Merge branch 'main' into SP3-17-animation-system
# Conflicts: # SHADE_Engine/src/Editor/EditorWindow/Inspector/SHEditorComponentView.hpp # SHADE_Engine/src/Serialization/SHYAMLConverters.h
This commit is contained in:
commit
53ef202e46
|
@ -1,4 +1,4 @@
|
|||
Start in Fullscreen: false
|
||||
Starting Scene ID: 97402985
|
||||
Starting Scene ID: 87244611
|
||||
Window Size: {x: 1920, y: 1080}
|
||||
Window Title: SHADE Engine
|
|
@ -1,16 +1,16 @@
|
|||
0 1 3
|
||||
1 2 3
|
||||
2 3 65535
|
||||
3 4 65535
|
||||
4 5 65535
|
||||
5 6 65535
|
||||
6 7 65535
|
||||
7 8 65535
|
||||
8 9 65535
|
||||
9 10 65535
|
||||
10 11 65535
|
||||
11 12 65535
|
||||
12 13 65535
|
||||
13 14 65535
|
||||
14 15 65535
|
||||
15 16 65535
|
||||
0 1
|
||||
1 2
|
||||
2 3
|
||||
3 4
|
||||
4 5
|
||||
5 6
|
||||
6 7
|
||||
7 8
|
||||
8 9
|
||||
9 10
|
||||
10 11
|
||||
11 12
|
||||
12 13
|
||||
13 14
|
||||
14 15
|
||||
15 16
|
||||
|
|
|
@ -1,4 +1,4 @@
|
|||
Start Maximized: true
|
||||
Working Scene ID: 97402985
|
||||
Working Scene ID: 97161771
|
||||
Window Size: {x: 1920, y: 1080}
|
||||
Style: 0
|
|
@ -1,247 +0,0 @@
|
|||
- EID: 0
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 2.72256827, y: 0.501797795, z: -0.0273017883}
|
||||
Rotate: {x: 0, y: 0, z: 0.436332315}
|
||||
Scale: {x: 4.61070776, y: 0.99999392, z: 0.999996722}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 1
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Camera Component:
|
||||
Position: {x: 0, y: 2, z: 10}
|
||||
Pitch: 0
|
||||
Yaw: 0
|
||||
Roll: 0
|
||||
Width: 1920
|
||||
Height: 1080
|
||||
Near: 0.00999999978
|
||||
Far: 10000
|
||||
Perspective: true
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 3
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 2, y: 7.5, z: 0}
|
||||
Rotate: {x: -0, y: 0, z: 0.785398185}
|
||||
Scale: {x: 1, y: 1, z: 1}
|
||||
IsActive: true
|
||||
RigidBody Component:
|
||||
Type: Dynamic
|
||||
Auto Mass: false
|
||||
Mass: 0.52359879
|
||||
Drag: 0.00999999978
|
||||
Angular Drag: 0
|
||||
Use Gravity: true
|
||||
Gravity Scale: 1
|
||||
Interpolate: true
|
||||
Sleeping Enabled: true
|
||||
Freeze Position X: false
|
||||
Freeze Position Y: true
|
||||
Freeze Position Z: false
|
||||
Freeze Rotation X: false
|
||||
Freeze Rotation Y: false
|
||||
Freeze Rotation Z: false
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Sphere
|
||||
Radius: 1
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 2
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 0, y: 4, z: 0}
|
||||
Rotate: {x: -0, y: 0, z: -0.436332315}
|
||||
Scale: {x: 4.61071014, y: 0.999995887, z: 1}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 2
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 4
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 0, y: -3, z: 0}
|
||||
Rotate: {x: -0, y: 0, z: -0}
|
||||
Scale: {x: 10, y: 3, z: 10}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 5
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: -4.80025721, y: 3, z: 0}
|
||||
Rotate: {x: -0, y: 0, z: 1.57079601}
|
||||
Scale: {x: 9.99975109, y: 0.499992192, z: 10}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 6
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 4.80000019, y: 3, z: 0}
|
||||
Rotate: {x: -0, y: 0, z: 1.57079601}
|
||||
Scale: {x: 9.99975109, y: 0.499992192, z: 10}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
||||
- EID: 7
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 0, y: 7, z: 0}
|
||||
Rotate: {x: 0, y: 0, z: 0.785398185}
|
||||
Scale: {x: 0.999990404, y: 0.999994457, z: 0.999985337}
|
||||
IsActive: true
|
||||
RigidBody Component:
|
||||
Type: Dynamic
|
||||
Auto Mass: false
|
||||
Mass: 1
|
||||
Drag: 0.00999999978
|
||||
Angular Drag: 0
|
||||
Use Gravity: true
|
||||
Gravity Scale: 1
|
||||
Interpolate: true
|
||||
Sleeping Enabled: true
|
||||
Freeze Position X: false
|
||||
Freeze Position Y: false
|
||||
Freeze Position Z: false
|
||||
Freeze Rotation X: false
|
||||
Freeze Rotation Y: false
|
||||
Freeze Rotation Z: false
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts:
|
||||
- Type: PhysicsTestObj
|
||||
Enabled: true
|
||||
forceAmount: 50
|
||||
torqueAmount: 5
|
||||
- EID: 8
|
||||
Name: Default
|
||||
IsActive: true
|
||||
NumberOfChildren: 0
|
||||
Components:
|
||||
Transform Component:
|
||||
Translate: {x: 0, y: 0, z: 3}
|
||||
Rotate: {x: -0, y: 0, z: -0}
|
||||
Scale: {x: 1, y: 1, z: 1}
|
||||
IsActive: true
|
||||
Collider Component:
|
||||
DrawColliders: false
|
||||
Colliders:
|
||||
- Is Trigger: false
|
||||
Collision Tag: 1
|
||||
Type: Box
|
||||
Half Extents: {x: 1, y: 1, z: 1}
|
||||
Friction: 0.400000006
|
||||
Bounciness: 0
|
||||
Density: 1
|
||||
Position Offset: {x: 0, y: 0, z: 0}
|
||||
Rotation Offset: {x: 0, y: 0, z: 0}
|
||||
IsActive: true
|
||||
Scripts: ~
|
|
@ -1,3 +0,0 @@
|
|||
Name: PhysicsSandbox
|
||||
ID: 97402985
|
||||
Type: 5
|
|
@ -159,7 +159,7 @@ public partial class LeafSearch : BehaviourTreeNode
|
|||
//Since transform position is often the raccoon's base and the ray needs to hit somewhere higher to be more reliable
|
||||
Vector3 rayDestination = plrT.GlobalPosition + plrT.GlobalScale * playerCollider.PositionOffset;
|
||||
Ray sightRay = new Ray(eyePosition, rayDestination - eyePosition);
|
||||
RaycastHit sightRayHit = Physics.Raycast(sightRay, false)[0];
|
||||
RaycastHit sightRayHit = Physics.Raycast(sightRay);
|
||||
//As of November 2022, RaycastHit contains only the FIRST object hit by
|
||||
//the ray in the Other GameObject data member
|
||||
//Diren may likely add ALL objects hit by the ray over December
|
||||
|
|
|
@ -1,7 +1,6 @@
|
|||
using SHADE;
|
||||
using SHADE_Scripting;
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using static PlayerController;
|
||||
using static Item;
|
||||
|
||||
|
@ -204,13 +203,9 @@ public class PickAndThrow : Script
|
|||
Vector3 playerRayPos = pc.tranform.GlobalPosition;
|
||||
playerRayPos.y += 0.05f;
|
||||
dirNor.Normalise();
|
||||
List<RaycastHit> rayList1 = Physics.Raycast(new Ray(playerRayPos, Vector3.RotateY(dirNor, SHADE.Math.DegreesToRadians(22.5f))), rayDistance, false);
|
||||
List<RaycastHit> rayList2 = Physics.Raycast(new Ray(playerRayPos, Vector3.RotateY(dirNor, SHADE.Math.DegreesToRadians(-22.5f))), rayDistance, false);
|
||||
List<RaycastHit> rayList3 = Physics.Raycast(new Ray(playerRayPos, dirNor), rayDistance * 0.75f, false);
|
||||
|
||||
RaycastHit ray1 = rayList1[0];
|
||||
RaycastHit ray2 = rayList2[0];
|
||||
RaycastHit ray3 = rayList3[0];
|
||||
RaycastHit ray1 = Physics.Raycast(new Ray(playerRayPos, Vector3.RotateY(dirNor, SHADE.Math.DegreesToRadians(22.5f))), rayDistance);
|
||||
RaycastHit ray2 = Physics.Raycast(new Ray(playerRayPos, Vector3.RotateY(dirNor, SHADE.Math.DegreesToRadians(-22.5f))), rayDistance);
|
||||
RaycastHit ray3 = Physics.Raycast(new Ray(playerRayPos, dirNor), rayDistance * 0.75f);
|
||||
inRange = CheckForItem(ray1) || CheckForItem(ray2) || CheckForItem(ray3);
|
||||
}
|
||||
}
|
||||
|
|
|
@ -1,119 +0,0 @@
|
|||
using SHADE;
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using static Item;
|
||||
|
||||
|
||||
public class PhysicsTestObj : Script
|
||||
{
|
||||
public RigidBody body { get; set; }
|
||||
public Collider collider { get; set; }
|
||||
|
||||
// Movement input booleans
|
||||
public enum Direction
|
||||
{
|
||||
UP,
|
||||
DOWN,
|
||||
FORWARD,
|
||||
BACK,
|
||||
LEFT,
|
||||
RIGHT
|
||||
};
|
||||
|
||||
internal bool[] move = new bool[6];
|
||||
internal bool[] rotate = new bool[6];
|
||||
|
||||
internal Vector3[] moveVec = new Vector3[6]
|
||||
{
|
||||
Vector3.Up,
|
||||
Vector3.Down,
|
||||
Vector3.Back,
|
||||
Vector3.Forward,
|
||||
Vector3.Left,
|
||||
Vector3.Right
|
||||
};
|
||||
|
||||
internal Vector3[] rotateVec = new Vector3[6]
|
||||
{
|
||||
Vector3.Right,
|
||||
Vector3.Left,
|
||||
Vector3.Forward,
|
||||
Vector3.Down,
|
||||
Vector3.Up,
|
||||
Vector3.Down
|
||||
};
|
||||
|
||||
internal Input.KeyCode[] moveInputKeys = new Input.KeyCode[6]
|
||||
{
|
||||
Input.KeyCode.Space,
|
||||
Input.KeyCode.LeftControl,
|
||||
Input.KeyCode.W,
|
||||
Input.KeyCode.S,
|
||||
Input.KeyCode.A,
|
||||
Input.KeyCode.D
|
||||
};
|
||||
|
||||
internal Input.KeyCode[] rotateInputKeys = new Input.KeyCode[6]
|
||||
{
|
||||
Input.KeyCode.I,
|
||||
Input.KeyCode.K,
|
||||
Input.KeyCode.U,
|
||||
Input.KeyCode.O,
|
||||
Input.KeyCode.J,
|
||||
Input.KeyCode.L
|
||||
};
|
||||
|
||||
public float forceAmount = 50.0f;
|
||||
public float torqueAmount = 500.0f;
|
||||
|
||||
protected override void awake()
|
||||
{
|
||||
body = GetComponent<RigidBody>();
|
||||
collider = GetComponent<Collider>();
|
||||
|
||||
for (int i = 0; i < 6; ++i)
|
||||
{
|
||||
move[i] = false;
|
||||
rotate[i] = false;
|
||||
}
|
||||
}
|
||||
|
||||
protected override void update()
|
||||
{
|
||||
Ray colliderRay = new Ray();
|
||||
colliderRay.Direction = Vector3.Right;
|
||||
Physics.ColliderRaycast(collider.Owner, colliderRay, false);
|
||||
|
||||
for (int i = 0; i < 6; ++i)
|
||||
{
|
||||
if (Input.GetKeyDown(moveInputKeys[i]))
|
||||
move[i] = true;
|
||||
|
||||
if (Input.GetKeyDown(rotateInputKeys[i]))
|
||||
rotate[i] = true;
|
||||
}
|
||||
}
|
||||
|
||||
protected override void fixedUpdate()
|
||||
{
|
||||
for (int i = 0; i < 6; ++i)
|
||||
{
|
||||
bool shouldMove = move[i];
|
||||
bool shouldRotate = rotate[i];
|
||||
|
||||
if (shouldMove)
|
||||
{
|
||||
//Vector3 offset = new Vector3(0.25f, 0.0f, 0.0f);
|
||||
//rb.AddForceAtLocalPos(moveVec[i] * forceAmount, offset);
|
||||
body.AddForce(moveVec[i] * forceAmount);
|
||||
move[i] = false;
|
||||
}
|
||||
|
||||
if (shouldRotate)
|
||||
{
|
||||
body.AddTorque(rotateVec[i] * torqueAmount);
|
||||
rotate[i] = false;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
|
@ -1,3 +0,0 @@
|
|||
Name: PhysicsTestObj
|
||||
ID: 159293012
|
||||
Type: 9
|
|
@ -79,6 +79,9 @@ namespace Sandbox
|
|||
SHSystemManager::CreateSystem<SHScriptEngine>();
|
||||
SHSystemManager::CreateSystem<SHTransformSystem>();
|
||||
SHSystemManager::CreateSystem<SHPhysicsSystem>();
|
||||
#ifndef _PUBLISH
|
||||
SHSystemManager::CreateSystem<SHPhysicsDebugDrawSystem>();
|
||||
#endif
|
||||
|
||||
SHSystemManager::CreateSystem<SHAudioSystem>();
|
||||
SHSystemManager::CreateSystem<SHCameraSystem>();
|
||||
|
@ -89,6 +92,7 @@ namespace Sandbox
|
|||
|
||||
SHSystemManager::CreateSystem<SHGraphicsSystem>();
|
||||
SHGraphicsSystem* graphicsSystem = static_cast<SHGraphicsSystem*>(SHSystemManager::GetSystem<SHGraphicsSystem>());
|
||||
SHPhysicsSystem* physicsSystem = SHSystemManager::GetSystem<SHPhysicsSystem>();
|
||||
|
||||
// Link up SHDebugDraw
|
||||
SHSystemManager::CreateSystem<SHDebugDrawSystem>();
|
||||
|
@ -104,8 +108,6 @@ namespace Sandbox
|
|||
editor->SetSDLWindow(sdlWindow);
|
||||
editor->SetSHWindow(&window);
|
||||
}
|
||||
|
||||
SHSystemManager::CreateSystem<SHPhysicsDebugDrawSystem>();
|
||||
#endif
|
||||
|
||||
// Create Routines
|
||||
|
@ -117,11 +119,11 @@ namespace Sandbox
|
|||
SHSystemManager::RegisterRoutine<SHTransformSystem, SHTransformSystem::TransformPostLogicUpdate>();
|
||||
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsPreUpdate>();
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsUpdate>();
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsFixedUpdate>();
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsSystem, SHPhysicsSystem::PhysicsPostUpdate>();
|
||||
|
||||
#ifdef SHEDITOR
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsDebugDrawSystem, SHPhysicsDebugDrawSystem::PhysicsDebugDraw>();
|
||||
#ifndef _PUBLISH
|
||||
SHSystemManager::RegisterRoutine<SHPhysicsDebugDrawSystem, SHPhysicsDebugDrawSystem::PhysicsDebugDrawRoutine>();
|
||||
#endif
|
||||
|
||||
SHSystemManager::RegisterRoutine<SHTransformSystem, SHTransformSystem::TransformPostPhysicsUpdate>();
|
||||
|
@ -199,12 +201,32 @@ namespace Sandbox
|
|||
#endif
|
||||
SHSceneManager::SceneUpdate(0.016f);
|
||||
#ifdef SHEDITOR
|
||||
|
||||
SHSystemManager::RunRoutines(editor->editorState != SHEditor::State::PLAY, SHFrameRateController::GetRawDeltaTime());
|
||||
editor->PollPicking();
|
||||
#else
|
||||
SHSystemManager::RunRoutines(false, SHFrameRateController::GetRawDeltaTime());
|
||||
#endif
|
||||
// TODO: Move into an Editor menu
|
||||
static bool drawContacts = false;
|
||||
if (SHInputManager::GetKeyDown(SHInputManager::SH_KEYCODE::F9))
|
||||
{
|
||||
drawContacts = !drawContacts;
|
||||
SHSystemManager::GetSystem<SHPhysicsDebugDrawSystem>()->SetDebugDrawFlag(SHPhysicsDebugDrawSystem::DebugDrawFlags::CONTACT_POINTS, drawContacts);
|
||||
SHSystemManager::GetSystem<SHPhysicsDebugDrawSystem>()->SetDebugDrawFlag(SHPhysicsDebugDrawSystem::DebugDrawFlags::CONTACT_NORMALS, drawContacts);
|
||||
}
|
||||
static bool drawColliders = false;
|
||||
if (SHInputManager::GetKeyDown(SHInputManager::SH_KEYCODE::F10))
|
||||
{
|
||||
drawColliders = !drawColliders;
|
||||
SHSystemManager::GetSystem<SHPhysicsDebugDrawSystem>()->SetDebugDrawFlag(SHPhysicsDebugDrawSystem::DebugDrawFlags::COLLIDER, drawColliders);
|
||||
}
|
||||
static bool drawRays = false;
|
||||
if (SHInputManager::GetKeyDown(SHInputManager::SH_KEYCODE::F11))
|
||||
{
|
||||
drawRays = !drawRays;
|
||||
SHSystemManager::GetSystem<SHPhysicsDebugDrawSystem>()->SetDebugDrawFlag(SHPhysicsDebugDrawSystem::DebugDrawFlags::RAYCASTS, drawRays);
|
||||
}
|
||||
|
||||
}
|
||||
// Finish all graphics jobs first
|
||||
graphicsSystem->AwaitGraphicsExecution();
|
||||
|
|
|
@ -44,6 +44,23 @@ namespace Sandbox
|
|||
{
|
||||
sceneName = SHSerialization::DeserializeSceneFromFile(sceneAssetID);
|
||||
|
||||
auto* physicsSystem = SHSystemManager::GetSystem<SHPhysicsSystem>();
|
||||
if (!physicsSystem)
|
||||
{
|
||||
SHLOGV_CRITICAL("Failed to get the physics system for building the scene!")
|
||||
return;
|
||||
}
|
||||
|
||||
#ifdef SHEDITOR
|
||||
|
||||
physicsSystem->ForceBuild(SHSceneManager::GetCurrentSceneGraph());
|
||||
|
||||
#else
|
||||
|
||||
physicsSystem->BuildScene(SHSceneManager::GetCurrentSceneGraph());
|
||||
|
||||
#endif
|
||||
|
||||
/*-----------------------------------------------------------------------*/
|
||||
/* TESTING CODE */
|
||||
/*-----------------------------------------------------------------------*/
|
||||
|
|
|
@ -92,7 +92,7 @@ namespace Sandbox
|
|||
|
||||
floorRigidBody.SetType(SHRigidBodyComponent::Type::STATIC);
|
||||
|
||||
//floorCollider.AddBoundingBox();
|
||||
floorCollider.AddBoundingBox();
|
||||
|
||||
// Create blank entity with a script
|
||||
//testObj = SHADE::SHEntityManager::CreateEntity<SHRenderable, SHTransformComponent>();
|
||||
|
@ -113,9 +113,9 @@ namespace Sandbox
|
|||
racoonTransform.SetWorldScale({ 2.0f, 2.0f, 2.0f });
|
||||
racoonTransform.SetWorldPosition({ -3.0f, -2.0f, -5.0f });
|
||||
|
||||
//racoonCollider.AddBoundingBox();
|
||||
//racoonCollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f,0.5f,0.0f));
|
||||
//racoonCollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
racoonCollider.AddBoundingBox();
|
||||
racoonCollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f,0.5f,0.0f));
|
||||
racoonCollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
|
||||
auto racoonItemLocation = SHEntityManager::CreateEntity<SHTransformComponent>();
|
||||
auto& racoonItemLocationTransform = *SHComponentManager::GetComponent_s<SHTransformComponent>(racoonItemLocation);
|
||||
|
@ -138,15 +138,15 @@ namespace Sandbox
|
|||
itemTransform.SetWorldScale({ 2.0f, 2.0f, 2.0f });
|
||||
itemTransform.SetWorldPosition({ 0.0f, -2.0f, -5.0f });
|
||||
|
||||
//itemCollider.AddBoundingBox();
|
||||
//itemCollider.AddBoundingBox(SHVec3(2.0f,2.0f,2.0f));
|
||||
//itemCollider.GetCollisionShape(1).SetIsTrigger(true);
|
||||
itemCollider.AddBoundingBox();
|
||||
itemCollider.AddBoundingBox(SHVec3(2.0f,2.0f,2.0f));
|
||||
itemCollider.GetCollisionShape(1).SetIsTrigger(true);
|
||||
|
||||
//itemCollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
//itemCollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
itemCollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
itemCollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
|
||||
//itemCollider.GetCollisionShape(1).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
//itemCollider.GetCollisionShape(1).SetBoundingBox(SHVec3(1.0f, 1.0f, 1.0f));
|
||||
itemCollider.GetCollisionShape(1).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
itemCollider.GetCollisionShape(1).SetBoundingBox(SHVec3(1.0f, 1.0f, 1.0f));
|
||||
|
||||
itemRigidBody.SetInterpolate(false);
|
||||
itemRigidBody.SetFreezeRotationX(true);
|
||||
|
@ -167,9 +167,9 @@ namespace Sandbox
|
|||
AITransform.SetWorldScale({ 2.0f, 2.0f, 2.0f });
|
||||
AITransform.SetWorldPosition({ -8.0f, -2.0f, 2.5f });
|
||||
|
||||
//AICollider.AddBoundingBox();
|
||||
//AICollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
//AICollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
AICollider.AddBoundingBox();
|
||||
AICollider.GetCollisionShape(0).SetPositionOffset(SHVec3(0.0f, 0.5f, 0.0f));
|
||||
AICollider.GetCollisionShape(0).SetBoundingBox(SHVec3(0.5f, 0.5f, 0.5f));
|
||||
|
||||
AIRigidBody.SetInterpolate(false);
|
||||
AIRigidBody.SetFreezeRotationX(true);
|
||||
|
|
|
@ -10,7 +10,7 @@
|
|||
namespace SHADE
|
||||
{
|
||||
|
||||
class SHAABB;
|
||||
class SHBox;
|
||||
class SHRay;
|
||||
|
||||
class SH_API SHCameraArmComponent final: public SHComponent
|
||||
|
|
|
@ -10,7 +10,7 @@
|
|||
#include "Scene/SHSceneManager.h"
|
||||
#include "ECS_Base/Managers/SHSystemManager.h"
|
||||
#include "Editor/SHEditor.h"
|
||||
#include "Math/Geometry/SHAABB.h"
|
||||
#include "Math/Geometry/SHBox.h"
|
||||
#include "Math/SHRay.h"
|
||||
#include "Physics/System/SHPhysicsSystem.h"
|
||||
|
||||
|
@ -186,20 +186,20 @@ namespace SHADE
|
|||
|
||||
//SHLOG_INFO("Ray position: {},{},{} direction:{},{},{}",pivot.ray.position.x, pivot.ray.position.y, pivot.ray.position.z,pivot.ray.direction.x, pivot.ray.direction.y, pivot.ray.direction.z)
|
||||
|
||||
//auto result = physicsSystem->Raycast(pivot.ray );
|
||||
//if (result && result.distance < pivot.GetArmLength())
|
||||
//{
|
||||
//
|
||||
// SHVec3 newOffset = SHVec3{ 0.0f,0.0f, result.distance * 0.8f };
|
||||
// newOffset = SHVec3::RotateX(newOffset, -(SHMath::DegreesToRadians(pivot.GetPitch())));
|
||||
// newOffset = SHVec3::RotateY(newOffset, (SHMath::DegreesToRadians(pivot.GetYaw())));
|
||||
// pivot.offset = newOffset;
|
||||
// //SHLOG_INFO("CAMERA COLLISION HIT, {}", result.distance);
|
||||
//}
|
||||
//else
|
||||
//{
|
||||
// //SHLOG_INFO("CAMERA COLLISION CANT HIT CAMERA");
|
||||
//}
|
||||
auto result = physicsSystem->Raycast(pivot.ray );
|
||||
if (result && result.distance < pivot.GetArmLength())
|
||||
{
|
||||
|
||||
SHVec3 newOffset = SHVec3{ 0.0f,0.0f, result.distance * 0.8f };
|
||||
newOffset = SHVec3::RotateX(newOffset, -(SHMath::DegreesToRadians(pivot.GetPitch())));
|
||||
newOffset = SHVec3::RotateY(newOffset, (SHMath::DegreesToRadians(pivot.GetYaw())));
|
||||
pivot.offset = newOffset;
|
||||
//SHLOG_INFO("CAMERA COLLISION HIT, {}", result.distance);
|
||||
}
|
||||
else
|
||||
{
|
||||
//SHLOG_INFO("CAMERA COLLISION CANT HIT CAMERA");
|
||||
}
|
||||
|
||||
|
||||
|
||||
|
|
|
@ -162,7 +162,7 @@ namespace SHADE
|
|||
|
||||
//SHSceneNode* parentNode = entityVec[eIndex]->GetSceneNode()->GetParent();
|
||||
|
||||
//SHSceneGraph::removeChild(parentNode,entityVec[eIndex].get());
|
||||
//SHSceneGraph::RemoveChild(parentNode,entityVec[eIndex].get());
|
||||
|
||||
//TODO remove from parent and recursively delete child.
|
||||
|
||||
|
|
|
@ -1,7 +1,7 @@
|
|||
#include "SHpch.h"
|
||||
#include "SHColliderTagPanel.h"
|
||||
#include "ECS_Base/Managers/SHSystemManager.h"
|
||||
#include "Physics/Collision/CollisionTags/SHCollisionTagMatrix.h"
|
||||
#include "Physics/Collision/SHCollisionTagMatrix.h"
|
||||
#include "Editor/SHEditorWidgets.hpp"
|
||||
|
||||
namespace SHADE
|
||||
|
@ -15,7 +15,7 @@ namespace SHADE
|
|||
ImGui::TableNextRow();
|
||||
ImGui::PushID("CollisionTagNames");
|
||||
|
||||
for (int i = SHCollisionTag::NUM_LAYERS; i >= 1; --i)
|
||||
for (int i = SHCollisionTag::NUM_LAYERS; i >= 0; --i)
|
||||
{
|
||||
ImGui::TableNextColumn();
|
||||
if(i == SHCollisionTag::NUM_LAYERS) continue;
|
||||
|
@ -29,7 +29,7 @@ namespace SHADE
|
|||
ImGui::PopID();
|
||||
}
|
||||
ImGui::PopID();
|
||||
for (int i = 0; i < SHCollisionTag::NUM_LAYERS - 1; ++i)
|
||||
for (int i = 0; i < SHCollisionTag::NUM_LAYERS; ++i)
|
||||
{
|
||||
std::string tagName = SHCollisionTagMatrix::GetTagName(i);
|
||||
auto tag = SHCollisionTagMatrix::GetTag(i);
|
||||
|
@ -53,8 +53,8 @@ namespace SHADE
|
|||
tagName2 = std::to_string(idx);
|
||||
|
||||
ImGui::TableNextColumn();
|
||||
if(i == idx)
|
||||
continue;
|
||||
//if(i == idx)
|
||||
// continue;
|
||||
std::string label = std::format("##{} vs {}", tagName, tagName2);
|
||||
SHEditorWidgets::CheckBox(label, [tag, &idx]{return tag->GetLayerState(idx);}, [tag, i, idx](bool const& value){tag->SetLayerState(idx, value); SHCollisionTagMatrix::GetTag(idx)->SetLayerState(i, value);}, label.substr(2));
|
||||
}
|
||||
|
|
|
@ -18,11 +18,11 @@
|
|||
#include "Physics/Interface/SHColliderComponent.h"
|
||||
#include "Reflection/SHReflectionMetadata.h"
|
||||
#include "Resource/SHResourceManager.h"
|
||||
#include "Physics/Collision/SHCollisionTagMatrix.h"
|
||||
#include "Serialization/SHSerializationHelper.hpp"
|
||||
#include "Tools/Utilities/SHClipboardUtilities.h"
|
||||
#include "SHInspectorCommands.h"
|
||||
#include "Physics/Collision/SHCompositeCollider.h"
|
||||
#include "Physics/Collision/CollisionTags/SHCollisionTagMatrix.h"
|
||||
#include "Physics/Collision/SHCollisionTagMatrix.h"
|
||||
#include "Animation/SHAnimatorComponent.h"
|
||||
namespace SHADE
|
||||
{
|
||||
|
@ -257,34 +257,31 @@ namespace SHADE
|
|||
|
||||
if(rbType == SHRigidBodyComponent::Type::DYNAMIC) //Dynamic only fields
|
||||
{
|
||||
SHEditorWidgets::CheckBox("Use Gravity", [component]{return component->IsGravityEnabled();}, [component](bool const& value){component->SetIsGravityEnabled(value);}, "Whether Gravity is enabled for this body");
|
||||
SHEditorWidgets::DragFloat("Gravity Scale", [component] { return component->GetGravityScale(); }, [component](float const& value) { component->SetGravityScale(value); }, "Per-object Gravity Scale", 0.1f, 0.0f);
|
||||
|
||||
SHEditorWidgets::CheckBox("Auto Mass", [component]{return component->GetAutoMass();}, [component](bool const& value){component->SetAutoMass(value);}, "If mass should be automatically computed. Setting mass will turn this off.");
|
||||
SHEditorWidgets::DragFloat("Mass", [component] {return component->GetMass(); }, [component](float const& value) {component->SetMass(value); }, "Mass");
|
||||
SHEditorWidgets::CheckBox("Use Gravity", [component]{return component->IsGravityEnabled();}, [component](bool const& value){component->SetGravityEnabled(value);}, "Gravity");
|
||||
//SHEditorWidgets::DragFloat("Mass", [component] {return component->GetMass(); }, [component](float const& value) {component->SetMass(value); }, "Mass");
|
||||
}
|
||||
if (rbType == SHRigidBodyComponent::Type::DYNAMIC || rbType == SHRigidBodyComponent::Type::KINEMATIC) //Dynamic or Kinematic only fields
|
||||
{
|
||||
SHEditorWidgets::DragFloat("Drag", [component] {return component->GetDrag(); }, [component](float const& value) {component->SetDrag(value); }, "Drag", 0.1f, 0.0f);
|
||||
SHEditorWidgets::DragFloat("Angular Drag", [component] {return component->GetAngularDrag(); }, [component](float const& value) {component->SetAngularDrag(value); }, "Angular Drag", 0.1f, 0.0f);
|
||||
SHEditorWidgets::DragFloat("Drag", [component] {return component->GetDrag(); }, [component](float const& value) {component->SetDrag(value); }, "Drag");
|
||||
SHEditorWidgets::DragFloat("Angular Drag", [component] {return component->GetAngularDrag(); }, [component](float const& value) {component->SetAngularDrag(value); }, "Angular Drag");
|
||||
|
||||
SHEditorWidgets::CheckBox("Interpolate", [component] {return component->IsInterpolating(); }, [component](bool const& value) {component->SetInterpolate(value); }, "If the position between frames should be interpolated.");
|
||||
SHEditorWidgets::CheckBox("Interpolate", [component] {return component->IsInterpolating(); }, [component](bool const& value) {component->SetInterpolate(value); }, "Interpolate");
|
||||
|
||||
SHEditorWidgets::BeginPanel(std::format("{} Constraints", ICON_FA_LOCK).data(), { ImGui::GetContentRegionAvail().x, ImGui::GetContentRegionAvail().y });
|
||||
|
||||
SHEditorWidgets::TextLabel("Freeze Position");
|
||||
ImGui::PushID("FreezePos");
|
||||
SHEditorWidgets::CheckBox("X", [component] {return component->GetFreezePositionX(); }, [component](bool const& value) {component->SetFreezePositionX(value); }, "Stops any displacement along the X-axis."); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Y", [component] {return component->GetFreezePositionY(); }, [component](bool const& value) {component->SetFreezePositionY(value); }, "Stops any displacement along the Y-axis."); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Z", [component] {return component->GetFreezePositionZ(); }, [component](bool const& value) {component->SetFreezePositionZ(value); }, "Stops any displacement along the Z-axis.");
|
||||
SHEditorWidgets::CheckBox("X", [component] {return component->GetFreezePositionX(); }, [component](bool const& value) {component->SetFreezePositionX(value); }, "Freeze Position - X"); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Y", [component] {return component->GetFreezePositionY(); }, [component](bool const& value) {component->SetFreezePositionY(value); }, "Freeze Position - Y"); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Z", [component] {return component->GetFreezePositionZ(); }, [component](bool const& value) {component->SetFreezePositionZ(value); }, "Freeze Position - Z");
|
||||
ImGui::PopID();
|
||||
|
||||
|
||||
SHEditorWidgets::TextLabel("Freeze Rotation");
|
||||
ImGui::PushID("FreezeRot");
|
||||
SHEditorWidgets::CheckBox("X", [component] {return component->GetFreezeRotationX(); }, [component](bool const& value) {component->SetFreezeRotationX(value); }, "Stops any rotation about the X-axis."); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Y", [component] {return component->GetFreezeRotationY(); }, [component](bool const& value) {component->SetFreezeRotationY(value); }, "Stops any rotation about the Y-axis."); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Z", [component] {return component->GetFreezeRotationZ(); }, [component](bool const& value) {component->SetFreezeRotationZ(value); }, "Stops any rotation about the Z-axis.");
|
||||
SHEditorWidgets::CheckBox("X", [component] {return component->GetFreezeRotationX(); }, [component](bool const& value) {component->SetFreezeRotationX(value); }, "Freeze Rotation - X"); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Y", [component] {return component->GetFreezeRotationY(); }, [component](bool const& value) {component->SetFreezeRotationY(value); }, "Freeze Rotation - Y"); ImGui::SameLine();
|
||||
SHEditorWidgets::CheckBox("Z", [component] {return component->GetFreezeRotationZ(); }, [component](bool const& value) {component->SetFreezeRotationZ(value); }, "Freeze Rotation - Z");
|
||||
ImGui::PopID();
|
||||
|
||||
SHEditorWidgets::EndPanel();
|
||||
|
@ -293,15 +290,9 @@ namespace SHADE
|
|||
//Debug Info (Read-Only)
|
||||
if(ImGui::CollapsingHeader("Debug Information", ImGuiTreeNodeFlags_DefaultOpen))//Dynamic or Kinematic only fields
|
||||
{
|
||||
SHEditorWidgets::DragFloat("Mass", [component] { return component->GetMass(); }, [](float value){}, "Mass", 0.1f, 0.0f, std::numeric_limits<float>::infinity(), "%.3f", ImGuiSliderFlags_ReadOnly);
|
||||
SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [component] {return component->GetPosition(); }, [](SHVec3 const& value) {}, false, "Position", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
SHEditorWidgets::DragVec3("Rotation", { "X", "Y", "Z" }, [component]
|
||||
{
|
||||
// Convert it to degrees...
|
||||
auto rot = component->GetRotation();
|
||||
for (size_t i = 0; i < SHVec3::SIZE; ++i)
|
||||
rot[i] = SHMath::RadiansToDegrees(rot[i]);
|
||||
return rot;
|
||||
}, [](SHVec3 const& value) {}, false, "Rotation", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
SHEditorWidgets::DragVec3("Rotation", { "X", "Y", "Z" }, [component] {return component->GetRotation(); }, [](SHVec3 const& value) {}, false, "Rotation", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
if (rbType == SHRigidBodyComponent::Type::DYNAMIC || rbType == SHRigidBodyComponent::Type::KINEMATIC) //Dynamic or Kinematic only fields
|
||||
{
|
||||
SHEditorWidgets::DragVec3("Velocity", { "X", "Y", "Z" }, [component] {return component->GetLinearVelocity(); }, [](SHVec3 const& value) {}, false, "Linear Velocity", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
|
@ -311,7 +302,7 @@ namespace SHADE
|
|||
{
|
||||
SHEditorWidgets::DragVec3("Force", { "X", "Y", "Z" }, [component] {return component->GetForce(); }, [](SHVec3 const& value) {}, false, "Force", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
SHEditorWidgets::DragVec3("Torque", { "X", "Y", "Z" }, [component] {return component->GetTorque(); }, [](SHVec3 const& value) {}, false, "Torque", 0.1f, "%.3f", 0.0f, 0.0f, ImGuiSliderFlags_ReadOnly);
|
||||
SHEditorWidgets::CheckBox("Is Asleep", [component] {return component->IsSleeping(); }, [](bool value) {}, "If the Rigid Body is asleep");
|
||||
SHEditorWidgets::CheckBox("Is Asleep", [component] {return component->GetIsSleeping(); }, [](bool value) {}, "If the Rigid Body is asleep");
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -343,67 +334,64 @@ namespace SHADE
|
|||
{
|
||||
DrawContextMenu(component);
|
||||
|
||||
SHEditorWidgets::CheckBox("Draw Colliders", [component] { return component->GetDebugDrawState(); }, [component](bool value) { component->SetDebugDrawState(value); });
|
||||
|
||||
auto* collisionShapes = component->GetCollisionShapes();
|
||||
int const size = collisionShapes ? static_cast<int>(collisionShapes->size()) : 0;
|
||||
ImGui::BeginChild("Collision Shapes", { 0.0f, collisionShapes->empty() ? 1.0f : 250.0f }, true);
|
||||
auto& colliders = component->GetCollisionShapes();
|
||||
int const size = static_cast<int>(colliders.size());
|
||||
ImGui::BeginChild("Collision Shapes", { 0.0f, colliders.empty() ? 1.0f : 250.0f }, true);
|
||||
std::optional<int> colliderToDelete{ std::nullopt };
|
||||
for (int i{}; i < size; ++i)
|
||||
{
|
||||
ImGui::PushID(i);
|
||||
SHCollisionShape* shape = component->GetCollisionShape(i);
|
||||
SHCollisionShape* collider = &component->GetCollisionShape(i);
|
||||
auto cursorPos = ImGui::GetCursorPos();
|
||||
|
||||
//collider->IsTrigger
|
||||
if (shape->GetType() == SHCollisionShape::Type::BOX)
|
||||
|
||||
if (collider->GetType() == SHCollisionShape::Type::BOX)
|
||||
{
|
||||
SHEditorWidgets::BeginPanel(std::format("{} Box #{}", ICON_FA_CUBE, i).data(), { ImGui::GetContentRegionAvail().x, ImGui::GetContentRegionAvail().y });
|
||||
|
||||
auto* box = reinterpret_cast<SHBox*>(shape);
|
||||
const auto* BOX = reinterpret_cast<const SHBox*>(collider->GetShape());
|
||||
SHEditorWidgets::DragVec3
|
||||
(
|
||||
"Half Extents", { "X", "Y", "Z" },
|
||||
[box] { return box->GetRelativeExtents(); },
|
||||
[box](SHVec3 const& vec) { box->SetRelativeExtents(vec); });
|
||||
[BOX] { return BOX->GetRelativeExtents(); },
|
||||
[collider](SHVec3 const& vec) { collider->SetBoundingBox(vec); });
|
||||
}
|
||||
else if (shape->GetType() == SHCollisionShape::Type::SPHERE)
|
||||
else if (collider->GetType() == SHCollisionShape::Type::SPHERE)
|
||||
{
|
||||
SHEditorWidgets::BeginPanel(std::format("{} Sphere #{}", ICON_MD_CIRCLE, i).data(), { ImGui::GetContentRegionAvail().x, ImGui::GetContentRegionAvail().y });
|
||||
auto* sphere = reinterpret_cast<SHSphere*>(shape);
|
||||
const auto* SPHERE = reinterpret_cast<const SHSphere*>(collider->GetShape());
|
||||
SHEditorWidgets::DragFloat
|
||||
(
|
||||
"Radius",
|
||||
[sphere] { return sphere->GetRelativeRadius(); },
|
||||
[sphere](float const& value) { sphere->SetRelativeRadius(value); });
|
||||
[SPHERE] { return SPHERE->GetRelativeRadius(); },
|
||||
[collider](float const& value) { collider->SetBoundingSphere(value); });
|
||||
}
|
||||
else if (shape->GetType() == SHCollisionShape::Type::CAPSULE)
|
||||
else if (collider->GetType() == SHCollisionShape::Type::CAPSULE)
|
||||
{
|
||||
|
||||
}
|
||||
|
||||
{
|
||||
SHEditorWidgets::CheckBox("Is Trigger", [shape] { return shape->IsTrigger(); }, [shape](bool value) { shape->SetIsTrigger(value); });
|
||||
SHEditorWidgets::ComboBox("Tag", collisionTagNames, [shape]{return SHCollisionTagMatrix::GetTagIndex(shape->GetCollisionTag().GetName());}, [shape](int const& value){shape->SetCollisionTag(SHCollisionTagMatrix::GetTag(value));});
|
||||
|
||||
SHEditorWidgets::CheckBox("Is Trigger", [collider] { return collider->IsTrigger(); }, [collider](bool value) { collider->SetIsTrigger(value); });
|
||||
SHEditorWidgets::ComboBox("Tag", collisionTagNames, [collider]{return SHCollisionTagMatrix::GetTagIndex(collider->GetCollisionTag().GetName());}, [collider](int const& value){collider->SetCollisionTag(SHCollisionTagMatrix::GetTag(value));});
|
||||
if(ImGui::CollapsingHeader("Physics Material"))
|
||||
{
|
||||
SHEditorWidgets::DragFloat("Friction", [shape] { return shape->GetFriction(); }, [shape](float value) { shape->SetFriction(value); }, "Friction", 0.05f, 0.0f, 1.0f);
|
||||
SHEditorWidgets::DragFloat("Bounciness", [shape] { return shape->GetBounciness(); }, [shape](float value) { shape->SetBounciness(value); }, "Bounciness", 0.05f, 0.0f, 1.0f);
|
||||
SHEditorWidgets::DragFloat("Mass Density", [shape] { return shape->GetDensity(); }, [shape](float value) { shape->SetDensity(value); }, "Mass Density", 0.1f, 0.0f);
|
||||
SHEditorWidgets::DragFloat("Friction", [collider] { return collider->GetFriction(); }, [collider](float value) { collider->SetFriction(value); }, "Friction", 0.05f, 0.0f, 1.0f);
|
||||
SHEditorWidgets::DragFloat("Bounciness", [collider] { return collider->GetBounciness(); }, [collider](float value) { collider->SetBounciness(value); }, "Bounciness", 0.05f, 0.0f, 1.0f);
|
||||
SHEditorWidgets::DragFloat("Mass Density", [collider] { return collider->GetDensity(); }, [collider](float value) { collider->SetDensity(value); }, "Mass Density", 0.1f, 0.0f);
|
||||
}
|
||||
|
||||
SHEditorWidgets::BeginPanel("Offsets",{ ImGui::GetContentRegionAvail().x, 30.0f });
|
||||
SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [&shape] {return shape->GetPositionOffset(); }, [&shape](SHVec3 const& vec) {shape->SetPositionOffset(vec); });
|
||||
SHEditorWidgets::DragVec3("Position", { "X", "Y", "Z" }, [&collider] {return collider->GetPositionOffset(); }, [&collider](SHVec3 const& vec) {collider->SetPositionOffset(vec); });
|
||||
SHEditorWidgets::DragVec3("Rotation", { "X", "Y", "Z" },
|
||||
[&shape]
|
||||
[&collider]
|
||||
{
|
||||
auto offset = shape->GetRotationOffset();
|
||||
auto offset = collider->GetRotationOffset();
|
||||
return offset;
|
||||
},
|
||||
[&shape](SHVec3 const& vec)
|
||||
[&collider](SHVec3 const& vec)
|
||||
{
|
||||
shape->SetRotationOffset(vec);
|
||||
collider->SetRotationOffset(vec);
|
||||
}, true);
|
||||
SHEditorWidgets::EndPanel();
|
||||
}
|
||||
|
@ -418,24 +406,21 @@ namespace SHADE
|
|||
}
|
||||
if (colliderToDelete.has_value())
|
||||
{
|
||||
component->GetCollider()->RemoveCollisionShape(colliderToDelete.value());
|
||||
component->RemoveCollider(colliderToDelete.value());
|
||||
}
|
||||
ImGui::EndChild();
|
||||
|
||||
// TODO: Handle differences between composite & hull collider
|
||||
if (ImGui::BeginMenu("Add Collider"))
|
||||
{
|
||||
int newColl = -1;
|
||||
|
||||
if (ImGui::Selectable("Box Collider"))
|
||||
{
|
||||
auto* compositeCollider = dynamic_cast<SHCompositeCollider* const>(component->GetCollider());
|
||||
compositeCollider->AddBoxCollisionShape(SHVec3::One);
|
||||
newColl = component->AddBoundingBox();
|
||||
}
|
||||
if (ImGui::Selectable("Sphere Collider"))
|
||||
{
|
||||
auto* compositeCollider = dynamic_cast<SHCompositeCollider* const>(component->GetCollider());
|
||||
compositeCollider->AddSphereCollisionShape(1.0f);
|
||||
newColl = component->AddBoundingSphere();
|
||||
}
|
||||
|
||||
//No idea why this doesn't work
|
||||
|
|
|
@ -25,7 +25,6 @@
|
|||
#include "Serialization/SHSerialization.h"
|
||||
#include "Serialization/Configurations/SHConfigurationManager.h"
|
||||
#include "Editor/EditorWindow/SHEditorWindowManager.h"
|
||||
#include "Physics/System/SHPhysicsDebugDrawSystem.h"
|
||||
|
||||
const std::string LAYOUT_FOLDER_PATH{ std::string(ASSET_ROOT) + "/Editor/Layouts" };
|
||||
|
||||
|
@ -89,7 +88,6 @@ namespace SHADE
|
|||
DrawThemeMenu();
|
||||
DrawLayoutMenu();
|
||||
DrawApplicationConfig();
|
||||
DrawPhysicsSettings();
|
||||
|
||||
std::string const sceneName{std::format("Current Scene: {}",SHSceneManager::GetSceneName().data())};
|
||||
auto const size = ImGui::CalcTextSize(sceneName.data());
|
||||
|
@ -306,32 +304,4 @@ namespace SHADE
|
|||
ImGui::EndMenu();
|
||||
}
|
||||
}
|
||||
|
||||
void SHEditorMenuBar::DrawPhysicsSettings() noexcept
|
||||
{
|
||||
if (ImGui::BeginMenu("Physics Settings"))
|
||||
{
|
||||
if (auto* physicsDebugDraw = SHSystemManager::GetSystem<SHPhysicsDebugDrawSystem>())
|
||||
{
|
||||
bool drawColliders = physicsDebugDraw->GetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::COLLIDERS);
|
||||
if (ImGui::Checkbox("Draw Colliders", &drawColliders))
|
||||
physicsDebugDraw->SetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::COLLIDERS, drawColliders);
|
||||
|
||||
bool drawContactPoints = physicsDebugDraw->GetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::CONTACTS);
|
||||
if (ImGui::Checkbox("Draw Contact Points", &drawContactPoints))
|
||||
physicsDebugDraw->SetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::CONTACTS, drawContactPoints);
|
||||
|
||||
bool drawRays = physicsDebugDraw->GetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::RAYCASTS);
|
||||
if (ImGui::Checkbox("Draw Rays", &drawRays))
|
||||
physicsDebugDraw->SetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::RAYCASTS, drawRays);
|
||||
|
||||
bool drawBroadphase = physicsDebugDraw->GetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::BROADPHASE);
|
||||
if (ImGui::Checkbox("Draw Broadphase", &drawBroadphase))
|
||||
physicsDebugDraw->SetFlagState(SHPhysicsDebugDrawSystem::DebugDrawFlags::BROADPHASE, drawBroadphase);
|
||||
}
|
||||
|
||||
ImGui::EndMenu();
|
||||
}
|
||||
}
|
||||
|
||||
}//namespace SHADE
|
||||
|
|
|
@ -25,7 +25,6 @@ namespace SHADE
|
|||
void DrawThemeMenu() noexcept;
|
||||
void DrawLayoutMenu() noexcept;
|
||||
void DrawApplicationConfig() noexcept;
|
||||
void DrawPhysicsSettings() noexcept;
|
||||
|
||||
float menuBarHeight = 20.0f;
|
||||
std::vector<std::filesystem::path> layoutPaths;
|
||||
|
|
|
@ -24,6 +24,4 @@ constexpr SHEventIdentifier SH_SCENE_EXIT_PRE { 15 };
|
|||
constexpr SHEventIdentifier SH_SCENE_EXIT_POST { 16 };
|
||||
constexpr SHEventIdentifier SH_GRAPHICS_LIGHT_ENABLE_SHADOW_EVENT { 17 };
|
||||
constexpr SHEventIdentifier SH_BUTTON_CLICK_EVENT { 18 };
|
||||
constexpr SHEventIdentifier SH_PHYSICS_COLLIDER_DRAW_EVENT { 19 };
|
||||
|
||||
|
||||
|
|
|
@ -1,173 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHAABB.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a 3-Dimensional Axis Aligned Bounding Box
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <DirectXCollision.h>
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHRay.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a 3D Axis-Aligned Bounding Box.
