param>
+            <returns>Managed copy of a native std::string.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(System.String)">
+            <summary>
+Converts from a managed String to a native std::string.
+</summary>
+            <param name="str">The managed String to convert from.</param>
+            <returns>Native copy of a managed String.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHRay!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector2 to a managed Vector2.
+</summary>
+            <param name="vec">The native Vector2 to convert from.</param>
+            <returns>Managed copy of a native Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHQuaternion!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Quaternion to a managed Quaternion.
+</summary>
+            <param name="quat">The native Quaternion to convert from.</param>
+            <returns>Managed copy of a native Quaternion.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Quaternion)">
+            <summary>
+Converts from a managed Quaternion to a native Quaternion.
+</summary>
+            <param name="quat">The managed Quaternion to convert from.</param>
+            <returns>Native copy of a managed Quaternion.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHVec2!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector2 to a managed Vector2.
+</summary>
+            <param name="vec">The native Vector2 to convert from.</param>
+            <returns>Managed copy of a native Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Vector2)">
+            <summary>
+Converts from a managed Vector2 to a native Vector2.
+</summary>
+            <param name="vec">The managed Vector2 to convert from.</param>
+            <returns>Native copy of a managed Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHVec3!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced)">
+            <summary>
+Converts from a native Vector3 to a managed Vector3.
+</summary>
+            <param name="vec">The native Vector3 to convert from.</param>
+            <returns>Managed copy of a native Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToNative(SHADE.Vector3)">
+            <summary>
+Converts from a managed Vector3 to a native Vector3.
+</summary>
+            <param name="vec">The managed Vector3 to convert from.</param>
+            <returns>Native copy of a managed Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Convert.ToCLI(SHADE.SHEntity)">
+            <summary>
+Converts from a native Entity to a managed Entity (UInt32).
+</summary>
+            <param name="entity">Native Entity to convert from.</param>
+            <returns>Managed representation of the specified Entity.</returns>
+        </member>
+        <member name="T:SHADE.Convert">
+            <summary>
+Provides functions easy and consistent syntax for converting between custom
+managed and native types that are aligned.
+</summary>
+        </member>
+        <member name="M:SHADE.GenericHandle.op_Implicit~System.Boolean">
+            <summary>
+Converts to true if this is a valid Handle.
+</summary>
+        </member>
+        <member name="P:SHADE.GenericHandle.Library">
+            <summary>
+The library that the handle was issued by.
+</summary>
+        </member>
+        <member name="P:SHADE.GenericHandle.Id">
+            <summary>
+The internal ID of the handle.
+</summary>
+        </member>
+        <member name="M:SHADE.Ray.#ctor(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a ray starting at origin along direction.
+</summary>
+            <param name="origin">Source of the ray.</param>
+            <param name="direction">Direction the ray travels in.</param>
+        </member>
+        <member name="F:SHADE.Ray.Direction">
+            <summary>
+The direction that a ray travels in.
+</summary>
+        </member>
+        <member name="F:SHADE.Ray.Origin">
+            <summary>
+The start point of the ray.
+</summary>
+        </member>
+        <member name="T:SHADE.Ray">
+            <summary>
+CLR version of the the SHADE Engine's Ray class that represents a ray in
+3-Dimensional space.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.op_Equality(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Are two quaternions equal to each other?
+</summary>
+            <param name="lhs">Left-hand side quaternion.</param>
+            <param name="rhs">Right-hand side quaternion.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.op_Multiply(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Combines rotations lhs and rhs.
+</summary>
+            <param name="lhs">Left-hand side quaternion.</param>
+            <param name="rhs">Right-hand side quaternion.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.SlerpUnclamped(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Spherically interpolates between a and b by t. The parameter t is not clamped.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Slerp(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Spherically interpolates between quaternions a and b by ratio t. The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">Start value, returned when t = 0.</param>
+            <param name="b">End value, returned when t = 1.</param>
+            <param name="t">Interpolation ratio.</param>
+            <returns> A quaternion spherically interpolated between quaternions a and b.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.RotateTowards(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Rotates a rotation from towards to. <br />
+The from quaternion is rotated towards to by an angular step of maxDegreesDelta (but note that the rotation will not overshoot).
+Negative values of maxDegreesDelta will move away from to until the rotation is exactly the opposite direction.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Normalize(SHADE.Quaternion)">
+            <summary>
+Converts this quaternion to one with the same orientation but with a magnitude of 1.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.LookRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation with the specified forward and upwards directions. <br />
+Z axis will be aligned with forward, X axis aligned with cross product between forward and upwards, and Y axis aligned with cross product between Z and X.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.LerpUnclamped(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Interpolates between a and b by t and normalizes the result afterwards. The parameter t is not clamped.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Lerp(SHADE.Quaternion,SHADE.Quaternion,System.Single)">
+            <summary>
+Interpolates between a and b by t and normalizes the result afterwards. The parameter t is clamped to the range [0, 1].
+</summary>
+            <param name="a">Start value, returned when t = 0.</param>
+            <param name="b">End value, returned when t = 1.</param>
+            <param name="t">Interpolation ratio.</param>
+            <returns> A quaternion interpolated between quaternions a and b.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Inverse(SHADE.Quaternion)">
+            <summary>
+Returns the Inverse of rotation.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.FromToRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates from fromDirection to toDirection.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Euler(System.Single,System.Single,System.Single)">
+            <summary>
+Returns a rotation that rotates y degrees around the y axis, x degrees around the x axis, and z degrees around the z axis; applied in that order.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Dot(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+The dot product between two rotations.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.AngleAxis(System.Single,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates angle degrees around axis.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.Angle(SHADE.Quaternion,SHADE.Quaternion)">
+            <summary>
+Returns the angle in degrees between two rotations a and b.<br /></summary>
+            <returns>The angle in degrees between the two vectors. </returns>
+        </member>
+        <member name="M:SHADE.Quaternion.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.Equals(SHADE.Quaternion)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Quaternion.ToAngleAxis(System.ValueType!System.Single!System.Runtime.CompilerServices.IsBoxed@,System.ValueType!SHADE.Vector3!System.Runtime.CompilerServices.IsBoxed@)">
+            <summary>
+Converts a rotation to angle-axis representation (angles in degrees).
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.SetLookRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation with the specified forward and upwards directions. <br />
+The result is applied to this quaternion.
+If used to orient a Transform, the Z axis will be aligned with forward and the Y axis with upwards, assuming these vectors are orthogonal.
+Logs an error if the forward direction is zero.
+</summary>
+            <param name="view">The direction to look in.</param>
+            <param name="up">The vector that defines in which direction up is.</param>
+        </member>
+        <member name="M:SHADE.Quaternion.SetFromToRotation(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Creates a rotation which rotates from fromDirection to toDirection. <br />
+Use this to create a rotation which starts at the first Vector (fromDirection) and rotates to the second Vector (toDirection).
+These Vectors must be set up in a script.
+</summary>
+        </member>
+        <member name="M:SHADE.Quaternion.#ctor(System.Single,System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Quaternion with the specified components.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+            <param name="_z">Z-coordinate to set.</param>
+            <param name="_z">W-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Quaternion.w">
+            <summary>
+W-component of the Quaternion. Do not directly modify quaternions.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.z">
+            <summary>
+Z-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.y">
+            <summary>
+Y-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.x">
+            <summary>
+X-component of the Quaternion.
+Don't modify this directly unless you know quaternions inside out.
+</summary>
+        </member>
+        <member name="F:SHADE.Quaternion.Identity">
+            <summary>
+Shorthand for writing Quaternion(0, 0, 0, 1).
+</summary>
+        </member>
+        <member name="T:SHADE.Quaternion">
+            <summary>
+CLR version of SHADE's Quaternion class that represents an orientation.