|
||||
*/
|
||||
class SH_API SHAABB : private DirectX::BoundingBox
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr size_t NUM_VERTICES = 8;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
~SHAABB () noexcept = default;
|
||||
|
||||
SHAABB () noexcept;
|
||||
SHAABB (const SHVec3& center, const SHVec3& halfExtents) noexcept;
|
||||
SHAABB (const SHAABB& rhs) noexcept;
|
||||
SHAABB (SHAABB&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABB& operator= (const SHAABB& rhs) noexcept;
|
||||
SHAABB& operator= (SHAABB&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] SHVec3 GetCenter () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetExtents () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetMin () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetMax () const noexcept;
|
||||
[[nodiscard]] std::vector<SHVec3> GetVertices () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCenter (const SHVec3& newCenter) noexcept;
|
||||
void SetExtents (const SHVec3& newHalfExtents) noexcept;
|
||||
void SetMin (const SHVec3& min) noexcept;
|
||||
void SetMax (const SHVec3& max) noexcept;
|
||||
void SetMinMax (const SHVec3& min, const SHVec3& max) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Checks if a point is inside the aabb.
|
||||
* @param point
|
||||
* The point to check.
|
||||
* @return
|
||||
* True if the point is inside the aabb.
|
||||
*/
|
||||
[[nodiscard]] bool TestPoint (const SHVec3& point) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Casts a ray against the aabb.
|
||||
* @param ray
|
||||
* The ray to cast.
|
||||
* @return
|
||||
* The result of the raycast. <br/>
|
||||
* See the corresponding header for the contents of the raycast result object.
|
||||
*/
|
||||
[[nodiscard]] SHRaycastResult Raycast (const SHRay& ray) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Checks if an entire other aabb is contained by this aabb.
|
||||
* @param rhs
|
||||
* The aabb to check.
|
||||
* @return
|
||||
* True if the other sphere is completely contained by this aabb.
|
||||
*/
|
||||
[[nodiscard]] bool Contains (const SHAABB& rhs) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Calculates the volume of the aabb.
|
||||
*/
|
||||
[[nodiscard]] float Volume () const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Calculates the surface area of the aabb.
|
||||
*/
|
||||
[[nodiscard]] float SurfaceArea () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Combines two aabbs to form a larger aabb.
|
||||
* If one aabb is completely contained by the other, the result is the larger aabb.
|
||||
* @return
|
||||
* The combined aabb.
|
||||
*/
|
||||
[[nodiscard]] static SHAABB Combine (const SHAABB& lhs, const SHAABB& rhs) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Checks if two aabbs are intersecting.
|
||||
* @return
|
||||
* True if they are intersecting.
|
||||
*/
|
||||
[[nodiscard]] static bool Intersect (const SHAABB& lhs, const SHAABB& rhs) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Builds a single aabb from multiple aabbs.
|
||||
* @param spheres
|
||||
* The set of aabbs to build from.
|
||||
* @param numSpheres
|
||||
* The number of aabbs in the set to build from.
|
||||
* @return
|
||||
* An aabb that contains all the spheres in the set.
|
||||
*/
|
||||
[[nodiscard]] static SHAABB BuildFromBoxes (const SHAABB* boxes, size_t numBoxes) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Builds a aabb from a set of vertices.
|
||||
* @param vertices
|
||||
* The vertices to build a aabb from.
|
||||
* @param numVertices
|
||||
* The number of vertices in the set to build from.
|
||||
* @param stride
|
||||
* The stride between each vertex, in the instance there is data in between each
|
||||
* vertex that does not define the geometry of the object.
|
||||
* @return
|
||||
* An aabb that contains all the vertices in the set.
|
||||
*/
|
||||
[[nodiscard]] static SHAABB BuildFromVertices (const SHVec3* vertices, size_t numVertices, size_t stride = 0) noexcept;
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
||||
|
|
@ -1,5 +1,5 @@
|
|||
/****************************************************************************************
|
||||
* \file SHAABB.cpp
|
||||
* \file SHBox.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a 3-Dimensional Axis Aligned Bounding Box
|
||||
*
|
||||
|
@ -11,7 +11,7 @@
|
|||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHAABB.h"
|
||||
#include "SHBox.h"
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Math/SHRay.h"
|
||||
|
@ -24,52 +24,75 @@ namespace SHADE
|
|||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABB::SHAABB() noexcept
|
||||
SHBox::SHBox() noexcept
|
||||
: RelativeExtents { SHVec3::One }
|
||||
{
|
||||
Extents = SHVec3::One * 0.5f;
|
||||
type = Type::BOX;
|
||||
}
|
||||
|
||||
SHAABB::SHAABB(const SHVec3& c, const SHVec3& hE) noexcept
|
||||
SHBox::SHBox(const SHVec3& c, const SHVec3& hE) noexcept
|
||||
: RelativeExtents { SHVec3::One }
|
||||
{
|
||||
Center = c;
|
||||
type = Type::BOX;
|
||||
|
||||
Center = c;
|
||||
Extents = hE;
|
||||
}
|
||||
|
||||
|
||||
SHAABB::SHAABB(const SHAABB& rhs) noexcept
|
||||
SHBox::SHBox(const SHBox& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return;
|
||||
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
type = Type::BOX;
|
||||
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
RelativeExtents = rhs.RelativeExtents;
|
||||
}
|
||||
|
||||
SHAABB::SHAABB(SHAABB&& rhs) noexcept
|
||||
SHBox::SHBox(SHBox&& rhs) noexcept
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
type = Type::BOX;
|
||||
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
RelativeExtents = rhs.RelativeExtents;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABB& SHAABB::operator=(const SHAABB& rhs) noexcept
|
||||
SHBox& SHBox::operator=(const SHBox& rhs) noexcept
|
||||
{
|
||||
if (this != &rhs)
|
||||
if (rhs.type != Type::BOX)
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
SHLOG_WARNING("Cannot assign a non-bounding box to a bounding box!")
|
||||
}
|
||||
else if (this != &rhs)
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
RelativeExtents = rhs.RelativeExtents;
|
||||
}
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHAABB& SHAABB::operator=(SHAABB&& rhs) noexcept
|
||||
SHBox& SHBox::operator=(SHBox&& rhs) noexcept
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
if (rhs.type != Type::BOX)
|
||||
{
|
||||
SHLOG_WARNING("Cannot assign a non-bounding box to a bounding box!")
|
||||
}
|
||||
else
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
RelativeExtents = rhs.RelativeExtents;
|
||||
}
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
@ -78,22 +101,27 @@ namespace SHADE
|
|||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 SHAABB::GetCenter() const noexcept
|
||||
SHVec3 SHBox::GetCenter() const noexcept
|
||||
{
|
||||
return Center;
|
||||
}
|
||||
|
||||
SHVec3 SHAABB::GetExtents() const noexcept
|
||||
SHVec3 SHBox::GetWorldExtents() const noexcept
|
||||
{
|
||||
return Extents;
|
||||
}
|
||||
|
||||
SHVec3 SHAABB::GetMin() const noexcept
|
||||
const SHVec3& SHBox::GetRelativeExtents() const noexcept
|
||||
{
|
||||
return RelativeExtents;
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetMin() const noexcept
|
||||
{
|
||||
return SHVec3{ Center.x - Extents.x, Center.y - Extents.y, Center.z - Extents.z };
|
||||
}
|
||||
|
||||
SHVec3 SHAABB::GetMax() const noexcept
|
||||
SHVec3 SHBox::GetMax() const noexcept
|
||||
{
|
||||
return SHVec3{ Center.x + Extents.x, Center.y + Extents.y, Center.z + Extents.z };
|
||||
}
|
||||
|
@ -102,17 +130,22 @@ namespace SHADE
|
|||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHAABB::SetCenter(const SHVec3& newCenter) noexcept
|
||||
void SHBox::SetCenter(const SHVec3& newCenter) noexcept
|
||||
{
|
||||
Center = newCenter;
|
||||
}
|
||||
|
||||
void SHAABB::SetExtents(const SHVec3& newHalfExtents) noexcept
|
||||
void SHBox::SetWorldExtents(const SHVec3& newWorldExtents) noexcept
|
||||
{
|
||||
Extents = newHalfExtents;
|
||||
Extents = newWorldExtents;
|
||||
}
|
||||
|
||||
void SHAABB::SetMin(const SHVec3& min) noexcept
|
||||
void SHBox::SetRelativeExtents(const SHVec3& newRelativeExtents) noexcept
|
||||
{
|
||||
RelativeExtents = newRelativeExtents;
|
||||
}
|
||||
|
||||
void SHBox::SetMin(const SHVec3& min) noexcept
|
||||
{
|
||||
const SHVec3 MAX = GetMax();
|
||||
|
||||
|
@ -120,7 +153,7 @@ namespace SHADE
|
|||
Extents = SHVec3::Abs((MAX - min) * 0.5f);
|
||||
}
|
||||
|
||||
void SHAABB::SetMax(const SHVec3& max) noexcept
|
||||
void SHBox::SetMax(const SHVec3& max) noexcept
|
||||
{
|
||||
const SHVec3 MIN = GetMin();
|
||||
|
||||
|
@ -128,13 +161,13 @@ namespace SHADE
|
|||
Extents = SHVec3::Abs((max - MIN) * 0.5f);
|
||||
}
|
||||
|
||||
void SHAABB::SetMinMax(const SHVec3& min, const SHVec3& max) noexcept
|
||||
void SHBox::SetMinMax(const SHVec3& min, const SHVec3& max) noexcept
|
||||
{
|
||||
Center = SHVec3::Lerp(min, max, 0.5f);
|
||||
Extents = SHVec3::Abs((max - min) * 0.5f);
|
||||
}
|
||||
|
||||
std::vector<SHVec3> SHAABB::GetVertices() const noexcept
|
||||
std::vector<SHVec3> SHBox::GetVertices() const noexcept
|
||||
{
|
||||
std::vector<SHVec3> vertices{ 8 };
|
||||
GetCorners(vertices.data());
|
||||
|
@ -145,12 +178,12 @@ namespace SHADE
|
|||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHAABB::TestPoint(const SHVec3& point) const noexcept
|
||||
bool SHBox::TestPoint(const SHVec3& point) const noexcept
|
||||
{
|
||||
return BoundingBox::Contains(point);
|
||||
}
|
||||
|
||||
SHRaycastResult SHAABB::Raycast(const SHRay& ray) const noexcept
|
||||
SHRaycastResult SHBox::Raycast(const SHRay& ray) const noexcept
|
||||
{
|
||||
SHRaycastResult result;
|
||||
|
||||
|
@ -159,24 +192,22 @@ namespace SHADE
|
|||
{
|
||||
result.position = ray.position + ray.direction * result.distance;
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
|
||||
// TODO: Compute normal
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
bool SHAABB::Contains(const SHAABB& rhs) const noexcept
|
||||
bool SHBox::Contains(const SHBox& rhs) const noexcept
|
||||
{
|
||||
return BoundingBox::Contains(rhs) == CONTAINS;
|
||||
return BoundingBox::Contains(rhs);
|
||||
}
|
||||
|
||||
float SHAABB::Volume() const noexcept
|
||||
float SHBox::Volume() const noexcept
|
||||
{
|
||||
return 8.0f * (Extents.x * Extents.y * Extents.z);
|
||||
}
|
||||
|
||||
float SHAABB::SurfaceArea() const noexcept
|
||||
float SHBox::SurfaceArea() const noexcept
|
||||
{
|
||||
return 8.0f * ((Extents.x * Extents.y)
|
||||
+ (Extents.x * Extents.z)
|
||||
|
@ -187,21 +218,21 @@ namespace SHADE
|
|||
/* Static Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABB SHAABB::Combine(const SHAABB& lhs, const SHAABB& rhs) noexcept
|
||||
SHBox SHBox::Combine(const SHBox& lhs, const SHBox& rhs) noexcept
|
||||
{
|
||||
SHAABB result;
|
||||
SHBox result;
|
||||
CreateMerged(result, lhs, rhs);
|
||||
return result;
|
||||
}
|
||||
|
||||
bool SHAABB::Intersect(const SHAABB& lhs, const SHAABB& rhs) noexcept
|
||||
bool SHBox::Intersect(const SHBox& lhs, const SHBox& rhs) noexcept
|
||||
{
|
||||
return lhs.Intersects(rhs);
|
||||
}
|
||||
|
||||
SHAABB SHAABB::BuildFromBoxes(const SHAABB* boxes, size_t numBoxes) noexcept
|
||||
SHBox SHBox::BuildFromBoxes(const SHBox* boxes, size_t numBoxes) noexcept
|
||||
{
|
||||
SHAABB result;
|
||||
SHBox result;
|
||||
|
||||
for (size_t i = 1; i < numBoxes; ++i)
|
||||
CreateMerged(result, boxes[i - 1], boxes[i]);
|
||||
|
@ -209,9 +240,9 @@ namespace SHADE
|
|||
return result;
|
||||
}
|
||||
|
||||
SHAABB SHAABB::BuildFromVertices(const SHVec3* vertices, size_t numVertices, size_t stride) noexcept
|
||||
SHBox SHBox::BuildFromVertices(const SHVec3* vertices, size_t numVertices, size_t stride) noexcept
|
||||
{
|
||||
SHAABB result;
|
||||
SHBox result;
|
||||
CreateFromPoints(result, numVertices, vertices, stride);
|
||||
return result;
|
||||
}
|
|
@ -0,0 +1,105 @@
|
|||
/****************************************************************************************
|
||||
* \file SHBox.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a 3-Dimensional Axis Aligned Bounding Box
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <DirectXCollision.h>
|
||||
|
||||
// Project Headers
|
||||
#include "SHShape.h"
|
||||
#include "SH_API.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SH_API SHBox : public SHShape,
|
||||
private DirectX::BoundingBox
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr size_t NUM_VERTICES = 8;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
~SHBox () override = default;
|
||||
|
||||
SHBox () noexcept;
|
||||
SHBox (const SHVec3& center, const SHVec3& halfExtents) noexcept;
|
||||
SHBox (const SHBox& rhs) noexcept;
|
||||
SHBox (SHBox&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHBox& operator= (const SHBox& rhs) noexcept;
|
||||
SHBox& operator= (SHBox&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] SHVec3 GetCenter () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetWorldExtents () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetRelativeExtents () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetMin () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetMax () const noexcept;
|
||||
[[nodiscard]] std::vector<SHVec3> GetVertices () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCenter (const SHVec3& newCenter) noexcept;
|
||||
void SetWorldExtents (const SHVec3& newWorldExtents) noexcept;
|
||||
void SetRelativeExtents (const SHVec3& newRelativeExtents) noexcept;
|
||||
void SetMin (const SHVec3& min) noexcept;
|
||||
void SetMax (const SHVec3& max) noexcept;
|
||||
void SetMinMax (const SHVec3& min, const SHVec3& max) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] bool TestPoint (const SHVec3& point) const noexcept override;
|
||||
[[nodiscard]] SHRaycastResult Raycast(const SHRay& ray) const noexcept override;
|
||||
|
||||
[[nodiscard]] bool Contains (const SHBox& rhs) const noexcept;
|
||||
[[nodiscard]] float Volume () const noexcept;
|
||||
[[nodiscard]] float SurfaceArea () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] static SHBox Combine (const SHBox& lhs, const SHBox& rhs) noexcept;
|
||||
[[nodiscard]] static bool Intersect (const SHBox& lhs, const SHBox& rhs) noexcept;
|
||||
[[nodiscard]] static SHBox BuildFromBoxes (const SHBox* boxes, size_t numBoxes) noexcept;
|
||||
[[nodiscard]] static SHBox BuildFromVertices (const SHVec3* vertices, size_t numVertices, size_t stride = 0) noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 RelativeExtents;
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
||||
|
|
@ -1,141 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPlane.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a plane.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
#include <DirectXMath.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHPlane.h"
|
||||
|
||||
#include "Input/SHInputManager.h"
|
||||
#include "Math/SHMathHelpers.h"
|
||||
|
||||
using namespace DirectX;
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPlane::SHPlane() noexcept
|
||||
: planeEquation { SHVec3::One }
|
||||
{
|
||||
planeEquation.w = 0.0f;
|
||||
}
|
||||
|
||||
SHPlane::SHPlane(const SHVec3& point, const SHVec3& normal) noexcept
|
||||
{
|
||||
XMStoreFloat4(&planeEquation, XMPlaneFromPointNormal(point, normal));
|
||||
}
|
||||
|
||||
SHPlane::SHPlane(float a, float b, float c, float d) noexcept
|
||||
: planeEquation { a, b, c, d }
|
||||
{}
|
||||
|
||||
SHPlane::SHPlane(const SHVec3& normal, float distance) noexcept
|
||||
: planeEquation { normal }
|
||||
{
|
||||
planeEquation.w = distance;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHPlane::operator==(const SHPlane& rhs) const noexcept
|
||||
{
|
||||
return XMPlaneEqual(planeEquation, rhs.planeEquation);
|
||||
}
|
||||
|
||||
bool SHPlane::operator!=(const SHPlane& rhs) const noexcept
|
||||
{
|
||||
return XMPlaneNotEqual(planeEquation, rhs.planeEquation);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 SHPlane::GetNormal() const noexcept
|
||||
{
|
||||
return SHVec3{ planeEquation.x, planeEquation.y, planeEquation.z };
|
||||
}
|
||||
|
||||
float SHPlane::GetDistance() const noexcept
|
||||
{
|
||||
return planeEquation.w;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPlane::SetNormal(const SHVec3& normal) noexcept
|
||||
{
|
||||
planeEquation.x = normal.x;
|
||||
planeEquation.y = normal.y;
|
||||
planeEquation.z = normal.z;
|
||||
}
|
||||
|
||||
void SHPlane::SetDistance(float distance) noexcept
|
||||
{
|
||||
planeEquation.w = distance;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHPlane::TestPoint(const SHVec3& point) const noexcept
|
||||
{
|
||||
const float DISTANCE = SignedDistance(point);
|
||||
return SHMath::CompareFloat(DISTANCE, 0.0f);
|
||||
}
|
||||
|
||||
SHRaycastResult SHPlane::Raycast(const SHRay& ray) const noexcept
|
||||
{
|
||||
SHRaycastResult result;
|
||||
|
||||
const SHVec3 N = GetNormal();
|
||||
|
||||
// Check if ray is parallel to plane
|
||||
const float N_DOT_D = N.Dot(ray.direction);
|
||||
if (SHMath::CompareFloat(N_DOT_D, 0.0f))
|
||||
{
|
||||
result.hit = false;
|
||||
return result;
|
||||
}
|
||||
|
||||
const float DIST = (planeEquation.w - N.Dot(ray.position)) / N_DOT_D;
|
||||
if (DIST < 0.0f || !SHMath::CompareFloat(DIST, 0.0f))
|
||||
{
|
||||
result.hit = false;
|
||||
return result;
|
||||
}
|
||||
|
||||
result.hit = true;
|
||||
result.distance = DIST;
|
||||
result.position = ray.position + ray.direction * DIST;
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
|
||||
// The normal is either the plane's normal or the reverse if the ray came from below
|
||||
result.normal = N_DOT_D < 0.0f ? -N : N;
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
float SHPlane::SignedDistance(const SHVec3& point) const noexcept
|
||||
{
|
||||
return XMVectorGetX(XMPlaneDotCoord(planeEquation, point));
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,121 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPlane.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a plane.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHRay.h"
|
||||
#include "Math/Vector/SHVec4.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a 3D plane in point-normal form.
|
||||
*/
|
||||
class SH_API SHPlane
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
~SHPlane () noexcept = default;
|
||||
SHPlane (const SHPlane& rhs) noexcept = default;
|
||||
SHPlane (SHPlane&& rhs) noexcept = default;
|
||||
|
||||
SHPlane () noexcept;
|
||||
SHPlane (const SHVec3& point, const SHVec3& normal) noexcept;
|
||||
SHPlane (float a, float b, float c, float d) noexcept;
|
||||
SHPlane (const SHVec3& normal, float distance) noexcept;
|
||||
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHPlane& operator= (const SHPlane& rhs) noexcept = default;
|
||||
SHPlane& operator= (SHPlane&& rhs) noexcept = default;
|
||||
|
||||
bool operator== (const SHPlane& rhs) const noexcept;
|
||||
bool operator!= (const SHPlane& rhs) const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] SHVec3 GetNormal () const noexcept;
|
||||
[[nodiscard]] float GetDistance () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetNormal (const SHVec3& normal) noexcept;
|
||||
void SetDistance (float distance) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Checks if a point is on the plane.
|
||||
* @param point
|
||||
* The point to check.
|
||||
* @return
|
||||
* True if the point is on the plane.
|
||||
*/
|
||||
[[nodiscard]] bool TestPoint (const SHVec3& point) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Casts a ray against the plane.
|
||||
* @param ray
|
||||
* The ray to cast.
|
||||
* @return
|
||||
* The result of the raycast. <br/>
|
||||
* See the corresponding header for the contents of the raycast result object.
|
||||
*/
|
||||
[[nodiscard]] SHRaycastResult Raycast (const SHRay& ray) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Gets the signed distance from a point to the plane.
|
||||
* @param point
|
||||
* The point to check.
|
||||
* @return
|
||||
* The signed distance of the point to a plane. <br/>
|
||||
* If the signed distance is negative, the point is behind the plane. <br/>
|
||||
* If the signed distance is zero, the point is on the plane. <br/>
|
||||
* If the signed distance is positive, the point is in front of the plane. <br/>
|
||||
*/
|
||||
[[nodiscard]] float SignedDistance (const SHVec3& point) const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/*
|
||||
* TODO:
|
||||
* Transform plane
|
||||
* Intersection Tests
|
||||
*/
|
||||
|
||||
private:
|
||||
|
||||
SHVec4 planeEquation;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,7 +1,7 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCapsuleVsCapsule.cpp
|
||||
* \file SHShape.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between two capsules
|
||||
* \brief Implementation for a shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
|
@ -11,25 +11,25 @@
|
|||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "SHShape.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::CapsuleVsCapsule(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return false;
|
||||
}
|
||||
SHShape::SHShape()
|
||||
: type { Type::NONE }
|
||||
{}
|
||||
|
||||
bool SHCollision::CapsuleVsCapsule(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHShape::Type SHShape::GetType() const noexcept
|
||||
{
|
||||
return false;
|
||||
return type;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,8 +1,7 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactSolver.h
|
||||
* \file SHShape.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Contact Solver that builds contacct constraints and solves
|
||||
* them.
|
||||
* \brief Interface for a shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
|
@ -12,8 +11,9 @@
|
|||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Constraints/SHContactConstraint.h"
|
||||
#include "Constraints/SHVelocityState.h"
|
||||
#include "SH_API.h"
|
||||
#include "Math/SHRay.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
|
@ -21,73 +21,62 @@ namespace SHADE
|
|||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates an object that builds contact constraints and solves them.
|
||||
*/
|
||||
class SH_API SHContactSolver
|
||||
class SH_API SHShape
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
using VelocityStates = std::unordered_map<EntityID, SHVelocityState>;
|
||||
using ContactConstraints = std::unordered_map<SHCollisionKey, SHContactConstraint, SHCollisionKeyHash>;
|
||||
enum class Type
|
||||
{
|
||||
BOX
|
||||
, SPHERE
|
||||
, CAPSULE
|
||||
, CONVEX_HULL
|
||||
|
||||
, COUNT
|
||||
, NONE = -1
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
bool isIntersecting;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHContactSolver () noexcept = default;
|
||||
~SHContactSolver () noexcept = default;
|
||||
virtual ~SHShape () = default;
|
||||
|
||||
SHShape (const SHShape&) = default;
|
||||
SHShape (SHShape&&) = default;
|
||||
|
||||
SHShape& operator=(const SHShape&) = default;
|
||||
SHShape& operator=(SHShape&&) = default;
|
||||
|
||||
SHShape();
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] const VelocityStates& GetVelocities () const noexcept;
|
||||
[[nodiscard]] const ContactConstraints& GetContantConstraints () const noexcept;
|
||||
[[nodiscard]] Type GetType () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Build a contact constraint from a new manifold.
|
||||
* @param manifold
|
||||
* A manifold to build a contact constraint from.
|
||||
*/
|
||||
void AddContact (const SHCollisionKey& key, const SHManifold& manifold) noexcept;
|
||||
[[nodiscard]] virtual bool TestPoint (const SHVec3& point) const noexcept = 0;
|
||||
[[nodiscard]] virtual SHRaycastResult Raycast (const SHRay& ray) const noexcept = 0;
|
||||
|
||||
void Reset () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Solves all the contact constraints.
|
||||
* @param numIterations
|
||||
* The number of times to iterate over constraints when solving them.
|
||||
* @param dt
|
||||
* The delta time of the simulation step.
|
||||
*/
|
||||
void SolveContacts (int numIterations, float dt) noexcept;
|
||||
|
||||
private:
|
||||
protected:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
VelocityStates velocityStates;
|
||||
ContactConstraints contactConstraints;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void preSolve (float dt) noexcept;
|
||||
void solve () noexcept;
|
||||
|
||||
Type type;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -0,0 +1,208 @@
|
|||
/****************************************************************************************
|
||||
* \file SHBoundingSphere.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Bounding Sphere
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHSphere.h"
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Math/SHRay.h"
|
||||
|
||||
using namespace DirectX;
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere::SHSphere() noexcept
|
||||
: RelativeRadius { 1.0f }
|
||||
{
|
||||
type = Type::SPHERE;
|
||||
}
|
||||
|
||||
SHSphere::SHSphere(const SHVec3& center, float radius) noexcept
|
||||
: RelativeRadius { 1.0f }
|
||||
{
|
||||
type = Type::SPHERE;
|
||||
|
||||
Center = center;
|
||||
Radius = radius;
|
||||
}
|
||||
|
||||
SHSphere::SHSphere(const SHSphere& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return;
|
||||
|
||||
type = Type::SPHERE;
|
||||
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
RelativeRadius = rhs.RelativeRadius;
|
||||
}
|
||||
|
||||
SHSphere::SHSphere(SHSphere&& rhs) noexcept
|
||||
{
|
||||
type = Type::SPHERE;
|
||||
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
RelativeRadius = rhs.RelativeRadius;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere& SHSphere::operator=(const SHSphere& rhs) noexcept
|
||||
{
|
||||
if (rhs.type != Type::SPHERE)
|
||||
{
|
||||
SHLOG_WARNING("Cannot assign a non-sphere to a sphere!")
|
||||
}
|
||||
else if (this != &rhs)
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
RelativeRadius = rhs.RelativeRadius;
|
||||
}
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHSphere& SHSphere::operator=(SHSphere&& rhs) noexcept
|
||||
{
|
||||
if (rhs.type != Type::SPHERE)
|
||||
{
|
||||
SHLOG_WARNING("Cannot assign a non-sphere to a sphere!")
|
||||
}
|
||||
else
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
RelativeRadius = rhs.RelativeRadius;
|
||||
}
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 SHSphere::GetCenter() const noexcept
|
||||
{
|
||||
return Center;
|
||||
}
|
||||
|
||||
float SHSphere::GetWorldRadius() const noexcept
|
||||
{
|
||||
return Radius;
|
||||
}
|
||||
|
||||
float SHSphere::GetRelativeRadius() const noexcept
|
||||
{
|
||||
return RelativeRadius;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHSphere::SetCenter(const SHVec3& center) noexcept
|
||||
{
|
||||
Center = center;
|
||||
}
|
||||
|
||||
void SHSphere::SetWorldRadius(float newWorldRadius) noexcept
|
||||
{
|
||||
Radius = newWorldRadius;
|
||||
}
|
||||
|
||||
void SHSphere::SetRelativeRadius(float newRelativeRadius) noexcept
|
||||
{
|
||||
RelativeRadius = newRelativeRadius;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHSphere::TestPoint(const SHVec3& point) const noexcept
|
||||
{
|
||||
return BoundingSphere::Contains(point);
|
||||
}
|
||||
|
||||
SHRaycastResult SHSphere::Raycast(const SHRay& ray) const noexcept
|
||||
{
|
||||
SHRaycastResult result;
|
||||
|
||||
result.hit = Intersects(ray.position, ray.direction, result.distance);
|
||||
if (result.hit)
|
||||
{
|
||||
result.position = ray.position + ray.direction * result.distance;
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
bool SHSphere::Contains(const SHSphere& rhs) const noexcept
|
||||
{
|
||||
return BoundingSphere::Contains(rhs);
|
||||
}
|
||||
|
||||
float SHSphere::Volume() const noexcept
|
||||
{
|
||||
return (4.0f / 3.0f) * SHMath::PI * (Radius * Radius * Radius);
|
||||
}
|
||||
|
||||
float SHSphere::SurfaceArea() const noexcept
|
||||
{
|
||||
return 4.0f * SHMath::PI * (Radius * Radius);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Static Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere SHSphere::Combine(const SHSphere& lhs, const SHSphere& rhs) noexcept
|
||||
{
|
||||
SHSphere result;
|
||||
CreateMerged(result, lhs, rhs);
|
||||
return result;
|
||||
}
|
||||
|
||||
bool SHSphere::Intersect(const SHSphere& lhs, const SHSphere& rhs) noexcept
|
||||
{
|
||||
return lhs.Intersects(rhs);
|
||||
}
|
||||
|
||||
SHSphere SHSphere::BuildFromSpheres(const SHSphere* spheres, size_t numSpheres) noexcept
|
||||
{
|
||||
SHSphere result;
|
||||
|
||||
for (size_t i = 1; i < numSpheres; ++i)
|
||||
CreateMerged(result, spheres[i - 1], spheres[i]);
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
SHSphere SHSphere::BuildFromVertices(const SHVec3* vertices, size_t numVertices, size_t stride) noexcept
|
||||
{
|
||||
SHSphere result;
|
||||
CreateFromPoints(result, numVertices, vertices, stride);
|
||||
return result;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,7 +1,7 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSphereCollisionShape.h
|
||||
* \file SHBoundingSphere.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Sphere Collision Shape.
|
||||
* \brief Interface for a Bounding Sphere.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
|
@ -13,7 +13,8 @@
|
|||
#include <DirectXCollision.h>
|
||||
|
||||
// Project Headers
|
||||
#include "SHCollisionShape.h"
|
||||
#include "SHShape.h"
|
||||
#include "SH_API.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
|
@ -21,44 +22,18 @@ namespace SHADE
|
|||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the information to create a sphere.
|
||||
*/
|
||||
struct SHSphereCreateInfo
|
||||
class SH_API SHSphere : public SHShape,
|
||||
private DirectX::BoundingSphere
|
||||
{
|
||||
public:
|
||||
SHVec3 Center = SHVec3::Zero;
|
||||
float Radius = 1.0f;
|
||||
float RelativeRadius = 1.0f;
|
||||
float Scale = 1.0f;
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulate a Sphere Shape used for Physics Simulations.
|
||||
*/
|
||||
class SH_API SHSphere final : public SHCollisionShape
|
||||
, private DirectX::BoundingSphere
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollider;
|
||||
friend class SHCompositeCollider;
|
||||
friend class SHCollision;
|
||||
friend class SHCollisionShapeLibrary;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere (SHCollisionShapeID id) noexcept;
|
||||
SHSphere (const SHSphere& rhs) noexcept;
|
||||
SHSphere (SHSphere&& rhs) noexcept;
|
||||
SHSphere () noexcept;
|
||||
SHSphere (const SHVec3& center, float radius) noexcept;
|
||||
SHSphere (const SHSphere& rhs) noexcept;
|
||||
SHSphere (SHSphere&& rhs) noexcept;
|
||||
|
||||
~SHSphere () override = default;
|
||||
|
||||
|
@ -73,43 +48,45 @@ namespace SHADE
|
|||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] float GetWorldRadius () const noexcept;
|
||||
[[nodiscard]] float GetRelativeRadius () const noexcept;
|
||||
|
||||
[[nodiscard]] SHVec3 GetWorldCentroid () const noexcept override;
|
||||
[[nodiscard]] SHVec3 GetRelativeCentroid () const noexcept override;
|
||||
[[nodiscard]] SHVec3 GetLocalCentroid () const noexcept override;
|
||||
[[nodiscard]] SHQuaternion GetWorldOrientation () const noexcept override;
|
||||
[[nodiscard]] SHQuaternion GetRelativeOrientation () const noexcept override;
|
||||
[[nodiscard]] float GetVolume () const noexcept override;
|
||||
[[nodiscard]] float GetSurfaceArea () const noexcept override;
|
||||
[[nodiscard]] SHMatrix GetInertiaTensor (float mass) const noexcept override;
|
||||
[[nodiscard]] SHVec3 GetCenter () const noexcept;
|
||||
[[nodiscard]] float GetWorldRadius () const noexcept;
|
||||
[[nodiscard]] float GetRelativeRadius () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCenter (const SHVec3& center) noexcept;
|
||||
void SetWorldRadius (float newWorldRadius) noexcept;
|
||||
void SetRelativeRadius (float newRelativeRadius) noexcept;
|
||||
void SetScale (float maxScale) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void Update () noexcept override;
|
||||
[[nodiscard]] bool TestPoint (const SHVec3& point) const noexcept override;
|
||||
[[nodiscard]] SHRaycastResult Raycast (const SHRay& ray) const noexcept override;
|
||||
[[nodiscard]] SHMatrix GetTRS () const noexcept override;
|
||||
[[nodiscard]] SHAABB ComputeAABB () const noexcept override;
|
||||
[[nodiscard]] SHRaycastResult Raycast(const SHRay& ray) const noexcept override;
|
||||
|
||||
[[nodiscard]] bool Contains (const SHSphere& rhs) const noexcept;
|
||||
[[nodiscard]] float Volume () const noexcept;
|
||||
[[nodiscard]] float SurfaceArea () const noexcept;
|
||||
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] static SHSphere Combine (const SHSphere& lhs, const SHSphere& rhs) noexcept;
|
||||
[[nodiscard]] static bool Intersect (const SHSphere& lhs, const SHSphere& rhs) noexcept;
|
||||
[[nodiscard]] static SHSphere BuildFromSpheres (const SHSphere* spheres, size_t numSpheres) noexcept;
|
||||
[[nodiscard]] static SHSphere BuildFromVertices (const SHVec3* vertices, size_t numVertices, size_t stride = 0) noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
float relativeRadius;
|
||||
float scale;
|
||||
};
|
||||
float RelativeRadius;
|
||||
|
||||
};
|
||||
} // namespace SHADE
|
|
@ -260,8 +260,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -276,8 +274,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -292,8 +288,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -308,8 +302,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -46,16 +46,14 @@ namespace SHADE
|
|||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/** Standard Epsilon value for comparing Single-Precision Floating-Point values. */
|
||||
static constexpr float EPSILON = 0.0001f;
|
||||
static constexpr float EPSILON = 0.001f;
|
||||
|
||||
/** Single-Precision Floating-Point value of infinity */
|
||||
static constexpr float INF = std::numeric_limits<float>::infinity();
|
||||
static constexpr float INF = std::numeric_limits<float>::infinity();
|
||||
|
||||
static constexpr float PI = std::numbers::pi_v<float>;
|
||||
static constexpr float HALF_PI = PI * 0.5f;
|
||||
static constexpr float TWO_PI = 2.0f * PI;
|
||||
|
||||
static constexpr float EULER_CONSTANT = std::numbers::egamma_v<float>;
|
||||
static constexpr float PI = std::numbers::pi_v<float>;
|
||||
static constexpr float HALF_PI = PI * 0.5f;
|
||||
static constexpr float TWO_PI = 2.0f * PI;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Static Function Members */
|
||||
|
|
|
@ -34,14 +34,6 @@ namespace SHADE
|
|||
0.0f, 0.0f, 0.0f, 1.0f
|
||||
};
|
||||
|
||||
const SHMatrix SHMatrix::Zero
|
||||
{
|
||||
SHVec4::Zero
|
||||
, SHVec4::Zero
|
||||
, SHVec4::Zero
|
||||
, SHVec4::Zero
|
||||
};
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
|
|
@ -45,7 +45,6 @@ namespace SHADE
|
|||
static constexpr size_t NUM_COLS = 4U;
|
||||
|
||||
static const SHMatrix Identity;
|
||||
static const SHMatrix Zero;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
|
|
|
@ -40,14 +40,20 @@ namespace SHADE
|
|||
: XMFLOAT4( vec4.x, vec4.y, vec4.z, vec4.w )
|
||||
{}
|
||||
|
||||
SHQuaternion::SHQuaternion(const XMFLOAT4& xmfloat4) noexcept
|
||||
: XMFLOAT4( xmfloat4 )
|
||||
{}
|
||||
|
||||
SHQuaternion::SHQuaternion(float _x, float _y, float _z, float _w) noexcept
|
||||
: XMFLOAT4( _x, _y, _z, _w )
|
||||
{}
|
||||
|
||||
SHQuaternion::SHQuaternion(const reactphysics3d::Vector3& rp3dEuler) noexcept
|
||||
: XMFLOAT4( 0.0f, 0.0f, 0.0f, 1.0f )
|
||||
{
|
||||
XMStoreFloat4(this, XMQuaternionRotationRollPitchYawFromVector(SHVec3 { rp3dEuler }));
|
||||
}
|
||||
|
||||
SHQuaternion::SHQuaternion(const reactphysics3d::Quaternion& rp3dQuat) noexcept
|
||||
: XMFLOAT4( rp3dQuat.x, rp3dQuat.y, rp3dQuat.z, rp3dQuat.w )
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
@ -135,6 +141,16 @@ namespace SHADE
|
|||
return XMQuaternionNotEqual(*this, rhs);
|
||||
}
|
||||
|
||||
SHQuaternion::operator reactphysics3d::Quaternion() const noexcept
|
||||
{
|
||||
return reactphysics3d::Quaternion{ x, y, z, w };
|
||||
}
|
||||
|
||||
SHQuaternion::operator reactphysics3d::Vector3() const noexcept
|
||||
{
|
||||
return reactphysics3d::Vector3{ ToEuler() };
|
||||
}
|
||||
|
||||
SHQuaternion::operator XMVECTOR() const noexcept
|
||||
{
|
||||
return XMLoadFloat4(this);
|
||||
|
|
|
@ -11,6 +11,7 @@
|
|||
#pragma once
|
||||
|
||||
#include <DirectXMath.h>
|
||||
#include <reactphysics3d/mathematics/Quaternion.h>
|
||||
|
||||
#include <string>
|
||||
|
||||
|
@ -47,10 +48,14 @@ namespace SHADE
|
|||
SHQuaternion (const SHQuaternion& rhs) = default;
|
||||
SHQuaternion (SHQuaternion&& rhs) = default;
|
||||
|
||||
SHQuaternion () noexcept;
|
||||
SHQuaternion (const SHVec4& vec4) noexcept;
|
||||
SHQuaternion (const XMFLOAT4& xmfloat4) noexcept;
|
||||
SHQuaternion (float x, float y, float z, float w) noexcept;
|
||||
SHQuaternion () noexcept;
|
||||
SHQuaternion (const SHVec4& vec4) noexcept;
|
||||
SHQuaternion (float x, float y, float z, float w) noexcept;
|
||||
|
||||
// Conversion from other math types
|
||||
|
||||
SHQuaternion (const reactphysics3d::Vector3& rp3dEuler) noexcept;
|
||||
SHQuaternion (const reactphysics3d::Quaternion& rp3dQuat) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
|
@ -77,6 +82,8 @@ namespace SHADE
|
|||
|
||||
// Conversion to other math types used by SHADE
|
||||
|
||||
operator reactphysics3d::Quaternion () const noexcept;
|
||||
operator reactphysics3d::Vector3 () const noexcept;
|
||||
operator DirectX::XMVECTOR () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
|
|
@ -30,6 +30,12 @@ namespace SHADE
|
|||
, direction { dir }
|
||||
{}
|
||||
|
||||
SHRay::SHRay(const reactphysics3d::Ray rp3dRay) noexcept
|
||||
: position { rp3dRay.point1 }
|
||||
, direction { SHVec3::Normalise(rp3dRay.point2 - rp3dRay.point1) }
|
||||
{}
|
||||
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
@ -56,6 +62,12 @@ namespace SHADE
|
|||
return XMVector3NotEqual(LHS_POS, RHS_POS) || XMVector3NotEqual(LHS_DIR, RHS_DIR);
|
||||
}
|
||||
|
||||
SHRay::operator reactphysics3d::Ray() const noexcept
|
||||
{
|
||||
// We use 2km. Temp solution.
|
||||
return reactphysics3d::Ray{ position, position + (direction * MAX_RAYCAST_DIST) };
|
||||
}
|
||||
|
||||
SHRaycastResult::operator bool() const noexcept
|
||||
{
|
||||
return hit;
|
||||
|
|
|
@ -10,7 +10,10 @@
|
|||
|
||||
#pragma once
|
||||
|
||||
#include <reactphysics3d/mathematics/Ray.h>
|
||||
|
||||
// Project Headers
|
||||
#include "SH_API.h"
|
||||
#include "Vector/SHVec3.h"
|
||||
|
||||
namespace SHADE
|
||||
|
@ -37,6 +40,7 @@ namespace SHADE
|
|||
|
||||
SHRay () noexcept;
|
||||
SHRay (const SHVec3& pos, const SHVec3& dir) noexcept;
|
||||
SHRay (const reactphysics3d::Ray rp3dRay) noexcept;
|
||||
|
||||
SHRay (const SHRay&) noexcept = default;
|
||||
SHRay (SHRay&& ) noexcept = default;
|
||||
|
@ -51,6 +55,8 @@ namespace SHADE
|
|||
|
||||
[[nodiscard]] bool operator==(const SHRay& rhs) const noexcept;
|
||||
[[nodiscard]] bool operator!=(const SHRay& rhs) const noexcept;
|
||||
|
||||
operator reactphysics3d::Ray() const noexcept;
|
||||
};
|
||||
|
||||
struct SH_API SHRaycastResult
|
||||
|
|
|
@ -246,6 +246,8 @@ namespace SHADE
|
|||
tf.world.position = SHVec3::Transform(tf.local.position, localToWorld);
|
||||
tf.world.scale = tf.local.scale * (parent ? parent->GetLocalScale() : SHVec3::One);
|
||||
|
||||
|
||||
|
||||
if (convertRotation)
|
||||
{
|
||||
tf.worldRotation = tf.localRotation + (parent ? parent->GetLocalRotation() : SHVec3::Zero);
|
||||
|
|
|
@ -50,6 +50,10 @@ namespace SHADE
|
|||
: XMFLOAT2( _x, _y )
|
||||
{}
|
||||
|
||||
SHVec2::SHVec2(const reactphysics3d::Vector2& rp3dVec2) noexcept
|
||||
: XMFLOAT2( rp3dVec2.x, rp3dVec2.y )
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
@ -161,8 +165,6 @@ namespace SHADE
|
|||
{
|
||||
case 0: return x;
|
||||
case 1: return y;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -175,8 +177,6 @@ namespace SHADE
|
|||
{
|
||||
case 0: return x;
|
||||
case 1: return y;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -189,8 +189,6 @@ namespace SHADE
|
|||
{
|
||||
case 0: return x;
|
||||
case 1: return y;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -203,11 +201,14 @@ namespace SHADE
|
|||
{
|
||||
case 0: return x;
|
||||
case 1: return y;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
SHVec2::operator reactphysics3d::Vector2() const noexcept
|
||||
{
|
||||
return reactphysics3d::Vector2{ x, y };
|
||||
}
|
||||
|
||||
SHVec2 operator* (float lhs, const SHVec2& rhs) noexcept
|
||||
{
|
||||
SHVec2 result;
|
||||
|
|
|
@ -11,6 +11,7 @@
|
|||
#pragma once
|
||||
|
||||
#include <DirectXMath.h>
|
||||
#include <reactphysics3d/mathematics/Vector2.h>
|
||||
|
||||
#include <string>
|
||||
#include <initializer_list>
|
||||
|
@ -58,6 +59,10 @@ namespace SHADE
|
|||
SHVec2 (float n) noexcept;
|
||||
SHVec2 (float x, float y) noexcept;
|
||||
|
||||
// Conversion from other math types to SHADE
|
||||
|
||||
SHVec2 (const reactphysics3d::Vector2& rp3dVec2) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
@ -68,6 +73,7 @@ namespace SHADE
|
|||
// Conversion to other math types used by SHADE
|
||||
|
||||
operator DirectX::XMVECTOR () const noexcept;
|
||||
operator reactphysics3d::Vector2 () const noexcept;
|
||||
|
||||
SHVec2& operator+= (const SHVec2& rhs) noexcept;
|
||||
SHVec2& operator-= (const SHVec2& rhs) noexcept;
|
||||
|
|
|
@ -57,6 +57,14 @@ namespace SHADE
|
|||
: XMFLOAT3( _x, _y, _z )
|
||||
{}
|
||||
|
||||
SHVec3::SHVec3(const reactphysics3d::Vector3& rp3dVec3) noexcept
|
||||
: XMFLOAT3( rp3dVec3.x, rp3dVec3.y, rp3dVec3.z )
|
||||
{}
|
||||
|
||||
SHVec3::SHVec3(const reactphysics3d::Quaternion& rp3dVec3) noexcept
|
||||
: XMFLOAT3( SHQuaternion{rp3dVec3}.ToEuler() )
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
@ -171,8 +179,6 @@ namespace SHADE
|
|||
case 0: return x;
|
||||
case 1: return y;
|
||||
case 2: return z;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -186,8 +192,6 @@ namespace SHADE
|
|||
case 0: return x;
|
||||
case 1: return y;
|
||||
case 2: return z;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -201,8 +205,6 @@ namespace SHADE
|
|||
case 0: return x;
|
||||
case 1: return y;
|
||||
case 2: return z;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -216,11 +218,19 @@ namespace SHADE
|
|||
case 0: return x;
|
||||
case 1: return y;
|
||||
case 2: return z;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
SHVec3::operator reactphysics3d::Vector3() const noexcept
|
||||
{
|
||||
return reactphysics3d::Vector3{ x, y , z };
|
||||
}
|
||||
|
||||
SHVec3::operator reactphysics3d::Quaternion() const noexcept
|
||||
{
|
||||
return reactphysics3d::Quaternion::fromEulerAngles(x, y, z);
|
||||
}
|
||||
|
||||
SHVec3 operator* (float lhs, const SHVec3& rhs) noexcept
|
||||
{
|
||||
SHVec3 result;
|
||||
|
@ -372,30 +382,6 @@ namespace SHADE
|
|||
return lhs.Cross(rhs);
|
||||
}
|
||||
|
||||
SHMatrix SHVec3::OuterProduct(const SHVec3& lhs, const SHVec3& rhs) noexcept
|
||||
{
|
||||
/*
|
||||
* Outer product is a matrix multiplication u * vT
|
||||
* 3x1 * 1x3 = 3x3
|
||||
*
|
||||
* | u1 | | v1 v2 v3 | | u1v1 u1v2 u1v3 |
|
||||
* | u2 | = | u2v1 u2v2 u2v3 |
|
||||
* | u3 | | u3v1 u3v2 u3v3 |
|
||||
*/
|
||||
|
||||
SHMatrix u = SHMatrix::Zero;
|
||||
SHMatrix vT = SHMatrix::Zero;
|
||||
|
||||
for (int i = 0; i < SIZE; ++i)
|
||||
{
|
||||
u.m[0][i] = lhs[i];
|
||||
vT.m[i][0] = rhs[i];
|
||||
}
|
||||
|
||||
return u * vT;
|
||||
}
|
||||
|
||||
|
||||
SHVec3 SHVec3::Project(const SHVec3& v, const SHVec3& u) noexcept
|
||||
{
|
||||
SHVec3 result;
|
||||
|
|
|
@ -11,6 +11,8 @@
|
|||
#pragma once
|
||||
|
||||
#include <DirectXMath.h>
|
||||
#include <reactphysics3d/mathematics/Vector3.h>
|
||||
#include <reactphysics3d/mathematics/Quaternion.h>
|
||||
|
||||
#include <string>
|
||||
#include <initializer_list>
|
||||
|
@ -67,6 +69,9 @@ namespace SHADE
|
|||
|
||||
// Conversion from other math types to SHADE
|
||||
|
||||
SHVec3 (const reactphysics3d::Vector3& rp3dVec3) noexcept;
|
||||
SHVec3 (const reactphysics3d::Quaternion& rp3dVec3) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
@ -76,6 +81,8 @@ namespace SHADE
|
|||
|
||||
// Conversion to other math types used by SHADE
|
||||
|
||||
operator reactphysics3d::Vector3 () const noexcept;
|
||||
operator reactphysics3d::Quaternion () const noexcept;
|
||||
operator DirectX::XMVECTOR () const noexcept;
|
||||
|
||||
SHVec3& operator+= (const SHVec3& rhs) noexcept;
|
||||
|
@ -115,28 +122,27 @@ namespace SHADE
|
|||
/* Static Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] static SHVec3 Normalise (const SHVec3& v) noexcept;
|
||||
[[nodiscard]] static SHVec3 Abs (const SHVec3& v) noexcept;
|
||||
[[nodiscard]] static SHVec3 Min (const std::initializer_list<SHVec3>& vs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Max (const std::initializer_list<SHVec3>& vs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Clamp (const SHVec3& v, const SHVec3& vMin, const SHVec3& vMax) noexcept;
|
||||
[[nodiscard]] static SHVec3 Lerp (const SHVec3& a, const SHVec3& b, float t) noexcept;
|
||||
[[nodiscard]] static SHVec3 ClampedLerp (const SHVec3& a, const SHVec3& b, float t, float tMin = 0.0f, float tMax = 1.0f) noexcept;
|
||||
[[nodiscard]] static SHVec3 Normalise (const SHVec3& v) noexcept;
|
||||
[[nodiscard]] static SHVec3 Abs (const SHVec3& v) noexcept;
|
||||
[[nodiscard]] static SHVec3 Min (const std::initializer_list<SHVec3>& vs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Max (const std::initializer_list<SHVec3>& vs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Clamp (const SHVec3& v, const SHVec3& vMin, const SHVec3& vMax) noexcept;
|
||||
[[nodiscard]] static SHVec3 Lerp (const SHVec3& a, const SHVec3& b, float t) noexcept;
|
||||
[[nodiscard]] static SHVec3 ClampedLerp (const SHVec3& a, const SHVec3& b, float t, float tMin = 0.0f, float tMax = 1.0f) noexcept;
|
||||
|
||||
[[nodiscard]] static float Distance (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float DistanceSquared (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float Angle (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float Dot (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Cross (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static SHMatrix OuterProduct (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Project (const SHVec3& v, const SHVec3& u) noexcept;
|
||||
[[nodiscard]] static SHVec3 Reflect (const SHVec3& v, const SHVec3& normal) noexcept;
|
||||
[[nodiscard]] static SHVec3 Rotate (const SHVec3& v, const SHVec3& axis, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 Rotate (const SHVec3& v, const SHQuaternion& q) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateX (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateY (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateZ (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 Transform (const SHVec3& v, const SHMatrix& transformMtx) noexcept;
|
||||
[[nodiscard]] static float Distance (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float DistanceSquared (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float Angle (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static float Dot (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Cross (const SHVec3& lhs, const SHVec3& rhs) noexcept;
|
||||
[[nodiscard]] static SHVec3 Project (const SHVec3& v, const SHVec3& u) noexcept;
|
||||
[[nodiscard]] static SHVec3 Reflect (const SHVec3& v, const SHVec3& normal) noexcept;
|
||||
[[nodiscard]] static SHVec3 Rotate (const SHVec3& v, const SHVec3& axis, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 Rotate (const SHVec3& v, const SHQuaternion& q) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateX (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateY (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 RotateZ (const SHVec3& v, float angleInRad) noexcept;
|
||||
[[nodiscard]] static SHVec3 Transform (const SHVec3& v, const SHMatrix& transformMtx) noexcept;
|
||||
};
|
||||
|
||||
SHVec3 operator* (float lhs, const SHVec3& rhs) noexcept;
|
||||
|
|
|
@ -164,8 +164,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -180,8 +178,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -196,8 +192,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -212,8 +206,6 @@ namespace SHADE
|
|||
case 1: return y;
|
||||
case 2: return z;
|
||||
case 3: return w;
|
||||
// This will never hit
|
||||
default: return x;
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -1,644 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHDynamicAABBTree.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Dynamic AABB Tree for broadphase collision detection.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
#include <stack>
|
||||
|
||||
// Primary Header
|
||||
#include "SHDynamicAABBTree.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABBTree::SHAABBTree() noexcept
|
||||
: root { NULL_NODE }
|
||||
, nodes { nullptr }
|
||||
, nodeCount { 0 }
|
||||
, capacity { 1024 }
|
||||
, freeList { NULL_NODE }
|
||||
{
|
||||
// Build initial tree
|
||||
nodes = new Node[1024];
|
||||
|
||||
addToFreeList(0);
|
||||
}
|
||||
|
||||
SHAABBTree::~SHAABBTree() noexcept
|
||||
{
|
||||
delete[] nodes;
|
||||
}
|
||||
|
||||
SHAABBTree::Node::Node() noexcept
|
||||
: id { MAX_EID, std::numeric_limits<uint32_t>::max() }
|
||||
, parent { NULL_NODE }
|
||||
, left { NULL_NODE }
|
||||
, right { NULL_NODE }
|
||||
, height { NULL_NODE }
|
||||
{}
|
||||
|
||||
SHAABBTree::Node::Node(const Node& rhs) noexcept
|
||||
: AABB { rhs.AABB }
|
||||
, id { rhs.id }
|
||||
, next { rhs.next }
|
||||
, left { rhs.left }
|
||||
, right { rhs.right }
|
||||
, height { rhs.height }
|
||||
{}
|
||||
|
||||
SHAABBTree::Node::Node(Node&& rhs) noexcept
|
||||
: AABB { rhs.AABB }
|
||||
, id { rhs.id }
|
||||
, next { rhs.next }
|
||||
, left { rhs.left }
|
||||
, right { rhs.right }
|
||||
, height { rhs.height }
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABBTree::Node& SHAABBTree::Node::operator=(const Node& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
AABB = rhs.AABB;
|
||||
id = rhs.id;
|
||||
parent = rhs.parent;
|
||||
next = rhs.next;
|
||||
left = rhs.left;
|
||||
right = rhs.right;
|
||||
height = rhs.height;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHAABBTree::Node& SHAABBTree::Node::operator=(Node&& rhs) noexcept
|
||||
{
|
||||
AABB = std::move(rhs.AABB);
|
||||
id = std::move(rhs.id);
|
||||
parent = rhs.parent;
|
||||
next = rhs.next;
|
||||
left = rhs.left;
|
||||
right = rhs.right;
|
||||
height = rhs.height;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const std::vector<SHAABB>& SHAABBTree::GetAABBs() const noexcept
|
||||
{
|
||||
static AABBs aabbs;
|
||||
static std::stack<int32_t> nodeIndices;
|
||||
|
||||
aabbs.clear();
|
||||
|
||||
nodeIndices.push(root);
|
||||
while (!nodeIndices.empty())
|
||||
{
|
||||
// Pop the top node
|
||||
const int INDEX = nodeIndices.top();
|
||||
nodeIndices.pop();
|
||||
|
||||
// Skip null nodes
|
||||
if (INDEX == NULL_NODE)
|
||||
continue;
|
||||
|
||||
const Node& CURRENT_NODE = nodes[INDEX];
|
||||
|
||||
aabbs.emplace_back(CURRENT_NODE.AABB);
|
||||
|
||||
if (!isLeaf(INDEX))
|
||||
{
|
||||
nodeIndices.push(CURRENT_NODE.left);
|
||||
nodeIndices.push(CURRENT_NODE.right);
|
||||
}
|
||||
}
|
||||
|
||||
return aabbs;
|
||||
}
|
||||
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHAABBTree::Insert(SHCollisionShapeID id, const SHAABB& AABB)
|
||||
{
|
||||
const int32_t NEW_INDEX = allocateNode();
|
||||
|
||||
if (!nodeMap.emplace(id, NEW_INDEX).second)
|
||||
{
|
||||
// Attempted to add a duplicate node
|
||||
freeNode(NEW_INDEX);
|
||||
return;
|
||||
}
|
||||
|
||||
Node& newNode = nodes[NEW_INDEX];
|
||||
newNode.AABB = AABB;
|
||||
newNode.id = id;
|
||||
newNode.height = 0;
|
||||
|
||||
// Fatten the AABB
|
||||
const SHVec3 EXTENSION{ AABB_EXTENSION };
|
||||
|
||||
const SHVec3 newMin = newNode.AABB.GetMin() - EXTENSION;
|
||||
const SHVec3 newMax = newNode.AABB.GetMax() + EXTENSION;
|
||||
|
||||
newNode.AABB.SetMin(newMin);
|
||||
newNode.AABB.SetMax(newMax);
|
||||
|
||||
insertLeaf(NEW_INDEX);
|
||||
}
|
||||
|
||||
void SHAABBTree::Update(SHCollisionShapeID id, const SHAABB& AABB)
|
||||
{
|
||||
// Get node index
|
||||
const int32_t INDEX_TO_UPDATE = nodeMap[id];
|
||||
|
||||
Node& nodeToUpdate = nodes[INDEX_TO_UPDATE];
|
||||
|
||||
// If new AABB has not moved enough, skip.
|
||||
if (nodeToUpdate.AABB.Contains(AABB))
|
||||
return;
|
||||
|
||||
removeLeaf(INDEX_TO_UPDATE);
|
||||
|
||||
nodeToUpdate.AABB = AABB;
|
||||
|
||||
// Fatten the AABB
|
||||
const SHVec3 EXTENSION{ AABB_EXTENSION };
|
||||
|
||||
const SHVec3 newMin = nodeToUpdate.AABB.GetMin() - EXTENSION;
|
||||
const SHVec3 newMax = nodeToUpdate.AABB.GetMax() + EXTENSION;
|
||||
|
||||
nodeToUpdate.AABB.SetMin(newMin);
|
||||
nodeToUpdate.AABB.SetMax(newMax);
|
||||
|
||||
insertLeaf(INDEX_TO_UPDATE);
|
||||
}
|
||||
|
||||
void SHAABBTree::Remove(SHCollisionShapeID id) noexcept
|
||||
{
|
||||
// Get node index
|
||||
const int32_t INDEX_TO_REMOVE = nodeMap[id];
|
||||
|
||||
removeLeaf(INDEX_TO_REMOVE);
|
||||
freeNode(INDEX_TO_REMOVE);
|
||||
|
||||
nodeMap.erase(id);
|
||||
}
|
||||
|
||||
const std::vector<SHCollisionShapeID>& SHAABBTree::Query(SHCollisionShapeID id, const SHAABB& AABB) const noexcept
|
||||
{
|
||||
static std::vector<SHCollisionShapeID> potentialCollisions;
|
||||
static std::stack<int32_t> nodeIndices;
|
||||
|
||||
potentialCollisions.clear();
|
||||
|
||||
// We use this to ignore shapes on the same entity
|
||||
const EntityID EID = id.GetEntityID();
|
||||
|
||||
nodeIndices.push(root);
|
||||
while (!nodeIndices.empty())
|
||||
{
|
||||
const int32_t INDEX = nodeIndices.top();
|
||||
nodeIndices.pop();
|
||||
|
||||
if (INDEX == NULL_NODE)
|
||||
continue;
|
||||
|
||||
const Node& NODE = nodes[INDEX];
|
||||
if (!SHAABB::Intersect(AABB, NODE.AABB))
|
||||
continue;
|
||||
|
||||
// Avoid checking against shapes of the same composite collider (and itself)
|
||||
if (isLeaf(INDEX) && NODE.id.GetEntityID() != EID)
|
||||
{
|
||||
potentialCollisions.emplace_back(NODE.id);
|
||||
}
|
||||
else
|
||||
{
|
||||
nodeIndices.push(NODE.left);
|
||||
nodeIndices.push(NODE.right);
|
||||
}
|
||||
}
|
||||
|
||||
return potentialCollisions;
|
||||
}
|
||||
|
||||
const std::vector<SHCollisionShapeID>& SHAABBTree::Query(const SHRay& ray, float distance) const noexcept
|
||||
{
|
||||
static std::vector<SHCollisionShapeID> potentialHits;
|
||||
static std::stack<int32_t> nodeIndices;
|
||||
|
||||
potentialHits.clear();
|
||||
|
||||
nodeIndices.push(root);
|
||||
while (!nodeIndices.empty())
|
||||
{
|
||||
const int32_t INDEX = nodeIndices.top();
|
||||
nodeIndices.pop();
|
||||
|
||||
if (INDEX == NULL_NODE)
|
||||
continue;
|
||||
|
||||
const Node& NODE = nodes[INDEX];
|
||||
|
||||
const auto& RESULT = NODE.AABB.Raycast(ray);
|
||||
if (!RESULT || RESULT.distance > distance)
|
||||
continue;
|
||||
|
||||
if (isLeaf(INDEX))
|
||||
{
|
||||
potentialHits.emplace_back(NODE.id);
|
||||
}
|
||||
else
|
||||
{
|
||||
// Non-leaf nodes need to be traversed further
|
||||
nodeIndices.push(NODE.left);
|
||||
nodeIndices.push(NODE.right);
|
||||
}
|
||||
}
|
||||
|
||||
return potentialHits;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHAABBTree::isLeaf(int32_t index) const noexcept
|
||||
{
|
||||
const Node& NODE = nodes[index];
|
||||
return NODE.left == NULL_NODE && NODE.right == NULL_NODE;
|
||||
}
|
||||
|
||||
int32_t SHAABBTree::allocateNode()
|
||||
{
|
||||
if (freeList == NULL_NODE)
|
||||
{
|
||||
// No more free nodes available, so we need to resize the tree for more nodes
|
||||
capacity *= 2;
|
||||
|
||||
Node* newNodes = new Node[capacity];
|
||||
|
||||
// Copy all the nodes manually. I do this instead of memcpy to guarantee it copies properly.
|
||||
for (int32_t i = 0; i < nodeCount; ++i)
|
||||
{
|
||||
newNodes[i].AABB = nodes[i].AABB;
|
||||
newNodes[i].id = nodes[i].id;
|
||||
newNodes[i].parent = nodes[i].parent;
|
||||
newNodes[i].left = nodes[i].left;
|
||||
newNodes[i].right = nodes[i].right;
|
||||
newNodes[i].height = nodes[i].height;
|
||||
}
|
||||
|
||||
delete[] nodes;
|
||||
nodes = newNodes;
|
||||
|
||||
addToFreeList(nodeCount);
|
||||
}
|
||||
|
||||
const int32_t FREE_NODE = freeList;
|
||||
freeList = nodes[FREE_NODE].next;
|
||||
|
||||
// Set node to default
|
||||
Node& newNode = nodes[FREE_NODE];
|
||||
newNode.parent = NULL_NODE;
|
||||
newNode.left = NULL_NODE;
|
||||
newNode.right = NULL_NODE;
|
||||
newNode.height = NULL_NODE;
|
||||
|
||||
++nodeCount;
|
||||
return FREE_NODE;
|
||||
}
|
||||
|
||||
void SHAABBTree::freeNode(int32_t index) noexcept
|
||||
{
|
||||
SHASSERT(index >= 0 && index < capacity, "Trying to free an invalid AABB Tree node!")
|
||||
|
||||
nodes[index].next = freeList;
|
||||
nodes[index].height = NULL_NODE;
|
||||
|
||||
// Put it back on the free list
|
||||
freeList = index;
|
||||
|
||||
--nodeCount;
|
||||
}
|
||||
|
||||
void SHAABBTree::insertLeaf(int32_t index)
|
||||
{
|
||||
// If there is no root, the first insert must make the root
|
||||
if (root == NULL_NODE)
|
||||
{
|
||||
root = index;
|
||||
nodes[root].parent = NULL_NODE;
|
||||
return;
|
||||
}
|
||||
|
||||
// Find best sibling for new leaf
|
||||
// Utilise Surface Area Heuristic
|
||||
const SHAABB& LEAF_AABB = nodes[index].AABB;
|
||||
|
||||
uint32_t searchIndex = root;
|
||||
while (!isLeaf(searchIndex))
|
||||
{
|
||||
const SHAABB COMBINED_AABB = SHAABB::Combine(LEAF_AABB, nodes[searchIndex].AABB);
|
||||
const float COMBINED_AREA = COMBINED_AABB.SurfaceArea();
|
||||
|
||||
const float INHERITED_COST = 2.0f * (COMBINED_AREA - nodes[searchIndex].AABB.SurfaceArea());
|
||||
|
||||
const int32_t LEFT_INDEX = nodes[searchIndex].left;
|
||||
const int32_t RIGHT_INDEX = nodes[searchIndex].right;
|
||||
|
||||
float leftCost = 0.0f;
|
||||
float rightCost = 0.0f;
|
||||
|
||||
const float LEFT_COMBINED_AREA = SHAABB::Combine(LEAF_AABB, nodes[LEFT_INDEX].AABB).SurfaceArea();
|
||||
const float RIGHT_COMBINED_AREA = SHAABB::Combine(LEAF_AABB, nodes[RIGHT_INDEX].AABB).SurfaceArea();
|
||||
|
||||
// Compute cost for descending into the left
|
||||
if (isLeaf(LEFT_INDEX))
|
||||
leftCost = LEFT_COMBINED_AREA + INHERITED_COST;
|
||||
else
|
||||
leftCost = LEFT_COMBINED_AREA - nodes[LEFT_INDEX].AABB.SurfaceArea() + INHERITED_COST;
|
||||
|
||||
// Compute cost for descending into the right
|
||||
if (isLeaf(RIGHT_INDEX))
|
||||
rightCost = RIGHT_COMBINED_AREA + INHERITED_COST;
|
||||
else
|
||||
rightCost = RIGHT_COMBINED_AREA - nodes[RIGHT_INDEX].AABB.SurfaceArea() + INHERITED_COST;
|
||||
|
||||
// Early out
|
||||
const float BRANCH_COST = 2.0f * COMBINED_AREA;
|
||||
if (BRANCH_COST < leftCost && BRANCH_COST < rightCost)
|
||||
break;
|
||||
|
||||
// Traverse
|
||||
searchIndex = leftCost < rightCost ? LEFT_INDEX : RIGHT_INDEX;
|
||||
}
|
||||
|
||||
const int32_t BEST_SIBLING = searchIndex;
|
||||
|
||||
// Create a new parent for the leaf
|
||||
const int32_t OLD_PARENT = nodes[BEST_SIBLING].parent;
|
||||
const int32_t NEW_PARENT = allocateNode();
|
||||
|
||||
Node& newParent = nodes[NEW_PARENT];
|
||||
newParent.parent = OLD_PARENT;
|
||||
newParent.id = SHCollisionShapeID{ MAX_EID, std::numeric_limits<uint32_t>::max() };
|
||||
newParent.AABB = SHAABB::Combine(LEAF_AABB, nodes[BEST_SIBLING].AABB);
|
||||
newParent.height = nodes[BEST_SIBLING].height + 1;
|
||||
|
||||
newParent.left = BEST_SIBLING;
|
||||
newParent.right = index;
|
||||
|
||||
nodes[BEST_SIBLING].parent = NEW_PARENT;
|
||||
nodes[index].parent = NEW_PARENT;
|
||||
|
||||
// If sibling was the root
|
||||
if (OLD_PARENT == NULL_NODE)
|
||||
root = NEW_PARENT;
|
||||
else
|
||||
(nodes[OLD_PARENT].left == BEST_SIBLING ? nodes[OLD_PARENT].left : nodes[OLD_PARENT].right) = NEW_PARENT;
|
||||
|
||||
syncHierarchy(NEW_PARENT);
|
||||
}
|
||||
|
||||
void SHAABBTree::removeLeaf(int32_t index)
|
||||
{
|
||||
if (index == root)
|
||||
{
|
||||
root = NULL_NODE;
|
||||
return;
|
||||
}
|
||||
|
||||
const int32_t PARENT = nodes[index].parent;
|
||||
|
||||
if (PARENT == NULL_NODE)
|
||||
{
|
||||
freeNode(index);
|
||||
return;
|
||||
}
|
||||
|
||||
const int32_t GRANDPARENT = nodes[PARENT].parent;
|
||||
const int32_t SIBLING = nodes[PARENT].left == index ? nodes[PARENT].right : nodes[PARENT].left;
|
||||
|
||||
if (GRANDPARENT != NULL_NODE)
|
||||
{
|
||||
// Replace parent with sibling
|
||||
(nodes[GRANDPARENT].left == PARENT ? nodes[GRANDPARENT].left : nodes[GRANDPARENT].right) = SIBLING;
|
||||
nodes[SIBLING].parent = GRANDPARENT;
|
||||
}
|
||||
else
|
||||
{
|
||||
// Parent was root
|
||||
root = SIBLING;
|
||||
nodes[SIBLING].parent = NULL_NODE;
|
||||
}
|
||||
|
||||
freeNode(PARENT);
|
||||
syncHierarchy(GRANDPARENT);
|
||||
}
|
||||
|
||||
void SHAABBTree::syncHierarchy(int32_t index)
|
||||
{
|
||||
while (index != NULL_NODE)
|
||||
{
|
||||
index = balance(index);
|
||||
|
||||
const int32_t LEFT_INDEX = nodes[index].left;
|
||||
const Node& LEFT_NODE = nodes[LEFT_INDEX];
|
||||
|
||||
const int32_t RIGHT_INDEX = nodes[index].right;
|
||||
const Node& RIGHT_NODE = nodes[RIGHT_INDEX];
|
||||
|
||||
nodes[index].height = 1 + SHMath::Max(LEFT_NODE.height, RIGHT_NODE.height);
|
||||
nodes[index].AABB = SHAABB::Combine(LEFT_NODE.AABB, RIGHT_NODE.AABB);
|
||||
|
||||
// Sync up to the root
|
||||
index = nodes[index].parent;
|
||||
}
|
||||
}
|
||||
|
||||
int32_t SHAABBTree::balance(int32_t index)
|
||||
{
|
||||
if (isLeaf(index) || nodes[index].height == 1)
|
||||
return index;
|
||||
|
||||
Node& nodeA = nodes[index];
|
||||
|
||||
const int32_t LEFT = nodeA.left;
|
||||
const int32_t RIGHT = nodeA.right;
|
||||
|
||||
const int32_t DIFF = nodes[RIGHT].height - nodes[LEFT].height;
|
||||
|
||||
if (DIFF > 1)
|
||||
return rotateLeft(index);
|
||||
|
||||
if (DIFF < -1)
|
||||
return rotateRight(index);
|
||||
|
||||
return index;
|
||||
}
|
||||
|
||||
int32_t SHAABBTree::rotateLeft(int32_t index)
|
||||
{
|
||||
/****************************
|
||||
A C
|
||||
/ \ / \
|
||||
B C --> A F/G
|
||||
/ \ / \
|
||||
F G B G/F
|
||||
****************************/
|
||||
|
||||
// Promote C
|
||||
|
||||
Node& nodeA = nodes[index];
|
||||
|
||||
const int32_t B = nodeA.left;
|
||||
const int32_t C = nodeA.right;
|
||||
|
||||
Node& nodeB = nodes[B];
|
||||
Node& nodeC = nodes[C];
|
||||
|
||||
const int32_t F = nodeC.left;
|
||||
const int32_t G = nodeC.right;
|
||||
|
||||
Node& nodeF = nodes[F];
|
||||
Node& nodeG = nodes[G];
|
||||
|
||||
if (nodeA.parent != NULL_NODE)
|
||||
(nodes[nodeA.parent].left == index ? nodes[nodeA.parent].left : nodes[nodeA.parent].right) = C;
|
||||
else
|
||||
root = C;
|
||||
|
||||
nodeC.left = index;
|
||||
nodeC.parent = nodeA.parent;
|
||||
nodeA.parent = C;
|
||||
|
||||
if (nodeF.height > nodeG.height)
|
||||
{
|
||||
nodeC.right = F;
|
||||
nodeA.right = G;
|
||||
nodeG.parent = index;
|
||||
|
||||
nodeA.AABB = SHAABB::Combine(nodeB.AABB, nodeG.AABB);
|
||||
nodeC.AABB = SHAABB::Combine(nodeA.AABB, nodeF.AABB);
|
||||
|
||||
nodeA.height = 1 + SHMath::Max(nodeB.height, nodeG.height);
|
||||
nodeC.height = 1 + SHMath::Max(nodeA.height, nodeF.height);
|
||||
}
|
||||
else
|
||||
{
|
||||
nodeC.right = G;
|
||||
nodeA.right = F;
|
||||
nodeF.parent = index;
|
||||
|
||||
nodeA.AABB = SHAABB::Combine(nodeB.AABB, nodeF.AABB);
|
||||
nodeC.AABB = SHAABB::Combine(nodeA.AABB, nodeG.AABB);
|
||||
|
||||
nodeA.height = 1 + SHMath::Max(nodeB.height, nodeF.height);
|
||||
nodeC.height = 1 + SHMath::Max(nodeA.height, nodeG.height);
|
||||
}
|
||||
|
||||
return C;
|
||||
}
|
||||
|
||||
int32_t SHAABBTree::rotateRight(int32_t index)
|
||||
{
|
||||
/*************************
|
||||
A B
|
||||
/ \ / \
|
||||
B C --> D/E A
|
||||
/ \ / \
|
||||
D E E/D C
|
||||
*************************/
|
||||
|
||||
// Promote B
|
||||
|
||||
Node& nodeA = nodes[index];
|
||||
|
||||
const int32_t B = nodeA.left;
|
||||
const int32_t C = nodeA.right;
|
||||
|
||||
Node& nodeB = nodes[B];
|
||||
Node& nodeC = nodes[C];
|
||||
|
||||
const int32_t D = nodeB.left;
|
||||
const int32_t E = nodeB.right;
|
||||
|
||||
Node& nodeD = nodes[D];
|
||||
Node& nodeE = nodes[E];
|
||||
|
||||
if (nodeA.parent != NULL_NODE)
|
||||
(nodes[nodeA.parent].left == index ? nodes[nodeA.parent].left : nodes[nodeA.parent].right) = B;
|
||||
else
|
||||
root = B;
|
||||
|
||||
nodeB.right = index;
|
||||
nodeB.parent = nodeA.parent;
|
||||
nodeA.parent = B;
|
||||
|
||||
if (nodeD.height > nodeE.height)
|
||||
{
|
||||
nodeB.left = D;
|
||||
nodeA.left = E;
|
||||
nodeE.parent = index;
|
||||
|
||||
nodeA.AABB = SHAABB::Combine(nodeC.AABB, nodeE.AABB);
|
||||
nodeB.AABB = SHAABB::Combine(nodeA.AABB, nodeD.AABB);
|
||||
|
||||
nodeA.height = 1 + SHMath::Max(nodeC.height, nodeE.height);
|
||||
nodeB.height = 1 + SHMath::Max(nodeA.height, nodeD.height);
|
||||
}
|
||||
else
|
||||
{
|
||||
nodeB.left = E;
|
||||
nodeA.left = D;
|
||||
nodeD.parent = index;
|
||||
|
||||
nodeA.AABB = SHAABB::Combine(nodeC.AABB, nodeD.AABB);
|
||||
nodeB.AABB = SHAABB::Combine(nodeA.AABB, nodeE.AABB);
|
||||
|
||||
nodeA.height = 1 + SHMath::Max(nodeC.height, nodeD.height);
|
||||
nodeB.height = 1 + SHMath::Max(nodeA.height, nodeE.height);
|
||||
}
|
||||
|
||||
return B;
|
||||
}
|
||||
|
||||
void SHAABBTree::addToFreeList(int32_t index) noexcept
|
||||
{
|
||||
for (int32_t i = index; i < capacity; ++i)
|
||||
{
|
||||
nodes[i].next = i + 1;
|
||||
nodes[i].height = NULL_NODE;
|
||||
}
|
||||
|
||||
nodes[capacity - 1].next = NULL_NODE;
|
||||
nodes[capacity - 1].height = NULL_NODE;
|
||||
|
||||
freeList = index;
|
||||
}
|
||||
} // namespace SHADE
|
|
@ -1,156 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHDynamicAABBTree.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Dynamic AABB Tree for broadphase collision detection.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <unordered_map>
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/Shapes/SHCollisionShape.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a dynamic AABB Tree for collision detection.
|
||||
*/
|
||||
class SH_API SHAABBTree
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
using AABBs = std::vector<SHAABB>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr int NULL_NODE = -1;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABBTree () noexcept;
|
||||
~SHAABBTree () noexcept;
|
||||
|
||||
SHAABBTree(const SHAABBTree& other) = delete;
|
||||
SHAABBTree(SHAABBTree&& other) noexcept = delete;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABBTree& operator=(const SHAABBTree& other) = delete;
|
||||
SHAABBTree& operator=(SHAABBTree&& other) noexcept = delete;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] const AABBs& GetAABBs () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void Insert (SHCollisionShapeID id, const SHAABB& AABB);
|
||||
void Update (SHCollisionShapeID id, const SHAABB& AABB);
|
||||
void Remove (SHCollisionShapeID id) noexcept;
|
||||
|
||||
[[nodiscard]] const std::vector<SHCollisionShapeID>& Query(SHCollisionShapeID id, const SHAABB& AABB) const noexcept;
|
||||
[[nodiscard]] const std::vector<SHCollisionShapeID>& Query(const SHRay& ray, float distance) const noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct Node
|
||||
{
|
||||
public:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
Node () noexcept;
|
||||
Node (const Node& rhs) noexcept;
|
||||
Node (Node&& rhs) noexcept;
|
||||
|
||||
~Node () noexcept = default;
|
||||
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
Node& operator=(const Node& rhs) noexcept;
|
||||
Node& operator=(Node&& rhs) noexcept;
|
||||
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
SHAABB AABB;
|
||||
SHCollisionShapeID id; // Used to lookup the collision shape & entity for culling against itself
|
||||
|
||||
union
|
||||
{
|
||||
int32_t parent;
|
||||
int32_t next;
|
||||
};
|
||||
|
||||
|
||||
int32_t left;
|
||||
int32_t right;
|
||||
int32_t height; // Leaves have a height of 0. Free nodes have a height of -1
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr float AABB_EXTENSION = 0.2f;
|
||||
|
||||
// For quick access
|
||||
std::unordered_map<SHCollisionShapeID, int32_t, SHCollisionShapeIDHash> nodeMap;
|
||||
|
||||
int32_t root;
|
||||
Node* nodes; // Dynamically allocated array of nodes. I use dynamic allocation as in the past, using a vector causes weird issues.
|
||||
int32_t nodeCount;
|
||||
int32_t capacity; // Used for resizing the tree.
|
||||
int32_t freeList; // Stores the next available node on the free list.
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
bool isLeaf (int32_t index) const noexcept;
|
||||
|
||||
int32_t allocateNode ();
|
||||
void freeNode (int32_t index) noexcept;
|
||||
|
||||
void insertLeaf (int32_t index);
|
||||
void removeLeaf (int32_t index);
|
||||
void syncHierarchy (int32_t index);
|
||||
int32_t balance (int32_t index);
|
||||
int32_t rotateLeft (int32_t index);
|
||||
int32_t rotateRight (int32_t index);
|
||||
|
||||
void addToFreeList (int32_t index) noexcept;
|
||||
};
|
||||
|
||||
|
||||
}
|
|
@ -1,60 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionKey.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for Collision Information for Collision & Triggers.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "SHCollisionKey.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
enum class SHCollisionState
|
||||
{
|
||||
ENTER
|
||||
, STAY
|
||||
, EXIT
|
||||
|
||||
, TOTAL
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the event for an intersection between two collision shapes that do not
|
||||
* have physical resolution.
|
||||
*/
|
||||
struct SH_API SHTriggerEvent
|
||||
{
|
||||
public:
|
||||
SHCollisionKey info;
|
||||
SHCollisionState state = SHCollisionState::INVALID;
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the event for an intersection between two collision shapes that do
|
||||
* have physical resolution.
|
||||
*/
|
||||
struct SH_API SHCollisionEvent
|
||||
{
|
||||
public:
|
||||
static constexpr int MAX_NUM_CONTACTS = 4;
|
||||
|
||||
SHCollisionKey info;
|
||||
SHCollisionState state = SHCollisionState::INVALID;
|
||||
SHVec3 normal;
|
||||
SHVec3 contactPoints[MAX_NUM_CONTACTS];
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,166 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionInfo.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for Collision Info.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionKey.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
#include "Physics/Interface/SHColliderComponent.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionKey::SHCollisionKey() noexcept
|
||||
{
|
||||
ids[ENTITY_A] = MAX_EID;
|
||||
ids[ENTITY_B] = MAX_EID;
|
||||
ids[SHAPE_INDEX_A] = std::numeric_limits<uint32_t>::max();
|
||||
ids[SHAPE_INDEX_B] = std::numeric_limits<uint32_t>::max();
|
||||
}
|
||||
|
||||
SHCollisionKey::SHCollisionKey(const SHCollisionKey& rhs) noexcept
|
||||
{
|
||||
value[0] = rhs.value[0];
|
||||
value[1] = rhs.value[1];
|
||||
}
|
||||
|
||||
SHCollisionKey::SHCollisionKey(SHCollisionKey&& rhs) noexcept
|
||||
{
|
||||
value[0] = rhs.value[0];
|
||||
value[1] = rhs.value[1];
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionKey& SHCollisionKey::operator=(const SHCollisionKey& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
value[0] = rhs.value[0];
|
||||
value[1] = rhs.value[1];
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHCollisionKey& SHCollisionKey::operator=(SHCollisionKey&& rhs) noexcept
|
||||
{
|
||||
value[0] = rhs.value[0];
|
||||
value[1] = rhs.value[1];
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
bool SHCollisionKey::operator==(const SHCollisionKey& rhs) const
|
||||
{
|
||||
// When checking for equal, check both ways.
|
||||
// Exact Match (A, idxA, B, idxB)
|
||||
const bool EXACT_MATCH = value[0] == rhs.value[0] && value[1] == rhs.value[1];
|
||||
|
||||
// Flipped Match: (B, idxB, A, idxA)
|
||||
const bool FLIPPED_MATCH = value[0] == rhs.value[1] && value[1] == rhs.value[0];
|
||||
|
||||
return EXACT_MATCH || FLIPPED_MATCH;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
EntityID SHCollisionKey::GetEntityA() const noexcept
|
||||
{
|
||||
return ids[ENTITY_A];
|
||||
}
|
||||
|
||||
EntityID SHCollisionKey::GetEntityB() const noexcept
|
||||
{
|
||||
return ids[ENTITY_B];
|
||||
}
|
||||
|
||||
uint32_t SHCollisionKey::GetShapeIndexA() const noexcept
|
||||
{
|
||||
return ids[SHAPE_INDEX_A];
|
||||
}
|
||||
|
||||
uint32_t SHCollisionKey::GetShapeIndexB() const noexcept
|
||||
{
|
||||
return ids[SHAPE_INDEX_B];
|
||||
}
|
||||
|
||||
const SHRigidBodyComponent* SHCollisionKey::GetRigidBodyA() const noexcept
|
||||
{
|
||||
return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_A]);
|
||||
}
|
||||
|
||||
const SHRigidBodyComponent* SHCollisionKey::GetRigidBodyB() const noexcept
|
||||
{
|
||||
return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_B]);
|
||||
}
|
||||
|
||||
const SHCollisionShape* SHCollisionKey::GetCollisionShapeA() const noexcept
|
||||
{
|
||||
const auto* COLLIDER_COMPONENT = SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_A]);
|
||||
return COLLIDER_COMPONENT->GetCollider()->GetCollisionShape(ids[SHAPE_INDEX_A]);
|
||||
}
|
||||
|
||||
const SHCollisionShape* SHCollisionKey::GetCollisionShapeB() const noexcept
|
||||
{
|
||||
const auto* COLLIDER_COMPONENT = SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_B]);
|
||||
return COLLIDER_COMPONENT->GetCollider()->GetCollisionShape(ids[SHAPE_INDEX_B]);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionKey::SetEntityA(EntityID entityID) noexcept
|
||||
{
|
||||
ids[ENTITY_A] = entityID;
|
||||
}
|
||||
|
||||
void SHCollisionKey::SetEntityB(EntityID entityID) noexcept
|
||||
{
|
||||
ids[ENTITY_B] = entityID;
|
||||
}
|
||||
|
||||
void SHCollisionKey::SetCollisionShapeA(uint32_t shapeIndexA) noexcept
|
||||
{
|
||||
ids[SHAPE_INDEX_A] = shapeIndexA;
|
||||
}
|
||||
|
||||
void SHCollisionKey::SetCollisionShapeB(uint32_t shapeIndexB) noexcept
|
||||
{
|
||||
ids[SHAPE_INDEX_B] = shapeIndexB;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
std::size_t SHCollisionKeyHash::operator()(const SHCollisionKey& id) const
|
||||
{
|
||||
static constexpr int NUM_IDS = ARRAYSIZE(id.ids);
|
||||
|
||||
// Hashable is not a word. Sue me.
|
||||
auto hashablePtr = reinterpret_cast<std::basic_string_view<char32_t>::const_pointer>(id.ids);
|
||||
return std::hash<std::u32string_view>{}(std::u32string_view(hashablePtr, NUM_IDS));
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,72 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHManifold.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collision Manifold
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
#include "Physics/Collision/Shapes/SHCollisionShape.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a value that represents the touching features of a contact.
|
||||
*/
|
||||
union SHContactFeatures
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct
|
||||
{
|
||||
uint8_t inI; // Incoming Incident Edge
|
||||
uint8_t outI; // Outgoing Incident Edge
|
||||
uint8_t inR; // Incoming Reference Edge
|
||||
uint8_t outR; // Outgoing Reference Edge
|
||||
};
|
||||
|
||||
uint32_t key = std::numeric_limits<uint32_t>::max();
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a physical collision contact.
|
||||
*/
|
||||
struct SH_API SHContact
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr int NUM_TANGENTS = 2;
|
||||
|
||||
float penetration = 0.0f;
|
||||
float bias = 0.0f; // Restitution + Baumguarte factor
|
||||
float normalImpulse = 0.0f; // Accumulated normal impulse
|
||||
float normalMass = 0.0f; // Effective mass along the normal
|
||||
float tangentImpulse[NUM_TANGENTS] = { 0.0f }; // Accumulated tangent impulses
|
||||
float tangentMass[NUM_TANGENTS] = { 0.0f }; // Effective masses along the tangents
|
||||
|
||||
SHVec3 position;
|
||||
SHVec3 rA; // Vector from COM of A to the contact
|
||||
SHVec3 rB; // Vector from COM of B to the contact
|
||||
SHContactFeatures featurePair;
|
||||
};
|
||||
}
|
||||
|
||||
#pragma once
|
|
@ -1,73 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHManifold.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collision Manifold
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
#include "Physics/Collision/Narrowphase/SHSATInfo.h"
|
||||
#include "Physics/Collision/Shapes/SHCollisionShape.h"
|
||||
#include "SHContact.h"
|
||||
#include "SHCollisionEvents.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
struct SH_API SHManifold
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHManifold (SHCollisionShape* a, SHCollisionShape* b) noexcept;
|
||||
SHManifold (const SHManifold& rhs) noexcept;
|
||||
SHManifold (SHManifold&& rhs) noexcept;
|
||||
|
||||
~SHManifold () noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHManifold& operator=(const SHManifold& rhs) noexcept;
|
||||
SHManifold& operator=(SHManifold&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// We only need 4 contact points to build a stable manifold.
|
||||
static constexpr int MAX_NUM_CONTACTS = 4;
|
||||
|
||||
SHCollisionShape* shapeA;
|
||||
SHCollisionShape* shapeB;
|
||||
|
||||
SHRigidBody* bodyA = nullptr;
|
||||
SHRigidBody* bodyB = nullptr;
|
||||
|
||||
uint32_t numContacts = 0;
|
||||
SHCollisionState state = SHCollisionState::INVALID;
|
||||
|
||||
SHSATInfo cachedSATInfo;
|
||||
|
||||
SHVec3 normal;
|
||||
SHVec3 tangents[SHContact::NUM_TANGENTS];
|
||||
SHContact contacts[MAX_NUM_CONTACTS];
|
||||
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
||||
|
||||
#include "SHManifold.hpp"
|
||||
|
|
@ -1,110 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHManifold.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collision Manifold
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "SHManifold.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline SHManifold::SHManifold(SHCollisionShape* a, SHCollisionShape* b) noexcept
|
||||
: shapeA { a }
|
||||
, shapeB { b }
|
||||
{
|
||||
bodyA = shapeA->collider->rigidBody;
|
||||
bodyB = shapeB->collider->rigidBody;
|
||||
}
|
||||
|
||||
inline SHManifold::SHManifold(const SHManifold& rhs) noexcept
|
||||
: shapeA { rhs.shapeA }
|
||||
, shapeB { rhs.shapeB }
|
||||
, bodyA { rhs.bodyA }
|
||||
, bodyB { rhs.bodyB }
|
||||
, numContacts { rhs.numContacts }
|
||||
, state { rhs.state }
|
||||
, cachedSATInfo { rhs.cachedSATInfo }
|
||||
, normal { rhs.normal }
|
||||
{
|
||||
static constexpr size_t SIZE_OF_CONTACTS = sizeof(SHContact) * static_cast<size_t>(MAX_NUM_CONTACTS);
|
||||
memcpy_s(contacts, SIZE_OF_CONTACTS, rhs.contacts, SIZE_OF_CONTACTS);
|
||||
|
||||
for (int i = 0; i < SHContact::NUM_TANGENTS; ++i)
|
||||
tangents[i] = rhs.tangents[i];
|
||||
}
|
||||
|
||||
inline SHManifold::SHManifold(SHManifold&& rhs) noexcept
|
||||
: shapeA { rhs.shapeA }
|
||||
, shapeB { rhs.shapeB }
|
||||
, bodyA { rhs.bodyA }
|
||||
, bodyB { rhs.bodyB }
|
||||
, numContacts { rhs.numContacts }
|
||||
, state { rhs.state }
|
||||
, cachedSATInfo { rhs.cachedSATInfo }
|
||||
, normal { rhs.normal }
|
||||
{
|
||||
static constexpr size_t SIZE_OF_CONTACTS = sizeof(SHContact) * static_cast<size_t>(MAX_NUM_CONTACTS);
|
||||
memcpy_s(contacts, SIZE_OF_CONTACTS, rhs.contacts, SIZE_OF_CONTACTS);
|
||||
|
||||
for (int i = 0; i < SHContact::NUM_TANGENTS; ++i)
|
||||
tangents[i] = rhs.tangents[i];
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline SHManifold& SHManifold::operator=(const SHManifold& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
shapeA = rhs.shapeA;
|
||||
shapeB = rhs.shapeB;
|
||||
bodyA = rhs.bodyA;
|
||||
bodyB = rhs.bodyB;
|
||||
numContacts = rhs.numContacts;
|
||||
state = rhs.state;
|
||||
cachedSATInfo = rhs.cachedSATInfo;
|
||||
normal = rhs.normal;
|
||||
|
||||
static constexpr size_t SIZE_OF_CONTACTS = sizeof(SHContact) * static_cast<size_t>(MAX_NUM_CONTACTS);
|
||||
memcpy_s(contacts, SIZE_OF_CONTACTS, rhs.contacts, SIZE_OF_CONTACTS);
|
||||
|
||||
for (int i = 0; i < SHContact::NUM_TANGENTS; ++i)
|
||||
tangents[i] = rhs.tangents[i];
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
inline SHManifold& SHManifold::operator=(SHManifold&& rhs) noexcept
|
||||
{
|
||||
shapeA = rhs.shapeA;
|
||||
shapeB = rhs.shapeB;
|
||||
bodyA = rhs.bodyA;
|
||||
bodyB = rhs.bodyB;
|
||||
numContacts = rhs.numContacts;
|
||||
state = rhs.state;
|
||||
cachedSATInfo = rhs.cachedSATInfo;
|
||||
normal = rhs.normal;
|
||||
|
||||
static constexpr size_t SIZE_OF_CONTACTS = sizeof(SHContact) * static_cast<size_t>(MAX_NUM_CONTACTS);
|
||||
memcpy_s(contacts, SIZE_OF_CONTACTS, rhs.contacts, SIZE_OF_CONTACTS);
|
||||
|
||||
for (int i = 0; i < SHContact::NUM_TANGENTS; ++i)
|
||||
tangents[i] = rhs.tangents[i];
|
||||
|
||||
return *this;
|
||||
}
|
||||
} // namespace SHADE
|
|
@ -1,49 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCapsuleVsConvex.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between a capsule and a convex
|
||||
* polyhedron.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/Collision/Shapes/SHConvexPolyhedron.h"
|
||||
|
||||
// TODO
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::CapsuleVsConvex(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return false;
|
||||
}
|
||||
|
||||
bool SHCollision::ConvexVsCapsule(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return CapsuleVsConvex(B, A);
|
||||
}
|
||||
|
||||
bool SHCollision::CapsuleVsConvex(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return false;
|
||||
}
|
||||
|
||||
bool SHCollision::ConvexVsCapsule(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return CapsuleVsConvex(manifold, B, A);
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,222 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollision.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for the Detecting Collisions between two shapes
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Math/Geometry/SHPlane.h"
|
||||
#include "Physics/Collision/Contacts/SHManifold.h"
|
||||
#include "Physics/Collision/Contacts/SHCollisionKey.h"
|
||||
#include "Physics/Collision/Shapes/SHHalfEdgeStructure.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates static methods for testing for collision between two shapes.