+Designed to closely match Unity's Quaternion struct.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector3.op_Explicit(SHADE.Vector2)~SHADE.Vector3">
+            <summary>
+Explicit conversion operator to enable explicit casting from a Vector2 to a
+Vector3.
+</summary>
+            <param name="vec">Vector2 to convert from.</param>
+        </member>
+        <member name="M:SHADE.Vector3.op_Explicit(SHADE.Vector3)~SHADE.Vector2">
+            <summary>
+Explicit conversion operator to enable explicit casting from a Vector3 to a
+Vector2.
+</summary>
+            <param name="vec">Vector3 to convert from.</param>
+        </member>
+        <member name="M:SHADE.Vector3.op_Inequality(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two Vector3s are not approximately equal. This is equivalent to 
+calling !Vector3.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector3 to compare.</param>
+            <param name="rhs">Another Vector3 to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Equality(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two Vector3s are approximately equal. This is equivalent to 
+calling Vector3.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector3 to compare.</param>
+            <param name="rhs">Another Vector3 to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Division(SHADE.Vector3,System.Single)">
+            <summary>
+Calculates the division of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector3 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,System.Single)">
+            <summary>
+Calculates the multiplication of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Division(SHADE.Vector3,System.Double)">
+            <summary>
+Calculates the division of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector3 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,System.Double)">
+            <summary>
+Calculates the multiplication of a Vector3 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Multiply(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Calculates the component-wise multiplication of two Vector3s and returns the
+result.
+</summary>
+            <param name="lhs">Vector3 to multiply with.</param>
+            <param name="rhs">Another Vector3 to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Subtraction(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Subtracts a Vector3 from another Vector3 and returns the result.
+</summary>
+            <param name="lhs">Vector3 to subtract from.</param>
+            <param name="rhs">Another Vector3 to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.op_Addition(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Adds two Vector3s together and returns the result.
+</summary>
+            <param name="lhs">Vector3 to add.</param>
+            <param name="rhs">Another Vector3 to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Vector3.MoveTowards(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Moves a point current towards target.
+Similar to Lerp(), however, the function will ensure that the distance never
+exceeds maxDistanceDelta. Negative values of maxDistanceDelta pushes the
+vector away from target
+</summary>
+            <param name="current">The current position of the point.</param>
+            <param name="target">The target position to move to.</param>
+            <param name="maxDistanceDelta">Maximum distance moved per call.</param>
+            <returns>Vector representing the moved point.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.LerpUnclamped(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="a">The start Vector3, returned when t = 0.0f.</param>
+            <param name="b">The end Vector3, returned when t = 1.0f.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Lerp(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="a">The start Vector3, returned when t = 0.0f.</param>
+            <param name="b">The end Vector3, returned when t = 1.0f.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Max(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 that is made from the largest components of 
+the two specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate maximum Vector3 with.</param>
+            <param name="rhs">Another Vector3 to calculate maximum Vector3 with.</param>
+            <returns>
+The Vector3 that contains the largest components of the two specified 
+Vector3s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Min(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 that is made from the smallest components of 
+the two specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate minimum Vector3 with.</param>
+            <param name="rhs">Another Vector3 to calculate minimum Vector3 with.</param>
+            <returns>
+The Vector3 that contains the smallest components of the two specified
+Vector3s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.RotateDegrees(SHADE.Vector3,System.Single)">
+            <summary>
+Rotates a Vector3 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector3 to rotate.</param>
+            <param name="degrees">
+Angle to rotate the vector by in an anti-clockwise direction in degrees.
+</param>
+            <returns>The Vector3 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.RotateRadians(SHADE.Vector3,System.Single)">
+            <summary>
+Rotates a Vector3 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector3 to rotate.</param>
+            <param name="radians">
+Angle to rotate the vector by in an anti-clockwise direction in radians.
+</param>
+            <returns>The Vector3 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Reflect(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Reflects a Vector3 across another Vector3.
+</summary>
+            <param name="vec">A Vector3 to reflect.</param>
+            <param name="normal">A normal to reflect the Vector3 across.</param>
+            <returns>The Vector3 that represents vec reflected across normal.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Project(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns a Vector3 projection.
+</summary>
+            <param name="vec">Vector3 to project.</param>
+            <param name="direction">Vector3 to project onto.</param>
+            <returns>The Vector3 that represents the projected vec onto direction.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Cross(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns the cross product of 2 specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate cross product with.</param>
+            <param name="rhs">Another Vector3 to calculate cross product with.</param>
+            <returns>The cross product of the two Vector3s.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Dot(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Computes and returns the dot product of 2 specified Vector3s.
+</summary>
+            <param name="lhs">Vector3 to calculate dot product with.</param>
+            <param name="rhs">Another Vector3 to calculate dot product with.</param>
+            <returns>Scalar value representing the dot product of the two Vector3s.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNear(SHADE.Vector3,SHADE.Vector3,System.Single)">
+            <summary>
+Checks if two specified Vector3s are near in value.
+</summary>
+            <param name="lhs">Vector3 to check if is near in value.</param>
+            <param name="rhs">Another Vector3 to check if is near in value.</param>
+            <param name="tolerance">Amount of tolerance to do the comparison with.</param>
+            <returns>
+True if the two Vector3s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNear(SHADE.Vector3,SHADE.Vector3)">
+            <summary>
+Checks if two specified Vector3s are near in value.
+</summary>
+            <param name="lhs">Vector3 to check if is near in value.</param>
+            <param name="rhs">Another Vector3 to check if is near in value.</param>
+            <returns>
+True if the two Vector3s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Equals(SHADE.Vector3)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNearPoint(SHADE.Vector3,System.Single)">
+            <summary>
+Checks if a specified point is near this Vector3 that represents a point.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <param name="tolerance">
+The amount of tolerance before we consider these points as "near".
+</param>
+            <returns>
+True if this Vector3 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.IsNearPoint(SHADE.Vector3)">
+            <summary>
+Checks if a specified point is near this Vector3 that represents a point with
+a tolerance value of PLS_EPSILON.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <returns>
+True if this Vector3 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Angle2DFromRightDegrees">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -180.0f and 180.0f.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Angle2DFromRightRadians">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -Math.PI and Math.PI.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in radians.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetSqrMagnitude">
+            <summary>
+Calculates and returns the squared magnitude of this Vector3.
+</summary>
+            <returns>Returns the squared length of this Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetMagnitude">
+            <summary>
+Calculates and returns the magnitude of this Vector3. Note that this function
+incurs a performance cost from the square root calculation. If you do not 
+need the precise magnitude, consider using GetSqrMagnitude() instead.
+</summary>
+            <returns>Returns the length of this Vector3.</returns>
+        </member>
+        <member name="M:SHADE.Vector3.GetNormalised">
+            <summary>
+Creates a copy of this Vector3 and returns a normalized version. 
+</summary>
+            <returns>
+Returns a normalised copy of this Vector3. 
+If this Vector3 is a zero vector, a zero vector will be returned.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector3.Normalise">
+            <summary>
+Normalises this current Vector3. This changes the data of this Vector3. 
+If you would like to get a copy, use GetNormalised() instead. 
+This function does nothing to a zero vector.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(SHADE.Vector2)">
+            <summary>
+Conversion constructor to construct a Vector3 using a Vector2.