|
||||
*/
|
||||
class SH_API SHCollision
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/* Spheres VS X */
|
||||
|
||||
[[nodiscard]] static bool SphereVsSphere (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool SphereVsSphere (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool SphereVsCapsule (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool SphereVsCapsule (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool SphereVsConvex (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool SphereVsConvex (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
/* Capsule VS X */
|
||||
|
||||
[[nodiscard]] static bool CapsuleVsSphere (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool CapsuleVsSphere (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool CapsuleVsCapsule (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool CapsuleVsCapsule (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool CapsuleVsConvex (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool CapsuleVsConvex (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
/* Polygon VS X */
|
||||
|
||||
[[nodiscard]] static bool ConvexVsSphere (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool ConvexVsSphere (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool ConvexVsCapsule (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool ConvexVsCapsule (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
[[nodiscard]] static bool ConvexVsConvex (const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
[[nodiscard]] static bool ConvexVsConvex (SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct FaceQuery
|
||||
{
|
||||
bool colliding = false; // Allows for early out
|
||||
int32_t closestFace = -1;
|
||||
float bestDistance = std::numeric_limits<float>::lowest();
|
||||
};
|
||||
|
||||
struct EdgeQuery
|
||||
{
|
||||
int32_t halfEdgeA = -1;
|
||||
int32_t halfEdgeB = -1;
|
||||
int32_t axis = -1;
|
||||
float bestDistance = std::numeric_limits<float>::lowest();
|
||||
};
|
||||
|
||||
struct ClipVertex
|
||||
{
|
||||
SHVec3 position;
|
||||
SHContactFeatures featurePair;
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// Sphere VS Convex
|
||||
|
||||
static FaceQuery findClosestFace
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHConvexPolyhedron& polyhedron
|
||||
) noexcept;
|
||||
|
||||
static int32_t findClosestPoint
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHConvexPolyhedron& polyhedron
|
||||
, int32_t faceIndex
|
||||
) noexcept;
|
||||
|
||||
static int32_t findVoronoiRegion
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHVec3& faceVertex
|
||||
, const SHVec3& faceNormal
|
||||
, const SHVec3& tangent1
|
||||
, const SHVec3& tangent2
|
||||
) noexcept;
|
||||
|
||||
// Capsule VS Convex
|
||||
|
||||
// TODO: Capsule VS Convex uses the same gauss map optimisation as convex vs convex
|
||||
|
||||
// Convex VS Convex
|
||||
|
||||
/*
|
||||
* ! References
|
||||
* https://ia801303.us.archive.org/30/items/GDC2013Gregorius/GDC2013-Gregorius.pdf
|
||||
* https://github.com/RandyGaul/qu3e/blob/master/src/collision/q3Collide.cpp
|
||||
*/
|
||||
|
||||
static FaceQuery queryFaceDirections
|
||||
(
|
||||
const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
) noexcept;
|
||||
|
||||
|
||||
|
||||
static EdgeQuery queryEdgeDirections
|
||||
(
|
||||
const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
) noexcept;
|
||||
|
||||
static bool buildMinkowskiFace
|
||||
(
|
||||
const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
, int32_t edgeA
|
||||
, int32_t edgeB
|
||||
) noexcept;
|
||||
|
||||
static bool isMinkowskiFace
|
||||
(
|
||||
const SHVec3& a
|
||||
, const SHVec3& b
|
||||
, const SHVec3& c
|
||||
, const SHVec3& d
|
||||
) noexcept;
|
||||
|
||||
static float distanceBetweenEdges
|
||||
(
|
||||
const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
, int32_t edgeA
|
||||
, int32_t edgeB
|
||||
) noexcept;
|
||||
|
||||
static SHVec3 findClosestPointBetweenEdges
|
||||
(
|
||||
const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
, int32_t edgeA
|
||||
, int32_t edgeB
|
||||
) noexcept;
|
||||
|
||||
static int32_t findIncidentFace
|
||||
(
|
||||
const SHConvexPolyhedron& poly
|
||||
, const SHVec3& normal
|
||||
) noexcept;
|
||||
|
||||
static bool findFaceContacts
|
||||
(
|
||||
SHManifold& manifold
|
||||
, const SHConvexPolyhedron& incPoly
|
||||
, int32_t incFace
|
||||
, const SHConvexPolyhedron& refPoly
|
||||
, int32_t refFace
|
||||
, bool flip
|
||||
) noexcept;
|
||||
|
||||
static std::vector<ClipVertex> clipPolygonWithPlane
|
||||
(
|
||||
const std::vector<ClipVertex>& in
|
||||
, int32_t numIn
|
||||
, const SHPlane& plane
|
||||
, int32_t planeIdx
|
||||
) noexcept;
|
||||
|
||||
static std::vector<int32_t> reduceContacts
|
||||
(
|
||||
const std::vector<SHContact>& in
|
||||
, const SHVec3& faceNormal
|
||||
) noexcept;
|
||||
|
||||
// Cached Convex VS Convex
|
||||
|
||||
static bool cachedConvexVSConvex
|
||||
(
|
||||
SHManifold& manifold
|
||||
, const SHSATInfo& cachedInfo
|
||||
, const SHConvexPolyhedron& A
|
||||
, const SHConvexPolyhedron& B
|
||||
) noexcept;
|
||||
};
|
||||
} // namespace SHADE
|
|
@ -1,65 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionDispatch.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the static Collision Dispatcher
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionDispatch.h"
|
||||
|
||||
// Project Header
|
||||
#include "SHCollision.h"
|
||||
#include "Tools/Utilities/SHUtilities.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Static Data Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHCollisionDispatcher::ManifoldCollide SHCollisionDispatcher::manifoldCollide[NUM_SHAPES][NUM_SHAPES]
|
||||
{
|
||||
// <SHAPE> vs Sphere / Box / Capsule
|
||||
|
||||
{ SHCollision::SphereVsSphere, SHCollision::SphereVsConvex, SHCollision::SphereVsCapsule } // Sphere
|
||||
, { SHCollision::ConvexVsSphere, SHCollision::ConvexVsConvex, SHCollision::ConvexVsCapsule } // Box
|
||||
, { SHCollision::CapsuleVsSphere, SHCollision::CapsuleVsConvex, SHCollision::CapsuleVsCapsule } // Capsule
|
||||
};
|
||||
|
||||
const SHCollisionDispatcher::TriggerCollide SHCollisionDispatcher::triggerCollide[NUM_SHAPES][NUM_SHAPES]
|
||||
{
|
||||
// <SHAPE> vs Sphere / Box / Capsule
|
||||
|
||||
{ SHCollision::SphereVsSphere, SHCollision::SphereVsConvex, SHCollision::SphereVsCapsule } // Sphere
|
||||
, { SHCollision::ConvexVsSphere, SHCollision::ConvexVsConvex, SHCollision::ConvexVsCapsule } // Box
|
||||
, { SHCollision::CapsuleVsSphere, SHCollision::CapsuleVsConvex, SHCollision::CapsuleVsCapsule } // Capsule
|
||||
};
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollisionDispatcher::Collide(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
const int TYPE_A = SHUtilities::ConvertEnum(A.GetType());
|
||||
const int TYPE_B = SHUtilities::ConvertEnum(B.GetType());
|
||||
|
||||
return manifoldCollide[TYPE_A][TYPE_B](manifold, A, B);
|
||||
}
|
||||
|
||||
bool SHCollisionDispatcher::Collide(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
const int TYPE_A = SHUtilities::ConvertEnum(A.GetType());
|
||||
const int TYPE_B = SHUtilities::ConvertEnum(B.GetType());
|
||||
|
||||
return triggerCollide[TYPE_A][TYPE_B](A, B);
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,822 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHConvexVsConvex.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between two convex polyhedrons.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Math/Geometry/SHPlane.h"
|
||||
#include "Physics/Collision/Shapes/SHConvexPolyhedron.h"
|
||||
#include "Physics/SHPhysicsConstants.h"
|
||||
#include "Tools/Utilities/SHUtilities.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::ConvexVsConvex(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
const SHConvexPolyhedron& POLY_A = dynamic_cast<const SHConvexPolyhedron&>(A);
|
||||
const SHConvexPolyhedron& POLY_B = dynamic_cast<const SHConvexPolyhedron&>(B);
|
||||
|
||||
const FaceQuery FACE_QUERY_A = queryFaceDirections(POLY_A, POLY_B);
|
||||
if (FACE_QUERY_A.bestDistance > 0.0f)
|
||||
return false;
|
||||
|
||||
const FaceQuery FACE_QUERY_B = queryFaceDirections(POLY_B, POLY_A);
|
||||
if (FACE_QUERY_B.bestDistance > 0.0f)
|
||||
return false;
|
||||
|
||||
const EdgeQuery EDGE_QUERY = queryEdgeDirections(POLY_A, POLY_B);
|
||||
if (EDGE_QUERY.bestDistance > 0.0f)
|
||||
return false;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
bool SHCollision::ConvexVsConvex(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
static constexpr float ABSOLUTE_TOLERANCE = 0.01f; // 0.0005
|
||||
static constexpr float RELATIVE_TOLERANCE = 0.95f; // 1.0002
|
||||
|
||||
const SHConvexPolyhedron& POLY_A = dynamic_cast<const SHConvexPolyhedron&>(A);
|
||||
const SHConvexPolyhedron& POLY_B = dynamic_cast<const SHConvexPolyhedron&>(B);
|
||||
|
||||
if (manifold.cachedSATInfo.type != SHSATInfo::Type::INVALID)
|
||||
return cachedConvexVSConvex(manifold, manifold.cachedSATInfo, POLY_A, POLY_B);
|
||||
|
||||
SHSATInfo cachedInfo;
|
||||
|
||||
const FaceQuery FACE_QUERY_A = queryFaceDirections(POLY_A, POLY_B);
|
||||
if (FACE_QUERY_A.bestDistance > 0.0f)
|
||||
{
|
||||
// cache the info
|
||||
cachedInfo.type = SHSATInfo::Type::FACE;
|
||||
cachedInfo.info.refPoly = SHSATInfo::ShapeID::A;
|
||||
cachedInfo.info.refFace = FACE_QUERY_A.closestFace;
|
||||
|
||||
manifold.cachedSATInfo = cachedInfo;
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
|
||||
const FaceQuery FACE_QUERY_B = queryFaceDirections(POLY_B, POLY_A);
|
||||
if (FACE_QUERY_B.bestDistance > 0.0f)
|
||||
{
|
||||
// cache the info
|
||||
cachedInfo.type = SHSATInfo::Type::FACE;
|
||||
cachedInfo.info.refPoly = SHSATInfo::ShapeID::B;
|
||||
cachedInfo.info.refFace = FACE_QUERY_B.closestFace;
|
||||
|
||||
manifold.cachedSATInfo = cachedInfo;
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
const EdgeQuery EDGE_QUERY = queryEdgeDirections(POLY_A, POLY_B);
|
||||
if (EDGE_QUERY.bestDistance > 0.0f)
|
||||
{
|
||||
// cache the info
|
||||
cachedInfo.type = SHSATInfo::Type::EDGE;
|
||||
cachedInfo.info.edgeA = EDGE_QUERY.halfEdgeA;
|
||||
cachedInfo.info.edgeB = EDGE_QUERY.halfEdgeB;
|
||||
|
||||
manifold.cachedSATInfo = cachedInfo;
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
// Apply weight to improve frame coherence of normal directions.
|
||||
// We want a normal in the direction from A -> B, so we flip the normal if needed.
|
||||
bool flipNormal = false;
|
||||
const SHConvexPolyhedron* referencePoly = nullptr;
|
||||
const SHConvexPolyhedron* incidentPoly = nullptr;
|
||||
|
||||
FaceQuery minFaceQuery;
|
||||
if (FACE_QUERY_A.bestDistance + ABSOLUTE_TOLERANCE > FACE_QUERY_B.bestDistance * RELATIVE_TOLERANCE)
|
||||
{
|
||||
minFaceQuery = FACE_QUERY_A;
|
||||
referencePoly = &POLY_A;
|
||||
incidentPoly = &POLY_B;
|
||||
flipNormal = false;
|
||||
|
||||
cachedInfo.type = SHSATInfo::Type::FACE;
|
||||
cachedInfo.info.refPoly = SHSATInfo::ShapeID::A;
|
||||
cachedInfo.info.refFace = minFaceQuery.closestFace;
|
||||
}
|
||||
else
|
||||
{
|
||||
minFaceQuery = FACE_QUERY_B;
|
||||
referencePoly = &POLY_B;
|
||||
incidentPoly = &POLY_A;
|
||||
flipNormal = true;
|
||||
|
||||
cachedInfo.type = SHSATInfo::Type::FACE;
|
||||
cachedInfo.info.refPoly = SHSATInfo::ShapeID::B;
|
||||
cachedInfo.info.refFace = minFaceQuery.closestFace;
|
||||
}
|
||||
|
||||
|
||||
|
||||
|
||||
// If an edge pair contains the closest distance,vwe ignore any face queries and find the closest points on
|
||||
// each edge and use that as the contact point.
|
||||
if (EDGE_QUERY.bestDistance * RELATIVE_TOLERANCE > minFaceQuery.bestDistance + ABSOLUTE_TOLERANCE)
|
||||
{
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_A = POLY_A.GetHalfEdge(EDGE_QUERY.halfEdgeA);
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_B = POLY_B.GetHalfEdge(EDGE_QUERY.halfEdgeB);
|
||||
|
||||
const SHVec3 HEAD_A = POLY_A.GetVertex(HALF_EDGE_A.headVertexIndex);
|
||||
const SHVec3 TAIL_A = POLY_A.GetVertex(HALF_EDGE_A.tailVertexIndex);
|
||||
const SHVec3 HEAD_B = POLY_B.GetVertex(HALF_EDGE_B.headVertexIndex);
|
||||
const SHVec3 TAIL_B = POLY_B.GetVertex(HALF_EDGE_B.tailVertexIndex);
|
||||
|
||||
const SHVec3 VA = SHVec3::Normalise(HEAD_A - TAIL_A);
|
||||
const SHVec3 VB = SHVec3::Normalise(HEAD_B - TAIL_B);
|
||||
|
||||
manifold.normal = SHVec3::Cross(VB, VA);
|
||||
// Flip normal if need to ( A -> B)
|
||||
if (SHVec3::Dot(manifold.normal, HEAD_A - A.GetWorldCentroid()) < 0.0f)
|
||||
manifold.normal = -manifold.normal;
|
||||
|
||||
// In this scenario, we only have one contact
|
||||
uint32_t numContacts = 0;
|
||||
|
||||
SHContact contact;
|
||||
contact.featurePair.key = EDGE_QUERY.axis;
|
||||
contact.position = findClosestPointBetweenEdges(POLY_A, POLY_B, EDGE_QUERY.halfEdgeA, EDGE_QUERY.halfEdgeB);
|
||||
contact.penetration = -EDGE_QUERY.bestDistance;
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
manifold.numContacts = numContacts;
|
||||
|
||||
// Cache the info
|
||||
cachedInfo.type = SHSATInfo::Type::EDGE;
|
||||
cachedInfo.info.edgeA = EDGE_QUERY.halfEdgeA;
|
||||
cachedInfo.info.edgeB = EDGE_QUERY.halfEdgeB;
|
||||
|
||||
manifold.cachedSATInfo = cachedInfo;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
const SHVec3 REFERENCE_NORMAL = referencePoly->GetNormal(minFaceQuery.closestFace);
|
||||
const int32_t INCIDENT_FACE_IDX = findIncidentFace(*incidentPoly, REFERENCE_NORMAL);
|
||||
|
||||
manifold.cachedSATInfo = cachedInfo;
|
||||
return findFaceContacts(manifold, *incidentPoly, INCIDENT_FACE_IDX, *referencePoly, minFaceQuery.closestFace, flipNormal);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollision::FaceQuery SHCollision::queryFaceDirections(const SHConvexPolyhedron& A, const SHConvexPolyhedron& B) noexcept
|
||||
{
|
||||
FaceQuery faceQuery;
|
||||
|
||||
const int32_t NUM_FACES = A.GetFaceCount();
|
||||
for (const int32_t i : std::views::iota(0, NUM_FACES))
|
||||
{
|
||||
const SHHalfEdgeStructure::Face& FACE_A = A.GetFace(i);
|
||||
const SHVec3 NORMAL_A = A.GetNormal(i);
|
||||
|
||||
// Smallest penetration is point closest to face normal
|
||||
const SHVec3 SUPPORT_POINT = B.FindSupportPoint(-NORMAL_A);
|
||||
|
||||
const SHVec3 VERTEX_A = A.GetVertex(FACE_A.vertexIndices[0].index);
|
||||
|
||||
const SHPlane FACE_PLANE { VERTEX_A, NORMAL_A };
|
||||
const float DISTANCE = FACE_PLANE.SignedDistance(SUPPORT_POINT);
|
||||
|
||||
if (DISTANCE > faceQuery.bestDistance)
|
||||
{
|
||||
faceQuery.bestDistance = DISTANCE;
|
||||
faceQuery.closestFace = i;
|
||||
}
|
||||
}
|
||||
|
||||
return faceQuery;
|
||||
}
|
||||
|
||||
SHCollision::EdgeQuery SHCollision::queryEdgeDirections(const SHConvexPolyhedron& A, const SHConvexPolyhedron& B) noexcept
|
||||
{
|
||||
EdgeQuery edgeQuery;
|
||||
|
||||
const int32_t EDGE_COUNT_A = A.GetHalfEdgeCount();
|
||||
const int32_t EDGE_COUNT_B = B.GetHalfEdgeCount();
|
||||
|
||||
int32_t axis = -1;
|
||||
for (int32_t i = 0; i < EDGE_COUNT_A; i += 2)
|
||||
{
|
||||
for (int32_t j = 0; j < EDGE_COUNT_B; j += 2)
|
||||
{
|
||||
const bool IS_MINKOWSKI_FACE = buildMinkowskiFace(A, B, i, j);
|
||||
if (!IS_MINKOWSKI_FACE)
|
||||
continue;
|
||||
|
||||
++axis;
|
||||
|
||||
const float SEPARATION = distanceBetweenEdges(A, B, i, j);
|
||||
if (SEPARATION > edgeQuery.bestDistance)
|
||||
{
|
||||
edgeQuery.bestDistance = SEPARATION;
|
||||
edgeQuery.halfEdgeA = i;
|
||||
edgeQuery.halfEdgeB = j;
|
||||
edgeQuery.axis = axis;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return edgeQuery;
|
||||
}
|
||||
|
||||
bool SHCollision::buildMinkowskiFace(const SHConvexPolyhedron& A, const SHConvexPolyhedron& B, int32_t edgeA, int32_t edgeB) noexcept
|
||||
{
|
||||
// Get Half Edge from both polygons
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_A = A.GetHalfEdge(edgeA);
|
||||
const SHHalfEdgeStructure::HalfEdge& TWIN_EDGE_A = A.GetHalfEdge(HALF_EDGE_A.twinEdgeIndex);
|
||||
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_B = B.GetHalfEdge(edgeB);
|
||||
const SHHalfEdgeStructure::HalfEdge& TWIN_EDGE_B = B.GetHalfEdge(HALF_EDGE_B.twinEdgeIndex);
|
||||
|
||||
|
||||
|
||||
// Get normals from face and twin edge face
|
||||
const SHVec3 NA = A.GetNormal(HALF_EDGE_A.faceIndex);
|
||||
const SHVec3 NB = A.GetNormal(TWIN_EDGE_A.faceIndex);
|
||||
const SHVec3 NC = B.GetNormal(HALF_EDGE_B.faceIndex);
|
||||
const SHVec3 ND = B.GetNormal(TWIN_EDGE_B.faceIndex);
|
||||
|
||||
return isMinkowskiFace(NA, NB, -NC, -ND);
|
||||
}
|
||||
|
||||
bool SHCollision::isMinkowskiFace(const SHVec3& a, const SHVec3& b, const SHVec3& c, const SHVec3& d) noexcept
|
||||
{
|
||||
const SHVec3 BXA = SHVec3::Cross(b, a);
|
||||
const SHVec3 DXC = SHVec3::Cross(d, c);
|
||||
|
||||
const float CBA = SHVec3::Dot(c, BXA);
|
||||
const float DBA = SHVec3::Dot(d, BXA);
|
||||
const float ADC = SHVec3::Dot(a, DXC);
|
||||
const float BDC = SHVec3::Dot(b, DXC);
|
||||
|
||||
return CBA * DBA < 0.0f && ADC * BDC < 0.0f && CBA * BDC > 0.0f;
|
||||
}
|
||||
|
||||
float SHCollision::distanceBetweenEdges(const SHConvexPolyhedron& A, const SHConvexPolyhedron& B, int32_t edgeA, int32_t edgeB) noexcept
|
||||
{
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_A = A.GetHalfEdge(edgeA);
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_B = B.GetHalfEdge(edgeB);
|
||||
|
||||
const SHVec3 HEAD_A = A.GetVertex(HALF_EDGE_A.headVertexIndex);
|
||||
const SHVec3 TAIL_A = A.GetVertex(HALF_EDGE_A.tailVertexIndex);
|
||||
const SHVec3 HEAD_B = B.GetVertex(HALF_EDGE_B.headVertexIndex);
|
||||
const SHVec3 TAIL_B = B.GetVertex(HALF_EDGE_B.tailVertexIndex);
|
||||
|
||||
const SHVec3 DIR_A = SHVec3::Normalise(HEAD_A - TAIL_A);
|
||||
const SHVec3 DIR_B = SHVec3::Normalise(HEAD_B - TAIL_B);
|
||||
|
||||
// Check if the edges are parallel (abs dot product is 1)
|
||||
const float DOT_BETWEEN_EDGES = std::fabs(SHVec3::Dot(DIR_A, DIR_B));
|
||||
if (SHMath::CompareFloat(DOT_BETWEEN_EDGES, 1.0f))
|
||||
return std::numeric_limits<float>::lowest();
|
||||
|
||||
SHVec3 normal = SHVec3::Cross(DIR_A, DIR_B);
|
||||
// Flip normal if need to ( A -> B)
|
||||
if (SHVec3::Dot(normal, HEAD_A - A.GetWorldCentroid()) < 0.0f)
|
||||
normal = -normal;
|
||||
|
||||
return SHVec3::Dot(normal, HEAD_B - HEAD_A);
|
||||
}
|
||||
|
||||
SHVec3 SHCollision::findClosestPointBetweenEdges(const SHConvexPolyhedron& A, const SHConvexPolyhedron& B, int32_t edgeA, int32_t edgeB) noexcept
|
||||
{
|
||||
/*
|
||||
* The two edges can be parameterised in the form p + tv
|
||||
*
|
||||
* LA(r) = A + rVA
|
||||
* LB(s) = B + sVB
|
||||
*
|
||||
* The vector between the closest points is the cross product of VA and VB.
|
||||
* Since the cross product is orthogonal to VA and VB, we can generalise this as:
|
||||
* (LB(s) - LA(r)) /dot VA = 0
|
||||
* (LB(s) - LA(r)) /dot VB = 0
|
||||
*
|
||||
* Where LB(s) - LA(r) is the same vector as VB X VA.
|
||||
*
|
||||
*/
|
||||
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_A = A.GetHalfEdge(edgeA);
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_B = B.GetHalfEdge(edgeB);
|
||||
|
||||
const SHVec3 HEAD_A = A.GetVertex(HALF_EDGE_A.headVertexIndex);
|
||||
const SHVec3 TAIL_A = A.GetVertex(HALF_EDGE_A.tailVertexIndex);
|
||||
const SHVec3 HEAD_B = B.GetVertex(HALF_EDGE_B.headVertexIndex);
|
||||
const SHVec3 TAIL_B = B.GetVertex(HALF_EDGE_B.tailVertexIndex);
|
||||
|
||||
const SHVec3 VA = SHVec3::Normalise(HEAD_A - TAIL_A);
|
||||
const SHVec3 VB = SHVec3::Normalise(HEAD_B - TAIL_B);
|
||||
|
||||
/*
|
||||
* Find a1, a2, b1, b2, c1, c2 to solve the simultaneous equation
|
||||
*
|
||||
* C' = TAIL_B - TAIL_A
|
||||
*
|
||||
* a = VB /dot U
|
||||
* b = -VA /dot U
|
||||
* c = C' /dot U
|
||||
*
|
||||
* U is either VA or VB
|
||||
*
|
||||
* TODO: Check if segments degenerate into a point
|
||||
*/
|
||||
|
||||
const SHVec3 C = TAIL_B - TAIL_A;
|
||||
|
||||
const float VB_DOT_VA = SHVec3::Dot(VB, VA); // a1
|
||||
const float VB_DOT_VB = SHVec3::Dot(VB, VB); // a2
|
||||
const float AV_DOT_VA = SHVec3::Dot(-VA, VA); // b1
|
||||
const float AV_DOT_VB = SHVec3::Dot(-VA, VB); // b2
|
||||
const float C_DOT_VA = SHVec3::Dot(C, VA); // c1
|
||||
const float C_DOT_VB = SHVec3::Dot(C, VB); // c2
|
||||
|
||||
/*
|
||||
* We only need to solve for R
|
||||
* R = (c1a2 / a1 - c2) / ( b2 - a2b1/a1 )
|
||||
*/
|
||||
|
||||
const float A2_OVER_A1 = VB_DOT_VA == 0.0f ? 0.0f : VB_DOT_VB / VB_DOT_VA;
|
||||
const float NUMERATOR = C_DOT_VA * A2_OVER_A1 - C_DOT_VB;
|
||||
const float DENOMINATOR = AV_DOT_VB - AV_DOT_VA * A2_OVER_A1;
|
||||
|
||||
// We clamp it because the factor cannot be beyond [0,1] as it would be beyond the segment if it was so.
|
||||
const float R = DENOMINATOR == 0.0f ? NUMERATOR : NUMERATOR / DENOMINATOR;
|
||||
|
||||
// Just take a point from A since it's A -> B
|
||||
return TAIL_A + R * VA;
|
||||
}
|
||||
|
||||
int32_t SHCollision::findIncidentFace(const SHConvexPolyhedron& poly, const SHVec3& normal) noexcept
|
||||
{
|
||||
// Get the most anti-parallel face to the normal
|
||||
int32_t bestFace = 0;
|
||||
float bestProjection = std::numeric_limits<float>::max();
|
||||
|
||||
const int32_t NUM_FACES = poly.GetFaceCount();
|
||||
for (const int32_t i : std::views::iota(0, NUM_FACES))
|
||||
{
|
||||
const SHVec3 INC_NORMAL = poly.GetNormal(i);
|
||||
const float PROJECTION = SHVec3::Dot(INC_NORMAL, normal);
|
||||
|
||||
if (PROJECTION < bestProjection)
|
||||
{
|
||||
bestProjection = PROJECTION;
|
||||
bestFace = i;
|
||||
}
|
||||
}
|
||||
|
||||
return bestFace;
|
||||
}
|
||||
|
||||
bool SHCollision::findFaceContacts(SHManifold& manifold, const SHConvexPolyhedron& incPoly, int32_t incFace, const SHConvexPolyhedron& refPoly, int32_t refFace, bool flip) noexcept
|
||||
{
|
||||
const SHHalfEdgeStructure::Face& INCIDENT_FACE = incPoly.GetFace(incFace);
|
||||
const SHHalfEdgeStructure::Face& REFERENCE_FACE = refPoly.GetFace(refFace);
|
||||
|
||||
const int32_t NUM_INCIDENT_VERTICES = static_cast<int32_t>(INCIDENT_FACE.vertexIndices.size());
|
||||
const int32_t NUM_REFERENCE_VERTICES = static_cast<int32_t>(REFERENCE_FACE.vertexIndices.size());
|
||||
|
||||
// Build incoming vertices to clip
|
||||
std::vector<ClipVertex> clipIn;
|
||||
clipIn.resize(NUM_INCIDENT_VERTICES * 2, ClipVertex{});
|
||||
|
||||
int32_t numClipIn = 0;
|
||||
for (int32_t i = 0; i < NUM_INCIDENT_VERTICES; ++i)
|
||||
{
|
||||
const int32_t prevI = i - 1 < 0 ? NUM_INCIDENT_VERTICES - 1 : i - 1;
|
||||
|
||||
const int32_t V_INDEX = INCIDENT_FACE.vertexIndices[i].index;
|
||||
|
||||
// The incoming id is the previous edge
|
||||
// The outgoing id is the current edge (where this vertex is the tail of)
|
||||
|
||||
ClipVertex v;
|
||||
v.position = incPoly.GetVertex(V_INDEX);
|
||||
v.featurePair.inI = INCIDENT_FACE.vertexIndices[prevI].edgeIndex;
|
||||
v.featurePair.outI = INCIDENT_FACE.vertexIndices[i].edgeIndex;
|
||||
v.featurePair.inR = 0;
|
||||
v.featurePair.outR = 0;
|
||||
|
||||
clipIn[numClipIn++] = v;
|
||||
}
|
||||
|
||||
// Clip the vertices against the reference face side planes.
|
||||
// Number of side planes == number of edges == number of vertices
|
||||
const SHVec3 REF_NORMAL = refPoly.GetNormal(refFace);
|
||||
for (int32_t i = 0; i < NUM_REFERENCE_VERTICES; ++i)
|
||||
{
|
||||
// Side plane can be built with the vertex on the edge and the plane's normal
|
||||
// Plane normal = faceNormal X tangent (v2 - v1)
|
||||
|
||||
const int32_t V1_INDEX = REFERENCE_FACE.vertexIndices[i].index;
|
||||
const int32_t V2_INDEX = REFERENCE_FACE.vertexIndices[(i + 1) % NUM_REFERENCE_VERTICES].index;
|
||||
|
||||
const SHVec3 V1 = refPoly.GetVertex(V1_INDEX);
|
||||
const SHVec3 V2 = refPoly.GetVertex(V2_INDEX);
|
||||
|
||||
const SHVec3 TANGENT = SHVec3::Normalise(V2 - V1);
|
||||
const SHPlane CLIP_PLANE { V1, SHVec3::Cross(REF_NORMAL, TANGENT) };
|
||||
|
||||
std::vector<ClipVertex> clipOut = clipPolygonWithPlane(clipIn, numClipIn, CLIP_PLANE, REFERENCE_FACE.vertexIndices[i].edgeIndex);
|
||||
if (clipOut.empty())
|
||||
return false;
|
||||
|
||||
// Replace the clip container's contents with the clipped points for the next clipping pass
|
||||
const int32_t NUM_CLIPPED = static_cast<int32_t>(clipOut.size());
|
||||
for (int32_t clippedIndex = 0; clippedIndex < NUM_CLIPPED; ++clippedIndex)
|
||||
{
|
||||
clipIn[clippedIndex].position = clipOut[clippedIndex].position;
|
||||
clipIn[clippedIndex].featurePair.key = clipOut[clippedIndex].featurePair.key;
|
||||
}
|
||||
numClipIn = NUM_CLIPPED;
|
||||
}
|
||||
|
||||
// From the final set of clipped points, only keep the points that are below the reference plane.
|
||||
const SHPlane REFERENCE_PLANE{ refPoly.GetVertex(REFERENCE_FACE.vertexIndices.front().index), REF_NORMAL };
|
||||
|
||||
uint32_t numContacts = 0;
|
||||
|
||||
std::vector<SHContact> contacts;
|
||||
for (int32_t i = 0; i < numClipIn; ++i)
|
||||
{
|
||||
const SHVec3 POS = clipIn[i].position;
|
||||
const float DIST = REFERENCE_PLANE.SignedDistance(POS);
|
||||
if (DIST <= 0.0f)
|
||||
{
|
||||
SHContact contact;
|
||||
contact.position = POS;
|
||||
contact.penetration = -DIST;
|
||||
|
||||
if (flip)
|
||||
{
|
||||
contact.featurePair.inI = clipIn[i].featurePair.inR;
|
||||
contact.featurePair.inR = clipIn[i].featurePair.inI;
|
||||
contact.featurePair.outI = clipIn[i].featurePair.outR;
|
||||
contact.featurePair.outR = clipIn[i].featurePair.outI;
|
||||
}
|
||||
else
|
||||
{
|
||||
contact.featurePair.key = clipIn[i].featurePair.key;
|
||||
}
|
||||
|
||||
contacts.emplace_back(contact);
|
||||
++numContacts;
|
||||
}
|
||||
}
|
||||
|
||||
// Reduce contact manifold if more than 4 points
|
||||
if (numContacts > 4)
|
||||
{
|
||||
const auto INDICES_TO_KEEP = reduceContacts(contacts, REF_NORMAL);
|
||||
std::vector<SHContact> reducedContacts;
|
||||
|
||||
const int32_t NUM_REDUCED = static_cast<int32_t>(INDICES_TO_KEEP.size());
|
||||
for (int32_t i = 0; i < NUM_REDUCED; ++i)
|
||||
reducedContacts.emplace_back(contacts[INDICES_TO_KEEP[i]]);
|
||||
|
||||
contacts.clear();
|
||||
// Copy contacts to main container
|
||||
for (auto& contact : reducedContacts)
|
||||
contacts.emplace_back(contact);
|
||||
}
|
||||
|
||||
// Remove potential duplicate contact points
|
||||
// No way about this being an n^2 loop
|
||||
static constexpr float THRESHOLD = SHPHYSICS_SAME_CONTACT_DISTANCE * SHPHYSICS_SAME_CONTACT_DISTANCE;
|
||||
for (auto i = contacts.begin(); i != contacts.end(); ++i)
|
||||
{
|
||||
for (auto j = i + 1; j != contacts.end();)
|
||||
{
|
||||
const float D2 = SHVec3::DistanceSquared(i->position, j->position);
|
||||
if (D2 < THRESHOLD)
|
||||
j = contacts.erase(j);
|
||||
else
|
||||
++j;
|
||||
}
|
||||
}
|
||||
|
||||
// Copy final contacts into the manifold
|
||||
numContacts = static_cast<int32_t>(contacts.size());
|
||||
for (int32_t i = 0; i < numContacts; ++i)
|
||||
manifold.contacts[i] = contacts[i];
|
||||
|
||||
manifold.numContacts = numContacts;
|
||||
manifold.normal = REF_NORMAL;
|
||||
if (flip)
|
||||
manifold.normal = -manifold.normal;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
|
||||
std::vector<SHCollision::ClipVertex> SHCollision::clipPolygonWithPlane(const std::vector<ClipVertex>& in, int32_t numIn, const SHPlane& plane, int32_t planeIdx) noexcept
|
||||
{
|
||||
std::vector<ClipVertex> out;
|
||||
|
||||
int32_t v1Index = numIn - 1;
|
||||
int32_t v2Index = 0;
|
||||
|
||||
float v1Distance = plane.SignedDistance(in[v1Index].position);
|
||||
float v2Distance = 0.0f;
|
||||
|
||||
for (int32_t i = 0; i < numIn; ++i)
|
||||
{
|
||||
v2Index = i;
|
||||
|
||||
const SHVec3 v1Pos = in[v1Index].position;
|
||||
const SHVec3 v2Pos = in[v2Index].position;
|
||||
|
||||
v2Distance = plane.SignedDistance(v2Pos);
|
||||
|
||||
// v1 in front, v2 behind
|
||||
// keep the intersection point
|
||||
if (v1Distance >= 0.0f && v2Distance < 0.0f)
|
||||
{
|
||||
ClipVertex intersection;
|
||||
|
||||
// In case the edge is parallel, the intersection is just the start point
|
||||
const bool IS_PARALLEL = SHMath::CompareFloat(SHVec3::Dot(v2Pos - v1Pos, plane.GetNormal()), 0.0f);
|
||||
const float ALPHA = IS_PARALLEL ? 0.0f : v1Distance / SHVec3::Distance(v1Pos, v2Pos);
|
||||
|
||||
intersection.position = SHVec3::ClampedLerp(v1Pos, v2Pos, ALPHA);
|
||||
intersection.featurePair.inI = in[v1Index].featurePair.outI;
|
||||
intersection.featurePair.outI = 0;
|
||||
intersection.featurePair.inR = 0;
|
||||
intersection.featurePair.outR = planeIdx;
|
||||
|
||||
out.emplace_back(intersection);
|
||||
}
|
||||
|
||||
// v1 behind, v2 in front
|
||||
// keep intersection point & v2
|
||||
if(v1Distance < 0.0f && v2Distance >= 0.0f)
|
||||
{
|
||||
ClipVertex intersection;
|
||||
|
||||
// In case the edge is parallel, the intersection is just the start point
|
||||
const bool IS_PARALLEL = SHMath::CompareFloat(SHVec3::Dot(v2Pos - v1Pos, plane.GetNormal()), 0.0f);
|
||||
const float ALPHA = IS_PARALLEL ? 0.0f : -v1Distance / SHVec3::Distance(v1Pos, v2Pos);
|
||||
|
||||
intersection.position = SHVec3::ClampedLerp(v1Pos, v2Pos, ALPHA);
|
||||
intersection.featurePair.inI = 0;
|
||||
intersection.featurePair.outI = in[v2Index].featurePair.inI;
|
||||
intersection.featurePair.inR = planeIdx;
|
||||
intersection.featurePair.outR = 0;
|
||||
|
||||
out.emplace_back(intersection);
|
||||
out.emplace_back(in[v2Index]);
|
||||
}
|
||||
|
||||
// both in front, keep v2
|
||||
if (v1Distance >= 0.0f && v2Distance >= 0.0f)
|
||||
{
|
||||
out.emplace_back(in[v2Index]);
|
||||
}
|
||||
|
||||
// v2 is the next v1
|
||||
v1Index = v2Index;
|
||||
v1Distance = v2Distance;
|
||||
}
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
std::vector<int32_t> SHCollision::reduceContacts(const std::vector<SHContact>& in, const SHVec3& faceNormal) noexcept
|
||||
{
|
||||
std::vector<int32_t> indicesToKeep;
|
||||
|
||||
// Use a map to temporarily store and track the contacts we want
|
||||
std::unordered_map<int, const SHContact*> contactMap;
|
||||
const int32_t NUM_CONTACTS = static_cast<int32_t>(in.size());
|
||||
for (int32_t i = 0; i < NUM_CONTACTS; ++i)
|
||||
contactMap.emplace(i, &in[i]);
|
||||
|
||||
// Find the furthest point in a given direction
|
||||
int32_t indexToKeep = -1;
|
||||
float bestDistance = std::numeric_limits<float>::lowest();
|
||||
|
||||
for (const auto& [index, contact] : contactMap)
|
||||
{
|
||||
const float DIST = SHVec3::Dot(contact->position, SHVec3::One);
|
||||
if (DIST > bestDistance)
|
||||
{
|
||||
bestDistance = DIST;
|
||||
indexToKeep = index;
|
||||
}
|
||||
}
|
||||
|
||||
indicesToKeep.emplace_back(indexToKeep);
|
||||
contactMap.erase(indexToKeep);
|
||||
|
||||
|
||||
indexToKeep = -1;
|
||||
bestDistance = std::numeric_limits<float>::lowest();
|
||||
|
||||
// Find point furthest away from the first index
|
||||
const SHVec3& FIRST_POS = in[indicesToKeep.back()].position;
|
||||
for (const auto& [index, contact] : contactMap)
|
||||
{
|
||||
const float DIST_SQUARED = SHVec3::DistanceSquared(FIRST_POS, contact->position);
|
||||
if (DIST_SQUARED > bestDistance)
|
||||
{
|
||||
bestDistance = DIST_SQUARED;
|
||||
indexToKeep = index;
|
||||
}
|
||||
}
|
||||
|
||||
indicesToKeep.emplace_back(indexToKeep);
|
||||
contactMap.erase(indexToKeep);
|
||||
|
||||
indexToKeep = -1;
|
||||
|
||||
// We compute the triangle with the largest area.
|
||||
// The area can be positive or negative depending on the winding order.
|
||||
|
||||
float maxArea = std::numeric_limits<float>::lowest();
|
||||
float minArea = std::numeric_limits<float>::max();
|
||||
|
||||
int32_t maxAreaIndex = -1;
|
||||
int32_t minAreaIndex = -1;
|
||||
|
||||
const SHVec3& SECOND_POS = in[indicesToKeep.back()].position;
|
||||
for (const auto& [index, contact] : contactMap)
|
||||
{
|
||||
const SHVec3& POS = contact->position;
|
||||
const SHVec3 TO_P1 = FIRST_POS - POS;
|
||||
const SHVec3 TO_P2 = SECOND_POS - POS;
|
||||
|
||||
const float AREA = SHVec3::Dot(SHVec3::Cross(TO_P1, TO_P2), faceNormal) * 0.5f;
|
||||
|
||||
if (AREA > maxArea)
|
||||
{
|
||||
maxArea = AREA;
|
||||
maxAreaIndex = index;
|
||||
}
|
||||
|
||||
if (AREA < minArea)
|
||||
{
|
||||
minArea = AREA;
|
||||
minAreaIndex = index;
|
||||
}
|
||||
}
|
||||
|
||||
// Compare which triangle creates the largest area
|
||||
bool isAreaPositive = false;
|
||||
if (maxArea > (-minArea))
|
||||
{
|
||||
isAreaPositive = true;
|
||||
indexToKeep = maxAreaIndex;
|
||||
}
|
||||
else
|
||||
{
|
||||
isAreaPositive = false;
|
||||
indexToKeep = minAreaIndex;
|
||||
}
|
||||
|
||||
indicesToKeep.emplace_back(indexToKeep);
|
||||
contactMap.erase(indexToKeep);
|
||||
|
||||
indexToKeep = -1;
|
||||
|
||||
// For the last point, we want the point which forms the largest area that is winded opposite to the first triangle
|
||||
// The areas should be inverted: If area was -ve, we want a +ve. Otherwise, vice versa.
|
||||
float bestArea = 0.0f;
|
||||
|
||||
const SHVec3& THIRD_POS = in[indicesToKeep.back()].position;
|
||||
const SHVec3 ABC[3] = { FIRST_POS, SECOND_POS, THIRD_POS };
|
||||
|
||||
for (const auto& [index, contact] : contactMap)
|
||||
{
|
||||
const SHVec3& Q = contact->position;
|
||||
|
||||
for (int i = 0; i < 3; ++i)
|
||||
{
|
||||
const int P1 = i;
|
||||
const int P2 = (i + 1) % 3;
|
||||
|
||||
const SHVec3 TO_P1 = ABC[P1] - Q;
|
||||
const SHVec3 TO_P2 = ABC[P2] - Q;
|
||||
|
||||
const float AREA = SHVec3::Dot(SHVec3::Cross(TO_P1, TO_P2), faceNormal) * 0.5f;
|
||||
|
||||
if (isAreaPositive && AREA < bestArea)
|
||||
{
|
||||
bestArea = AREA;
|
||||
indexToKeep = index;
|
||||
}
|
||||
|
||||
if (!isAreaPositive && AREA > bestArea)
|
||||
{
|
||||
bestArea = AREA;
|
||||
indexToKeep = index;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
indicesToKeep.emplace_back(indexToKeep);
|
||||
return indicesToKeep;
|
||||
}
|
||||
|
||||
bool SHCollision::cachedConvexVSConvex(SHManifold& manifold, const SHSATInfo& cachedInfo, const SHConvexPolyhedron& A, const SHConvexPolyhedron& B) noexcept
|
||||
{
|
||||
if (cachedInfo.type == SHSATInfo::Type::FACE)
|
||||
{
|
||||
SHASSERT(cachedInfo.info.refPoly != SHSATInfo::ShapeID::INVALID, "Attempted to perform cached SAT with an invalid cached collision!")
|
||||
|
||||
// Assume the reference poly was A
|
||||
const SHConvexPolyhedron* incPoly = &B;
|
||||
const SHConvexPolyhedron* refPoly = &A;
|
||||
bool flip = false;
|
||||
|
||||
// Swap if it was B
|
||||
if (cachedInfo.info.refPoly == SHSATInfo::ShapeID::B)
|
||||
{
|
||||
refPoly = &B;
|
||||
incPoly = &A;
|
||||
flip = true;
|
||||
}
|
||||
|
||||
const SHHalfEdgeStructure::Face& REF_FACE = refPoly->GetFace(cachedInfo.info.refFace);
|
||||
const SHVec3 REF_NORMAL = refPoly->GetNormal(cachedInfo.info.refFace);
|
||||
|
||||
const SHVec3 SUPPORT_POINT = incPoly->FindSupportPoint(-REF_NORMAL);
|
||||
|
||||
const SHPlane REF_FACE_PLANE { refPoly->GetVertex(REF_FACE.vertexIndices[0].index), REF_NORMAL };
|
||||
const float DISTANCE = REF_FACE_PLANE.SignedDistance(SUPPORT_POINT);
|
||||
|
||||
if (DISTANCE > 0.0f)
|
||||
return false;
|
||||
|
||||
// Find the incident face
|
||||
const int32_t INCIDENT_FACE_INDEX = findIncidentFace(*incPoly, REF_NORMAL);
|
||||
|
||||
return findFaceContacts(manifold, *incPoly, INCIDENT_FACE_INDEX, *refPoly, cachedInfo.info.refFace, flip);
|
||||
}
|
||||
|
||||
if (cachedInfo.type == SHSATInfo::Type::EDGE)
|
||||
{
|
||||
const float DISTANCE = distanceBetweenEdges(A, B, cachedInfo.info.edgeA, cachedInfo.info.edgeB);
|
||||
if (DISTANCE > 0.0f)
|
||||
return false;
|
||||
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_A = A.GetHalfEdge(cachedInfo.info.edgeA);
|
||||
const SHHalfEdgeStructure::HalfEdge& HALF_EDGE_B = B.GetHalfEdge(cachedInfo.info.edgeB);
|
||||
|
||||
const SHVec3 HEAD_A = A.GetVertex(HALF_EDGE_A.headVertexIndex);
|
||||
const SHVec3 TAIL_A = A.GetVertex(HALF_EDGE_A.tailVertexIndex);
|
||||
const SHVec3 HEAD_B = B.GetVertex(HALF_EDGE_B.headVertexIndex);
|
||||
const SHVec3 TAIL_B = B.GetVertex(HALF_EDGE_B.tailVertexIndex);
|
||||
|
||||
const SHVec3 VA = SHVec3::Normalise(HEAD_A - TAIL_A);
|
||||
const SHVec3 VB = SHVec3::Normalise(HEAD_B - TAIL_B);
|
||||
|
||||
manifold.normal = SHVec3::Cross(VB, VA);
|
||||
// Flip normal if need to ( A -> B)
|
||||
if (SHVec3::Dot(manifold.normal, HEAD_A - A.GetWorldCentroid()) < 0.0f)
|
||||
manifold.normal = -manifold.normal;
|
||||
|
||||
// In this scenario, we only have one contact
|
||||
uint32_t numContacts = 0;
|
||||
|
||||
SHContact contact;
|
||||
// Take feature pair key from previous manifold
|
||||
contact.featurePair.key = manifold.contacts[0].featurePair.key;
|
||||
contact.position = findClosestPointBetweenEdges(A, B, cachedInfo.info.edgeA, cachedInfo.info.edgeB);
|
||||
contact.penetration = -DISTANCE;
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
manifold.numContacts = numContacts;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
// Should never reach this.
|
||||
return false;
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,87 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSATInfo.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for storing information of collision detection between two
|
||||
* convex shapes using SAT.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <numeric> // int32_t
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/**
|
||||
* @brief
|
||||
* Primarily used to cached collision information between two convex polyhedrons for
|
||||
* temporal coherence.
|
||||
*/
|
||||
struct SHSATInfo
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
enum class ShapeID : int32_t
|
||||
{
|
||||
A = 0
|
||||
, B = 1
|
||||
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
enum class Type
|
||||
{
|
||||
EDGE
|
||||
, FACE
|
||||
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
union ContactInfo
|
||||
{
|
||||
struct // FaceContact
|
||||
{
|
||||
ShapeID refPoly;
|
||||
int32_t refFace;
|
||||
};
|
||||
|
||||
struct // Edge Contact
|
||||
{
|
||||
int32_t edgeA;
|
||||
int32_t edgeB;
|
||||
};
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
Type type;
|
||||
ContactInfo info;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHSATInfo () noexcept;
|
||||
SHSATInfo (const SHSATInfo& rhs) noexcept;
|
||||
SHSATInfo (SHSATInfo&& rhs) noexcept;
|
||||
~SHSATInfo () noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHSATInfo& operator= (const SHSATInfo& rhs) noexcept;
|
||||
SHSATInfo& operator= (SHSATInfo&& rhs) noexcept;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
||||
|
||||
#include "SHSATInfo.hpp"
|
|
@ -1,71 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSATInfo.hpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation of inlined methods for cached SAT Info.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "SHSATInfo.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline SHSATInfo::SHSATInfo() noexcept
|
||||
: type { Type::INVALID }
|
||||
, info {}
|
||||
{
|
||||
info.refPoly = ShapeID::INVALID;
|
||||
info.refFace = -1;
|
||||
}
|
||||
|
||||
inline SHSATInfo::SHSATInfo(const SHSATInfo& rhs) noexcept
|
||||
: type { rhs.type }
|
||||
, info {}
|
||||
{
|
||||
info.refPoly = rhs.info.refPoly;
|
||||
info.refFace = rhs.info.refFace;
|
||||
|
||||
}
|
||||
|
||||
inline SHSATInfo::SHSATInfo(SHSATInfo&& rhs) noexcept
|
||||
: type { rhs.type }
|
||||
, info {}
|
||||
{
|
||||
info.refPoly = rhs.info.refPoly;
|
||||
info.refFace = rhs.info.refFace;
|
||||
}
|
||||
|
||||
/*---------------------------------------------------------------------------------- */
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------- */
|
||||
|
||||
inline SHSATInfo& SHSATInfo::operator=(const SHSATInfo& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
type = rhs.type;
|
||||
info.refPoly = rhs.info.refPoly;
|
||||
info.refFace = rhs.info.refFace;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
inline SHSATInfo& SHSATInfo::operator=(SHSATInfo&& rhs) noexcept
|
||||
{
|
||||
type = rhs.type;
|
||||
info.refPoly = rhs.info.refPoly;
|
||||
info.refFace = rhs.info.refFace;
|
||||
|
||||
return *this;
|
||||
}
|
||||
}
|
|
@ -1,48 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSphereVsCapsule.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between a sphere and a capsule.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/Collision/Shapes/SHSphere.h"
|
||||
|
||||
// TODO
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::SphereVsCapsule(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return false;
|
||||
}
|
||||
|
||||
bool SHCollision::CapsuleVsSphere(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return SphereVsCapsule(B, A);
|
||||
}
|
||||
|
||||
bool SHCollision::SphereVsCapsule(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return false;
|
||||
}
|
||||
|
||||
bool SHCollision::CapsuleVsSphere(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return SphereVsCapsule(manifold, B, A);
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,348 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSphereVsConvex.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between a sphere and a convex
|
||||
* polyhedron.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/Geometry/SHPlane.h"
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/Collision/Shapes/SHSphere.h"
|
||||
#include "Physics/Collision/Shapes/SHConvexPolyhedron.h"
|
||||
#include "Physics/SHPhysicsConstants.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::SphereVsConvex(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
const SHSphere& SPHERE = dynamic_cast<const SHSphere&>(A);
|
||||
const SHConvexPolyhedron& POLYHEDRON = dynamic_cast<const SHConvexPolyhedron&>(B);
|
||||
|
||||
const SHVec3 CENTER = SPHERE.Center;
|
||||
const float RADIUS = SPHERE.GetWorldRadius();
|
||||
|
||||
// Find closest face
|
||||
const FaceQuery FACE_QUERY = findClosestFace(SPHERE, POLYHEDRON);
|
||||
if (!FACE_QUERY.colliding)
|
||||
return false;
|
||||
|
||||
// If center of sphere is inside the polyhedron (below the face)
|
||||
if (FACE_QUERY.bestDistance < SHMath::EPSILON)
|
||||
return true;
|
||||
|
||||
// Find closest face of polygon to circle
|
||||
const int32_t CLOSEST_POINT = findClosestPoint(SPHERE, POLYHEDRON, FACE_QUERY.closestFace);
|
||||
|
||||
const auto& FACE = POLYHEDRON.GetFace(FACE_QUERY.closestFace);
|
||||
const SHVec3& FACE_NORMAL = POLYHEDRON.GetNormal(FACE_QUERY.closestFace);
|
||||
const int32_t NUM_VERTICES = static_cast<int32_t>(FACE.vertexIndices.size());
|
||||
|
||||
// Get points and build tangents
|
||||
const int32_t P2_INDEX = (CLOSEST_POINT + 1) % NUM_VERTICES;
|
||||
const int32_t P3_INDEX = CLOSEST_POINT == 0 ? NUM_VERTICES - 1 : CLOSEST_POINT - 1;
|
||||
|
||||
const SHVec3 P1 = POLYHEDRON.GetVertex(FACE.vertexIndices[CLOSEST_POINT].index);
|
||||
const SHVec3 P2 = POLYHEDRON.GetVertex(FACE.vertexIndices[P2_INDEX].index);
|
||||
const SHVec3 P3 = POLYHEDRON.GetVertex(FACE.vertexIndices[P3_INDEX].index);
|
||||
|
||||
const SHVec3 TANGENT_1 = SHVec3::Normalise(P2 - P1);
|
||||
const SHVec3 TANGENT_2 = SHVec3::Normalise(P3 - P1);
|
||||
|
||||
// Get the voronoi region it belongs in
|
||||
const int32_t REGION = findVoronoiRegion(SPHERE, P1, FACE_NORMAL, TANGENT_1, TANGENT_2);
|
||||
|
||||
return REGION > 0;
|
||||
}
|
||||
|
||||
bool SHCollision::ConvexVsSphere(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
return SphereVsConvex(B, A);
|
||||
}
|
||||
|
||||
bool SHCollision::SphereVsConvex(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
// Convert to underlying types
|
||||
// For the convex, we only need the convex polyhedron shape since the get vertex is pure virtual.