+</summary>
+            <param name="vec" />
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single,System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+            <param name="_z">Z-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components with the 
+Z-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector3.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Vector3 with the specified components with the 
+Y and Z-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Vector3.z">
+            <summary>
+Z-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.y">
+            <summary>
+Y-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.x">
+            <summary>
+X-component of the Vector3.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Zero">
+            <summary>
+Shorthand for writing Vector3(0, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Up">
+            <summary>
+Shorthand for writing Vector3(0, 1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Right">
+            <summary>
+Shorthand for writing Vector3(1, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.PositiveInfinity">
+            <summary>
+Shorthand for writing Vector3(float.PositiveInfinity, 
+float.PositiveInfinity, float.PositiveInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.One">
+            <summary>
+Shorthand for writing Vector3(1, 1, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.NegativeInfinity">
+            <summary>
+Shorthand for writing Vector3(float.NegativeInfinity, 
+float.NegativeInfinity, float.NegativeInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Left">
+            <summary>
+Shorthand for writing Vector3(-1, 0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Forward">
+            <summary>
+Shorthand for writing Vector3(0, 0, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Down">
+            <summary>
+Shorthand for writing Vector3(0, -1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector3.Back">
+            <summary>
+Shorthand for writing Vector3(0, 0, -1).
+</summary>
+        </member>
+        <member name="T:SHADE.Vector3">
+            <summary>
+CLR version of SHADE Engine's Vector3 class that represents a 3-Dimensional Vector.
+Designed to closely match Unity's Vector3 struct.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector2.op_Inequality(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two Vector2s are not approximately equal. This is equivalent to 
+calling !Vector2.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector2 to compare.</param>
+            <param name="rhs">Another Vector2 to compare.</param>
+            <returns>
+True if all components are not approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Equality(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two Vector2s are approximately equal. This is equivalent to 
+calling Vector2.IsNear() with default tolerance values.
+</summary>
+            <param name="lhs">Vector2 to compare.</param>
+            <param name="rhs">Another Vector2 to compare.</param>
+            <returns>
+True if all components are approximately equal within the default 
+tolerance value.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Division(SHADE.Vector2,System.Single)">
+            <summary>
+Calculates the division of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector2 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,System.Single)">
+            <summary>
+Calculates the multiplication of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Division(SHADE.Vector2,System.Double)">
+            <summary>
+Calculates the division of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Scalar to divide with.</param>
+            <param name="rhs">Vector2 to divide with.</param>
+            <returns>The result of the scalar division.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,System.Double)">
+            <summary>
+Calculates the multiplication of a Vector2 with a scalar value and returns 
+the result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Scalar to multiply with.</param>
+            <returns>The result of the scalar multiplication.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Multiply(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Calculates the component-wise multiplication of two Vector2s and returns the
+result.
+</summary>
+            <param name="lhs">Vector2 to multiply with.</param>
+            <param name="rhs">Another Vector2 to multiply with.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Subtraction(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Subtracts a Vector2 from another Vector2 and returns the result.
+</summary>
+            <param name="lhs">Vector2 to subtract from.</param>
+            <param name="rhs">Another Vector2 to subtract.</param>
+            <returns>The result of rhs subtracted from lhs.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.op_Addition(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Adds two Vector2s together and returns the result.
+</summary>
+            <param name="lhs">Vector2 to add.</param>
+            <param name="rhs">Another Vector2 to add.</param>
+            <returns>The result of lhs added to rhs</returns>
+        </member>
+        <member name="M:SHADE.Vector2.MoveTowards(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Moves a point current towards target.
+Similar to Lerp(), however, the function will ensure that the distance never
+exceeds maxDistanceDelta. Negative values of maxDistanceDelta pushes the
+vector away from target
+</summary>
+            <param name="current">The current position of the point.</param>
+            <param name="target">The target position to move to.</param>
+            <param name="maxDistanceDelta">Maximum distance moved per call.</param>
+            <returns>Vector representing the moved point.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.LerpUnclamped(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Linearly interpolates between two specified points. 
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+Unlike Lerp(), t is not clamped to a range at all.
+</summary>
+            <param name="a">The start Vector2, returned when t = 0.0f.</param>
+            <param name="b">The end Vector2, returned when t = 1.0f.</param>
+            <param name="t">Value used to interpolate between a and b.</param>
+            <returns>The interpolated Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Lerp(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Linearly interpolates between two specified points.
+This is most commonly used to find a point some fraction of the way along a 
+line between two endpoints.
+</summary>
+            <param name="a">The start Vector2, returned when t = 0.0f.</param>
+            <param name="b">The end Vector2, returned when t = 1.0f.</param>
+            <param name="t">
+Value used to interpolate between a and b which is clamped to
+the range[0, 1].
+</param>
+            <returns>The interpolated Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Max(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 that is made from the largest components of 
+the two specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate maximum Vector2 with.</param>
+            <param name="rhs">Another Vector2 to calculate maximum Vector2 with.</param>
+            <returns>
+The Vector2 that contains the largest components of the two specified 
+Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Min(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 that is made from the smallest components of 
+the two specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate minimum Vector2 with.</param>
+            <param name="rhs">Another Vector2 to calculate minimum Vector2 with.</param>
+            <returns>
+The Vector2 that contains the smallest components of the two specified
+Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.RotateDegrees(SHADE.Vector2,System.Single)">
+            <summary>
+Rotates a Vector2 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector2 to rotate.</param>
+            <param name="degrees">
+Angle to rotate the vector by in an anti-clockwise direction in degrees.
+</param>
+            <returns>The Vector2 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.RotateRadians(SHADE.Vector2,System.Single)">
+            <summary>
+Rotates a Vector2 on the Z-axis by a specified angle in an anti-clockwise 
+direction.
+</summary>
+            <param name="vec">A Vector2 to rotate.</param>
+            <param name="radians">
+Angle to rotate the vector by in an anti-clockwise direction in radians.
+</param>
+            <returns>The Vector2 that represents the rotated vector.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Reflect(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Reflects a Vector2 across another Vector2.
+</summary>
+            <param name="vec">A Vector2 to reflect.</param>
+            <param name="normal">A normal to reflect the Vector2 across.</param>
+            <returns>The Vector2 that represents vec reflected across normal.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Project(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns a Vector2 projection.
+</summary>
+            <param name="vec">Vector2 to project.</param>
+            <param name="direction">Vector2 to project onto.</param>
+            <returns>The Vector2 that represents the projected vec onto direction.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Perpendicular(SHADE.Vector2,System.Boolean)">
+            <summary>
+Computes a perpendicular Vector2 to the specified Vector2.
+</summary>
+            <param name="lhs">Vector2 to find a perpendicular of.</param>
+            <param name="inward">
+Whether the inward perpendicular Vector is retrieved. If true, the
+resultant vector is rotated 90-degrees in a counter-clockwise.
+</param>
+            <returns>The perpendicular Vector2 relative to the specified Vector2.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Perpendicular(SHADE.Vector2)">
+            <summary>
+Computes the inward perpendicular Vector2 to the specified Vector2.
+Equivalent to calling Perpendicular(lhs, true). This means, the
+resultant Vector2 is rotated 90-degrees in a counter-clockwise.
+</summary>
+            <param name="lhs">Vector2 to find a perpendicular of.</param>
+            <returns>
+The perpendicular Vector2 relative to the specified Vector2.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Dot(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Computes and returns the dot product of 2 specified Vector2s.
+</summary>
+            <param name="lhs">Vector2 to calculate dot product with.</param>
+            <param name="rhs">Another Vector2 to calculate dot product with.</param>
+            <returns>
+Scalar value representing the dot product of the two Vector2s.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNear(SHADE.Vector2,SHADE.Vector2,System.Single)">
+            <summary>
+Checks if two specified Vector2s are near in value.
+</summary>
+            <param name="lhs">Vector2 to check if is near in value.</param>
+            <param name="rhs">Another Vector2 to check if is near in value.</param>
+            <param name="tolerance">
+Amount of tolerance to do the comparison with.
+</param>
+            <returns>
+True if the two Vector2s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNear(SHADE.Vector2,SHADE.Vector2)">
+            <summary>
+Checks if two specified Vector2s are near in value.