|
||||
const SHSphere& SPHERE = dynamic_cast<const SHSphere&>(A);
|
||||
const SHConvexPolyhedron& POLYHEDRON = dynamic_cast<const SHConvexPolyhedron&>(B);
|
||||
|
||||
const SHVec3 CENTER = SPHERE.Center;
|
||||
const float RADIUS = SPHERE.GetWorldRadius();
|
||||
|
||||
const FaceQuery FACE_QUERY = findClosestFace(SPHERE, POLYHEDRON);
|
||||
if (!FACE_QUERY.colliding)
|
||||
return false;
|
||||
|
||||
uint32_t numContacts = 0;
|
||||
const float PENETRATION = RADIUS - FACE_QUERY.bestDistance;
|
||||
|
||||
SHContact contact;
|
||||
contact.featurePair.key = 0;
|
||||
|
||||
// Check if center is inside polyhedron (below the face)
|
||||
if (FACE_QUERY.bestDistance < SHMath::EPSILON)
|
||||
{
|
||||
manifold.normal = -POLYHEDRON.GetNormal(FACE_QUERY.closestFace);
|
||||
|
||||
contact.penetration = PENETRATION;
|
||||
contact.position = CENTER;
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
manifold.numContacts = numContacts;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
// Find closest face of polygon to circle
|
||||
const int32_t CLOSEST_POINT = findClosestPoint(SPHERE, POLYHEDRON, FACE_QUERY.closestFace);
|
||||
|
||||
const auto& FACE = POLYHEDRON.GetFace(FACE_QUERY.closestFace);
|
||||
const SHVec3& FACE_NORMAL = POLYHEDRON.GetNormal(FACE_QUERY.closestFace);
|
||||
const int32_t NUM_VERTICES = static_cast<int32_t>(FACE.vertexIndices.size());
|
||||
|
||||
// Get points and build tangents
|
||||
const int32_t P2_INDEX = (CLOSEST_POINT + 1) % NUM_VERTICES;
|
||||
const int32_t P3_INDEX = CLOSEST_POINT == 0 ? NUM_VERTICES - 1 : CLOSEST_POINT - 1;
|
||||
|
||||
const SHVec3 P1 = POLYHEDRON.GetVertex(FACE.vertexIndices[CLOSEST_POINT].index);
|
||||
const SHVec3 P2 = POLYHEDRON.GetVertex(FACE.vertexIndices[P2_INDEX].index);
|
||||
const SHVec3 P3 = POLYHEDRON.GetVertex(FACE.vertexIndices[P3_INDEX].index);
|
||||
|
||||
const SHVec3 TANGENT_1 = SHVec3::Normalise(P2 - P1);
|
||||
const SHVec3 TANGENT_2 = SHVec3::Normalise(P3 - P1);
|
||||
|
||||
// Get the voronoi region it belongs in
|
||||
const int32_t REGION = findVoronoiRegion(SPHERE, P1, FACE_NORMAL, TANGENT_1, TANGENT_2);
|
||||
if (REGION == 0)
|
||||
return false;
|
||||
|
||||
// Create contact information based on region
|
||||
|
||||
const SHVec3 P1_TO_CENTER = CENTER - P1;
|
||||
switch (REGION)
|
||||
{
|
||||
case 1: // Region A
|
||||
case 2: // Region B
|
||||
{
|
||||
// Find closest point
|
||||
const SHVec3& TANGENT = REGION == 1 ? TANGENT_1 : TANGENT_2;
|
||||
const SHVec3 CP = P1 + TANGENT * SHVec3::Dot(P1_TO_CENTER, TANGENT);
|
||||
const SHVec3 CP_TO_CENTER = CENTER - CP;
|
||||
|
||||
manifold.normal = -SHVec3::Normalise(CP_TO_CENTER);
|
||||
|
||||
contact.penetration = RADIUS - SHVec3::Dot(CP_TO_CENTER, -manifold.normal);
|
||||
contact.position = CP;
|
||||
|
||||
break;
|
||||
}
|
||||
case 3: // Region C
|
||||
{
|
||||
manifold.normal = -SHVec3::Normalise(P1_TO_CENTER);
|
||||
|
||||
contact.penetration = RADIUS - P1_TO_CENTER.Length();
|
||||
contact.position = P1;
|
||||
|
||||
break;
|
||||
}
|
||||
case 4: // Region D
|
||||
{
|
||||
manifold.normal = -FACE_NORMAL;
|
||||
|
||||
contact.penetration = PENETRATION;
|
||||
contact.position = CENTER - FACE_NORMAL * RADIUS;
|
||||
|
||||
break;
|
||||
}
|
||||
default: return false; // Should never happen
|
||||
}
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
manifold.numContacts = numContacts;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
bool SHCollision::ConvexVsSphere(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
if (SphereVsConvex(manifold, B, A))
|
||||
{
|
||||
manifold.normal = -manifold.normal;
|
||||
return true;
|
||||
};
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollision::FaceQuery SHCollision::findClosestFace
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHConvexPolyhedron& polyhedron
|
||||
) noexcept
|
||||
{
|
||||
FaceQuery faceQuery;
|
||||
|
||||
const SHVec3 CENTER = sphere.Center;
|
||||
const float RADIUS = sphere.GetWorldRadius();
|
||||
|
||||
/*
|
||||
* Test against each face.
|
||||
*
|
||||
* 1. For each face, build a plane in point-normal form.
|
||||
* 2. Find the signed distance from plane to center of sphere.
|
||||
* 3. Save best distance and face.
|
||||
*/
|
||||
for (int32_t i = 0; i < polyhedron.GetFaceCount(); ++i)
|
||||
{
|
||||
const SHHalfEdgeStructure::Face& FACE = polyhedron.GetFace(i);
|
||||
|
||||
// Build plane equation
|
||||
// Use first vertex to build the plane
|
||||
const SHPlane FACE_PLANE { polyhedron.GetVertex(FACE.vertexIndices[0].index), polyhedron.GetNormal(i) };
|
||||
|
||||
// Find signed distance of center to plane
|
||||
const float SIGNED_DIST = FACE_PLANE.SignedDistance(CENTER);
|
||||
|
||||
// Early out:
|
||||
// If face is facing away from center, signed dist is negative.
|
||||
// Therefore signed distance is only positive when sphere is in front of the face.
|
||||
if (SIGNED_DIST > RADIUS)
|
||||
return faceQuery;
|
||||
|
||||
if (SIGNED_DIST > faceQuery.bestDistance)
|
||||
{
|
||||
faceQuery.bestDistance = SIGNED_DIST;
|
||||
faceQuery.closestFace = i;
|
||||
}
|
||||
}
|
||||
|
||||
faceQuery.colliding = true;
|
||||
return faceQuery;
|
||||
}
|
||||
|
||||
int32_t SHCollision::findClosestPoint
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHConvexPolyhedron& polyhedron
|
||||
, int32_t faceIndex
|
||||
) noexcept
|
||||
{
|
||||
// Find closest point on face
|
||||
int32_t closestPointIndex = -1;
|
||||
|
||||
const SHVec3 CENTER = sphere.Center;
|
||||
|
||||
const SHHalfEdgeStructure::Face& FACE = polyhedron.GetFace(faceIndex);
|
||||
const int32_t NUM_VERITICES = static_cast<int32_t>(FACE.vertexIndices.size());
|
||||
|
||||
float smallestDist = std::numeric_limits<float>::max();
|
||||
for (int32_t i = 0; i < NUM_VERITICES; ++i)
|
||||
{
|
||||
const SHVec3 POINT = polyhedron.GetVertex(FACE.vertexIndices[i].index);
|
||||
const float DIST = SHVec3::DistanceSquared(CENTER, POINT);
|
||||
|
||||
if (DIST < smallestDist)
|
||||
{
|
||||
smallestDist = DIST;
|
||||
closestPointIndex = i;
|
||||
}
|
||||
}
|
||||
|
||||
return closestPointIndex;
|
||||
}
|
||||
|
||||
int32_t SHCollision::findVoronoiRegion
|
||||
(
|
||||
const SHSphere& sphere
|
||||
, const SHVec3& faceVertex
|
||||
, const SHVec3& faceNormal
|
||||
, const SHVec3& tangent1
|
||||
, const SHVec3& tangent2
|
||||
) noexcept
|
||||
{
|
||||
static constexpr int NUM_TANGENTS = 2;
|
||||
|
||||
// Check against voronoi regions of the face to determine the type of the intersection test
|
||||
// We have 3 voronoi regions to check: 1 -> 2, 1 -> 3 and 1 -> center
|
||||
// If none of these are true, the sphere is above the face but not separating
|
||||
|
||||
/*
|
||||
* | 2
|
||||
* _ _ _ _ _ _ | _ _ _
|
||||
* / /
|
||||
* | / regionD | / regionA
|
||||
* |/ _ _ _ _ _|/ _ _ _
|
||||
* 3/ regionB /1
|
||||
* / / regionC
|
||||
*
|
||||
*/
|
||||
|
||||
const SHVec3 CENTER = sphere.Center;
|
||||
const float RADIUS = sphere.GetWorldRadius();
|
||||
|
||||
const SHVec3 TANGENTS [NUM_TANGENTS] { tangent1, tangent2 };
|
||||
const SHVec3 ADJACENT_NORMALS [NUM_TANGENTS] { SHVec3::Cross(tangent1, faceNormal), SHVec3::Cross(faceNormal, tangent2) };
|
||||
|
||||
const SHVec3 FACE_TO_CENTER = CENTER - faceVertex;
|
||||
|
||||
// To be inside either region A or B, 2 conditions must be satisfied
|
||||
// 1. Same side as tangent
|
||||
// 2. Same side as adjacent normal
|
||||
|
||||
// Check Region A & B
|
||||
for (int i = 0; i < NUM_TANGENTS; ++i)
|
||||
{
|
||||
float projection = SHVec3::Dot(FACE_TO_CENTER, TANGENTS[i]);
|
||||
if (projection >= 0.0f)
|
||||
{
|
||||
// Find closest point
|
||||
const SHVec3 CLOSEST_POINT = faceVertex + projection * TANGENTS[i];
|
||||
|
||||
projection = SHVec3::Dot(FACE_TO_CENTER, ADJACENT_NORMALS[i]);
|
||||
if (projection >= 0.0f)
|
||||
{
|
||||
if (projection > RADIUS)
|
||||
return 0;
|
||||
|
||||
// Region 1 or 2 ( A or B)
|
||||
return i + 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Check Region C
|
||||
// Face to vertex is in the opposite direction of any tangent.
|
||||
const float PROJECTION = SHVec3::Dot(FACE_TO_CENTER, tangent1);
|
||||
if (PROJECTION < 0)
|
||||
{
|
||||
const float DISTANCE_SQUARED = SHVec3::DistanceSquared(faceVertex, CENTER);
|
||||
if (DISTANCE_SQUARED > RADIUS * RADIUS)
|
||||
return 0;
|
||||
|
||||
return 3;
|
||||
}
|
||||
|
||||
// Belongs in region D by default
|
||||
return 4;
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,97 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSphereVsSphere.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for the Detecting Collisions between two spheres
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollision.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/Collision/Shapes/SHSphere.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollision::SphereVsSphere(const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
const SHSphere& SPHERE_A = dynamic_cast<const SHSphere&>(A);
|
||||
const SHSphere& SPHERE_B = dynamic_cast<const SHSphere&>(B);
|
||||
|
||||
const SHVec3 CENTER_A = SPHERE_A.Center;
|
||||
const float RADIUS_A = SPHERE_A.Radius;
|
||||
const SHVec3 CENTER_B = SPHERE_B.Center;
|
||||
const float RADIUS_B = SPHERE_B.Radius;
|
||||
|
||||
|
||||
const SHVec3 A_TO_B = CENTER_B - CENTER_A;
|
||||
const float DISTANCE_BETWEEN_CENTERS_SQUARED = A_TO_B.LengthSquared();
|
||||
|
||||
const float COMBINED_RADIUS = RADIUS_B + RADIUS_A;
|
||||
const float COMBINED_RADIUS_SQUARED = COMBINED_RADIUS * COMBINED_RADIUS;
|
||||
|
||||
if (DISTANCE_BETWEEN_CENTERS_SQUARED > COMBINED_RADIUS_SQUARED)
|
||||
return false;
|
||||
}
|
||||
|
||||
bool SHCollision::SphereVsSphere(SHManifold& manifold, const SHCollisionShape& A, const SHCollisionShape& B) noexcept
|
||||
{
|
||||
// Convert to underlying types
|
||||
const SHSphere& SPHERE_A = dynamic_cast<const SHSphere&>(A);
|
||||
const SHSphere& SPHERE_B = dynamic_cast<const SHSphere&>(B);
|
||||
|
||||
const SHVec3 CENTER_A = SPHERE_A.Center;
|
||||
const float RADIUS_A = SPHERE_A.Radius;
|
||||
const SHVec3 CENTER_B = SPHERE_B.Center;
|
||||
const float RADIUS_B = SPHERE_B.Radius;
|
||||
|
||||
|
||||
const SHVec3 A_TO_B = CENTER_B - CENTER_A;
|
||||
const float DISTANCE_BETWEEN_CENTERS_SQUARED = A_TO_B.LengthSquared();
|
||||
|
||||
const float COMBINED_RADIUS = RADIUS_B + RADIUS_A;
|
||||
const float COMBINED_RADIUS_SQUARED = COMBINED_RADIUS * COMBINED_RADIUS;
|
||||
|
||||
if (DISTANCE_BETWEEN_CENTERS_SQUARED > COMBINED_RADIUS_SQUARED)
|
||||
return false;
|
||||
|
||||
// Only populate the manifold if there is a collision
|
||||
|
||||
uint32_t numContacts = 0;
|
||||
|
||||
SHContact contact;
|
||||
contact.featurePair.key = 0;
|
||||
|
||||
if (SHMath::CompareFloat(DISTANCE_BETWEEN_CENTERS_SQUARED, 0.0f))
|
||||
{
|
||||
manifold.normal = SHVec3::UnitY;
|
||||
contact.position = CENTER_A;
|
||||
contact.penetration = RADIUS_B;
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
}
|
||||
else
|
||||
{
|
||||
manifold.normal = SHVec3::Normalise(A_TO_B);
|
||||
contact.position = CENTER_B - manifold.normal * RADIUS_B;
|
||||
contact.penetration = COMBINED_RADIUS - A_TO_B.Length();
|
||||
|
||||
manifold.contacts[numContacts++] = contact;
|
||||
}
|
||||
|
||||
manifold.numContacts = numContacts;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,393 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollider.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Base Collider Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollider.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Broadphase/SHDynamicAABBTree.h"
|
||||
#include "Events/SHEvent.h"
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/SHPhysicsEvents.h"
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollider::SHCollider(EntityID eid, const SHTransform& worldTransform) noexcept
|
||||
: entityID { eid }
|
||||
, flags { 0 }
|
||||
, rigidBody { nullptr }
|
||||
, shapeLibrary { nullptr }
|
||||
, broadphase { nullptr }
|
||||
, transform { worldTransform }
|
||||
{
|
||||
flags |= ACTIVE_FLAG;
|
||||
flags |= MOVED_FLAG;
|
||||
}
|
||||
|
||||
SHCollider::SHCollider(const SHCollider& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
, flags { rhs.flags }
|
||||
, rigidBody { rhs.rigidBody }
|
||||
, shapeLibrary { rhs.shapeLibrary }
|
||||
, broadphase { rhs.broadphase }
|
||||
, transform { rhs.transform }
|
||||
{}
|
||||
|
||||
SHCollider::SHCollider(SHCollider&& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
, flags { rhs.flags }
|
||||
, rigidBody { rhs.rigidBody }
|
||||
, shapeLibrary { rhs.shapeLibrary }
|
||||
, broadphase { rhs.broadphase }
|
||||
, transform { rhs.transform }
|
||||
{}
|
||||
|
||||
SHCollider::~SHCollider() noexcept
|
||||
{
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Composite Collider {}. Unable to add destroy collider!", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
for (auto* shape : shapes)
|
||||
shapeLibrary->DestroyShape(shape);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollider& SHCollider::operator=(const SHCollider& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Collider {}. Unable to add copy shapes!", entityID)
|
||||
return *this;
|
||||
}
|
||||
|
||||
entityID = rhs.entityID;
|
||||
flags = rhs.flags;
|
||||
rigidBody = rhs.rigidBody;
|
||||
shapeLibrary = rhs.shapeLibrary;
|
||||
broadphase = rhs.broadphase;
|
||||
transform = rhs.transform;
|
||||
|
||||
copyShapes(rhs);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHCollider& SHCollider::operator=(SHCollider&& rhs) noexcept
|
||||
{
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Collider {}. Unable to add copy shapes!", entityID)
|
||||
return *this;
|
||||
}
|
||||
|
||||
entityID = rhs.entityID;
|
||||
flags = rhs.flags;
|
||||
rigidBody = rhs.rigidBody;
|
||||
shapeLibrary = rhs.shapeLibrary;
|
||||
broadphase = rhs.broadphase;
|
||||
transform = rhs.transform;
|
||||
|
||||
copyShapes(rhs);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
EntityID SHCollider::GetEntityID() const noexcept
|
||||
{
|
||||
return entityID;
|
||||
}
|
||||
|
||||
SHCollider::Type SHCollider::GetType() const noexcept
|
||||
{
|
||||
if (flags & COMPOSITE_FLAG)
|
||||
return Type::COMPOSITE;
|
||||
|
||||
if (flags & HULL_FLAG)
|
||||
return Type::HULL;
|
||||
|
||||
return Type::INVALID;
|
||||
}
|
||||
|
||||
bool SHCollider::IsActive() const noexcept
|
||||
{
|
||||
return flags & ACTIVE_FLAG;
|
||||
}
|
||||
|
||||
bool SHCollider::GetDebugDrawState() const noexcept
|
||||
{
|
||||
return flags & DRAW_FLAG;
|
||||
}
|
||||
|
||||
const SHTransform& SHCollider::GetTransform() const noexcept
|
||||
{
|
||||
return transform;
|
||||
}
|
||||
|
||||
const SHVec3& SHCollider::GetPosition() const noexcept
|
||||
{
|
||||
return transform.position;
|
||||
}
|
||||
|
||||
const SHQuaternion& SHCollider::GetOrientation() const noexcept
|
||||
{
|
||||
return transform.orientation;
|
||||
}
|
||||
|
||||
const SHVec3& SHCollider::GetScale() const noexcept
|
||||
{
|
||||
return transform.scale;
|
||||
}
|
||||
|
||||
const SHCollider::CollisionShapes& SHCollider::GetCollisionShapes() const noexcept
|
||||
{
|
||||
return shapes;
|
||||
}
|
||||
|
||||
SHCollisionShape* SHCollider::GetCollisionShape(int index) const
|
||||
{
|
||||
const int NUM_SHAPES = static_cast<int>(shapes.size());
|
||||
|
||||
if (index < 0 || index >= NUM_SHAPES)
|
||||
throw std::invalid_argument("Out-of-range index!");
|
||||
|
||||
return shapes[index];
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollider::SetType(Type type) noexcept
|
||||
{
|
||||
if (type == Type::COMPOSITE)
|
||||
flags |= COMPOSITE_FLAG;
|
||||
|
||||
if (type == Type::HULL)
|
||||
flags |= HULL_FLAG;
|
||||
}
|
||||
|
||||
void SHCollider::SetIsActive(bool state) noexcept
|
||||
{
|
||||
const bool PREV_STATE = flags & ACTIVE_FLAG;
|
||||
state ? flags |= ACTIVE_FLAG : flags &= ~(ACTIVE_FLAG);
|
||||
|
||||
if (!broadphase)
|
||||
return;
|
||||
|
||||
for (auto* shape : shapes)
|
||||
{
|
||||
if (PREV_STATE) // Previously inactive
|
||||
broadphase->Insert(shape->id, shape->ComputeAABB());
|
||||
else // Previously active
|
||||
broadphase->Remove(shape->id);
|
||||
}
|
||||
}
|
||||
|
||||
void SHCollider::SetDebugDrawState(bool state) noexcept
|
||||
{
|
||||
state ? flags |= DRAW_FLAG : flags &= ~(DRAW_FLAG);
|
||||
|
||||
#ifdef SHEDITOR
|
||||
|
||||
// Broadcast event for the Debug Draw system to catch
|
||||
const SHColliderOnDebugDrawEvent EVENT_DATA
|
||||
{
|
||||
.entityID = entityID
|
||||
, .debugDrawState = state
|
||||
};
|
||||
|
||||
SHEventManager::BroadcastEvent<SHColliderOnDebugDrawEvent>(EVENT_DATA, SH_PHYSICS_COLLIDER_DRAW_EVENT);
|
||||
|
||||
#endif
|
||||
}
|
||||
|
||||
void SHCollider::SetRigidBody(SHRigidBody* rb) noexcept
|
||||
{
|
||||
rigidBody = rb;
|
||||
}
|
||||
|
||||
void SHCollider::SetTransform(const SHTransform& newTransform) noexcept
|
||||
{
|
||||
flags |= MOVED_FLAG;
|
||||
transform = newTransform;
|
||||
}
|
||||
|
||||
void SHCollider::SetPosition(const SHVec3& newPosition) noexcept
|
||||
{
|
||||
flags |= MOVED_FLAG;
|
||||
transform.position = newPosition;
|
||||
}
|
||||
|
||||
void SHCollider::SetOrientation(const SHQuaternion& newOrientation) noexcept
|
||||
{
|
||||
flags |= MOVED_FLAG;
|
||||
transform.orientation = newOrientation;
|
||||
}
|
||||
|
||||
void SHCollider::SetScale(const SHVec3& newScale) noexcept
|
||||
{
|
||||
flags |= MOVED_FLAG;
|
||||
transform.scale = newScale;
|
||||
}
|
||||
|
||||
void SHCollider::SetLibrary(SHCollisionShapeLibrary* factory) noexcept
|
||||
{
|
||||
shapeLibrary = factory;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHMatrix& SHCollider::ComputeTRS() noexcept
|
||||
{
|
||||
return transform.ComputeTRS();
|
||||
}
|
||||
|
||||
void SHCollider::RemoveCollisionShape(int index)
|
||||
{
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Collider {}. Unable to add remove shape!", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
const int NUM_SHAPES = static_cast<int>(shapes.size());
|
||||
|
||||
if (index < 0 || index >= NUM_SHAPES)
|
||||
throw std::invalid_argument("Out-of-range index!");
|
||||
|
||||
auto shape = shapes.begin();
|
||||
for (int i = 0; i < NUM_SHAPES; ++i, ++shape)
|
||||
{
|
||||
if (i == index)
|
||||
break;
|
||||
}
|
||||
|
||||
const SHPhysicsColliderRemovedEvent EVENT_DATA
|
||||
{
|
||||
.entityID = entityID
|
||||
, .colliderType = (*shape)->GetType()
|
||||
, .colliderIndex = index
|
||||
};
|
||||
|
||||
// Remove from broadphase
|
||||
if (broadphase)
|
||||
broadphase->Remove((*shape)->id);
|
||||
|
||||
shapeLibrary->DestroyShape(*shape);
|
||||
*shape = nullptr;
|
||||
|
||||
// Remove the shape from the container to prevent accessing a nullptr
|
||||
shape = shapes.erase(shape);
|
||||
|
||||
|
||||
|
||||
// Broadcast Event for removing a shape
|
||||
SHEventManager::BroadcastEvent<SHPhysicsColliderRemovedEvent>(EVENT_DATA, SH_PHYSICS_COLLIDER_REMOVED_EVENT);
|
||||
|
||||
if (rigidBody)
|
||||
rigidBody->ComputeMassData();
|
||||
|
||||
SHLOG_INFO_D("Removing Collision Shape {} from Entity {}", index, entityID)
|
||||
}
|
||||
|
||||
void SHCollider::Update() noexcept
|
||||
{
|
||||
for (auto* shape : shapes)
|
||||
shape->Update();
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollider::copyShapes(const SHCollider& rhsCollider)
|
||||
{
|
||||
for (const auto* shape : rhsCollider.shapes)
|
||||
{
|
||||
switch (shape->GetType())
|
||||
{
|
||||
case SHCollisionShape::Type::BOX:
|
||||
{
|
||||
const SHBox* RHS_BOX = dynamic_cast<const SHBox*>(shape);
|
||||
|
||||
const SHBoxCreateInfo BOX_CREATE_INFO
|
||||
{
|
||||
.Center = RHS_BOX->Center
|
||||
, .Extents = RHS_BOX->Extents
|
||||
, .RelativeExtents = RHS_BOX->relativeExtents
|
||||
, .Orientation = RHS_BOX->Orientation
|
||||
, .Scale = RHS_BOX->scale
|
||||
};
|
||||
|
||||
const uint32_t NEW_INDEX = static_cast<uint32_t>(shapes.size());
|
||||
const SHCollisionShapeID NEW_SHAPE_ID{ entityID, NEW_INDEX };
|
||||
|
||||
SHBox* box = shapeLibrary->CreateBox(NEW_SHAPE_ID, BOX_CREATE_INFO);
|
||||
*box = *RHS_BOX;
|
||||
|
||||
shapes.emplace_back(box);
|
||||
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::SPHERE:
|
||||
{
|
||||
const SHSphere* RHS_SPHERE = dynamic_cast<const SHSphere*>(shape);
|
||||
|
||||
const SHSphereCreateInfo SPHERE_CREATE_INFO
|
||||
{
|
||||
.Center = RHS_SPHERE->Center
|
||||
, .Radius = RHS_SPHERE->Radius
|
||||
, .RelativeRadius = RHS_SPHERE->relativeRadius
|
||||
, .Scale = RHS_SPHERE->scale
|
||||
};
|
||||
|
||||
const uint32_t NEW_INDEX = static_cast<uint32_t>(shapes.size());
|
||||
const SHCollisionShapeID NEW_SHAPE_ID{ entityID, NEW_INDEX };
|
||||
|
||||
SHSphere* sphere = shapeLibrary->CreateSphere(NEW_SHAPE_ID, SPHERE_CREATE_INFO);
|
||||
*sphere = *RHS_SPHERE;
|
||||
|
||||
shapes.emplace_back(sphere);
|
||||
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::CAPSULE:
|
||||
{
|
||||
break;
|
||||
}
|
||||
default: break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,178 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollider.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Base Collider Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "ECS_Base/Entity/SHEntity.h"
|
||||
#include "Math/Transform/SHTransform.h"
|
||||
#include "Physics/Collision/Shapes/SHCollisionShapeLibrary.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Forward Declarations */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SHRigidBody;
|
||||
class SHAABBTree;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Base class for a collider.
|
||||
* There are only two collider types supported by SHADE Engine: Composite & Hull
|
||||
*/
|
||||
class SH_API SHCollider
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollisionSpace;
|
||||
friend struct SHManifold;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
enum class Type
|
||||
{
|
||||
COMPOSITE
|
||||
, HULL
|
||||
|
||||
, TOTAL
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
using CollisionShapes = std::vector<SHCollisionShape*>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Constructor for a collider.
|
||||
* @param eid
|
||||
* The entity this collider belongs to.
|
||||
* @param worldTransform
|
||||
* The world transform for the collider. Defaults to the identity transform.
|
||||
* This is particularly important for composite colliders for offsets & relative sizes.
|
||||
* @return
|
||||
*/
|
||||
SHCollider (EntityID eid, const SHTransform& worldTransform = SHTransform::Identity) noexcept;
|
||||
SHCollider (const SHCollider& rhs) noexcept;
|
||||
SHCollider (SHCollider&& rhs) noexcept;
|
||||
virtual ~SHCollider () noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollider& operator=(const SHCollider& rhs) noexcept;
|
||||
SHCollider& operator=(SHCollider&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] EntityID GetEntityID () const noexcept;
|
||||
|
||||
[[nodiscard]] Type GetType () const noexcept;
|
||||
[[nodiscard]] bool IsActive () const noexcept;
|
||||
[[nodiscard]] bool GetDebugDrawState () const noexcept;
|
||||
|
||||
[[nodiscard]] const SHTransform& GetTransform () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetPosition () const noexcept;
|
||||
[[nodiscard]] const SHQuaternion& GetOrientation () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetScale () const noexcept;
|
||||
|
||||
[[nodiscard]] const CollisionShapes& GetCollisionShapes () const noexcept;
|
||||
[[nodiscard]] SHCollisionShape* GetCollisionShape (int index) const;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetType (Type type) noexcept;
|
||||
void SetIsActive (bool state) noexcept;
|
||||
void SetDebugDrawState (bool state) noexcept;
|
||||
|
||||
void SetRigidBody (SHRigidBody* rb) noexcept;
|
||||
|
||||
void SetTransform (const SHTransform& newTransform) noexcept;
|
||||
void SetPosition (const SHVec3& newPosition) noexcept;
|
||||
void SetOrientation (const SHQuaternion& newOrientation) noexcept;
|
||||
void SetScale (const SHVec3& newScale) noexcept;
|
||||
|
||||
void SetLibrary (SHCollisionShapeLibrary* factory) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes the TRS for the collider's transform
|
||||
* @return
|
||||
* The computed TRS.
|
||||
*/
|
||||
const SHMatrix& ComputeTRS() noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Removes a shape from the container. Removal reduces the size of the container.
|
||||
* If removing all, perform removal from back to front.
|
||||
* @param index
|
||||
* The index of the shape to remove.
|
||||
* @throws
|
||||
* Invalid argument for out-of-range indices.
|
||||
*/
|
||||
void RemoveCollisionShape (int index);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Recomputes the transforms for all shapes in this composite collider.
|
||||
*/
|
||||
void Update () noexcept;
|
||||
|
||||
protected:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr uint8_t COMPOSITE_FLAG = 1U << static_cast<uint8_t>(Type::COMPOSITE);
|
||||
static constexpr uint8_t HULL_FLAG = 1U << static_cast<uint8_t>(Type::HULL);
|
||||
static constexpr uint8_t ACTIVE_FLAG = 1U << 2;
|
||||
static constexpr uint8_t DRAW_FLAG = 1U << 3;
|
||||
static constexpr uint8_t MOVED_FLAG = 1U << 4;
|
||||
|
||||
EntityID entityID;
|
||||
uint8_t flags; // 0 0 0 hasMoved debugDraw active hull composite
|
||||
SHRigidBody* rigidBody;
|
||||
SHCollisionShapeLibrary* shapeLibrary;
|
||||
SHAABBTree* broadphase;
|
||||
SHTransform transform;
|
||||
CollisionShapes shapes;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void copyShapes (const SHCollider& rhsCollider);
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -0,0 +1,93 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionInfo.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for Collision Info.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionInfo.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionInfo::SHCollisionInfo() noexcept
|
||||
: collisionState { State::INVALID }
|
||||
{
|
||||
ids[ENTITY_A] = MAX_EID;
|
||||
ids[ENTITY_B] = MAX_EID;
|
||||
ids[COLLIDER_A] = std::numeric_limits<uint32_t>::max();
|
||||
ids[COLLIDER_B] = std::numeric_limits<uint32_t>::max();
|
||||
}
|
||||
|
||||
SHCollisionInfo::SHCollisionInfo(EntityID entityA, EntityID entityB) noexcept
|
||||
: collisionState { State::INVALID }
|
||||
{
|
||||
ids[ENTITY_A] = entityA;
|
||||
ids[ENTITY_B] = entityB;
|
||||
ids[COLLIDER_A] = std::numeric_limits<uint32_t>::max();
|
||||
ids[COLLIDER_B] = std::numeric_limits<uint32_t>::max();
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHCollisionInfo::operator==(const SHCollisionInfo& rhs) const noexcept
|
||||
{
|
||||
return value[0] == rhs.value[0] && value[1] == rhs.value[1];
|
||||
}
|
||||
|
||||
bool SHCollisionInfo::operator!=(const SHCollisionInfo& rhs) const noexcept
|
||||
{
|
||||
return value[0] != rhs.value[0] || value[1] != rhs.value[1];
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
EntityID SHCollisionInfo::GetEntityA() const noexcept
|
||||
{
|
||||
return ids[ENTITY_A];
|
||||
}
|
||||
|
||||
EntityID SHCollisionInfo::GetEntityB() const noexcept
|
||||
{
|
||||
return ids[ENTITY_B];
|
||||
}
|
||||
|
||||
const SHRigidBodyComponent* SHCollisionInfo::GetRigidBodyA() const noexcept
|
||||
{
|
||||
return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_A]);
|
||||
}
|
||||
|
||||
const SHRigidBodyComponent* SHCollisionInfo::GetRigidBodyB() const noexcept
|
||||
{
|
||||
return SHComponentManager::GetComponent_s<SHRigidBodyComponent>(ids[ENTITY_B]);
|
||||
}
|
||||
|
||||
const SHCollisionShape* SHCollisionInfo::GetColliderA() const noexcept
|
||||
{
|
||||
return &SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_A])->GetCollisionShape(ids[COLLIDER_A]);
|
||||
}
|
||||
|
||||
const SHCollisionShape* SHCollisionInfo::GetColliderB() const noexcept
|
||||
{
|
||||
return &SHComponentManager::GetComponent<SHColliderComponent>(ids[ENTITY_B])->GetCollisionShape(ids[COLLIDER_B]);
|
||||
}
|
||||
|
||||
SHCollisionInfo::State SHCollisionInfo::GetCollisionState() const noexcept
|
||||
{
|
||||
return collisionState;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,7 +1,7 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionShapeKey.h
|
||||
* \file SHCollisionInfo.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collison Shape ID Class and it's hashing function
|
||||
* \brief Interface for Collision Information for Collision & Triggers.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
|
@ -11,95 +11,92 @@
|
|||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "ECS_Base/Entity/SHEntity.h"
|
||||
#include "Physics/Interface/SHColliderComponent.h"
|
||||
#include "Physics/Interface/SHRigidBodyComponent.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Forward Declarations */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
struct SHCollisionShapeIDHash;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates an identifier for a collision shape.
|
||||
*/
|
||||
union SHCollisionShapeID
|
||||
class SH_API SHCollisionInfo
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend struct SHCollisionShapeIDHash;
|
||||
friend class SHCollisionListener;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
enum class State
|
||||
{
|
||||
ENTER
|
||||
, STAY
|
||||
, EXIT
|
||||
|
||||
, TOTAL
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShapeID (EntityID eid, uint32_t shapeID) noexcept;
|
||||
SHCollisionShapeID (const SHCollisionShapeID& rhs) noexcept;
|
||||
SHCollisionShapeID (SHCollisionShapeID&& rhs) noexcept;
|
||||
SHCollisionInfo () noexcept;
|
||||
SHCollisionInfo (EntityID entityA, EntityID entityB) noexcept;
|
||||
|
||||
~SHCollisionShapeID () noexcept = default;
|
||||
|
||||
SHCollisionInfo (const SHCollisionInfo& rhs) = default;
|
||||
SHCollisionInfo (SHCollisionInfo&& rhs) = default;
|
||||
~SHCollisionInfo () = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShapeID& operator=(const SHCollisionShapeID& rhs) noexcept;
|
||||
SHCollisionShapeID& operator=(SHCollisionShapeID&& rhs) noexcept;
|
||||
bool operator== (const SHCollisionInfo& rhs) const noexcept;
|
||||
bool operator!= (const SHCollisionInfo& rhs) const noexcept;
|
||||
|
||||
bool operator==(const SHCollisionShapeID& rhs) const;
|
||||
SHCollisionInfo& operator= (const SHCollisionInfo& rhs) = default;
|
||||
SHCollisionInfo& operator= (SHCollisionInfo&& rhs) = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] EntityID GetEntityID () const noexcept;
|
||||
[[nodiscard]] uint32_t GetShapeIndex () const noexcept;
|
||||
[[nodiscard]] EntityID GetEntityA () const noexcept;
|
||||
[[nodiscard]] EntityID GetEntityB () const noexcept;
|
||||
[[nodiscard]] const SHRigidBodyComponent* GetRigidBodyA () const noexcept;
|
||||
[[nodiscard]] const SHRigidBodyComponent* GetRigidBodyB () const noexcept;
|
||||
[[nodiscard]] const SHCollisionShape* GetColliderA () const noexcept;
|
||||
[[nodiscard]] const SHCollisionShape* GetColliderB () const noexcept;
|
||||
[[nodiscard]] State GetCollisionState () const noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct IDs
|
||||
{
|
||||
public:
|
||||
EntityID entityID = MAX_EID;
|
||||
uint32_t shapeIndex = std::numeric_limits<uint32_t>::max();
|
||||
};
|
||||
|
||||
static constexpr uint32_t ENTITY_A = 0;
|
||||
static constexpr uint32_t ENTITY_B = 1;
|
||||
static constexpr uint32_t COLLIDER_A = 2;
|
||||
static constexpr uint32_t COLLIDER_B = 3;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
uint64_t value;
|
||||
IDs ids;
|
||||
};
|
||||
union
|
||||
{
|
||||
uint64_t value[2]; // EntityValue, ColliderIndexValue
|
||||
uint32_t ids [4]; // EntityA, EntityB, ColliderIndexA, ColliderIndexB
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a functor to hash a CollisionShapeID
|
||||
*/
|
||||
struct SHCollisionShapeIDHash
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
std::size_t operator()(const SHCollisionShapeID& id) const;
|
||||
State collisionState;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
||||
|
||||
#include "SHCollisionShapeID.hpp"
|
|
@ -0,0 +1,254 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionListener.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Collision Listener.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionListener.h"
|
||||
|
||||
// Project Headers
|
||||
#include "ECS_Base/Managers/SHEntityManager.h"
|
||||
#include "Physics/PhysicsObject/SHPhysicsObject.h"
|
||||
#include "Physics/System/SHPhysicsSystem.h"
|
||||
#include "Scene/SHSceneManager.h"
|
||||
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
/* Local Helper Functions */
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
|
||||
uint32_t matchColliders(const SHADE::SHPhysicsObject&physicsObject, const rp3d::Entity colliderID)
|
||||
{
|
||||
for (uint32_t i = 0; i < physicsObject.GetCollisionBody()->getNbColliders(); ++i)
|
||||
{
|
||||
const auto* collider = physicsObject.GetCollisionBody()->getCollider(i);
|
||||
if (collider->getEntity() == colliderID)
|
||||
return i;
|
||||
}
|
||||
|
||||
return std::numeric_limits<uint32_t>::max();
|
||||
}
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionListener::SHCollisionListener() noexcept
|
||||
: system { nullptr }
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const std::vector<SHCollisionInfo>& SHCollisionListener::GetCollisionInfoContainer() const noexcept
|
||||
{
|
||||
return collisionInfoContainer;
|
||||
}
|
||||
|
||||
const std::vector<SHCollisionInfo>& SHCollisionListener::GetTriggerInfoContainer() const noexcept
|
||||
{
|
||||
return triggerInfoContainer;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionListener::BindToSystem(SHPhysicsSystem* physicsSystem) noexcept
|
||||
{
|
||||
system = physicsSystem;
|
||||
}
|
||||
|
||||
void SHCollisionListener::BindToWorld(rp3d::PhysicsWorld* world) noexcept
|
||||
{
|
||||
if (!world)
|
||||
return;
|
||||
|
||||
world->setEventListener(this);
|
||||
}
|
||||
|
||||
void SHCollisionListener::CleanContainers() noexcept
|
||||
{
|
||||
static const auto CLEAR = [](std::vector<SHCollisionInfo>& container)
|
||||
{
|
||||
for (auto eventIter = container.begin(); eventIter != container.end();)
|
||||
{
|
||||
const SHCollisionInfo& C_INFO = *eventIter;
|
||||
|
||||
const bool INVALID_ENTITY = !SHEntityManager::IsValidEID(C_INFO.GetEntityA()) || !SHEntityManager::IsValidEID(C_INFO.GetEntityB());
|
||||
if (INVALID_ENTITY)
|
||||
{
|
||||
eventIter = container.erase(eventIter);
|
||||
continue;
|
||||
}
|
||||
else
|
||||
{
|
||||
const bool CLEAR_EVENT = C_INFO.GetCollisionState() == SHCollisionInfo::State::EXIT || C_INFO.GetCollisionState() == SHCollisionInfo::State::INVALID;
|
||||
|
||||
const bool INACTIVE_OBJECT = !SHSceneManager::CheckNodeAndComponentsActive<SHColliderComponent>(C_INFO.GetEntityA())
|
||||
|| !SHSceneManager::CheckNodeAndComponentsActive<SHColliderComponent>(C_INFO.GetEntityB());
|
||||
|
||||
if (CLEAR_EVENT || INACTIVE_OBJECT)
|
||||
{
|
||||
eventIter = container.erase(eventIter);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
++eventIter;
|
||||
}
|
||||
};
|
||||
|
||||
CLEAR(collisionInfoContainer);
|
||||
CLEAR(triggerInfoContainer);
|
||||
}
|
||||
|
||||
void SHCollisionListener::ClearContainers() noexcept
|
||||
{
|
||||
collisionInfoContainer.clear();
|
||||
triggerInfoContainer.clear();
|
||||
}
|
||||
|
||||
void SHCollisionListener::onContact(const rp3d::CollisionCallback::CallbackData& callbackData)
|
||||
{
|
||||
for (uint32_t i = 0; i < callbackData.getNbContactPairs(); ++i)
|
||||
{
|
||||
const auto CONTACT_PAIR = callbackData.getContactPair(i);
|
||||
const SHCollisionInfo NEW_INFO = generateCollisionInfo(CONTACT_PAIR);
|
||||
|
||||
updateInfoContainers(NEW_INFO, collisionInfoContainer);
|
||||
}
|
||||
}
|
||||
|
||||
void SHCollisionListener::onTrigger(const rp3d::OverlapCallback::CallbackData& callbackData)
|
||||
{
|
||||
for (uint32_t i = 0; i < callbackData.getNbOverlappingPairs(); ++i)
|
||||
{
|
||||
const auto OVERLAP_PAIR = callbackData.getOverlappingPair(i);
|
||||
const SHCollisionInfo NEW_INFO = generateTriggerInfo(OVERLAP_PAIR);
|
||||
|
||||
updateInfoContainers(NEW_INFO, triggerInfoContainer);
|
||||
}
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionListener::updateInfoContainers(const SHCollisionInfo& collisionEvent, std::vector<SHCollisionInfo>& container) noexcept
|
||||
{
|
||||
const auto IT = std::ranges::find_if(container.begin(), container.end(), [&](const SHCollisionInfo& info)
|
||||
{
|
||||
const bool ENTITY_MATCH = (info.ids[0] == collisionEvent.ids[0] && info.ids[1] == collisionEvent.ids[1])
|
||||
|| (info.ids[0] == collisionEvent.ids[1] && info.ids[1] == collisionEvent.ids[0]);
|
||||
const bool COLLIDERS_MATCH = (info.ids[2] == collisionEvent.ids[2] && info.ids[3] == collisionEvent.ids[3])
|
||||
|| (info.ids[2] == collisionEvent.ids[3] && info.ids[3] == collisionEvent.ids[2]);
|
||||
return ENTITY_MATCH && COLLIDERS_MATCH;
|
||||
});
|
||||
|
||||
if (IT == container.end())
|
||||
container.emplace_back(collisionEvent);
|
||||
else
|
||||
IT->collisionState = collisionEvent.collisionState;
|
||||
}
|
||||
|
||||
SHCollisionInfo SHCollisionListener::generateCollisionInfo(const rp3d::CollisionCallback::ContactPair& cp) const noexcept
|
||||
{
|
||||
SHCollisionInfo cInfo;
|
||||
|
||||
// Update collision state
|
||||
cInfo.collisionState = static_cast<SHCollisionInfo::State>(cp.getEventType());
|
||||
|
||||
// Match body and collider for collision event
|
||||
const rp3d::Entity body1 = cp.getBody1()->getEntity();
|
||||
const rp3d::Entity body2 = cp.getBody2()->getEntity();
|
||||
const rp3d::Entity collider1 = cp.getCollider1()->getEntity();
|
||||
const rp3d::Entity collider2 = cp.getCollider2()->getEntity();
|
||||
|
||||
// Find and match both ids
|
||||
bool matched[2] = { false, false };
|
||||
|
||||
|
||||
for (auto& [entityID, physicsObject] : system->GetPhysicsObjects())
|
||||
{
|
||||
// Match body 1
|
||||
if (matched[SHCollisionInfo::ENTITY_A] == false && physicsObject.GetCollisionBody()->getEntity() == body1)
|
||||
{
|
||||
cInfo.ids[SHCollisionInfo::ENTITY_A] = entityID;
|
||||
cInfo.ids[SHCollisionInfo::COLLIDER_A] = matchColliders(physicsObject, collider1);
|
||||
|
||||
matched[SHCollisionInfo::ENTITY_A] = true;
|
||||
}
|
||||
|
||||
// Match body 2
|
||||
if (matched[SHCollisionInfo::ENTITY_B] == false && physicsObject.GetCollisionBody()->getEntity() == body2)
|
||||
{
|
||||
cInfo.ids[SHCollisionInfo::ENTITY_B] = entityID;
|
||||
cInfo.ids[SHCollisionInfo::COLLIDER_B] = matchColliders(physicsObject, collider2);
|
||||
|
||||
matched[SHCollisionInfo::ENTITY_B] = true;
|
||||
}
|
||||
|
||||
if (matched[SHCollisionInfo::ENTITY_A] == true && matched[SHCollisionInfo::ENTITY_B] == true)
|
||||
return cInfo;
|
||||
}
|
||||
|
||||
return cInfo;
|
||||
}
|
||||
|
||||
SHCollisionInfo SHCollisionListener::generateTriggerInfo(const rp3d::OverlapCallback::OverlapPair& cp) const noexcept
|
||||
{
|
||||
SHCollisionInfo cInfo;
|
||||
|
||||
// Update collision state
|
||||
cInfo.collisionState = static_cast<SHCollisionInfo::State>(cp.getEventType());
|
||||
|
||||
// Match body and collider for collision event
|
||||
const rp3d::Entity body1 = cp.getBody1()->getEntity();
|
||||
const rp3d::Entity body2 = cp.getBody2()->getEntity();
|
||||
const rp3d::Entity collider1 = cp.getCollider1()->getEntity();
|
||||
const rp3d::Entity collider2 = cp.getCollider2()->getEntity();
|
||||
|
||||
// Find and match both ids
|
||||
bool matched[2] = { false, false };
|
||||
|
||||
|
||||
for (auto& [entityID, physicsObject] : system->GetPhysicsObjects())
|
||||
{
|
||||
// Match body 1
|
||||
if (matched[SHCollisionInfo::ENTITY_A] == false && physicsObject.GetCollisionBody()->getEntity() == body1)
|
||||
{
|
||||
cInfo.ids[SHCollisionInfo::ENTITY_A] = entityID;
|
||||
cInfo.ids[SHCollisionInfo::COLLIDER_A] = matchColliders(physicsObject, collider1);
|
||||
|
||||
matched[SHCollisionInfo::ENTITY_A] = true;
|
||||
}
|
||||
|
||||
// Match body 2
|
||||
if (matched[SHCollisionInfo::ENTITY_B] == false && physicsObject.GetCollisionBody()->getEntity() == body2)
|
||||
{
|
||||
cInfo.ids[SHCollisionInfo::ENTITY_B] = entityID;
|
||||
cInfo.ids[SHCollisionInfo::COLLIDER_B] = matchColliders(physicsObject, collider2);
|
||||
|
||||
matched[SHCollisionInfo::ENTITY_B] = true;
|
||||
}
|
||||
|
||||
if (matched[SHCollisionInfo::ENTITY_A] == true && matched[SHCollisionInfo::ENTITY_B] == true)
|
||||
return cInfo;
|
||||
}
|
||||
|
||||
return cInfo;
|
||||
}
|
||||
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,7 +1,7 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionShapeLibrary.h
|
||||
* \file SHCollisionListener.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collison Shape Library.