+</summary>
+            <param name="lhs">Vector2 to check if is near in value.</param>
+            <param name="rhs">Another Vector2 to check if is near in value.</param>
+            <returns>
+True if the two Vector2s are within the tolerance value specified
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetHashCode">
+            <summary>
+Gets a unique hash for this object.
+</summary>
+            <returns>Unique hash for this object.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Equals(System.Object)">
+            <summary>
+Compares equality with another unboxed object.
+</summary>
+            <param name="o">The unboxed object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Equals(SHADE.Vector2)">
+            <summary>
+Compares equality with an object of the same type.
+</summary>
+            <param name="other">The object to compare with.</param>
+            <returns>True if both objects are the same.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNearPoint(SHADE.Vector2,System.Single)">
+            <summary>
+Checks if a specified point is near this Vector2 that represents a point.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <param name="tolerance">
+The amount of tolerance before we consider these points as "near".
+</param>
+            <returns>
+True if this Vector2 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.IsNearPoint(SHADE.Vector2)">
+            <summary>
+Checks if a specified point is near this Vector2 that represents a point with
+a tolerance value of PLS_EPSILON.
+</summary>
+            <param name="point">The other point to check if we are near.</param>
+            <returns>
+True if this Vector2 representing a point and the specified point are within
+the range of the specified tolerance. False otherwise.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.AngleFromRightDegrees">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -180.0f and 180.0f.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in degrees.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.AngleFromRightRadians">
+            <summary>
+Calculates and returns the angle of this vector from the right vector. This 
+function returns values between -Math.PI and Math.PI.
+</summary>
+            <returns>Returns the angle of this vector from the right vector in radians.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetSqrMagnitude">
+            <summary>
+Calculates and returns the squared magnitude of this Vector2.
+</summary>
+            <returns>Returns the squared length of this Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetMagnitude">
+            <summary>
+Calculates and returns the magnitude of this Vector2. Note that this function
+incurs a performance cost from the square root calculation. If you do not 
+need the precise magnitude, consider using GetSqrMagnitude() instead.
+</summary>
+            <returns>Returns the length of this Vector2.</returns>
+        </member>
+        <member name="M:SHADE.Vector2.GetNormalised">
+            <summary>
+Creates a copy of this Vector2 and returns a normalized version. 
+</summary>
+            <returns>
+Returns a normalised copy of this Vector2. 
+If this Vector2 is a zero vector, a zero vector will be returned.
+</returns>
+        </member>
+        <member name="M:SHADE.Vector2.Normalise">
+            <summary>
+Normalises this current Vector2. This changes the data of this Vector2. 
+If you would like to get a copy, use GetNormalised() instead. 
+This function does nothing to a zero vector.
+</summary>
+        </member>
+        <member name="M:SHADE.Vector2.#ctor(System.Single,System.Single)">
+            <summary>
+Constructor to construct a Vector2 with the specified components..
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+            <param name="_y">Y-coordinate to set.</param>
+        </member>
+        <member name="M:SHADE.Vector2.#ctor(System.Single)">
+            <summary>
+Constructor to construct a Vector2 with the specified components with the 
+Y-component set to 0.0f.
+</summary>
+            <param name="_x">X-coordinate to set.</param>
+        </member>
+        <member name="F:SHADE.Vector2.y">
+            <summary>
+Y-component of the Vector2.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.x">
+            <summary>
+X-component of the Vector2.
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Zero">
+            <summary>
+Shorthand for writing Vector2(0, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Up">
+            <summary>
+Shorthand for writing Vector2(0, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Right">
+            <summary>
+Shorthand for writing Vector2(1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.PositiveInfinity">
+            <summary>
+Shorthand for writing Vector2(float.PositiveInfinity, 
+float.PositiveInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.One">
+            <summary>
+Shorthand for writing Vector2(1, 1).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.NegativeInfinity">
+            <summary>
+Shorthand for writing Vector2(float.NegativeInfinity, 
+float.NegativeInfinity).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Left">
+            <summary>
+Shorthand for writing Vector2(-1, 0).