|
||||
* \brief Interface for a Collision Listener.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
|
@ -10,99 +10,71 @@
|
|||
|
||||
#pragma once
|
||||
|
||||
#include <unordered_map>
|
||||
// External Dependencies
|
||||
#include <reactphysics3d/reactphysics3d.h>
|
||||
|
||||
// Project Header
|
||||
#include "SHSphere.h"
|
||||
#include "SHBox.h"
|
||||
// Project Headers
|
||||
#include "SH_API.h"
|
||||
#include "SHCollisionInfo.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Forward Declarations */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SHPhysicsSystem;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a class for Creating, Storing and Destroying Collision Shapes. <br/>
|
||||
* All memory for collision shapes are stored in this factory class. <br/>
|
||||
*/
|
||||
class SH_API SHCollisionShapeLibrary final
|
||||
class SH_API SHCollisionListener final : public rp3d::EventListener
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShapeLibrary () noexcept;
|
||||
~SHCollisionShapeLibrary () noexcept;
|
||||
SHCollisionListener() noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] const std::vector<SHCollisionInfo>& GetCollisionInfoContainer () const noexcept;
|
||||
[[nodiscard]] const std::vector<SHCollisionInfo>& GetTriggerInfoContainer () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Creates a sphere collision shape.
|
||||
* @param id
|
||||
* The ID of the shape.
|
||||
* @param createInfo
|
||||
* The info to create the sphere with.
|
||||
* @return
|
||||
* A new sphere collision shape.
|
||||
*/
|
||||
SHSphere* CreateSphere (SHCollisionShapeID id, const SHSphereCreateInfo& createInfo);
|
||||
void BindToSystem (SHPhysicsSystem* physicsSystem) noexcept;
|
||||
void BindToWorld (rp3d::PhysicsWorld* world) noexcept;
|
||||
void CleanContainers () noexcept;
|
||||
void ClearContainers () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Creates a box collision shape.
|
||||
* @param id
|
||||
* The ID of the shape.
|
||||
* @param createInfo
|
||||
* The info to create the box with.
|
||||
* @return
|
||||
* A new box collision shape.
|
||||
*/
|
||||
SHBox* CreateBox (SHCollisionShapeID id, const SHBoxCreateInfo& createInfo);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Destroys a collision shape.
|
||||
* * @param eid
|
||||
* The entity the shape belongs to.
|
||||
* @param shapeID
|
||||
* The ID of the shape.
|
||||
* @param shape
|
||||
* The shape to destroy.
|
||||
*/
|
||||
void DestroyShape (SHCollisionShape* shape);
|
||||
void onContact (const rp3d::CollisionCallback::CallbackData& callbackData) override;
|
||||
void onTrigger (const rp3d::OverlapCallback::CallbackData& callbackData) override;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// We use unordered maps for fast lookup when deleting.
|
||||
// Since we are not instancing shapes (yet?), I'd rather not iterate through an entire vector to find the shape.
|
||||
|
||||
using Spheres = std::unordered_map<SHCollisionShapeID, SHSphere*, SHCollisionShapeIDHash>;
|
||||
using Boxes = std::unordered_map<SHCollisionShapeID, SHBox*, SHCollisionShapeIDHash>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHHalfEdgeStructure boxHalfEdgeStructure;
|
||||
|
||||
Spheres spheres;
|
||||
Boxes boxes;
|
||||
// TODO: Add capsules and hulls
|
||||
SHPhysicsSystem* system;
|
||||
std::vector<SHCollisionInfo> collisionInfoContainer;
|
||||
std::vector<SHCollisionInfo> triggerInfoContainer;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void createBoxPolyhedron() noexcept;
|
||||
static void updateInfoContainers (const SHCollisionInfo& collisionEvent, std::vector<SHCollisionInfo>& container) noexcept;
|
||||
|
||||
SHCollisionInfo generateCollisionInfo (const rp3d::CollisionCallback::ContactPair& cp) const noexcept;
|
||||
SHCollisionInfo generateTriggerInfo (const rp3d::OverlapCallback::OverlapPair& cp) const noexcept;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,308 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionSpace.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Collision Space that handles collision detetction.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionSpace.h"
|
||||
|
||||
#include "Narrowphase/SHCollisionDispatch.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHAABBTree::AABBs& SHCollisionSpace::GetBroadphaseAABBs() const noexcept
|
||||
{
|
||||
return broadphase.GetAABBs();
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionSpace::SetContactManager(SHContactManager* _contactManager) noexcept
|
||||
{
|
||||
contactManager = _contactManager;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionSpace::AddCollider(SHCollider* collider) noexcept
|
||||
{
|
||||
const bool INSERTED = colliders.emplace(collider->entityID, collider).second;
|
||||
if (!INSERTED)
|
||||
{
|
||||
SHLOG_WARNING_D("Attempting to add duplicate collider {} to the Physics World!", collider->entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
collider->broadphase = &broadphase;
|
||||
|
||||
// Add all existing shapes to the broadphase
|
||||
for (const auto* shape : collider->shapes)
|
||||
broadphase.Insert(shape->id, shape->ComputeAABB());
|
||||
}
|
||||
|
||||
void SHCollisionSpace::RemoveCollider(SHCollider* collider) noexcept
|
||||
{
|
||||
colliders.erase(collider->entityID);
|
||||
|
||||
const uint32_t NUM_SHAPES = static_cast<uint32_t>(collider->shapes.size());
|
||||
if (NUM_SHAPES == 0)
|
||||
return;
|
||||
|
||||
for (uint32_t i = 0; i < NUM_SHAPES; ++i)
|
||||
broadphase.Remove(collider->shapes[i]->id);
|
||||
|
||||
if (contactManager)
|
||||
{
|
||||
contactManager->RemoveInvalidatedTrigger(collider->entityID);
|
||||
contactManager->RemoveInvalidatedManifold(collider->entityID);
|
||||
}
|
||||
|
||||
/*
|
||||
* TODO:
|
||||
* Get collider's rigid body
|
||||
* Run through the rigid body's contact graph and wake all of its non-static bodies that are asleep
|
||||
*/
|
||||
}
|
||||
|
||||
void SHCollisionSpace::UpdateBroadphase() noexcept
|
||||
{
|
||||
// Update any colliders that have moved
|
||||
for (auto& collider : colliders | std::views::values)
|
||||
{
|
||||
const bool IS_ACTIVE = collider->IsActive();
|
||||
const bool HAS_MOVED = collider->flags & SHCollider::MOVED_FLAG;
|
||||
|
||||
if (!IS_ACTIVE || !HAS_MOVED)
|
||||
continue;
|
||||
|
||||
// Clear hasMoved flag here
|
||||
collider->flags &= ~SHCollider::MOVED_FLAG;
|
||||
|
||||
// Update moved shapes in broadphase
|
||||
for (auto* shape : collider->shapes)
|
||||
broadphase.Update(shape->id, shape->ComputeAABB());
|
||||
}
|
||||
}
|
||||
|
||||
void SHCollisionSpace::DetectCollisions() noexcept
|
||||
{
|
||||
// TODO: Profile broad-phase and narrow-phase
|
||||
|
||||
/*
|
||||
* Broad-phase
|
||||
*/
|
||||
|
||||
// Broadphase Queries: Kinematic Triggers, Awake Dynamic Bodies & Dynamic Triggers
|
||||
for (auto& collider : colliders | std::views::values)
|
||||
{
|
||||
// Colliders without bodies are considered to be static bodies
|
||||
// This is specific to this engine because of Unity's stupid convention.
|
||||
const bool IS_IMPLICIT_STATIC = !collider->rigidBody;
|
||||
const bool IS_ACTIVE = collider->IsActive();
|
||||
|
||||
// Skip inactive colliders
|
||||
if (!IS_ACTIVE || IS_IMPLICIT_STATIC)
|
||||
continue;
|
||||
|
||||
const bool IS_EXPLICIT_STATIC = collider->rigidBody->GetType() == SHRigidBody::Type::STATIC;
|
||||
if (IS_EXPLICIT_STATIC)
|
||||
continue;
|
||||
|
||||
// All remaining are kinematic or dynamic
|
||||
// Iterate through shapes: if kinematic / dynamic trigger, else if dynamic & awake
|
||||
// Results are loaded into the narrowphase batch
|
||||
broadphaseQuery(collider->rigidBody->GetType(), collider);
|
||||
}
|
||||
|
||||
/*
|
||||
* Narrow-phase
|
||||
*/
|
||||
|
||||
// If no potential collisions, we can skip the entire narrow phase. No further updates necessary.
|
||||
// All contact / trigger states persist in this step.
|
||||
if (narrowphaseBatch.empty())
|
||||
return;
|
||||
|
||||
// All narrowphase IDs are unique, there should be no duplicate collision checks.
|
||||
// This applies both ways: A -> B and B -> A.
|
||||
for (auto& [key, narrowphasePair] : narrowphaseBatch)
|
||||
{
|
||||
// Filter through tags before attempting narrow-phase
|
||||
const uint16_t TAG_A = narrowphasePair.A->GetCollisionTag().GetMask();
|
||||
const uint16_t TAG_B = narrowphasePair.B->GetCollisionTag().GetMask();
|
||||
|
||||
const bool MATCH_TAG = TAG_A & TAG_B;
|
||||
if (!MATCH_TAG)
|
||||
continue;
|
||||
|
||||
const bool IS_A_TRIGGER = narrowphasePair.A->IsTrigger();
|
||||
const bool IS_B_TRIGGER = narrowphasePair.B->IsTrigger();
|
||||
|
||||
if (IS_A_TRIGGER || IS_B_TRIGGER)
|
||||
collideTriggers(key, narrowphasePair);
|
||||
else
|
||||
collideManifolds(key, narrowphasePair);
|
||||
}
|
||||
|
||||
// Clear every frame
|
||||
narrowphaseBatch.clear();
|
||||
|
||||
// Test all collisions
|
||||
if (contactManager)
|
||||
contactManager->Update();
|
||||
}
|
||||
|
||||
const SHCollisionSpace::RaycastResults& SHCollisionSpace::Raycast(const RaycastInfo& info) noexcept
|
||||
{
|
||||
static RaycastResults results;
|
||||
results.clear();
|
||||
|
||||
const bool FILTER_COLLIDER = info.colliderEntityID.has_value();
|
||||
|
||||
// Cast ray into the broadphase scene
|
||||
const auto& POTENTIAL_HITS = broadphase.Query(info.ray, info.distance);
|
||||
|
||||
if (POTENTIAL_HITS.empty())
|
||||
return results;
|
||||
|
||||
// Iterate through all potential hits
|
||||
const int NUM_HITS = static_cast<int>(POTENTIAL_HITS.size());
|
||||
for (const int i : std::ranges::views::iota(0, NUM_HITS))
|
||||
{
|
||||
const auto HIT_ID = POTENTIAL_HITS[i];
|
||||
|
||||
const EntityID EID = HIT_ID.GetEntityID();
|
||||
|
||||
if (FILTER_COLLIDER && EID == info.colliderEntityID.value())
|
||||
continue;
|
||||
|
||||
// Get shape
|
||||
const uint32_t IDX = HIT_ID.GetShapeIndex();
|
||||
const auto* SHAPE = colliders.find(EID)->second->GetCollisionShape(IDX);
|
||||
|
||||
// Filter the layers
|
||||
const bool LAYER_MATCH = SHAPE->GetCollisionTag().GetMask() & info.layers;
|
||||
if (!LAYER_MATCH)
|
||||
continue;
|
||||
|
||||
// We cast to the underlying shape. THis is done because a convex hull will not have an inherited raycast method.
|
||||
// Kinda awkward oversight...oops
|
||||
|
||||
SHRaycastResult baseResult;
|
||||
switch (SHAPE->GetType())
|
||||
{
|
||||
case SHCollisionShape::Type::SPHERE:
|
||||
{
|
||||
baseResult = dynamic_cast<const SHSphere*>(SHAPE)->Raycast(info.ray);
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::BOX:
|
||||
{
|
||||
baseResult = dynamic_cast<const SHBox*>(SHAPE)->Raycast(info.ray);
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::CAPSULE:
|
||||
{
|
||||
// TODO
|
||||
break;
|
||||
}
|
||||
default: continue; // Redundant case
|
||||
}
|
||||
|
||||
if (!baseResult || baseResult.distance > info.distance)
|
||||
continue;
|
||||
|
||||
// Copy to a physics raycast result
|
||||
SHPhysicsRaycastResult result;
|
||||
memcpy_s(&result, sizeof(SHRaycastResult), &baseResult, sizeof(SHRaycastResult));
|
||||
|
||||
result.entityHit = EID;
|
||||
result.shapeIndex = IDX;
|
||||
|
||||
results.emplace_back(result);
|
||||
}
|
||||
|
||||
return results;
|
||||
}
|
||||
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionSpace::broadphaseQuery(SHRigidBody::Type rigidBodyType, SHCollider* collider) noexcept
|
||||
{
|
||||
for (auto* shape : collider->shapes)
|
||||
{
|
||||
// For kinematic shapes, we only query triggers against everything else
|
||||
if (rigidBodyType == SHRigidBody::Type::KINEMATIC && !shape->IsTrigger())
|
||||
continue;
|
||||
|
||||
auto& potentialCollisions = broadphase.Query(shape->id, shape->ComputeAABB());
|
||||
|
||||
// Build narrow-phase pairs
|
||||
auto* shapeA = shape;
|
||||
|
||||
const EntityID ID_A = shape->id.GetEntityID();
|
||||
const uint32_t INDEX_A = shape->id.GetShapeIndex();
|
||||
|
||||
for (auto& id : potentialCollisions)
|
||||
{
|
||||
// Get corresponding shape
|
||||
const EntityID ID_B = id.GetEntityID();
|
||||
const uint32_t INDEX_B = id.GetShapeIndex();
|
||||
|
||||
auto* shapeB = colliders[ID_B]->GetCollisionShape(INDEX_B);
|
||||
|
||||
// Build collision ID
|
||||
SHCollisionKey collisionKey;
|
||||
collisionKey.SetEntityA(ID_A);
|
||||
collisionKey.SetEntityB(ID_B);
|
||||
collisionKey.SetCollisionShapeA(INDEX_A);
|
||||
collisionKey.SetCollisionShapeB(INDEX_B);
|
||||
|
||||
// Check if it already exists. If it doesn't, put into batch.
|
||||
// The overloaded equality operator ensures no duplicate collision tests are performed.
|
||||
auto narrowphasePair = narrowphaseBatch.find(collisionKey);
|
||||
if (narrowphasePair == narrowphaseBatch.end())
|
||||
narrowphaseBatch.emplace(collisionKey, NarrowphasePair{ shapeA, shapeB });
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void SHCollisionSpace::collideTriggers(const SHCollisionKey& key, NarrowphasePair& narrowphasePair) const noexcept
|
||||
{
|
||||
auto* A = narrowphasePair.A;
|
||||
auto* B = narrowphasePair.B;
|
||||
|
||||
// Send to contact manager
|
||||
if (contactManager)
|
||||
contactManager->AddTrigger(key, A, B);
|
||||
}
|
||||
|
||||
void SHCollisionSpace::collideManifolds(const SHCollisionKey& key, NarrowphasePair& narrowphasePair) const noexcept
|
||||
{
|
||||
auto* A = narrowphasePair.A;
|
||||
auto* B = narrowphasePair.B;
|
||||
|
||||
// Send to contact manager
|
||||
if (contactManager)
|
||||
contactManager->AddManifold(key, A, B);
|
||||
}
|
||||
} // namespace SHADE
|
|
@ -1,196 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionSpace.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Collision Space that handles collision detetction.
|
||||
* This is to separate the logic between dynamics and collision detection,
|
||||
* but the collision space does send information to the contact manager
|
||||
* for dynamic resolution and collision state reporting.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <optional>
|
||||
|
||||
// Project Headers
|
||||
#include "Broadphase/SHDynamicAABBTree.h"
|
||||
#include "Physics/Dynamics/SHContactManager.h"
|
||||
#include "SHCollider.h"
|
||||
#include "SHPhysicsRaycastResult.h"
|
||||
#include "CollisionTags/SHCollisionTags.h"
|
||||
#include "CollisionTags/SHCollisionTags.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Allows collision detection to be performed with the use of colliders & collision shapes.
|
||||
* The space will generate manifold data for resolution when needed.
|
||||
*/
|
||||
class SH_API SHCollisionSpace
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Contains information to cast a ray into the collision space.
|
||||
* The collider entityID and shape index is optional.
|
||||
*/
|
||||
struct RaycastInfo
|
||||
{
|
||||
private:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollisionSpace;
|
||||
|
||||
public:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
bool continuous = false;
|
||||
uint16_t layers = static_cast<uint16_t>(SHCollisionTag::Layer::ALL);
|
||||
float distance = std::numeric_limits<float>::infinity();
|
||||
SHRay ray;
|
||||
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Sets the collider ID for the raycast. Setting this specifies that the ray
|
||||
* should ignore this collider.
|
||||
* @param eid
|
||||
* The entity ID of the collider.
|
||||
*/
|
||||
void SetColliderID(EntityID eid) noexcept { colliderEntityID = eid; }
|
||||
|
||||
private:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
std::optional<EntityID> colliderEntityID;
|
||||
};
|
||||
|
||||
using RaycastResults = std::vector<SHPhysicsRaycastResult>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionSpace () noexcept = default;
|
||||
~SHCollisionSpace () noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
const SHAABBTree::AABBs& GetBroadphaseAABBs () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetContactManager(SHContactManager* contactManager) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a collider to the collision space for it to be tested for collision with
|
||||
* other colliders.
|
||||
* @param collider
|
||||
* A collider to add. Duplicates will be ignored.
|
||||
*/
|
||||
void AddCollider (SHCollider* collider) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Removes a collider from the collision space. This will prevent any collisions
|
||||
* being detected between it and other colliders unless manually tested.
|
||||
* @param collider
|
||||
* A collider to remove. If a reference to it doesn't exist, it will be ignored.
|
||||
*/
|
||||
void RemoveCollider (SHCollider* collider) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Invoke this method to update the broadphase of colliders that have been moved since
|
||||
* the last frame.
|
||||
*/
|
||||
void UpdateBroadphase () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Detects collisions between all colliders. Results are sent to the attached contact
|
||||
* manager for resolution.
|
||||
*/
|
||||
void DetectCollisions () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Casts a ray into the collision space.
|
||||
* @param info
|
||||
* Contains the information for the raycast.
|
||||
* @return
|
||||
* A container of the objects hit by the ray. If nothing was hit, the container
|
||||
* will be empty.
|
||||
*/
|
||||
[[nodiscard]] const RaycastResults& Raycast(const RaycastInfo& info) noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct NarrowphasePair
|
||||
{
|
||||
SHCollisionShape* A = nullptr;
|
||||
SHCollisionShape* B = nullptr;
|
||||
};
|
||||
|
||||
using Colliders = std::unordered_map<EntityID, SHCollider*>;
|
||||
using NarrowphaseBatch = std::unordered_map<SHCollisionKey, NarrowphasePair, SHCollisionKeyHash>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHContactManager* contactManager = nullptr;
|
||||
|
||||
Colliders colliders;
|
||||
NarrowphaseBatch narrowphaseBatch;
|
||||
|
||||
SHAABBTree broadphase;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// Broadphase helpers
|
||||
|
||||
void broadphaseQuery (SHRigidBody::Type rigidBodyType, SHCollider* collider) noexcept;
|
||||
|
||||
// Narrowphase helpers
|
||||
|
||||
void collideTriggers (const SHCollisionKey& key, NarrowphasePair& narrowphasePair) const noexcept;
|
||||
void collideManifolds (const SHCollisionKey& key, NarrowphasePair& narrowphasePair) const noexcept;
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -14,9 +14,6 @@
|
|||
// Primary Header
|
||||
#include "SHCollisionTagMatrix.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Tools/Utilities/SHUtilities.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
@ -148,9 +145,8 @@ namespace SHADE
|
|||
/**
|
||||
* I HATE FILE IO
|
||||
*
|
||||
* Each line in the file should be "index<space>tag name<space>mask".
|
||||
* If the line fails to follow this format, use the default tag name (index + 1) and default mask.
|
||||
* If no mask was read, use a default mask.
|
||||
* Each line in the file should be "index<space>tag name".
|
||||
* If the line fails to follow this format, use the default tag name (index + 1)
|
||||
*/
|
||||
|
||||
// Populate tag names with default
|
||||
|
@ -191,40 +187,18 @@ namespace SHADE
|
|||
{
|
||||
SHLOG_ERROR
|
||||
(
|
||||
"Collision tag file line {} does not match the required format of 'index<space>tag name<space>mask'. Default tag used for index {}"
|
||||
"Collision tag file line {} does not match the required format of 'index<space>tag name'. Default tag used for index {}"
|
||||
, linesRead + 1
|
||||
, tagIndex
|
||||
)
|
||||
|
||||
// Use default
|
||||
collisionTags[tagIndex].SetName(std::to_string(tagIndex + 1));
|
||||
collisionTags[tagIndex].SetMask(SHUtilities::ConvertEnum(SHCollisionTag::Layer::ALL));
|
||||
continue;
|
||||
}
|
||||
|
||||
collisionTags[tagIndex].SetName(tagName);
|
||||
|
||||
// Next element is the mask value
|
||||
std::string maskString;
|
||||
ss >> maskString;
|
||||
|
||||
uint16_t mask = std::numeric_limits<uint16_t>::max();
|
||||
if (maskString.empty())
|
||||
{
|
||||
SHLOG_ERROR
|
||||
(
|
||||
"Collision tag file line {} does not match the required format of 'index<space>tag name<space>mask'. Default mask used for index {}"
|
||||
, linesRead + 1
|
||||
, tagIndex
|
||||
)
|
||||
}
|
||||
else
|
||||
{
|
||||
mask = static_cast<uint16_t>(std::stoi(maskString));
|
||||
}
|
||||
|
||||
collisionTags[tagIndex].SetMask(mask);
|
||||
|
||||
ss.clear();
|
||||
}
|
||||
|
||||
|
@ -241,9 +215,8 @@ namespace SHADE
|
|||
return;
|
||||
}
|
||||
|
||||
// Index Name Mask
|
||||
for (int i = 0; i < SHCollisionTag::NUM_LAYERS; ++i)
|
||||
collisionTagNamesFile << i << " " << collisionTags[i].GetName() << " " << collisionTags[i].GetMask() << std::endl;
|
||||
collisionTagNamesFile << i << " " << collisionTags[i].GetName() << std::endl;
|
||||
|
||||
collisionTagNamesFile.close();
|
||||
}
|
|
@ -1,176 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCompositeCollider.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Composite Collider Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCompositeCollider.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Broadphase/SHDynamicAABBTree.h"
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/SHPhysicsEvents.h"
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCompositeCollider::SHCompositeCollider(EntityID eid, const SHTransform& worldTransform) noexcept
|
||||
: SHCollider( eid, worldTransform )
|
||||
{
|
||||
flags |= COMPOSITE_FLAG;
|
||||
}
|
||||
|
||||
SHCompositeCollider::SHCompositeCollider(const SHCompositeCollider& rhs) noexcept
|
||||
: SHCollider( rhs )
|
||||
{}
|
||||
|
||||
SHCompositeCollider::SHCompositeCollider(SHCompositeCollider&& rhs) noexcept
|
||||
: SHCollider( rhs )
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCompositeCollider& SHCompositeCollider::operator=(const SHCompositeCollider& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
SHCollider::operator=(rhs);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHCompositeCollider& SHCompositeCollider::operator=(SHCompositeCollider&& rhs) noexcept
|
||||
{
|
||||
SHCollider::operator=(rhs);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
int SHCompositeCollider::AddSphereCollisionShape(float relativeRadius, const SHVec3& posOffset, const SHVec3& rotOffset)
|
||||
{
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Collider {}. Unable to add new shape!", entityID)
|
||||
return -1;
|
||||
}
|
||||
|
||||
// Compute world radius
|
||||
const float SPHERE_SCALE = std::fabs(SHMath::Max({ transform.scale.x, transform.scale.y, transform.scale.z }));
|
||||
|
||||
// Compute center
|
||||
const SHQuaternion FINAL_ROT = transform.orientation * SHQuaternion::FromEuler(rotOffset);
|
||||
const SHMatrix TRS = SHMatrix::Rotate(FINAL_ROT) * SHMatrix::Translate(transform.position);
|
||||
|
||||
// Create Sphere
|
||||
const SHSphereCreateInfo SPHERE_CREATE_INFO
|
||||
{
|
||||
.Center = SHVec3::Transform(posOffset, TRS)
|
||||
, .Radius = relativeRadius * SPHERE_SCALE * 0.5f
|
||||
, .RelativeRadius = relativeRadius
|
||||
, .Scale = SPHERE_SCALE
|
||||
};
|
||||
|
||||
const uint32_t NEW_INDEX = static_cast<uint32_t>(shapes.size());
|
||||
const SHCollisionShapeID NEW_SHAPE_ID{ entityID, NEW_INDEX };
|
||||
|
||||
SHSphere* sphere = shapeLibrary->CreateSphere(NEW_SHAPE_ID, SPHERE_CREATE_INFO);
|
||||
|
||||
// Set offsets
|
||||
sphere->collider = this;
|
||||
sphere->SetPositionOffset(posOffset);
|
||||
sphere->SetRotationOffset(rotOffset);
|
||||
|
||||
shapes.emplace_back(sphere);
|
||||
|
||||
if (broadphase)
|
||||
broadphase->Insert(NEW_SHAPE_ID, sphere->ComputeAABB());
|
||||
|
||||
// Broadcast Event for adding a shape
|
||||
const SHPhysicsColliderAddedEvent EVENT_DATA
|
||||
{
|
||||
.entityID = entityID
|
||||
, .colliderType = SHCollisionShape::Type::SPHERE
|
||||
, .colliderIndex = static_cast<int>(NEW_INDEX)
|
||||
};
|
||||
|
||||
SHEventManager::BroadcastEvent<SHPhysicsColliderAddedEvent>(EVENT_DATA, SH_PHYSICS_COLLIDER_ADDED_EVENT);
|
||||
|
||||
if (rigidBody)
|
||||
rigidBody->ComputeMassData();
|
||||
|
||||
return static_cast<int>(NEW_INDEX);
|
||||
}
|
||||
|
||||
int SHCompositeCollider::AddBoxCollisionShape(const SHVec3& relativeExtents, const SHVec3& posOffset, const SHVec3& rotOffset)
|
||||
{
|
||||
if (!shapeLibrary)
|
||||
{
|
||||
SHLOGV_ERROR("Shape factory is unlinked with Collider {}. Unable to add new shape!", entityID)
|
||||
return -1;
|
||||
}
|
||||
|
||||
// Compute center
|
||||
const SHQuaternion FINAL_ROT = transform.orientation * SHQuaternion::FromEuler(rotOffset);
|
||||
const SHMatrix TRS = SHMatrix::Rotate(FINAL_ROT) * SHMatrix::Translate(transform.position);
|
||||
|
||||
// Create Sphere
|
||||
const SHBoxCreateInfo BOX_CREATE_INFO
|
||||
{
|
||||
.Center = SHVec3::Transform(posOffset, TRS)
|
||||
, .Extents = relativeExtents * SHVec3::Abs(transform.scale) * 0.5f
|
||||
, .RelativeExtents = relativeExtents
|
||||
, .Orientation = FINAL_ROT
|
||||
, .Scale = SHVec3::Abs(transform.scale)
|
||||
};
|
||||
|
||||
const uint32_t NEW_INDEX = static_cast<uint32_t>(shapes.size());
|
||||
const SHCollisionShapeID NEW_SHAPE_ID{ entityID, NEW_INDEX };
|
||||
|
||||
SHBox* box = shapeLibrary->CreateBox(NEW_SHAPE_ID, BOX_CREATE_INFO);
|
||||
|
||||
// Set offsets
|
||||
box->collider = this;
|
||||
box->SetPositionOffset(posOffset);
|
||||
box->SetRotationOffset(rotOffset);
|
||||
|
||||
shapes.emplace_back(box);
|
||||
|
||||
if (broadphase)
|
||||
broadphase->Insert(NEW_SHAPE_ID, box->ComputeAABB());
|
||||
|
||||
// Broadcast Event for adding a shape
|
||||
const SHPhysicsColliderAddedEvent EVENT_DATA
|
||||
{
|
||||
.entityID = entityID
|
||||
, .colliderType = SHCollisionShape::Type::BOX
|
||||
, .colliderIndex = static_cast<int>(NEW_INDEX)
|
||||
};
|
||||
|
||||
SHEventManager::BroadcastEvent<SHPhysicsColliderAddedEvent>(EVENT_DATA, SH_PHYSICS_COLLIDER_ADDED_EVENT);
|
||||
|
||||
if (rigidBody)
|
||||
rigidBody->ComputeMassData();
|
||||
|
||||
return static_cast<int>(NEW_INDEX);
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,80 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCompositeCollider.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Composite Collider Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "SHCollider.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the behaviour of a collider with composited shapes. <br/>
|
||||
* Contains no data members but methods to add multiple shapes.
|
||||
*/
|
||||
class SH_API SHCompositeCollider : public SHCollider
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCompositeCollider(EntityID eid, const SHTransform& worldTransform = SHTransform::Identity) noexcept;
|
||||
SHCompositeCollider(const SHCompositeCollider& rhs) noexcept;
|
||||
SHCompositeCollider(SHCompositeCollider&& rhs) noexcept;
|
||||
~SHCompositeCollider () noexcept override = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCompositeCollider& operator=(const SHCompositeCollider& rhs) noexcept;
|
||||
SHCompositeCollider& operator=(SHCompositeCollider&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a sphere collision shape.
|
||||
* @param relativeRadius
|
||||
* The relative radius is constructed with respect to the world scale. <br/>
|
||||
* Radius = max(scale.x, scale.y, scale.z) * 0.5 * relativeRadius
|
||||
* @param posOffset
|
||||
* The position offset of the sphere from the center of the collider. Defaults to a Zero Vector.
|
||||
* @param rotOffset
|
||||
* The rotation offset of the sphere from the rotation of the collider. Defaults to a Zero Vector.
|
||||
* @return
|
||||
* The index of the newly added shape.
|
||||
*/
|
||||
int AddSphereCollisionShape (float relativeRadius, const SHVec3& posOffset = SHVec3::Zero, const SHVec3& rotOffset = SHVec3::Zero);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a box collision shape.
|
||||
* @param relativeExtents
|
||||
* The relative extents are constructed with respect to the world scale. <br/>
|
||||
* Extents = scale * 0.5 * relativeExtents
|
||||
* @param posOffset
|
||||
* The position offset of the box from the center of the collider. Defaults to a Zero Vector.
|
||||
* @param rotOffset
|
||||
* The rotation offset of the box from the rotation of the collider. Defaults to a Zero Vector.
|
||||
* @return
|
||||
* The index of the newly added shape.
|
||||
*/
|
||||
int AddBoxCollisionShape (const SHVec3& relativeExtents, const SHVec3& posOffset = SHVec3::Zero, const SHVec3& rotOffset = SHVec3::Zero);
|
||||
|
||||
// TODO: Add Capsule
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -0,0 +1,350 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsRaycaster.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Physics Raycaster.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHPhysicsRaycaster.h"
|
||||
|
||||
/*
|
||||
* TODO(DIREN):
|
||||
* Once the physics engine has been rebuilt, this whole implementation should change
|
||||
* and just call PhysicsWorld.Raycast etc.
|
||||
*
|
||||
* SHRaycastResult can be converted to a bool when necessary.
|
||||
*/
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsRaycaster::SHPhysicsRaycaster() noexcept
|
||||
: world { nullptr }
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHPhysicsRaycaster::RaycastPairs& SHPhysicsRaycaster::GetRaycasts() const noexcept
|
||||
{
|
||||
return raycasts;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsRaycaster::SetObjectManager(SHPhysicsObjectManager* physicsObjectManager) noexcept
|
||||
{
|
||||
objectManager = physicsObjectManager;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsRaycaster::BindToWorld(rp3d::PhysicsWorld* physicsWorld) noexcept
|
||||
{
|
||||
world = physicsWorld;
|
||||
}
|
||||
|
||||
void SHPhysicsRaycaster::ClearFrame() noexcept
|
||||
{
|
||||
raycasts.clear();
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::Raycast(const SHRay& ray, float distance, const SHCollisionTag& collisionTag) noexcept
|
||||
{
|
||||
// Reset temp
|
||||
temp = SHPhysicsRaycastResult{};
|
||||
temp.distance = distance;
|
||||
|
||||
if (!world)
|
||||
{
|
||||
SHLOG_ERROR("Physics world missing for raycasting!")
|
||||
return temp;
|
||||
}
|
||||
|
||||
// If distance in infinity, cast to the default max distance of 2 km.
|
||||
if (distance == std::numeric_limits<float>::infinity())
|
||||
{
|
||||
world->raycast(ray, this, collisionTag);
|
||||
}
|
||||
else
|
||||
{
|
||||
const SHVec3 END_POINT = ray.position + ray.direction * distance;
|
||||
const rp3d::Ray RP3D_RAY{ ray.position, END_POINT };
|
||||
world->raycast(RP3D_RAY, this, collisionTag);
|
||||
}
|
||||
|
||||
// If a hit was found, populate temp info for return.
|
||||
if (temp.hit)
|
||||
{
|
||||
temp.distance = SHVec3::Distance(ray.position, temp.position);
|
||||
temp.angle = SHVec3::Angle(ray.position, temp.position);
|
||||
}
|
||||
|
||||
raycasts.emplace_back(ray, temp);
|
||||
return temp;
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::Linecast(const SHVec3& start, const SHVec3& end, const SHCollisionTag& collisionTag) noexcept
|
||||
{
|
||||
temp = SHPhysicsRaycastResult{};
|
||||
temp.distance = SHVec3::Distance(start, end);
|
||||
|
||||
if (!world)
|
||||
{
|
||||
SHLOG_ERROR("Physics world missing for raycasting!")
|
||||
return temp;
|
||||
}
|
||||
|
||||
const rp3d::Ray RP3D_RAY{ start, end };
|
||||
world->raycast(RP3D_RAY, this, collisionTag);
|
||||
|
||||
if (temp.hit)
|
||||
{
|
||||
temp.distance = SHVec3::Distance(start, temp.position);
|
||||
temp.angle = SHVec3::Angle(start, temp.position);
|
||||
}
|
||||
|
||||
raycasts.emplace_back(RP3D_RAY, temp);
|
||||
return temp;
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::ColliderRaycast(EntityID eid, const SHRay& ray, float distance) noexcept
|
||||
{
|
||||
SHPhysicsRaycastResult result;
|
||||
result.distance = distance;
|
||||
|
||||
// Get a valid physics object with at least 1 collider.
|
||||
const auto* PHYSICS_OBJECT = validateColliderRaycast(eid);
|
||||
if (!PHYSICS_OBJECT)
|
||||
return result;
|
||||
|
||||
auto* rp3dBody = PHYSICS_OBJECT->GetCollisionBody();
|
||||
|
||||
// Data to populate
|
||||
rp3d::RaycastInfo rp3dRaycastInfo;
|
||||
bool hit = false;
|
||||
|
||||
if (distance == std::numeric_limits<float>::infinity())
|
||||
{
|
||||
hit = rp3dBody->raycast(ray, rp3dRaycastInfo);
|
||||
}
|
||||
else
|
||||
{
|
||||
const SHVec3 END_POINT = ray.position + ray.direction * distance;
|
||||
const rp3d::Ray RP3D_RAY{ ray.position, END_POINT };
|
||||
hit = rp3dBody->raycast(RP3D_RAY, rp3dRaycastInfo);
|
||||
}
|
||||
|
||||
if (hit)
|
||||
{
|
||||
result.hit = true;
|
||||
result.position = rp3dRaycastInfo.worldPoint;
|
||||
result.normal = rp3dRaycastInfo.worldPoint;
|
||||
result.distance = SHVec3::Distance(ray.position, result.position);
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
result.entityHit = eid;
|
||||
result.shapeIndex = findColliderIndex(rp3dBody, rp3dRaycastInfo.collider->getEntity());
|
||||
}
|
||||
|
||||
raycasts.emplace_back(ray, result);
|
||||
return result;
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::ColliderRaycast(EntityID eid, int shapeIndex, const SHRay& ray, float distance) noexcept
|
||||
{
|
||||
SHPhysicsRaycastResult result;
|
||||
result.distance = distance;
|
||||
|
||||
// Get a valid physics object with at least 1 collider.
|
||||
const auto* PHYSICS_OBJECT = validateColliderRaycast(eid);
|
||||
if (!PHYSICS_OBJECT)
|
||||
return result;
|
||||
|
||||
// Boundary check for shape index
|
||||
if (shapeIndex < 0 || shapeIndex >= static_cast<int>(PHYSICS_OBJECT->GetCollisionBody()->getNbColliders()))
|
||||
{
|
||||
SHLOGV_WARNING("Invalid collision shape index passed in")
|
||||
return result;
|
||||
}
|
||||
|
||||
auto* rp3dCollider = PHYSICS_OBJECT->GetCollisionBody()->getCollider(shapeIndex);
|
||||
|
||||
rp3d::RaycastInfo rp3dRaycastInfo;
|
||||
bool hit = false;
|
||||
if (distance == std::numeric_limits<float>::infinity())
|
||||
{
|
||||
hit = rp3dCollider->raycast(ray, rp3dRaycastInfo);
|
||||
}
|
||||
else
|
||||
{
|
||||
const SHVec3 END_POINT = ray.position + ray.direction * distance;
|
||||
const rp3d::Ray RP3D_RAY{ ray.position, END_POINT };
|
||||
hit = rp3dCollider->raycast(RP3D_RAY, rp3dRaycastInfo);
|
||||
}
|
||||
|
||||
if (hit)
|
||||
{
|
||||
result.hit = true;
|
||||
result.position = rp3dRaycastInfo.worldPoint;
|
||||
result.normal = rp3dRaycastInfo.worldPoint;
|
||||
result.distance = SHVec3::Distance(ray.position, result.position);
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
result.entityHit = eid;
|
||||
result.shapeIndex = shapeIndex;
|
||||
}
|
||||
|
||||
raycasts.emplace_back(ray, result);
|
||||
return result;
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::ColliderLinecast(EntityID eid, const SHVec3& start, const SHVec3& end) noexcept
|
||||
{
|
||||
SHPhysicsRaycastResult result;
|
||||
result.distance = SHVec3::Distance(start, end);
|
||||
|
||||
const auto* PHYSICS_OBJECT = validateColliderRaycast(eid);
|
||||
if (!PHYSICS_OBJECT)
|
||||
return result;
|
||||
|
||||
auto* rp3dBody = PHYSICS_OBJECT->GetCollisionBody();
|
||||
|
||||
rp3d::RaycastInfo rp3dRaycastInfo;
|
||||
|
||||
const rp3d::Ray RP3D_RAY{ start, end };
|
||||
if (rp3dBody->raycast(RP3D_RAY, rp3dRaycastInfo))
|
||||
{
|
||||
result.hit = true;
|
||||
result.position = rp3dRaycastInfo.worldPoint;
|
||||
result.normal = rp3dRaycastInfo.worldPoint;
|
||||
result.distance = SHVec3::Distance(start, result.position);
|
||||
result.angle = SHVec3::Angle(end, result.position);
|
||||
result.entityHit = eid;
|
||||
result.shapeIndex = findColliderIndex(rp3dBody, rp3dRaycastInfo.collider->getEntity());
|
||||
}
|
||||
|
||||
raycasts.emplace_back(RP3D_RAY, result);
|
||||
return result;
|
||||
}
|
||||
|
||||
SHPhysicsRaycastResult SHPhysicsRaycaster::ColliderLinecast(EntityID eid, int shapeIndex, const SHVec3& start, const SHVec3& end) noexcept
|
||||
{
|
||||
SHPhysicsRaycastResult result;
|
||||
result.distance = SHVec3::Distance(start, end);
|
||||
|
||||
const auto* PHYSICS_OBJECT = validateColliderRaycast(eid);
|
||||
if (!PHYSICS_OBJECT)
|
||||
return result;
|
||||
|
||||
if (shapeIndex < 0 || shapeIndex >= static_cast<int>(PHYSICS_OBJECT->GetCollisionBody()->getNbColliders()))
|
||||
{
|
||||
SHLOGV_WARNING("Invalid collision shape index passed in")
|
||||
return result;
|
||||
}
|
||||
|
||||
auto* rp3dCollider = PHYSICS_OBJECT->GetCollisionBody()->getCollider(shapeIndex);
|
||||
|
||||
rp3d::RaycastInfo rp3dRaycastInfo;
|
||||
|
||||
const rp3d::Ray RP3D_RAY{ start, end };
|
||||
if (rp3dCollider->raycast(RP3D_RAY, rp3dRaycastInfo))
|
||||
{
|
||||
result.hit = true;
|
||||
result.position = rp3dRaycastInfo.worldPoint;
|
||||
result.normal = rp3dRaycastInfo.worldPoint;
|
||||
result.distance = SHVec3::Distance(start, result.position);
|
||||
result.angle = SHVec3::Angle(end, result.position);
|
||||
result.entityHit = eid;
|
||||
result.shapeIndex = shapeIndex;
|
||||
}
|
||||
|
||||
raycasts.emplace_back(RP3D_RAY, result);
|
||||
return result;
|
||||
}
|
||||
|
||||
rp3d::decimal SHPhysicsRaycaster::notifyRaycastHit(const rp3d::RaycastInfo& raycastInfo)
|
||||
{
|
||||
temp.hit = true;
|
||||
temp.position = raycastInfo.worldPoint;
|
||||
temp.normal = raycastInfo.worldNormal;
|
||||
|
||||
if (!objectManager)
|
||||
{
|
||||
SHLOGV_ERROR("No physics object manager linked with raycaster to match bodies")
|
||||
return 0.0f;
|
||||
}
|
||||
|
||||
// Compare body IDs to find the matching physics object
|
||||
const auto HIT_BODY_EID = raycastInfo.body->getEntity();
|
||||
|
||||
for (const auto& [entityID, physicsObject] : objectManager->GetPhysicsObjects())
|
||||
{
|
||||
const auto RP3D_BODY = physicsObject.GetCollisionBody();
|
||||
|
||||
// Match rp3d bodies
|
||||
if (RP3D_BODY->getEntity() != HIT_BODY_EID)
|
||||
continue;
|
||||
|
||||
temp.entityHit = entityID;
|
||||
|
||||
// Find collider index
|
||||
if (const int INDEX = findColliderIndex(RP3D_BODY, raycastInfo.collider->getEntity()); INDEX > -1)
|
||||
{
|
||||
temp.shapeIndex = INDEX;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
return 0.0f;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Function Member Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject* SHPhysicsRaycaster::validateColliderRaycast(EntityID eid) noexcept
|
||||
{
|
||||
if (!objectManager)
|
||||
{
|
||||
SHLOGV_ERROR("No physics object manager linked with raycaster to match bodies")
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
auto* physicsObject = objectManager->GetPhysicsObject(eid);
|
||||
if (!physicsObject || physicsObject->GetCollisionBody()->getNbColliders() == 0)
|
||||
{
|
||||
SHLOGV_WARNING("Cannot cast ray at an entity without colliders!")
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
return physicsObject;
|
||||
}
|
||||
|
||||
int SHPhysicsRaycaster::findColliderIndex(const rp3d::CollisionBody* rp3dBody, rp3d::Entity rp3dColliderEID) noexcept
|
||||
{
|
||||
const int NUM_COLLISION_SHAPES = static_cast<int>(rp3dBody->getNbColliders());
|
||||
for (int i = 0; i < NUM_COLLISION_SHAPES; ++i)
|
||||
{
|
||||
const auto COLLIDER_EID = rp3dBody->getCollider(i)->getEntity();
|
||||
if (COLLIDER_EID == rp3dColliderEID)
|
||||
return i;
|
||||
}
|
||||
|
||||
return -1;
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -0,0 +1,134 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsRaycaster.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Physics Raycaster.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <vector>
|
||||
|
||||
#include <reactphysics3d/reactphysics3d.h>
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHRay.h"
|
||||
#include "Physics/PhysicsObject/SHPhysicsObjectManager.h"
|
||||
#include "Physics/SHPhysicsWorld.h"
|
||||
#include "SH_API.h"
|
||||
#include "SHCollisionTags.h"
|
||||
#include "SHPhysicsRaycastResult.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SH_API SHPhysicsRaycaster : public reactphysics3d::RaycastCallback
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
using RaycastPair = std::pair<SHRay, SHPhysicsRaycastResult>;
|
||||
using RaycastPairs = std::vector<RaycastPair>;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsRaycaster() noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] const RaycastPairs& GetRaycasts() const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetObjectManager(SHPhysicsObjectManager* physicsObjectManager) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void BindToWorld (rp3d::PhysicsWorld* physicsWorld) noexcept;
|
||||
void ClearFrame () noexcept;
|
||||
|
||||
// TODO(Diren): Filtering, return all shades ray hits
|
||||
|
||||
SHPhysicsRaycastResult Raycast
|
||||
(
|
||||
const SHRay& ray
|
||||
, float distance = std::numeric_limits<float>::infinity()
|
||||
, const SHCollisionTag& collisionTag = SHCollisionTag{}
|
||||
) noexcept;
|
||||
|
||||
SHPhysicsRaycastResult Linecast
|
||||
(
|
||||
const SHVec3& start
|
||||
, const SHVec3& end
|
||||
, const SHCollisionTag& collisionTag = SHCollisionTag{}
|
||||
) noexcept;
|
||||
|
||||
SHPhysicsRaycastResult ColliderRaycast
|
||||
(
|
||||
EntityID eid
|
||||
, const SHRay& ray
|
||||
, float distance = std::numeric_limits<float>::infinity()
|
||||
) noexcept;
|
||||
|
||||
SHPhysicsRaycastResult ColliderRaycast
|
||||
(
|
||||
EntityID eid
|
||||
, int shapeIndex
|
||||
, const SHRay& ray
|
||||
, float distance = std::numeric_limits<float>::infinity()
|
||||
) noexcept;
|
||||
|
||||
SHPhysicsRaycastResult ColliderLinecast
|
||||
(
|
||||
EntityID eid
|
||||
, const SHVec3& start
|
||||
, const SHVec3& end
|
||||
) noexcept;
|
||||
|
||||
SHPhysicsRaycastResult ColliderLinecast
|
||||
(
|
||||
EntityID eid
|
||||
, int shapeIndex
|
||||
, const SHVec3& start
|
||||
, const SHVec3& end
|
||||
) noexcept;
|
||||
|
||||
rp3d::decimal notifyRaycastHit(const rp3d::RaycastInfo& raycastInfo) override;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
rp3d::PhysicsWorld* world;
|
||||
SHPhysicsObjectManager* objectManager; // For
|
||||
SHPhysicsRaycastResult temp; // Holds the temporary result after casting into the world
|
||||
RaycastPairs raycasts; // Used for debug drawing
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject* validateColliderRaycast (EntityID eid) noexcept;
|
||||
static int findColliderIndex (const rp3d::CollisionBody* rp3dBody, rp3d::Entity rp3dColliderEID) noexcept;
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,319 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHBoxCollisionShape.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Box Collision Shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHBox.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Math/SHMatrix.h"
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHBox::SHBox(SHCollisionShapeID id) noexcept
|
||||
: SHConvexPolyhedron (id, Type::BOX)
|
||||
, relativeExtents { SHVec3::One }
|
||||
, scale { SHVec3::One }
|
||||
{
|
||||
Extents = SHVec3::One * 0.5f;
|
||||
}
|
||||
|
||||
SHBox::SHBox(const SHBox& rhs) noexcept
|
||||
: SHConvexPolyhedron ( rhs )
|
||||
, relativeExtents { rhs.relativeExtents }
|
||||
, scale { rhs.scale }
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
Orientation = rhs.Orientation;
|
||||
}
|
||||
|
||||
SHBox::SHBox(SHBox&& rhs) noexcept
|
||||
: SHConvexPolyhedron ( rhs )
|
||||
, relativeExtents { rhs.relativeExtents }
|
||||
, scale { rhs.scale }
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
Orientation = rhs.Orientation;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHBox& SHBox::operator=(const SHBox& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
// Collision Shape Properties
|
||||
|
||||
SHConvexPolyhedron::operator=(rhs);
|
||||
|
||||
// Box Properties
|
||||
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
Orientation = rhs.Orientation;
|
||||
|
||||
// Local Properties
|
||||
|
||||
relativeExtents = rhs.relativeExtents;
|
||||
scale = rhs.scale;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHBox& SHBox::operator=(SHBox&& rhs) noexcept
|
||||
{
|
||||
// Collision Shape Properties
|
||||
|
||||
SHConvexPolyhedron::operator=(rhs);
|
||||
|
||||
// Box Properties
|
||||
|
||||
Center = rhs.Center;
|
||||
Extents = rhs.Extents;
|
||||
Orientation = rhs.Orientation;
|
||||
|
||||
// Local Properties
|
||||
|
||||
relativeExtents = rhs.relativeExtents;
|
||||
scale = rhs.scale;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 SHBox::GetWorldExtents() const noexcept
|
||||
{
|
||||
return Extents;
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetRelativeExtents() const noexcept
|
||||
{
|
||||
return relativeExtents;
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetVertex(int index) const
|
||||
{
|
||||
if (index < 0 || index >= NUM_VERTICES)
|
||||
throw std::invalid_argument("Index out-of-range!");
|
||||
|
||||
SHVec3 vertices[NUM_VERTICES];
|
||||
GetCorners(vertices);
|
||||
|
||||
return vertices[index];
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetNormal(int faceIndex) const
|
||||
{
|
||||
// Get local normal
|
||||
const SHVec3& LOCAL_NORMAL = halfEdgeStructure->GetFace(faceIndex).normal;
|
||||
|
||||
// Rotate normal into world space
|
||||
return SHVec3::Rotate(LOCAL_NORMAL, Orientation);
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetWorldCentroid() const noexcept
|
||||
{
|
||||
return Center;
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetRelativeCentroid() const noexcept
|
||||
{
|
||||
if (collider)
|
||||
return SHVec3{ Center } - collider->GetPosition();
|
||||
|
||||
return Center;
|
||||
}
|
||||
|
||||
SHVec3 SHBox::GetLocalCentroid() const noexcept
|
||||
{
|
||||
return SHVec3::Zero;
|
||||
}
|
||||
|
||||
SHQuaternion SHBox::GetWorldOrientation() const noexcept
|
||||
{
|
||||
return Orientation;
|
||||
}
|
||||
|
||||
SHQuaternion SHBox::GetRelativeOrientation() const noexcept
|
||||
{
|
||||
return transform.orientation;
|
||||
}
|
||||
|
||||
float SHBox::GetVolume() const noexcept
|
||||
{
|
||||
return 8.0f * (Extents.x * Extents.y * Extents.z);
|
||||
}
|
||||
|
||||
float SHBox::GetSurfaceArea() const noexcept
|
||||
{
|
||||
return 8.0f * (Extents.x * Extents.y
|
||||
+ Extents.x * Extents.z
|
||||
+ Extents.y * Extents.z);
|
||||
}
|
||||
|
||||
SHMatrix SHBox::GetInertiaTensor(float mass) const noexcept
|
||||
{
|
||||
static constexpr float ONE_OVER_TWELVE = (1.0f / 12.0f);
|
||||
|
||||
const float WIDTH = 2.0f * Extents.x;
|
||||
const float HEIGHT = 2.0f * Extents.y;
|
||||
const float DEPTH = 2.0f * Extents.z;
|
||||
|
||||
const float WIDTH_SQUARED = WIDTH * WIDTH;
|
||||
const float HEIGHT_SQUARED = HEIGHT * HEIGHT;
|
||||
const float DEPTH_SQUARED = DEPTH * DEPTH;
|
||||
|
||||
const float H2_PLUS_D2 = HEIGHT_SQUARED + DEPTH_SQUARED;
|
||||
const float W2_PLUS_H2 = WIDTH_SQUARED + HEIGHT_SQUARED;
|
||||
const float W2_PLUS_D2 = WIDTH_SQUARED + DEPTH_SQUARED;
|
||||
|
||||
SHMatrix result;
|
||||
result.m[0][0] = ONE_OVER_TWELVE * mass * H2_PLUS_D2;
|
||||
result.m[1][1] = ONE_OVER_TWELVE * mass * W2_PLUS_H2;
|
||||
result.m[2][2] = ONE_OVER_TWELVE * mass * W2_PLUS_D2;
|
||||
return result;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHBox::SetWorldExtents(const SHVec3& newWorldExtents) noexcept
|
||||
{
|
||||
Extents = newWorldExtents;
|
||||
|
||||
// Recompute Relative radius
|
||||
relativeExtents = 2.0f * Extents / scale;
|
||||
}
|
||||
|
||||
void SHBox::SetRelativeExtents(const SHVec3& newRelativeExtents) noexcept
|
||||
{
|
||||
relativeExtents = newRelativeExtents;
|
||||
|
||||
// Recompute world radius
|
||||
Extents = relativeExtents * scale * 0.5f;
|
||||
}
|
||||
|
||||
void SHBox::SetScale(const SHVec3& newScale) noexcept
|
||||
{
|
||||
scale = SHVec3::Abs(newScale);
|
||||
|
||||
// Recompute world radius
|
||||
Extents = relativeExtents * scale * 0.5f;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHBox::Update() noexcept
|
||||
{
|
||||
const SHTransform& PARENT_TRANSFORM = collider->GetTransform();
|
||||
|
||||
SetScale(PARENT_TRANSFORM.scale);
|
||||
|
||||
// Recompute center
|
||||
const SHQuaternion FINAL_ROT = PARENT_TRANSFORM.orientation * transform.orientation;
|
||||
const SHMatrix TRS = SHMatrix::Rotate(FINAL_ROT) * SHMatrix::Translate(PARENT_TRANSFORM.position);
|
||||
|
||||
Orientation = FINAL_ROT;
|
||||
Center = SHVec3::Transform(transform.position, TRS);
|
||||
}
|
||||
|
||||
bool SHBox::TestPoint(const SHVec3& point) const noexcept
|
||||
{
|
||||
return Contains(point);
|
||||
}
|
||||
|
||||
SHRaycastResult SHBox::Raycast(const SHRay& ray) const noexcept
|
||||
{
|
||||
SHRaycastResult result;
|
||||
|
||||
result.hit = Intersects(ray.position, ray.direction, result.distance);
|
||||
if (result.hit)
|
||||
{
|
||||
result.position = ray.position + ray.direction * result.distance;
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
|
||||
// TODO: Compute Normal: Test which face the position belongs in. The normal is that face's normal.
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
SHMatrix SHBox::GetTRS() const noexcept
|
||||
{
|
||||
const SHQuaternion ROTATION = collider ? collider->GetTransform().orientation * transform.orientation : Orientation;
|
||||
const SHVec3 SCALE = SHVec3{ Extents } *2.0f;
|
||||
|
||||
return SHMatrix::Transform(Center, ROTATION, SCALE);
|
||||
}
|
||||
|
||||
SHAABB SHBox::ComputeAABB() const noexcept
|
||||
{
|
||||
SHVec3 min{ std::numeric_limits<float>::max() };
|
||||
SHVec3 max{ std::numeric_limits<float>::lowest() };
|
||||
|
||||
SHVec3 vertices[NUM_VERTICES];
|
||||
GetCorners(vertices);
|
||||
|
||||
for (auto& vertex : vertices)
|
||||
{
|
||||
min = SHVec3::Min({ vertex, min });
|
||||
max = SHVec3::Max({ vertex, max });
|
||||
}
|
||||
|
||||
const SHVec3 HALF_EXTENTS = (max - min) * 0.5f;
|
||||
const SHVec3 CENTROID = min + HALF_EXTENTS;
|
||||
|
||||
return SHAABB{ CENTROID, HALF_EXTENTS };
|
||||
}
|
||||
|
||||
SHVec3 SHBox::FindSupportPoint(const SHVec3& direction) const noexcept
|
||||
{
|
||||
float bestDistance = std::numeric_limits<float>::lowest();
|
||||
|
||||
|
||||
SHVec3 vertices[NUM_VERTICES];
|
||||
GetCorners(vertices);
|
||||
|
||||
// No reason to put the center really..
|
||||
SHVec3 bestPoint = Center;
|
||||
for (auto& vertex : vertices)
|
||||
{
|
||||
const float PROJECTION = SHVec3::Dot(vertex, direction);
|
||||
|
||||
if (PROJECTION > bestDistance)
|
||||
{
|
||||
bestDistance = PROJECTION;
|
||||
bestPoint = vertex;
|
||||
}
|
||||
}
|
||||
|
||||
return bestPoint;
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,129 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHBox.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Box Collision Shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <DirectXCollision.h>
|
||||
|
||||
// Project Headers
|
||||
#include "SHConvexPolyhedron.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the information to create a box.
|
||||
*/
|
||||
struct SHBoxCreateInfo
|
||||
{
|
||||
public:
|
||||
SHVec3 Center = SHVec3::Zero;
|
||||
SHVec3 Extents = SHVec3::One * 0.5f;
|
||||
SHVec3 RelativeExtents = SHVec3::One;
|
||||
SHQuaternion Orientation = SHQuaternion::Identity;
|
||||
SHVec3 Scale = SHVec3::One;
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulate a Box Shape used for Physics Simulations.
|
||||
*/
|
||||
class SH_API SHBox final : public SHConvexPolyhedron
|
||||
, private DirectX::BoundingOrientedBox
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollider;
|
||||
friend class SHCompositeCollider;
|
||||
friend class SHCollision;
|
||||
friend class SHCollisionShapeLibrary;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static constexpr int NUM_VERTICES = 8;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHBox (SHCollisionShapeID id) noexcept;
|
||||
SHBox (const SHBox& rhs) noexcept;
|
||||
SHBox (SHBox&& rhs) noexcept;
|
||||
|
||||
~SHBox () override = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHBox& operator= (const SHBox& rhs) noexcept;
|
||||
SHBox& operator= (SHBox&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] SHVec3 GetWorldExtents () const noexcept;
|
||||
[[nodiscard]] SHVec3 GetRelativeExtents () const noexcept;
|
||||
|
||||
// Overriden Methods
|
||||
|
||||
[[nodiscard]] SHVec3 GetVertex (int index) const override;
|
||||
[[nodiscard]] SHVec3 GetNormal (int faceIndex) const override;
|
||||
|
||||
[[nodiscard]] SHVec3 GetWorldCentroid () const noexcept override;
|
||||
[[nodiscard]] SHVec3 GetRelativeCentroid () const noexcept override;
|
||||
[[nodiscard]] SHVec3 GetLocalCentroid () const noexcept override;
|
||||
[[nodiscard]] SHQuaternion GetWorldOrientation () const noexcept override;
|
||||
[[nodiscard]] SHQuaternion GetRelativeOrientation () const noexcept override;
|
||||
[[nodiscard]] float GetVolume () const noexcept override;
|
||||
[[nodiscard]] float GetSurfaceArea () const noexcept override;
|
||||
[[nodiscard]] SHMatrix GetInertiaTensor (float mass) const noexcept override;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetWorldExtents (const SHVec3& newWorldExtents) noexcept;
|
||||
void SetRelativeExtents (const SHVec3& newRelativeExtents) noexcept;
|
||||
void SetScale (const SHVec3& newScale) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void Update () noexcept override;
|
||||
[[nodiscard]] bool TestPoint (const SHVec3& point) const noexcept override;
|
||||
[[nodiscard]] SHRaycastResult Raycast (const SHRay& ray) const noexcept override;
|
||||
[[nodiscard]] SHMatrix GetTRS () const noexcept override;
|
||||
[[nodiscard]] SHAABB ComputeAABB () const noexcept override;
|
||||
[[nodiscard]] SHVec3 FindSupportPoint (const SHVec3& direction) const noexcept override;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 relativeExtents;
|
||||
SHVec3 scale;
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,188 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollider.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Collider.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionShape.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
#include "Physics/Collision/CollisionTags/SHCollisionTagMatrix.h"
|
||||
#include "Reflection/SHReflectionMetadata.h"
|
||||
#include "Tools/Utilities/SHUtilities.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShape::SHCollisionShape(SHCollisionShapeID id, Type colliderType)
|
||||
: id { id }
|
||||
, flags { 0 }
|
||||
, collider { nullptr }
|
||||
, collisionTag { SHCollisionTagMatrix::GetTag(0) }
|
||||
{
|
||||
flags |= 1U << SHUtilities::ConvertEnum(colliderType);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
EntityID SHCollisionShape::GetEntityID() const noexcept
|
||||
{
|
||||
return id.GetEntityID();
|
||||
}
|
||||
|
||||
uint32_t SHCollisionShape::GetIndex() const noexcept
|
||||
{
|
||||
return id.GetShapeIndex();
|
||||
}
|
||||
|
||||
float SHCollisionShape::GetFriction() const noexcept
|
||||
{
|
||||
return material.GetFriction();
|
||||
}
|
||||
|
||||
float SHCollisionShape::GetBounciness() const noexcept
|
||||
{
|
||||
return material.GetBounciness();
|
||||
}
|
||||
|
||||
float SHCollisionShape::GetDensity() const noexcept
|
||||
{
|
||||
return material.GetDensity();
|
||||
}
|
||||
|
||||
const SHPhysicsMaterial& SHCollisionShape::GetMaterial() const noexcept
|
||||
{
|
||||
return material;
|
||||
}
|
||||
|
||||
const SHVec3& SHCollisionShape::GetPositionOffset() const noexcept
|
||||
{
|
||||
return transform.position;
|
||||
}
|
||||
|
||||
const SHVec3& SHCollisionShape::GetRotationOffset() const noexcept
|
||||
{
|
||||
return rotationOffset;
|
||||
}
|
||||
|
||||
SHCollisionShape::Type SHCollisionShape::GetType() const noexcept
|
||||
{
|
||||
for (int i = 0; i < SHUtilities::ConvertEnum(Type::COUNT); ++i)
|
||||
{
|
||||
const uint8_t FLAG_VALUE = 1U << SHUtilities::ConvertEnum(static_cast<Type>(i));
|
||||
|
||||
if (flags & FLAG_VALUE)
|
||||
return static_cast<Type>(i);
|
||||
}
|
||||
|
||||
return Type::INVALID;
|
||||
}
|
||||
|
||||
bool SHCollisionShape::IsTrigger() const noexcept
|
||||
{
|
||||
static constexpr int FLAG_POS = 3;
|
||||
static constexpr uint8_t FLAG_VALUE = 1U << FLAG_POS;
|
||||
|
||||
return flags & FLAG_VALUE;
|
||||
}
|
||||
|
||||
bool SHCollisionShape::IsColliding() const noexcept
|
||||
{
|
||||
static constexpr int FLAG_POS = 4;
|
||||
static constexpr uint8_t FLAG_VALUE = 1U << FLAG_POS;
|
||||
|
||||
return flags & FLAG_VALUE;
|
||||
}
|
||||
|
||||
const SHCollisionTag& SHCollisionShape::GetCollisionTag() const noexcept
|
||||
{
|
||||
return *collisionTag;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionShape::SetCollisionTag(SHCollisionTag* newCollisionTag) noexcept
|
||||
{
|
||||
collisionTag = newCollisionTag;
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetFriction(float friction) noexcept
|
||||
{
|
||||
material.SetFriction(friction);
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetBounciness(float bounciness) noexcept
|
||||
{
|
||||
material.SetBounciness(bounciness);
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetDensity(float density) noexcept
|
||||
{
|
||||
material.SetDensity(density);
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetMaterial(const SHPhysicsMaterial& newMaterial) noexcept
|
||||
{
|
||||
material = newMaterial;
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetPositionOffset(const SHVec3& posOffset) noexcept
|
||||
{
|
||||
transform.position = posOffset;
|
||||
|
||||
Update();
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetRotationOffset(const SHVec3& rotOffset) noexcept
|
||||
{
|
||||
rotationOffset = rotOffset;
|
||||
transform.orientation = SHQuaternion::FromEuler(rotationOffset);
|
||||
|
||||
Update();
|
||||
}
|
||||
|
||||
void SHCollisionShape::SetIsTrigger(bool isTrigger) noexcept
|
||||
{
|
||||
static constexpr int FLAG_POS = 3;
|
||||
static constexpr uint8_t FLAG_VALUE = 1U << FLAG_POS;
|
||||
|
||||
isTrigger ? flags |= FLAG_VALUE : flags &= ~FLAG_VALUE;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
||||
|
||||
RTTR_REGISTRATION
|
||||
{
|
||||
using namespace SHADE;
|
||||
using namespace rttr;
|
||||
|
||||
registration::enumeration<SHCollisionShape::Type>("Collider Type")
|
||||
(
|
||||
value("Box", SHCollisionShape::Type::BOX),
|
||||
value("Sphere", SHCollisionShape::Type::SPHERE)
|
||||
// TODO(Diren): Add More Shapes
|
||||
);
|
||||
|
||||
registration::class_<SHCollisionShape>("Collider")
|
||||
.property("IsTrigger" , &SHCollisionShape::IsTrigger , &SHCollisionShape::SetIsTrigger )
|
||||
.property("Friction" , &SHCollisionShape::GetFriction , &SHCollisionShape::SetFriction )
|
||||
.property("Bounciness" , &SHCollisionShape::GetBounciness , &SHCollisionShape::SetBounciness )
|
||||
.property("Density" , &SHCollisionShape::GetDensity , &SHCollisionShape::SetDensity )
|
||||
.property("Position Offset" , &SHCollisionShape::GetPositionOffset, &SHCollisionShape::SetPositionOffset)
|
||||
.property("Rotation Offset" , &SHCollisionShape::GetRotationOffset, &SHCollisionShape::SetRotationOffset) (metadata(META::angleInRad, true));
|
||||
}
|
|
@ -1,210 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionShape.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Base CollisionShape Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <rttr/registration>
|
||||
|
||||
// Project Headers
|
||||
#include "ECS_Base/Entity/SHEntity.h"
|
||||
#include "Physics/Collision/CollisionTags/SHCollisionTags.h"
|
||||
#include "Physics/Collision/SHPhysicsMaterial.h"
|
||||
#include "SHCollisionShapeID.h"
|
||||
#include "Math/Geometry/SHAABB.h"
|
||||
#include "Math/Transform/SHTransform.h"
|
||||
#include "Physics/Collision/SHPhysicsRaycastResult.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Forward Declarations */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SHRigidBody;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
class SH_API SHCollisionShape
|
||||
{
|
||||
private:
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollider;
|
||||
friend class SHCompositeCollider;
|
||||
friend class SHColliderComponent;
|
||||
friend class SHCollisionShapeLibrary;
|
||||
friend class SHCollisionSpace;
|
||||
friend struct SHManifold;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
enum class Type
|
||||
{
|
||||
SPHERE
|
||||
, BOX
|
||||
, CAPSULE
|
||||
, CONVEX_HULL
|
||||
|
||||
, COUNT
|
||||
, INVALID = -1
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShape (SHCollisionShapeID id, Type colliderType = Type::SPHERE);
|
||||
|
||||
SHCollisionShape (const SHCollisionShape& rhs) noexcept = default;
|
||||
SHCollisionShape (SHCollisionShape&& rhs) noexcept = default;
|
||||
virtual ~SHCollisionShape () noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShape& operator=(const SHCollisionShape& rhs) noexcept = default;
|
||||
SHCollisionShape& operator=(SHCollisionShape&& rhs) noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] EntityID GetEntityID () const noexcept;
|
||||
[[nodiscard]] uint32_t GetIndex () const noexcept;
|
||||
|
||||
// Material Properties
|
||||
// TODO: Remove individual setters once instanced materials are supported
|
||||
|
||||
[[nodiscard]] float GetFriction () const noexcept;
|
||||
[[nodiscard]] float GetBounciness () const noexcept;
|
||||
[[nodiscard]] float GetDensity () const noexcept;
|
||||
[[nodiscard]] const SHPhysicsMaterial& GetMaterial () const noexcept;
|
||||
|
||||
// Offsets
|
||||
|
||||
[[nodiscard]] const SHVec3& GetPositionOffset () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetRotationOffset () const noexcept;
|
||||
|
||||
// Flags
|
||||
|
||||
[[nodiscard]] Type GetType () const noexcept;
|
||||
[[nodiscard]] bool IsTrigger () const noexcept;
|
||||
[[nodiscard]] bool IsColliding () const noexcept;
|
||||
|
||||
[[nodiscard]] const SHCollisionTag& GetCollisionTag () const noexcept;
|
||||
|
||||
// Virtual methods
|
||||
|
||||
[[nodiscard]] virtual SHVec3 GetWorldCentroid () const noexcept = 0;
|
||||
[[nodiscard]] virtual SHVec3 GetRelativeCentroid () const noexcept = 0;
|
||||
[[nodiscard]] virtual SHVec3 GetLocalCentroid () const noexcept = 0;
|
||||
[[nodiscard]] virtual SHQuaternion GetWorldOrientation () const noexcept = 0;
|
||||
[[nodiscard]] virtual SHQuaternion GetRelativeOrientation () const noexcept = 0;
|
||||
[[nodiscard]] virtual float GetVolume () const noexcept = 0;
|
||||
[[nodiscard]] virtual float GetSurfaceArea () const noexcept = 0;
|
||||
[[nodiscard]] virtual SHMatrix GetInertiaTensor (float mass) const noexcept = 0;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCollisionTag (SHCollisionTag* newCollisionTag) noexcept;
|
||||
|
||||
void SetFriction (float friction) noexcept;
|
||||
void SetBounciness (float bounciness) noexcept;
|
||||
void SetDensity (float density) noexcept;
|
||||
void SetMaterial (const SHPhysicsMaterial& newMaterial) noexcept;
|
||||
|
||||
void SetPositionOffset (const SHVec3& posOffset) noexcept;
|
||||
void SetRotationOffset (const SHVec3& rotOffset) noexcept;
|
||||
|
||||
// Flags
|
||||
|
||||
// Forces rigidbody to recompute mass if one exists
|
||||
void SetIsTrigger (bool isTrigger) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes the transform of the shape.
|
||||
*/
|
||||
virtual void Update () noexcept = 0;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Tests if a point is inside this shape.
|
||||
* @param point
|
||||
* The point to test against the shape.
|
||||
* @return
|
||||
* True if the point is inside the shape. False otherwise.
|
||||
*/
|
||||
[[nodiscard]] virtual bool TestPoint (const SHVec3& point) const noexcept = 0;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Casts a ray at this shape.
|
||||
* @param ray
|
||||
* The ray to cast at the shape.
|
||||
* @return
|
||||
* The result of the ray cast. See the corresponding struct for it's contents.
|
||||
*/
|
||||
[[nodiscard]] virtual SHRaycastResult Raycast (const SHRay& ray) const noexcept = 0;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes the TRS matrix for rendering the shape.
|
||||
* @return
|
||||
* The model-to-world matrix for rendering the shape.
|
||||
*/
|
||||
[[nodiscard]] virtual SHMatrix GetTRS () const noexcept = 0;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes a tight-fitting AABB around this shape.
|
||||
* @return
|
||||
* An AABB.
|
||||
*/
|
||||
[[nodiscard]] virtual SHAABB ComputeAABB () const noexcept = 0;
|
||||
|
||||
protected:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShapeID id;
|
||||
|
||||
SHCollider* collider; // The collider it belongs to.
|
||||
SHCollisionTag* collisionTag;
|
||||
SHPhysicsMaterial material; // TODO: Change to pointer once instancing is supported
|
||||
|
||||
SHTransform transform; // Stores the local position and rotation.
|
||||
|
||||
// Needed for conversion to euler angles
|
||||
SHVec3 rotationOffset;
|
||||
|
||||
uint8_t flags; // 0 0 0 trigger convexHull capsule sphere box
|
||||
|
||||
|
||||
RTTR_ENABLE()
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,80 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionShapeKey.hpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Inlined Implementations for a Collison Shape ID Class and
|
||||
* it's hashing function.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionShapeID.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline SHCollisionShapeID::SHCollisionShapeID(EntityID eid, uint32_t shapeID) noexcept
|
||||
: ids { eid, shapeID }
|
||||
{}
|
||||
|
||||
inline SHCollisionShapeID::SHCollisionShapeID(const SHCollisionShapeID& rhs) noexcept
|
||||
: ids { rhs.ids.entityID, rhs.ids.shapeIndex }
|
||||
{}
|
||||
|
||||
inline SHCollisionShapeID::SHCollisionShapeID(SHCollisionShapeID&& rhs) noexcept
|
||||
: ids { rhs.ids.entityID, rhs.ids.shapeIndex }
|
||||
{}
|
||||
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline SHCollisionShapeID& SHCollisionShapeID::operator=(const SHCollisionShapeID& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
value = rhs.value;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
inline SHCollisionShapeID& SHCollisionShapeID::operator=(SHCollisionShapeID&& rhs) noexcept
|
||||
{
|
||||
value = rhs.value;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
inline bool SHCollisionShapeID::operator==(const SHCollisionShapeID& rhs) const
|
||||
{
|
||||
return value == rhs.value;
|
||||
}
|
||||
|
||||
inline std::size_t SHCollisionShapeIDHash::operator()(const SHCollisionShapeID& id) const
|
||||
{
|
||||
return std::hash<uint64_t>{}(id.value);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
inline EntityID SHCollisionShapeID::GetEntityID() const noexcept
|
||||
{
|
||||
return ids.entityID;
|
||||
}
|
||||
|
||||
inline uint32_t SHCollisionShapeID::GetShapeIndex() const noexcept
|
||||
{
|
||||
return ids.shapeIndex;
|
||||
}
|
||||
}
|
|
@ -1,174 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHCollisionShapeLibrary.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Collison Shape Factory Class.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHCollisionShapeLibrary.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHCollisionShapeLibrary::SHCollisionShapeLibrary() noexcept
|
||||
{
|
||||
createBoxPolyhedron();
|
||||
}
|
||||
|
||||
SHCollisionShapeLibrary::~SHCollisionShapeLibrary() noexcept
|
||||
{
|
||||
// Free all shapes in each container
|
||||
for (auto* sphereCollisionShape : spheres | std::views::values)
|
||||
DestroyShape(sphereCollisionShape);
|
||||
|
||||
// Free all shapes in each container
|
||||
for (auto* boxCollisionShape : boxes | std::views::values)
|
||||
DestroyShape(boxCollisionShape);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere* SHCollisionShapeLibrary::CreateSphere(SHCollisionShapeID id, const SHSphereCreateInfo& createInfo)
|
||||
{
|
||||
const auto RESULT = spheres.emplace(id, new SHSphere{ id });
|
||||
if (RESULT.second)
|
||||
{
|
||||
SHSphere* sphere = RESULT.first->second;
|
||||
|
||||
sphere->Center = createInfo.Center;
|
||||
sphere->Radius = createInfo.Radius;
|
||||
sphere->relativeRadius = createInfo.RelativeRadius;
|
||||
sphere->scale = createInfo.Scale;
|
||||
|
||||
return sphere;
|
||||
}
|
||||
|
||||
return spheres.find(id)->second;
|
||||
}
|
||||
|
||||
SHBox* SHCollisionShapeLibrary::CreateBox(SHCollisionShapeID id, const SHBoxCreateInfo& createInfo)
|
||||
{
|
||||
const auto RESULT = boxes.emplace(id, new SHBox{ id });
|
||||
if (RESULT.second)
|
||||
{
|
||||
SHBox* box = RESULT.first->second;
|
||||
|
||||
box->Center = createInfo.Center;
|
||||
box->Extents = createInfo.Extents;
|
||||
box->relativeExtents = createInfo.RelativeExtents;
|
||||
box->Orientation = createInfo.Orientation;
|
||||
box->scale = createInfo.Scale;
|
||||
|
||||
// Set halfEdge data structure for the box
|
||||
box->halfEdgeStructure = &boxHalfEdgeStructure;
|
||||
|
||||
return box;
|
||||
}
|
||||
|
||||
return boxes.find(id)->second;
|
||||
}
|
||||
|
||||
|
||||
void SHCollisionShapeLibrary::DestroyShape(SHCollisionShape* shape)
|
||||
{
|
||||
switch (shape->GetType())
|
||||
{
|
||||
case SHCollisionShape::Type::BOX:
|
||||
{
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::SPHERE:
|
||||
{
|
||||
SHSphere* sphere = spheres.find(shape->id)->second;
|
||||
spheres.erase(shape->id);
|
||||
|
||||
delete sphere;
|
||||
sphere = nullptr;
|
||||
|
||||
break;
|
||||
}
|
||||
case SHCollisionShape::Type::CAPSULE:
|
||||
{
|
||||
break;
|
||||
}
|
||||
default: break;
|
||||
}
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHCollisionShapeLibrary::createBoxPolyhedron() noexcept
|
||||
{
|
||||
static constexpr int NUM_VERTICES_PER_FACE = 4;
|
||||
static constexpr int NUM_FACES = 6;
|
||||
|
||||
/*
|
||||
* Vertices (Front/Back Face):
|
||||
*
|
||||
* 3/7 ---------- 2/6
|
||||
* | |
|
||||
* | |
|
||||
* | |
|
||||
* 0/4 ---------- 1/5
|
||||
*
|
||||
* Faces:
|
||||
*
|
||||
* Front: 0 (0,1,2,3) Normal: -Z
|
||||
* Right: 1 (1,5,6,2) Normal: X
|
||||
* Back: 2 (5,4,7,6) Normal: Z
|
||||
* Left: 3 (4,0,3,7) Normal: -X
|
||||
* Top: 4 (3,2,6,7) Normal: Y
|
||||
* Bottom: 5 (4,5,1,0) Normal: -Y
|
||||
*
|
||||
*/
|
||||
|
||||
// Create face data
|
||||
|
||||
const SHVec3 FACE_NORMALS[NUM_FACES]
|
||||
{
|
||||
-SHVec3::UnitZ
|
||||
, SHVec3::UnitX
|
||||
, SHVec3::UnitZ
|
||||
, -SHVec3::UnitX
|
||||
, SHVec3::UnitY
|
||||
, -SHVec3::UnitY
|
||||
};
|
||||
|
||||
const int32_t FACE_VERTICES[NUM_FACES][NUM_VERTICES_PER_FACE]
|
||||
{
|
||||
{ 0, 1, 2, 3 }
|
||||
, { 5, 6, 2, 1 }
|
||||
, { 5, 4, 7, 6 }
|
||||
, { 0, 3, 7, 4 }
|
||||
, { 2, 6, 7, 3 }
|
||||
, { 5, 1, 0, 4 }
|
||||
};
|
||||
|
||||
for (int i = 0; i < NUM_FACES; ++i)
|
||||
{
|
||||
SHHalfEdgeStructure::Face newFace;
|
||||
newFace.normal = FACE_NORMALS[i];
|
||||
|
||||
for (int j = 0; j < NUM_VERTICES_PER_FACE; ++j)
|
||||
newFace.vertexIndices.emplace_back(FACE_VERTICES[i][j]);
|
||||
|
||||
boxHalfEdgeStructure.AddFace(newFace);
|
||||
}
|
||||
|
||||
boxHalfEdgeStructure.Build();
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,96 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHConvexPolyhedronCollisionShape.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a convex polyhedron collision shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHConvexPolyhedron.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHConvexPolyhedron::SHConvexPolyhedron(SHCollisionShapeID id,Type polyhedronType) noexcept
|
||||
: SHCollisionShape (id, polyhedronType)
|
||||
, halfEdgeStructure { nullptr }
|
||||
{}
|
||||
|
||||
SHConvexPolyhedron::SHConvexPolyhedron(const SHConvexPolyhedron& rhs) noexcept
|
||||
: SHCollisionShape ( rhs )
|
||||
, halfEdgeStructure { rhs.halfEdgeStructure }
|
||||
{}
|
||||
|
||||
SHConvexPolyhedron::SHConvexPolyhedron(SHConvexPolyhedron&& rhs) noexcept
|
||||
: SHCollisionShape ( rhs )
|
||||
, halfEdgeStructure { rhs.halfEdgeStructure }
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHConvexPolyhedron& SHConvexPolyhedron::operator=(const SHConvexPolyhedron& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
SHCollisionShape::operator=(rhs);
|
||||
|
||||
// Local Properties
|
||||
halfEdgeStructure = rhs.halfEdgeStructure;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHConvexPolyhedron& SHConvexPolyhedron::operator=(SHConvexPolyhedron&& rhs) noexcept
|
||||
{
|
||||
SHCollisionShape::operator=(rhs);
|
||||
|
||||
// Local Properties
|
||||
halfEdgeStructure = rhs.halfEdgeStructure;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHHalfEdgeStructure* SHConvexPolyhedron::GetHalfEdgeStructure() const noexcept
|
||||
{
|
||||
return halfEdgeStructure;
|
||||
}
|
||||
|
||||
int32_t SHConvexPolyhedron::GetFaceCount() const noexcept
|
||||
{
|
||||
return halfEdgeStructure->GetFaceCount();
|
||||
}
|
||||
|
||||
int32_t SHConvexPolyhedron::GetHalfEdgeCount() const noexcept
|
||||
{
|
||||
return halfEdgeStructure->GetHalfEdgeCount();
|
||||
}
|
||||
|
||||
const SHHalfEdgeStructure::Face& SHConvexPolyhedron::GetFace(int index) const
|
||||
{
|
||||
// Assume it has already been initialised
|
||||
return halfEdgeStructure->GetFace(index);
|
||||
}
|
||||
|
||||
const SHHalfEdgeStructure::HalfEdge& SHConvexPolyhedron::GetHalfEdge(int index) const
|
||||
{
|
||||
// Assume it has already been initialised
|
||||
return halfEdgeStructure->GetHalfEdge(index);
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,93 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHConvexPolyhedronCollisionShape.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a convex polyhedron collision shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "SHCollisionShape.h"
|
||||
#include "SHHalfEdgeStructure.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a convex polyhedron shape used for Physics Simulations..
|
||||
*/
|
||||
class SH_API SHConvexPolyhedron : public SHCollisionShape
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHCollider;
|
||||
friend class SHCollision;
|
||||
friend class SHCollisionShapeLibrary;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHConvexPolyhedron (SHCollisionShapeID id, Type polyhedronType) noexcept;
|
||||
SHConvexPolyhedron (const SHConvexPolyhedron& rhs) noexcept;
|
||||
SHConvexPolyhedron (SHConvexPolyhedron&& rhs) noexcept;
|
||||
|
||||
~SHConvexPolyhedron () override = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHConvexPolyhedron& operator=(const SHConvexPolyhedron& rhs) noexcept;
|
||||
SHConvexPolyhedron& operator=(SHConvexPolyhedron&& rhs) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] const SHHalfEdgeStructure* GetHalfEdgeStructure () const noexcept;
|
||||
[[nodiscard]] int32_t GetFaceCount () const noexcept;
|
||||
[[nodiscard]] const SHHalfEdgeStructure::Face& GetFace (int index) const;
|
||||
[[nodiscard]] int32_t GetHalfEdgeCount () const noexcept;
|
||||
[[nodiscard]] const SHHalfEdgeStructure::HalfEdge& GetHalfEdge (int index) const;
|
||||
|
||||
// Virtual Methods
|
||||
|
||||
[[nodiscard]] virtual SHVec3 GetVertex (int index) const = 0;
|
||||
[[nodiscard]] virtual SHVec3 GetNormal (int faceIndex) const = 0;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Finds the most extreme point on the polygon in a given direction.
|
||||
* @param direction
|
||||
* The direction to find the support point in.
|
||||
* @return
|
||||
* The most extreme vertex in the given direction.
|
||||
*/
|
||||
[[nodiscard]] virtual SHVec3 FindSupportPoint (const SHVec3& direction) const noexcept = 0;
|
||||
|
||||
protected:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHHalfEdgeStructure* halfEdgeStructure; // Defines the polyhedron by it's half edges.
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,182 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHHalfEdgeStructure.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a half-edge data structure to represent polyhedra.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHHalfEdgeStructure.h"
|
||||
|
||||
// Helper Macros
|
||||
|
||||
#define BUILD_UINT64_FROM_UINT32S(a, b) (uint64_t)a << 32 | b
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHHalfEdgeStructure::Face::Face(const Face& rhs) noexcept
|
||||
: normal { rhs.normal }
|
||||
{
|
||||
std::ranges::copy(rhs.vertexIndices.begin(), rhs.vertexIndices.end(), std::back_inserter(vertexIndices));
|
||||
}
|
||||
|
||||
SHHalfEdgeStructure::Face::Face(Face&& rhs) noexcept
|
||||
: normal { rhs.normal }
|
||||
{
|
||||
std::ranges::copy(rhs.vertexIndices.begin(), rhs.vertexIndices.end(), std::back_inserter(vertexIndices));
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHHalfEdgeStructure::Face& SHHalfEdgeStructure::Face::operator=(const Face& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
normal = rhs.normal;
|
||||
|
||||
vertexIndices.clear();
|
||||
std::ranges::copy(rhs.vertexIndices.begin(), rhs.vertexIndices.end(), std::back_inserter(vertexIndices));
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHHalfEdgeStructure::Face& SHHalfEdgeStructure::Face::operator=(Face&& rhs) noexcept
|
||||
{
|
||||
normal = rhs.normal;
|
||||
|
||||
vertexIndices.clear();
|
||||
std::ranges::copy(rhs.vertexIndices.begin(), rhs.vertexIndices.end(), std::back_inserter(vertexIndices));
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
int32_t SHHalfEdgeStructure::GetFaceCount() const noexcept
|
||||
{
|
||||
return static_cast<int32_t>(faces.size());
|
||||
}
|
||||
|
||||
int32_t SHHalfEdgeStructure::GetHalfEdgeCount() const noexcept
|
||||
{
|
||||
return static_cast<int32_t>(halfEdges.size());
|
||||
}
|
||||
|
||||
const SHHalfEdgeStructure::Face& SHHalfEdgeStructure::GetFace(int32_t index) const
|
||||
{
|
||||
if (index < 0 || index >= static_cast<int32_t>(faces.size()))
|
||||
throw std::invalid_argument("Index out-of-range!");
|
||||
|
||||
return faces[index];
|
||||
}
|
||||
|
||||
const SHHalfEdgeStructure::HalfEdge& SHHalfEdgeStructure::GetHalfEdge(int32_t index) const
|
||||
{
|
||||
if (index < 0 || index >= static_cast<int32_t>(halfEdges.size()))
|
||||
throw std::invalid_argument("Index out-of-range!");
|
||||
|
||||
return halfEdges[index];
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHHalfEdgeStructure::AddFace(const Face& face)
|
||||
{
|
||||
faces.emplace_back(face);
|
||||
}
|
||||
|
||||
void SHHalfEdgeStructure::Build() noexcept
|
||||
{
|
||||
// We use the pair of vertex IDs on a half-edge to prevent duplicates
|
||||
std::unordered_map<uint64_t, HalfEdge> edgeMap;
|
||||
edgeMap.clear();
|
||||
|
||||
if (faces.empty())
|
||||
{
|
||||
SHLOGV_CRITICAL("Unable to build convex polyhedron, no faces have been added!")
|
||||
return;
|
||||
}
|
||||
|
||||
// For each face, build half edges
|
||||
for (size_t i = 0; i < faces.size(); ++i)
|
||||
{
|
||||
Face& face = faces[i];
|
||||
|
||||
if (face.vertexIndices.empty())
|
||||
{
|
||||
SHLOGV_CRITICAL("Unable to build convex polyhedron, no vertices have been added to face {}!", i)
|
||||
return;
|
||||
}
|
||||
|
||||
// Iterate through vertices and build half-edges
|
||||
for (size_t j = 0; j < face.vertexIndices.size(); ++j)
|
||||
{
|
||||
const int32_t TAIL = face.vertexIndices[j].index;
|
||||
const int32_t HEAD = face.vertexIndices[(j + 1) % face.vertexIndices.size()].index;
|
||||
|
||||
const uint64_t NEW_EDGE_ID = BUILD_UINT64_FROM_UINT32S(TAIL, HEAD);
|
||||
const uint64_t TWIN_EDGE_ID = BUILD_UINT64_FROM_UINT32S(HEAD, TAIL);
|
||||
|
||||
// Check if the half-edge has already been inserted
|
||||
auto newEdgeIter = edgeMap.find(NEW_EDGE_ID);
|
||||
if (newEdgeIter == edgeMap.end())
|
||||
{
|
||||
// Reuse the iterator for mapping with the twin
|
||||
newEdgeIter = edgeMap.emplace(NEW_EDGE_ID, HalfEdge{}).first;
|
||||
|
||||
HalfEdge& newHalfEdge = newEdgeIter->second;
|
||||
newHalfEdge.tailVertexIndex = TAIL;
|
||||
newHalfEdge.headVertexIndex = HEAD;
|
||||
newHalfEdge.faceIndex = static_cast<int32_t>(i);
|
||||
|
||||
// Set edge index of the newly inserted edge as the size of the map - 1
|
||||
// Since it is an unordered map, it will just be at the back
|
||||
newHalfEdge.edgeIndex = static_cast<int32_t>(edgeMap.size()) - 1;
|
||||
|
||||
// Map vertex to this edge index
|
||||
face.vertexIndices[j].edgeIndex = newHalfEdge.edgeIndex;
|
||||
}
|
||||
|
||||
// Find twin edge if one exists
|
||||
auto twinEdgeIter = edgeMap.find(TWIN_EDGE_ID);
|
||||
if (twinEdgeIter != edgeMap.end())
|
||||
{
|
||||
// Set the twin index of both the edges
|
||||
HalfEdge& newHalfEdge = newEdgeIter->second;
|
||||
HalfEdge& twinHalfEdge = twinEdgeIter->second;
|
||||
|
||||
newHalfEdge.twinEdgeIndex = twinHalfEdge.edgeIndex;
|
||||
twinHalfEdge.twinEdgeIndex = newHalfEdge.edgeIndex;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Copy all half edges into the vector
|
||||
// At this point, no duplicates should be in the map and all edges should be linked.
|
||||
for (auto& halfEdge : edgeMap | std::views::values)
|
||||
halfEdges.emplace_back(halfEdge);
|
||||
|
||||
// Sort based on edge indices
|
||||
std::ranges::sort(halfEdges.begin(), halfEdges.end(), [](const HalfEdge& lhs, const HalfEdge& rhs)
|
||||
{
|
||||
return lhs.edgeIndex < rhs.edgeIndex;
|
||||
});
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,143 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHHalfEdgeStructure.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a half-edge data structure to represent polyhedra.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <vector>
|
||||
|
||||
// Project Headers
|
||||
#include "Math/Vector/SHVec3.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates data for a convex polyhedron's geometry represented as faces & half edges.
|
||||
*/
|
||||
class SH_API SHHalfEdgeStructure
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the data half edge of a face on a polyhedron.
|
||||
*/
|
||||
struct HalfEdge
|
||||
{
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
//Head and tail forms the edge.
|
||||
//Head <----- Tail
|
||||
int32_t tailVertexIndex = -1;
|
||||
|
||||
// Head is also tail of the next edge.
|
||||
int32_t headVertexIndex = -1;
|
||||
|
||||
int32_t edgeIndex = -1;
|
||||
// Other half of the edge on a different face.
|
||||
// Important for extrapolating face normals.
|
||||
int32_t twinEdgeIndex = -1;
|
||||
|
||||
// Adjacent face of this edge.
|
||||
int32_t faceIndex = -1;
|
||||
};
|
||||
|
||||
struct Vertex
|
||||
{
|
||||
public:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
int32_t index = -1;
|
||||
int32_t edgeIndex = -1; // the half-edge that this vertex is a tail of.
|
||||
};
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the data of a face on a polyhedron.
|
||||
*/
|
||||
struct Face
|
||||
{
|
||||
public:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 normal;
|
||||
std::vector<Vertex> vertexIndices; // Must be in CCW order
|
||||
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
Face () noexcept = default;
|
||||
Face (const Face& rhs) noexcept;
|
||||
Face (Face&& rhs) noexcept;
|
||||
~Face () noexcept = default;
|
||||
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
Face& operator= (const Face& rhs) noexcept;
|
||||
Face& operator= (Face&& rhs) noexcept;
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] int32_t GetFaceCount () const noexcept;
|
||||
[[nodiscard]] int32_t GetHalfEdgeCount () const noexcept;
|
||||
|
||||
[[nodiscard]] const Face& GetFace (int32_t index) const;
|
||||
[[nodiscard]] const HalfEdge& GetHalfEdge (int32_t index) const;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a face to the polyhedron. The face must be constructed outside the polyhedron.
|
||||
* @param face
|
||||
* The face to insert.
|
||||
*/
|
||||
void AddFace (const Face& face);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Builds the half-edges of the polyhedron using the faces. <br/>
|
||||
* Before this method is invoked, there must be some faces.