+</summary>
+        </member>
+        <member name="F:SHADE.Vector2.Down">
+            <summary>
+Shorthand for writing Vector2(0, -1).
+</summary>
+        </member>
+        <member name="T:SHADE.Vector2">
+            <summary>
+CLR version of SHADE Engine's Vector2 class that represents a 2-Dimensional Vector.
+Designed to closely match Unity's Vector2 struct.
+</summary>
+        </member>
+        <member name="M:SHADE.EntityUtils.IsValid(System.ValueType!System.UInt32!System.Runtime.CompilerServices.IsBoxed)">
+            <summary>
+Checks if the specified entity is valid. This is done by checking if it
+matches Pls::Entity::INVALID.
+</summary>
+            <param name="entity">The Entity to check.</param>
+            <returns>True if the specified Entity is valid.</returns>
+        </member>
+        <member name="T:SHADE.EntityUtils">
+            <summary>
+Static class that contains useful utility functions for working with Entity.
+</summary>
+        </member>
+        <member name="T:SHADE.SHResourceHub">
+            <summary>
+Manages all resources in multiple ResourceLibraries.
+</summary>
+        </member>
+        <member name="T:SHADE.SHResourceLibraryBase">
+            <summary>
+Base class for SHResourceLibrary that holds information about the library type.
+</summary>
+        </member>
+        <member name="T:SHADE.Handle{System.Void}">
+            <summary>
+Template Specialization for Handle that represents a type-less Handle.
+</summary>
+        </member>
+        <member name="M:SHADE.HandleBase.op_Implicit~System.Boolean">
+            <summary>
+Converts to true if this is a valid Handle.
+</summary>
+        </member>
+        <member name="T:SHADE.HandleBase.Id">
+            <summary>
+Native ID type of a handle
+</summary>
+        </member>
+        <member name="T:SHADE.HandleBase">
+            <summary>
+Base implementation of the Handle that is not templated to allow for holding
+generic non-type-specific Handles.
+</summary>
+        </member>
+        <member name="T:SHADE.BadHandleCastException">
+            <summary>
+Exception thrown when a generic Handle is being casted to the wrong type.
+</summary>
+        </member>
+        <member name="T:SHADE.InvalidHandleException">
+            <summary>
+Exception thrown when an invalid Handle was dereferenced.
+</summary>
+        </member>
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SDL_acos(System.Double)'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputCheckbox(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputUnsignedInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputFloat(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputDouble(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputAngle(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32,System.Int32,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32,System.UInt32,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single,System.Single,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double,System.Double,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec2(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec2*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec3(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*,System.Single)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputTextField(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputEnumCombo(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.vector<std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>,std.allocator<std.basic_string<System.SByte!System.Runtime.Co'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputCheckbox(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputUnsignedInt(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputFloat(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputDouble(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputAngle(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32,System.Int32,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.UInt32,System.UInt32,System.UInt32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Single,System.Single,System.Single*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputSlider(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Double,System.Double,System.Double*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec2(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec2*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputVec3(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,SHADE.SHVec3*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*,System.Single)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputTextField(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Boolean*)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.SHEditorUI.InputEnumCombo(std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>!System.Runtime.CompilerServices.IsConst*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,System.Int32*!System.Runtime.CompilerServices.IsImplicitlyDereferenced,std.vector<std.basic_string<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte,std.char_traits{System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte},std.allocator<System.SByte!System.Runtime.CompilerServices.IsSignUnspecifiedByte>>,std.allocator<std.basic_string<System.SByte!System.Runtime.Co'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.Ray)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToNative(SHADE.GenericHandle)'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.Convert.ToCLI(SHADE.Handle{System.Void})'. -->
+        <!-- Discarding badly formed XML document comment for member 'T:SHADE.GenericHandle'. -->
+        <!-- Discarding badly formed XML document comment for member 'M:SHADE.GenericHandle.#ctor(SHADE.Handle{System.Void})'. -->
+    </members>
+</doc>
\ No newline at end of file