|
||||
* @return
|
||||
*/
|
||||
void Build() noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
std::vector<Face> faces;
|
||||
std::vector<HalfEdge> halfEdges;
|
||||
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,240 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHSphereCollisionShape.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Sphere Collision Shape.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHSphere.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Math/SHMatrix.h"
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere::SHSphere(SHCollisionShapeID id) noexcept
|
||||
: SHCollisionShape (id, Type::SPHERE)
|
||||
, relativeRadius { 1.0f }
|
||||
, scale { 1.0f }
|
||||
{
|
||||
Radius = 0.5f;
|
||||
}
|
||||
|
||||
SHSphere::SHSphere(const SHSphere& rhs) noexcept
|
||||
: SHCollisionShape ( rhs )
|
||||
, relativeRadius { rhs.relativeRadius }
|
||||
, scale { rhs.scale }
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
}
|
||||
|
||||
SHSphere::SHSphere(SHSphere&& rhs) noexcept
|
||||
: SHCollisionShape ( rhs )
|
||||
, relativeRadius { rhs.relativeRadius }
|
||||
, scale { rhs.scale }
|
||||
{
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHSphere& SHSphere::operator=(const SHSphere& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
SHCollisionShape::operator=(rhs);
|
||||
|
||||
// Sphere Properties
|
||||
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
|
||||
// Local Properties
|
||||
|
||||
relativeRadius = rhs.relativeRadius;
|
||||
scale = rhs.scale;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHSphere& SHSphere::operator=(SHSphere&& rhs) noexcept
|
||||
{
|
||||
SHCollisionShape::operator=(rhs);
|
||||
|
||||
// Sphere Properties
|
||||
|
||||
Center = rhs.Center;
|
||||
Radius = rhs.Radius;
|
||||
|
||||
// Local Properties
|
||||
|
||||
relativeRadius = rhs.relativeRadius;
|
||||
scale = rhs.scale;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
float SHSphere::GetWorldRadius() const noexcept
|
||||
{
|
||||
return Radius;
|
||||
}
|
||||
|
||||
float SHSphere::GetRelativeRadius() const noexcept
|
||||
{
|
||||
return relativeRadius;
|
||||
}
|
||||
|
||||
SHVec3 SHSphere::GetWorldCentroid() const noexcept
|
||||
{
|
||||
return Center;
|
||||
}
|
||||
|
||||
SHVec3 SHSphere::GetRelativeCentroid() const noexcept
|
||||
{
|
||||
if (collider)
|
||||
return SHVec3{ Center } - collider->GetPosition();
|
||||
|
||||
return Center;
|
||||
}
|
||||
|
||||
SHVec3 SHSphere::GetLocalCentroid() const noexcept
|
||||
{
|
||||
return SHVec3::Zero;
|
||||
}
|
||||
|
||||
SHQuaternion SHSphere::GetWorldOrientation() const noexcept
|
||||
{
|
||||
if (collider)
|
||||
return collider->GetOrientation() * transform.orientation;
|
||||
|
||||
return transform.orientation;
|
||||
}
|
||||
|
||||
SHQuaternion SHSphere::GetRelativeOrientation() const noexcept
|
||||
{
|
||||
return transform.orientation;
|
||||
}
|
||||
|
||||
float SHSphere::GetVolume() const noexcept
|
||||
{
|
||||
return (4.0f / 3.0f) * SHMath::PI * (Radius * Radius * Radius);
|
||||
}
|
||||
|
||||
float SHSphere::GetSurfaceArea() const noexcept
|
||||
{
|
||||
return 4.0f * SHMath::PI * (Radius * Radius);
|
||||
}
|
||||
|
||||
SHMatrix SHSphere::GetInertiaTensor(float mass) const noexcept
|
||||
{
|
||||
static constexpr float TWO_OVER_FIVE = 2.0f / 5.0f;
|
||||
|
||||
const float DIAGONAL = TWO_OVER_FIVE * mass * (Radius * Radius);
|
||||
|
||||
SHMatrix result;
|
||||
result.m[0][0] = result.m[1][1] = result.m[2][2] = DIAGONAL;
|
||||
return result;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHSphere::SetWorldRadius(float newWorldRadius) noexcept
|
||||
{
|
||||
Radius = newWorldRadius;
|
||||
|
||||
// Recompute Relative radius
|
||||
relativeRadius = 2.0f * Radius / scale;
|
||||
}
|
||||
|
||||
void SHSphere::SetRelativeRadius(float newRelativeRadius) noexcept
|
||||
{
|
||||
relativeRadius = newRelativeRadius;
|
||||
|
||||
// Recompute world radius
|
||||
Radius = relativeRadius * scale * 0.5f;
|
||||
}
|
||||
|
||||
void SHSphere::SetScale(float maxScale) noexcept
|
||||
{
|
||||
scale = std::fabs(maxScale);
|
||||
|
||||
// Recompute world radius
|
||||
Radius = relativeRadius * scale * 0.5f;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHSphere::Update() noexcept
|
||||
{
|
||||
const SHTransform& PARENT_TRANSFORM = collider->GetTransform();
|
||||
|
||||
const float SPHERE_SCALE = std::fabs(SHMath::Max({ PARENT_TRANSFORM.scale.x, PARENT_TRANSFORM.scale.y, PARENT_TRANSFORM.scale.z }));
|
||||
SetScale(SPHERE_SCALE);
|
||||
|
||||
// Recompute center
|
||||
const SHQuaternion FINAL_ROT = PARENT_TRANSFORM.orientation * transform.orientation;
|
||||
const SHMatrix TRS = SHMatrix::Rotate(FINAL_ROT) * SHMatrix::Translate(PARENT_TRANSFORM.position);
|
||||
|
||||
Center = SHVec3::Transform(transform.position, TRS);
|
||||
}
|
||||
|
||||
bool SHSphere::TestPoint(const SHVec3& point) const noexcept
|
||||
{
|
||||
return Contains(point);
|
||||
}
|
||||
|
||||
SHRaycastResult SHSphere::Raycast(const SHRay& ray) const noexcept
|
||||
{
|
||||
SHRaycastResult result;
|
||||
|
||||
result.hit = Intersects(ray.position, ray.direction, result.distance);
|
||||
if (result.hit)
|
||||
{
|
||||
result.position = ray.position + ray.direction * result.distance;
|
||||
result.angle = SHVec3::Angle(ray.position, result.position);
|
||||
result.normal = SHVec3::Normalise(result.position - Center);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
SHMatrix SHSphere::GetTRS() const noexcept
|
||||
{
|
||||
const SHQuaternion ROTATION = collider ? collider->GetTransform().orientation * transform.orientation : transform.orientation;
|
||||
const SHVec3 SCALE { Radius };
|
||||
|
||||
return SHMatrix::Transform(Center, ROTATION, SCALE);
|
||||
}
|
||||
|
||||
SHAABB SHSphere::ComputeAABB() const noexcept
|
||||
{
|
||||
return SHAABB{ Center, SHVec3{ Radius } };
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,56 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactConstraint.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Contact Constraint.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/Contacts/SHManifold.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
struct SH_API SHContactConstraint
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// Use the entity IDs to map resolved constraints back to the bodies
|
||||
|
||||
SHCollisionKey key;
|
||||
|
||||
// Material Data
|
||||
|
||||
float friction = 0.0f;
|
||||
float restitution = 0.0f;
|
||||
|
||||
// Mass Data
|
||||
|
||||
float invMassA = 0.0f;
|
||||
float invMassB = 0.0f;
|
||||
SHMatrix invInertiaA;
|
||||
SHMatrix invInertiaB;
|
||||
SHVec3 centerOfMassA;
|
||||
SHVec3 centerOfMassB;
|
||||
|
||||
// Collision Data
|
||||
|
||||
SHVec3 normal;
|
||||
SHVec3 tangents[SHContact::NUM_TANGENTS];
|
||||
SHContact contacts[SHManifold::MAX_NUM_CONTACTS];
|
||||
|
||||
uint32_t numContacts = 0;
|
||||
};
|
||||
} // namespace SHADE
|
||||
|
|
@ -1,63 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHVelocityState.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Velocity State for constraint solving.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
struct SH_API SHVelocityState
|
||||
{
|
||||
public:
|
||||
SHVec3 LinearVelocity;
|
||||
SHVec3 AngularVelocity;
|
||||
|
||||
SHVec3 LinearLockFactor;
|
||||
SHVec3 AngularLockFactor;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHVelocityState (const SHRigidBody* rigidBody) noexcept
|
||||
: LinearVelocity { SHVec3::Zero }
|
||||
, AngularVelocity { SHVec3::Zero }
|
||||
, LinearLockFactor { SHVec3::Zero }
|
||||
, AngularLockFactor { SHVec3::Zero }
|
||||
{
|
||||
if (rigidBody)
|
||||
{
|
||||
LinearVelocity = rigidBody->GetLinearVelocity();
|
||||
AngularVelocity = rigidBody->GetAngularVelocity();
|
||||
|
||||
LinearLockFactor = SHVec3
|
||||
{
|
||||
rigidBody->GetFreezePositionX() ? 0.0f : 1.0f
|
||||
, rigidBody->GetFreezePositionY() ? 0.0f : 1.0f
|
||||
, rigidBody->GetFreezePositionZ() ? 0.0f : 1.0f
|
||||
};
|
||||
|
||||
AngularLockFactor = SHVec3
|
||||
{
|
||||
rigidBody->GetFreezeRotationX() ? 0.0f : 1.0f
|
||||
, rigidBody->GetFreezeRotationY() ? 0.0f : 1.0f
|
||||
, rigidBody->GetFreezeRotationZ() ? 0.0f : 1.0f
|
||||
};
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,297 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactManager.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Contact Manager that stores collision information and
|
||||
* resolves contact constraints.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHContactManager.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/Collision/Narrowphase/SHCollisionDispatch.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHContactManager::TriggerEvents& SHContactManager::GetTriggerEvents() const noexcept
|
||||
{
|
||||
static TriggerEvents triggerEvents;
|
||||
|
||||
triggerEvents.clear();
|
||||
|
||||
for (auto& [id, trigger] : triggers)
|
||||
triggerEvents.emplace_back(SHTriggerEvent{ id, trigger.state });
|
||||
|
||||
return triggerEvents;
|
||||
}
|
||||
|
||||
const SHContactManager::CollisionEvents& SHContactManager::GetCollisionEvents() const noexcept
|
||||
{
|
||||
static CollisionEvents collisionEvents;
|
||||
|
||||
collisionEvents.clear();
|
||||
|
||||
for (auto& [id, manifold] : manifolds)
|
||||
{
|
||||
SHCollisionEvent collisionEvent
|
||||
{
|
||||
.info = id
|
||||
, .state = manifold.state
|
||||
, .normal = manifold.normal
|
||||
};
|
||||
|
||||
for (uint32_t i = 0; i < manifold.numContacts; ++i)
|
||||
collisionEvent.contactPoints[i] = manifold.contacts[i].position;
|
||||
|
||||
collisionEvents.emplace_back(collisionEvent);
|
||||
}
|
||||
|
||||
return collisionEvents;
|
||||
}
|
||||
|
||||
const SHContactManager::ContactPoints& SHContactManager::GetContactPoints() const noexcept
|
||||
{
|
||||
static ContactPoints contactPoints;
|
||||
contactPoints.clear();
|
||||
|
||||
for (auto& manifold : manifolds | std::views::values)
|
||||
{
|
||||
// Skip exit state manifolds
|
||||
if (manifold.state == SHCollisionState::EXIT)
|
||||
continue;
|
||||
|
||||
for (uint32_t i = 0; i < manifold.numContacts; ++i)
|
||||
{
|
||||
const ContactInfo INFO
|
||||
{
|
||||
.position = manifold.contacts[i].position
|
||||
, .normal = manifold.normal
|
||||
};
|
||||
|
||||
contactPoints.emplace_back(INFO);
|
||||
}
|
||||
}
|
||||
|
||||
return contactPoints;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHContactManager::AddTrigger(const SHCollisionKey& key, SHCollisionShape* A, SHCollisionShape* B) noexcept
|
||||
{
|
||||
// If id not found, emplace new trigger.
|
||||
auto trigger = triggers.find(key);
|
||||
if (trigger == triggers.end())
|
||||
triggers.emplace(key, Trigger{ A, B, SHCollisionState::INVALID });
|
||||
}
|
||||
|
||||
void SHContactManager::AddManifold(const SHCollisionKey& key, SHCollisionShape* A, SHCollisionShape* B) noexcept
|
||||
{
|
||||
// If id not found, emplace new manifold
|
||||
auto manifold = manifolds.find(key);
|
||||
if (manifold == manifolds.end())
|
||||
manifolds.emplace(key, SHManifold{ A, B });
|
||||
}
|
||||
|
||||
void SHContactManager::RemoveInvalidatedTrigger(EntityID eid) noexcept
|
||||
{
|
||||
removeInvalidObject(triggers, eid);
|
||||
}
|
||||
|
||||
void SHContactManager::RemoveInvalidatedTrigger(EntityID eid, uint32_t shapeIndex) noexcept
|
||||
{
|
||||
removeInvalidObject(triggers, eid, shapeIndex);
|
||||
}
|
||||
|
||||
void SHContactManager::RemoveInvalidatedManifold(EntityID eid) noexcept
|
||||
{
|
||||
removeInvalidObject(manifolds, eid);
|
||||
}
|
||||
|
||||
void SHContactManager::RemoveInvalidatedManifold(EntityID eid, uint32_t shapeIndex) noexcept
|
||||
{
|
||||
removeInvalidObject(manifolds, eid, shapeIndex);
|
||||
}
|
||||
|
||||
void SHContactManager::Update() noexcept
|
||||
{
|
||||
// Clear expired or invalid collisions. If not, test collision.
|
||||
for (auto manifoldPair = manifolds.begin(); manifoldPair != manifolds.end();)
|
||||
{
|
||||
// Test collision of every manifold.
|
||||
SHManifold& manifold = manifoldPair->second;
|
||||
SHManifold oldManifold = manifold;
|
||||
|
||||
const bool IS_COLLIDING = SHCollisionDispatcher::Collide(manifold, *manifold.shapeA, *manifold.shapeB);
|
||||
|
||||
auto& collisionState = manifold.state;
|
||||
updateCollisionState(IS_COLLIDING, collisionState);
|
||||
|
||||
const bool IS_INVALID = collisionState == SHCollisionState::INVALID;
|
||||
if (IS_INVALID)
|
||||
{
|
||||
manifoldPair = manifolds.erase(manifoldPair);
|
||||
continue;
|
||||
}
|
||||
|
||||
updateManifold(manifold, oldManifold);
|
||||
++manifoldPair;
|
||||
}
|
||||
|
||||
// Clear expired or invalid triggers, If not, test collision.
|
||||
for (auto triggerPair = triggers.begin(); triggerPair != triggers.end();)
|
||||
{
|
||||
// Test collision of every trigger.
|
||||
Trigger& oldTrigger = triggerPair->second;
|
||||
Trigger newTrigger = oldTrigger;
|
||||
|
||||
const bool IS_COLLIDING = SHCollisionDispatcher::Collide(*newTrigger.A, *newTrigger.B);
|
||||
|
||||
auto& collisionState = newTrigger.state;
|
||||
updateCollisionState(IS_COLLIDING, collisionState);
|
||||
|
||||
const bool IS_INVALID = collisionState == SHCollisionState::INVALID;
|
||||
if (IS_INVALID)
|
||||
triggerPair = triggers.erase(triggerPair);
|
||||
else
|
||||
++triggerPair;
|
||||
}
|
||||
}
|
||||
|
||||
void SHContactManager::SolveCollisions(int numIterations, float dt) noexcept
|
||||
{
|
||||
static constexpr int SIZE_CONTACTS = sizeof(SHContact) * SHManifold::MAX_NUM_CONTACTS;
|
||||
|
||||
// Build constraints
|
||||
for (auto& [key, manifold] : manifolds)
|
||||
contactSolver.AddContact(key, manifold);
|
||||
|
||||
// Solve contacts
|
||||
contactSolver.SolveContacts(numIterations, dt);
|
||||
|
||||
// Map impulses back to manifolds
|
||||
const auto& CONTACT_CONSTRAINTS = contactSolver.GetContantConstraints();
|
||||
const auto& VELOCITY_STATES = contactSolver.GetVelocities();
|
||||
|
||||
for (auto& [key, contactConstraint] : CONTACT_CONSTRAINTS)
|
||||
{
|
||||
SHManifold& manifold = manifolds.find(key)->second;
|
||||
|
||||
for (uint32_t i = 0; i < contactConstraint.numContacts; ++i)
|
||||
manifold.contacts[i] = contactConstraint.contacts[i];
|
||||
|
||||
// Assign velocities back to the bodies
|
||||
SHRigidBody* bodyA = manifold.bodyA;
|
||||
SHRigidBody* bodyB = manifold.bodyB;
|
||||
|
||||
const auto& STATE_A = VELOCITY_STATES.find(key.GetEntityA())->second;
|
||||
const auto& STATE_B = VELOCITY_STATES.find(key.GetEntityB())->second;
|
||||
|
||||
if (bodyA)
|
||||
{
|
||||
bodyA->SetLinearVelocity(STATE_A.LinearVelocity);
|
||||
bodyA->SetAngularVelocity(STATE_A.AngularVelocity);
|
||||
}
|
||||
|
||||
if (bodyB)
|
||||
{
|
||||
bodyB->SetLinearVelocity(STATE_B.LinearVelocity);
|
||||
bodyB->SetAngularVelocity(STATE_B.AngularVelocity);
|
||||
}
|
||||
}
|
||||
|
||||
contactSolver.Reset();
|
||||
}
|
||||
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHContactManager::updateCollisionState(bool isColliding, SHCollisionState& state) noexcept
|
||||
{
|
||||
if (isColliding)
|
||||
{
|
||||
// New states start at invalid. In the first frame of collision, move to enter.
|
||||
// If it already in enter, move to stay
|
||||
state = state == SHCollisionState::INVALID ? SHCollisionState::ENTER : SHCollisionState::STAY;
|
||||
}
|
||||
else
|
||||
{
|
||||
// If already exited and still not colliding, the collision has expired.
|
||||
// Invalid states are removed in the next frame
|
||||
if (state == SHCollisionState::EXIT)
|
||||
state = SHCollisionState::INVALID;
|
||||
|
||||
// If previously colliding, move to exit.
|
||||
if (state == SHCollisionState::ENTER || state == SHCollisionState::STAY)
|
||||
state = SHCollisionState::EXIT;
|
||||
}
|
||||
}
|
||||
|
||||
void SHContactManager::updateManifold(SHManifold& manifold, const SHManifold& oldManifold) noexcept
|
||||
{
|
||||
static const float SQRT_ONE_THIRD = std::sqrtf(1.0f / 3.0f);
|
||||
|
||||
// Early out since exiting a collision does not require an update beyond updating the state
|
||||
if (manifold.state == SHCollisionState::EXIT)
|
||||
return;
|
||||
|
||||
const SHVec3& NORMAL = manifold.normal;
|
||||
SHVec3& tangent0 = manifold.tangents[0];
|
||||
SHVec3& tangent1 = manifold.tangents[1];
|
||||
|
||||
const SHVec3& OLD_TANGENT_0 = oldManifold.tangents[0];
|
||||
const SHVec3& OLD_TANGENT_1 = oldManifold.tangents[1];
|
||||
|
||||
// Compute tangents
|
||||
if (std::fabs(NORMAL.x) >= SQRT_ONE_THIRD)
|
||||
tangent0 = SHVec3{ NORMAL.y, -NORMAL.x, 0.0f };
|
||||
else
|
||||
tangent0 = SHVec3{ 0.0f, NORMAL.z, -NORMAL.y };
|
||||
|
||||
tangent0 = SHVec3::Normalise(tangent0);
|
||||
tangent1 = SHVec3::Cross(NORMAL, tangent0);
|
||||
|
||||
// Accumulate impulses
|
||||
for (uint32_t i = 0; i < manifold.numContacts; ++i)
|
||||
{
|
||||
SHContact& contact = manifold.contacts[i];
|
||||
|
||||
// Reset impulses
|
||||
contact.normalImpulse = 0.0f;
|
||||
contact.tangentImpulse[0] = contact.tangentImpulse[1] = 0.0f;
|
||||
|
||||
for (uint32_t j = 0; j < oldManifold.numContacts; ++j)
|
||||
{
|
||||
const SHContact& OLD_CONTACT = oldManifold.contacts[j];
|
||||
|
||||
if (OLD_CONTACT.featurePair.key == contact.featurePair.key)
|
||||
{
|
||||
// If contact features persists, re-project old solution
|
||||
contact.normalImpulse = OLD_CONTACT.normalImpulse;
|
||||
|
||||
const SHVec3 FRICTION_FORCE = OLD_TANGENT_0 * OLD_CONTACT.tangentImpulse[0] + OLD_TANGENT_1 * OLD_CONTACT.tangentImpulse[1];
|
||||
contact.tangentImpulse[0] = SHVec3::Dot(FRICTION_FORCE, tangent0);
|
||||
contact.tangentImpulse[1] = SHVec3::Dot(FRICTION_FORCE, tangent1);
|
||||
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,140 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactManager.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Contact Manager that stores collision information.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <unordered_map>
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/Contacts/SHCollisionEvents.h"
|
||||
#include "Physics/Collision/Contacts/SHCollisionKey.h"
|
||||
#include "Physics/Collision/Contacts/SHManifold.h"
|
||||
#include "SHContactSolver.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a class that stores collision information.
|
||||
*/
|
||||
class SH_API SHContactManager
|
||||
{
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHPhysicsWorld;
|
||||
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct ContactInfo
|
||||
{
|
||||
SHVec3 position;
|
||||
SHVec3 normal;
|
||||
};
|
||||
|
||||
using TriggerEvents = std::vector<SHTriggerEvent>;
|
||||
using CollisionEvents = std::vector<SHCollisionEvent>;
|
||||
using ContactPoints = std::vector<ContactInfo>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHContactManager () noexcept = default;
|
||||
~SHContactManager () noexcept = default;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
const TriggerEvents& GetTriggerEvents () const noexcept;
|
||||
const CollisionEvents& GetCollisionEvents () const noexcept;
|
||||
const ContactPoints& GetContactPoints () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void AddTrigger (const SHCollisionKey& key, SHCollisionShape* A, SHCollisionShape* B) noexcept;
|
||||
void AddManifold (const SHCollisionKey& key, SHCollisionShape* A, SHCollisionShape* B) noexcept;
|
||||
|
||||
void RemoveInvalidatedTrigger (EntityID eid) noexcept;
|
||||
void RemoveInvalidatedTrigger (EntityID eid, uint32_t shapeIndex) noexcept;
|
||||
void RemoveInvalidatedManifold (EntityID eid) noexcept;
|
||||
void RemoveInvalidatedManifold (EntityID eid, uint32_t shapeIndex) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Removes any invalidated contacts and triggers, then performs narrowphase collision
|
||||
* detection on existing triggers and manifolds.
|
||||
*/
|
||||
void Update () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Builds contact constraints and solves them. Results are stored in the corresponding
|
||||
* manifolds abiding by the sequential impulse method.
|
||||
*/
|
||||
void SolveCollisions (int numIterations, float dt) noexcept;
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct Trigger
|
||||
{
|
||||
SHCollisionShape* A = nullptr;
|
||||
SHCollisionShape* B = nullptr;
|
||||
|
||||
SHCollisionState state = SHCollisionState::INVALID;
|
||||
};
|
||||
|
||||
using Manifolds = std::unordered_map<SHCollisionKey, SHManifold, SHCollisionKeyHash>;
|
||||
using Triggers = std::unordered_map<SHCollisionKey, Trigger, SHCollisionKeyHash>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
Manifolds manifolds;
|
||||
Triggers triggers;
|
||||
|
||||
SHContactSolver contactSolver;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
static void updateCollisionState (bool isColliding, SHCollisionState& state) noexcept;
|
||||
static void updateManifold (SHManifold& manifold, const SHManifold& oldManifold) noexcept;
|
||||
|
||||
// Removal Helpers
|
||||
|
||||
template <typename T>
|
||||
static void removeInvalidObject (std::unordered_map<SHCollisionKey, T, SHCollisionKeyHash>& container, EntityID eid) noexcept;
|
||||
template <typename T>
|
||||
static void removeInvalidObject (std::unordered_map<SHCollisionKey, T, SHCollisionKeyHash>& container, EntityID eid, uint32_t shapeIndex) noexcept;
|
||||
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
||||
|
||||
#include "SHContactManager.hpp"
|
|
@ -1,61 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactManager.hpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for templated methods of the Contact Manager.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Primary Header
|
||||
#include "SHContactManager.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
template <typename T>
|
||||
void SHContactManager::removeInvalidObject(std::unordered_map<SHCollisionKey, T, SHCollisionKeyHash>& container, EntityID eid) noexcept
|
||||
{
|
||||
if (container.empty())
|
||||
return;
|
||||
|
||||
for (auto invalidated = container.begin(); invalidated != container.end();)
|
||||
{
|
||||
const auto& ID = invalidated->first;
|
||||
|
||||
const bool MATCHES_A = ID.GetEntityA() == eid;
|
||||
const bool MATCHES_B = ID.GetEntityB() == eid;
|
||||
|
||||
if (MATCHES_A || MATCHES_B)
|
||||
invalidated = container.erase(invalidated);
|
||||
else
|
||||
++invalidated;
|
||||
}
|
||||
}
|
||||
|
||||
template <typename T>
|
||||
void SHContactManager::removeInvalidObject(std::unordered_map<SHCollisionKey, T, SHCollisionKeyHash>& container, EntityID eid, uint32_t shapeIndex) noexcept
|
||||
{
|
||||
if (container.empty())
|
||||
return;
|
||||
|
||||
for (auto invalidated = container.begin(); invalidated != container.end();)
|
||||
{
|
||||
const auto& ID = invalidated->first;
|
||||
|
||||
const bool MATCHES_A = ID.GetEntityA() == eid && ID.GetShapeIndexA() == shapeIndex;
|
||||
const bool MATCHES_B = ID.GetEntityB() == eid && ID.GetShapeIndexB() == shapeIndex;
|
||||
|
||||
if (MATCHES_A || MATCHES_B)
|
||||
invalidated = container.erase(invalidated);
|
||||
else
|
||||
++invalidated;
|
||||
}
|
||||
}
|
||||
} // namespace SHADE
|
|
@ -1,332 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHContactSolver.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Contact Solver.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
***************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHContactSolver.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
#include "Physics/SHPhysicsConstants.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHContactSolver::VelocityStates& SHContactSolver::GetVelocities() const noexcept
|
||||
{
|
||||
return velocityStates;
|
||||
}
|
||||
|
||||
const SHContactSolver::ContactConstraints& SHContactSolver::GetContantConstraints() const noexcept
|
||||
{
|
||||
return contactConstraints;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHContactSolver::AddContact(const SHCollisionKey& key, const SHManifold& manifold) noexcept
|
||||
{
|
||||
SHContactConstraint& newConstraint = contactConstraints.emplace(key, SHContactConstraint{}).first->second;
|
||||
|
||||
const auto* SHAPE_A = manifold.shapeA;
|
||||
const auto* SHAPE_B = manifold.shapeB;
|
||||
|
||||
const auto* BODY_A = manifold.bodyA;
|
||||
const auto* BODY_B = manifold.bodyB;
|
||||
|
||||
// Add velocities if it doesn't already exist
|
||||
velocityStates.emplace(key.GetEntityA(), SHVelocityState{ BODY_A });
|
||||
velocityStates.emplace(key.GetEntityB(), SHVelocityState{ BODY_B });
|
||||
|
||||
// Mix friction & restitution
|
||||
const float FRICTION_A = SHAPE_A->GetFriction();
|
||||
const float RESTITUTION_A = SHAPE_A->GetBounciness();
|
||||
|
||||
const float FRICTION_B = SHAPE_B->GetFriction();
|
||||
const float RESTITUTION_B = SHAPE_B->GetBounciness();
|
||||
|
||||
newConstraint.friction = std::sqrtf(FRICTION_A * FRICTION_B);
|
||||
newConstraint.restitution = std::max(RESTITUTION_A, RESTITUTION_B);
|
||||
|
||||
// Mass data
|
||||
|
||||
// Account for implicity-static bodies
|
||||
if (BODY_A)
|
||||
{
|
||||
newConstraint.invMassA = BODY_A->invMass;
|
||||
newConstraint.centerOfMassA = BODY_A->worldCentroid;
|
||||
newConstraint.invInertiaA = BODY_A->worldInvInertia;
|
||||
}
|
||||
else
|
||||
{
|
||||
newConstraint.invMassA = 0.0f;
|
||||
newConstraint.centerOfMassA = SHVec3::Zero;
|
||||
|
||||
// Matrix needs to maintain its homogenous structure
|
||||
newConstraint.invInertiaA = SHMatrix::Zero;
|
||||
newConstraint.invInertiaA.m[3][3] = 1.0f;
|
||||
}
|
||||
|
||||
if (BODY_B)
|
||||
{
|
||||
newConstraint.invMassB = BODY_B->invMass;
|
||||
newConstraint.centerOfMassB = BODY_B->worldCentroid;
|
||||
newConstraint.invInertiaB = BODY_B->worldInvInertia;
|
||||
}
|
||||
else
|
||||
{
|
||||
newConstraint.invMassB = 0.0f;
|
||||
newConstraint.centerOfMassB = SHVec3::Zero;
|
||||
|
||||
// Matrix needs to maintain its homogenous structure
|
||||
newConstraint.invInertiaB = SHMatrix::Zero;
|
||||
newConstraint.invInertiaB.m[3][3] = 1.0f;
|
||||
}
|
||||
|
||||
// Collision data
|
||||
|
||||
newConstraint.numContacts = manifold.numContacts;
|
||||
|
||||
newConstraint.normal = manifold.normal;
|
||||
|
||||
static constexpr size_t TANGENTS_SIZE = sizeof(SHVec3) * SHContact::NUM_TANGENTS;
|
||||
static constexpr size_t CONTACTS_SIZE = sizeof(SHContact) * SHManifold::MAX_NUM_CONTACTS;
|
||||
|
||||
memcpy_s(newConstraint.tangents, TANGENTS_SIZE, manifold.tangents, TANGENTS_SIZE);
|
||||
memcpy_s(newConstraint.contacts, CONTACTS_SIZE, manifold.contacts, CONTACTS_SIZE);
|
||||
|
||||
// Compute rA & rB for contacts
|
||||
for (uint32_t i = 0; i < newConstraint.numContacts; ++i)
|
||||
{
|
||||
newConstraint.contacts[i].rA = newConstraint.contacts[i].position - newConstraint.centerOfMassA;
|
||||
newConstraint.contacts[i].rB = newConstraint.contacts[i].position - newConstraint.centerOfMassB;
|
||||
}
|
||||
}
|
||||
|
||||
void SHContactSolver::Reset() noexcept
|
||||
{
|
||||
velocityStates.clear();
|
||||
contactConstraints.clear();
|
||||
}
|
||||
|
||||
void SHContactSolver::SolveContacts(int numIterations, float dt) noexcept
|
||||
{
|
||||
preSolve(dt);
|
||||
|
||||
for (int i = 0; i < numIterations; ++i)
|
||||
solve();
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHContactSolver::preSolve(float dt) noexcept
|
||||
{
|
||||
const float INV_DT = 1.0f / dt;
|
||||
|
||||
for (auto& [key, constraint] : contactConstraints)
|
||||
{
|
||||
const float INV_MASS_SUM = constraint.invMassA + constraint.invMassB;
|
||||
|
||||
SHVelocityState& velocityStateA = velocityStates.find(key.GetEntityA())->second;
|
||||
SHVelocityState& velocityStateB = velocityStates.find(key.GetEntityB())->second;
|
||||
|
||||
SHVec3 vA = velocityStateA.LinearVelocity;
|
||||
SHVec3 wA = velocityStateA.AngularVelocity;
|
||||
SHVec3 vB = velocityStateB.LinearVelocity;
|
||||
SHVec3 wB = velocityStateB.AngularVelocity;
|
||||
|
||||
const SHVec3& LINEAR_LOCK_A = velocityStateA.LinearLockFactor;
|
||||
const SHVec3& ANGULAR_LOCK_A = velocityStateA.AngularLockFactor;
|
||||
const SHVec3& LINEAR_LOCK_B = velocityStateB.LinearLockFactor;
|
||||
const SHVec3& ANGULAR_LOCK_B = velocityStateB.AngularLockFactor;
|
||||
|
||||
for (uint32_t i = 0; i < constraint.numContacts; ++i)
|
||||
{
|
||||
SHContact& contact = constraint.contacts[i];
|
||||
|
||||
// Calculate JM-1JT (Effective mass)
|
||||
/*
|
||||
* rXnT * I-1 * rXn:
|
||||
*
|
||||
* 1. 3x3 * 3x1 = 3x1
|
||||
* 2. 1x3 * 3x1 = 1x1
|
||||
*
|
||||
* First do I-1 * rXn
|
||||
* | ix 0 0 || x | | ix * x |
|
||||
* | 0 iy 0 || y | = | iy * y |
|
||||
* | 0 0 iz || z | | iz * z |
|
||||
*
|
||||
* Then dot product the result with rXnT
|
||||
* | ix * x |[ u v w ]
|
||||
* | iy * y | = [ ix * x * w + iy * y * v + iz * z * w ]
|
||||
* | iz * z |
|
||||
*
|
||||
* Simplified:
|
||||
*
|
||||
* rXnT /dot (I-1 * rXn)
|
||||
*/
|
||||
|
||||
// Effective mass along Normal
|
||||
const SHVec3 RA_CROSS_N = SHVec3::Cross(contact.rA, constraint.normal);
|
||||
const SHVec3 RB_CROSS_N = SHVec3::Cross(contact.rB, constraint.normal);
|
||||
|
||||
contact.normalMass = INV_MASS_SUM;
|
||||
contact.normalMass += SHVec3::Dot(RA_CROSS_N, constraint.invInertiaA * RA_CROSS_N);
|
||||
contact.normalMass += SHVec3::Dot(RB_CROSS_N, constraint.invInertiaB * RB_CROSS_N);
|
||||
|
||||
// Invert the normal mass (we want the actual mass, not the inverse mass)
|
||||
contact.normalMass = 1.0f / contact.normalMass;
|
||||
|
||||
// Effective mass along tangents (same steps as above)
|
||||
|
||||
for (int j = 0; j < SHContact::NUM_TANGENTS; ++j)
|
||||
{
|
||||
const SHVec3 RA_CROSS_T = SHVec3::Cross(contact.rA, constraint.tangents[j]);
|
||||
const SHVec3 RB_CROSS_T = SHVec3::Cross(contact.rB, constraint.tangents[j]);
|
||||
|
||||
contact.tangentMass[j] = INV_MASS_SUM;
|
||||
contact.tangentMass[j] += SHVec3::Dot(RA_CROSS_T, constraint.invInertiaA * RA_CROSS_T);
|
||||
contact.tangentMass[j] += SHVec3::Dot(RB_CROSS_T, constraint.invInertiaB * RB_CROSS_T);
|
||||
|
||||
contact.tangentMass[j] = 1.0f / contact.tangentMass[j];
|
||||
}
|
||||
|
||||
// Calculate bias per contact
|
||||
/*
|
||||
* error bias = baumgarte factor / dt * penetration
|
||||
* restituion bias = restitution * (relative velocity /dot normal)
|
||||
*/
|
||||
|
||||
const float ERROR_BIAS = -SHPHYSICS_BAUMGARTE * INV_DT * std::max(0.0f, contact.penetration - SHPHYSICS_LINEAR_SLOP);
|
||||
|
||||
// Warm starting
|
||||
// Compute impulses
|
||||
SHVec3 impulse = constraint.normal * contact.normalImpulse;
|
||||
for (int j = 0; j < SHContact::NUM_TANGENTS; ++j)
|
||||
impulse += constraint.tangents[j] * contact.tangentImpulse[j];
|
||||
|
||||
// Apply impulses onto velocities
|
||||
vA -= impulse * constraint.invMassA * LINEAR_LOCK_A;
|
||||
wA -= constraint.invInertiaA * SHVec3::Cross(contact.rA, impulse) * ANGULAR_LOCK_A;
|
||||
|
||||
vB += impulse * constraint.invMassB * LINEAR_LOCK_B;
|
||||
wB += constraint.invInertiaB * SHVec3::Cross(contact.rB, impulse) * ANGULAR_LOCK_B;
|
||||
|
||||
const SHVec3 RV_A = vA + SHVec3::Cross(wA, contact.rA);
|
||||
const SHVec3 RV_B = vB + SHVec3::Cross(wB, contact.rB);
|
||||
const float RV_N = SHVec3::Dot(RV_B - RV_A, constraint.normal);
|
||||
|
||||
const float RESTITUTION_BIAS = std::fabs(RV_N) > SHPHYSICS_RESTITUTION_THRESHOLD ? -constraint.restitution * RV_N : 0.0f;
|
||||
|
||||
contact.bias = ERROR_BIAS + RESTITUTION_BIAS;
|
||||
}
|
||||
|
||||
velocityStateA.LinearVelocity = vA;
|
||||
velocityStateA.AngularVelocity = wA;
|
||||
velocityStateB.LinearVelocity = vB;
|
||||
velocityStateB.AngularVelocity = wB;
|
||||
}
|
||||
}
|
||||
|
||||
void SHContactSolver::solve() noexcept
|
||||
{
|
||||
for (auto& [key, constraint] : contactConstraints)
|
||||
{
|
||||
SHVelocityState& velocityStateA = velocityStates.find(key.GetEntityA())->second;
|
||||
SHVelocityState& velocityStateB = velocityStates.find(key.GetEntityB())->second;
|
||||
|
||||
SHVec3 vA = velocityStateA.LinearVelocity;
|
||||
SHVec3 wA = velocityStateA.AngularVelocity;
|
||||
SHVec3 vB = velocityStateB.LinearVelocity;
|
||||
SHVec3 wB = velocityStateB.AngularVelocity;
|
||||
|
||||
const SHVec3& LINEAR_LOCK_A = velocityStateA.LinearLockFactor;
|
||||
const SHVec3& ANGULAR_LOCK_A = velocityStateA.AngularLockFactor;
|
||||
const SHVec3& LINEAR_LOCK_B = velocityStateB.LinearLockFactor;
|
||||
const SHVec3& ANGULAR_LOCK_B = velocityStateB.AngularLockFactor;
|
||||
|
||||
for (uint32_t i = 0; i < constraint.numContacts; ++i)
|
||||
{
|
||||
SHContact& contact = constraint.contacts[i];
|
||||
|
||||
// Compute relative velocity
|
||||
SHVec3 velocityA = vA + SHVec3::Cross(wA, contact.rA);
|
||||
SHVec3 velocityB = vB + SHVec3::Cross(wB, contact.rB);
|
||||
SHVec3 relativeVelocity = velocityB - velocityA;
|
||||
|
||||
// Get scalar of relative velocity along the normal
|
||||
const float VN = SHVec3::Dot(relativeVelocity, constraint.normal);
|
||||
|
||||
// Compute true normal impulse
|
||||
const float OLD_NORMAL_IMPULSE = contact.normalImpulse;
|
||||
|
||||
float newNormalImpulse = -(VN + contact.bias) * contact.normalMass;
|
||||
contact.normalImpulse = std::max(OLD_NORMAL_IMPULSE + newNormalImpulse, 0.0f);
|
||||
newNormalImpulse = contact.normalImpulse - OLD_NORMAL_IMPULSE;
|
||||
|
||||
const SHVec3 NORMAL_IMPULSE = newNormalImpulse * constraint.normal;
|
||||
|
||||
// Apply impulses
|
||||
vA -= NORMAL_IMPULSE * constraint.invMassA * LINEAR_LOCK_A;
|
||||
wA -= constraint.invInertiaA * SHVec3::Cross(contact.rA, NORMAL_IMPULSE) * ANGULAR_LOCK_A;
|
||||
|
||||
vB += NORMAL_IMPULSE * constraint.invMassB * LINEAR_LOCK_B;
|
||||
wB += constraint.invInertiaB * SHVec3::Cross(contact.rB, NORMAL_IMPULSE) * ANGULAR_LOCK_B;
|
||||
|
||||
// Solve normal impulse
|
||||
// Re-compute relative velocity
|
||||
velocityA = vA + SHVec3::Cross(wA, contact.rA);
|
||||
velocityB = vB + SHVec3::Cross(wB, contact.rB);
|
||||
relativeVelocity = velocityB - velocityA;
|
||||
|
||||
// Solve tangent impulse
|
||||
for (int j = 0; j < SHContact::NUM_TANGENTS; ++j)
|
||||
{
|
||||
// Get scalar of relative velocity along tangent
|
||||
const float VT = SHVec3::Dot(relativeVelocity, constraint.tangents[j]);
|
||||
|
||||
// Compute true tangent impulse
|
||||
const float MAX_TANGENT_IMPULSE = constraint.friction * contact.normalImpulse;
|
||||
const float OLD_TANGENT_IMPULSE = contact.tangentImpulse[j];
|
||||
|
||||
// We cannot exceed the maximum frictional force (coulumb's law)
|
||||
// Compute true tangent impulse
|
||||
float newTangentImpulse = -VT * contact.tangentMass[j];
|
||||
contact.tangentImpulse[j] = std::clamp(OLD_TANGENT_IMPULSE + newTangentImpulse, -MAX_TANGENT_IMPULSE, MAX_TANGENT_IMPULSE);
|
||||
newTangentImpulse = contact.tangentImpulse[j] - OLD_TANGENT_IMPULSE;
|
||||
|
||||
const SHVec3 TANGENT_IMPULSE = newTangentImpulse * constraint.tangents[j];
|
||||
|
||||
// Apply impulses
|
||||
vA -= TANGENT_IMPULSE * constraint.invMassA * LINEAR_LOCK_A;
|
||||
wA -= constraint.invInertiaA * SHVec3::Cross(contact.rA, TANGENT_IMPULSE) * ANGULAR_LOCK_A;
|
||||
|
||||
vB += TANGENT_IMPULSE * constraint.invMassB * LINEAR_LOCK_B;
|
||||
wB += constraint.invInertiaB * SHVec3::Cross(contact.rB, TANGENT_IMPULSE) * ANGULAR_LOCK_B;
|
||||
}
|
||||
}
|
||||
|
||||
velocityStateA.LinearVelocity = vA;
|
||||
velocityStateA.AngularVelocity = wA;
|
||||
velocityStateB.LinearVelocity = vB;
|
||||
velocityStateB.AngularVelocity = wB;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,128 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHMotionState.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Motion State.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHMotionState.h"
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHMathHelpers.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHMotionState::SHMotionState() noexcept
|
||||
: hasMoved { false }
|
||||
{}
|
||||
|
||||
SHMotionState::SHMotionState(const SHMotionState& rhs) noexcept
|
||||
: hasMoved { rhs.hasMoved }
|
||||
, position { rhs.position }
|
||||
, prevPosition { rhs.prevPosition }
|
||||
{}
|
||||
|
||||
SHMotionState::SHMotionState(SHMotionState&& rhs) noexcept
|
||||
: hasMoved { rhs.hasMoved }
|
||||
, position { rhs.position }
|
||||
, prevPosition { rhs.prevPosition }
|
||||
{}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHMotionState& SHMotionState::operator=(const SHMotionState& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
hasMoved = rhs.hasMoved;
|
||||
position = rhs.position;
|
||||
prevPosition = rhs.prevPosition;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHMotionState& SHMotionState::operator=(SHMotionState&& rhs) noexcept
|
||||
{
|
||||
hasMoved = rhs.hasMoved;
|
||||
position = rhs.position;
|
||||
prevPosition = rhs.prevPosition;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHMotionState::operator bool() const noexcept
|
||||
{
|
||||
return hasMoved;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definition */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHMotionState::ForcePosition(const SHVec3& newPosition) noexcept
|
||||
{
|
||||
hasMoved = true;
|
||||
|
||||
prevPosition = newPosition;
|
||||
position = newPosition;
|
||||
}
|
||||
|
||||
void SHMotionState::ForceOrientation(const SHQuaternion& newOrientation) noexcept
|
||||
{
|
||||
hasMoved = true;
|
||||
|
||||
prevOrientation = newOrientation;
|
||||
orientation = newOrientation;
|
||||
}
|
||||
|
||||
|
||||
void SHMotionState::IntegratePosition(const SHVec3& velocity, float dt) noexcept
|
||||
{
|
||||
// Velocities are 0 when objects are static or sleeping. We do not want to integrate them here.
|
||||
// This call should never reach here.
|
||||
|
||||
hasMoved = true;
|
||||
|
||||
prevPosition = position;
|
||||
position += velocity * dt;
|
||||
}
|
||||
|
||||
void SHMotionState::IntegrateOrientation(const SHVec3& velocity, float dt) noexcept
|
||||
{
|
||||
// Velocities are 0 when objects are static or sleeping. We do not want to integrate them here.
|
||||
// This call should never reach here.
|
||||
|
||||
hasMoved = true;
|
||||
|
||||
prevOrientation = orientation;
|
||||
|
||||
orientation += orientation * SHQuaternion{ velocity.x, velocity.y, velocity.z, 0.0f } * dt * 0.5f;
|
||||
orientation = SHQuaternion::Normalise(orientation);
|
||||
}
|
||||
|
||||
|
||||
SHVec3 SHMotionState::InterpolatePositions(float factor) const noexcept
|
||||
{
|
||||
return SHVec3::ClampedLerp(prevPosition, position, factor);
|
||||
}
|
||||
|
||||
SHQuaternion SHMotionState::InterpolateOrientations(float factor) const noexcept
|
||||
{
|
||||
return SHQuaternion::ClampedSlerp(prevOrientation, orientation, factor);
|
||||
}
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,127 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHMotionState.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Motion State.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Math/SHQuaternion.h"
|
||||
#include "Math/Vector/SHVec3.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the motion state of a rigid body in physics.
|
||||
*/
|
||||
struct SH_API SHMotionState
|
||||
{
|
||||
public:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool hasMoved;
|
||||
|
||||
SHVec3 position;
|
||||
SHVec3 prevPosition;
|
||||
|
||||
SHQuaternion orientation;
|
||||
SHQuaternion prevOrientation;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHMotionState () noexcept;
|
||||
SHMotionState (const SHMotionState& rhs) noexcept;
|
||||
SHMotionState (SHMotionState&& rhs) noexcept;
|
||||
|
||||
~SHMotionState() = default;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHMotionState& operator= (const SHMotionState& rhs) noexcept;
|
||||
SHMotionState& operator= (SHMotionState&& rhs) noexcept;
|
||||
|
||||
operator bool () const noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Forcefully sets the position. Meant to be used when transform overrides the rigid body
|
||||
* positions.
|
||||
* @param newPosition
|
||||
* The new position to set.
|
||||
*/
|
||||
void ForcePosition (const SHVec3& newPosition) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Forcefully sets the orientation. Meant to be used when transform overrides the rigid body
|
||||
* orientations
|
||||
* @param newOrientation
|
||||
* The new orientation to set.
|
||||
*/
|
||||
void ForceOrientation (const SHQuaternion& newOrientation) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Integrates the positions using linear velocity with respect to time.
|
||||
* @param velocity
|
||||
* The linear velocity to integrate.
|
||||
* @param dt
|
||||
* The delta time to integrate with respect to.
|
||||
*/
|
||||
void IntegratePosition (const SHVec3& velocity, float dt) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Integrates the orientation using angular velocity with respect to time.
|
||||
* @param velocity
|
||||
* The angular velocity to integrate.
|
||||
* @param dt
|
||||
* The delta time to integrate with respect to.
|
||||
*/
|
||||
void IntegrateOrientation (const SHVec3& velocity, float dt) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Interpolates the position between the previous and the last using a given factor.
|
||||
* @param factor
|
||||
* The factor to interpolate by. Should be between 0 & 1.
|
||||
* @returns
|
||||
* The interpolated position meant for rendering.
|
||||
*/
|
||||
SHVec3 InterpolatePositions (float factor) const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Interpolates the orientation between the previous and the last using a given factor.
|
||||
* @param factor
|
||||
* The factor to interpolate by. Should be between 0 & 1.
|
||||
* @returns
|
||||
* The interpolated orientation meant for rendering.
|
||||
*/
|
||||
SHQuaternion InterpolateOrientations (float factor) const noexcept;
|
||||
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,190 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsWorld.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Physics World.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHPhysicsWorld.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsWorld::SHPhysicsWorld(const WorldSettings& worldSettings) noexcept
|
||||
: settings { worldSettings }
|
||||
, collisionSpace { nullptr }
|
||||
{
|
||||
SHLOG_INFO_D("Creating Physics World")
|
||||
}
|
||||
|
||||
SHPhysicsWorld::~SHPhysicsWorld() noexcept
|
||||
{
|
||||
collisionSpace = nullptr;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
const SHContactManager::ContactPoints& SHPhysicsWorld::GetContactPoints() const noexcept
|
||||
{
|
||||
return contactManager.GetContactPoints();
|
||||
}
|
||||
|
||||
const SHContactManager::TriggerEvents& SHPhysicsWorld::GetTriggerEvents() const noexcept
|
||||
{
|
||||
return contactManager.GetTriggerEvents();
|
||||
}
|
||||
|
||||
const SHContactManager::CollisionEvents& SHPhysicsWorld::GetCollisionEvents() const noexcept
|
||||
{
|
||||
return contactManager.GetCollisionEvents();
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsWorld::SetCollisionSpace(SHCollisionSpace* _collisionSpace) noexcept
|
||||
{
|
||||
collisionSpace = _collisionSpace;
|
||||
_collisionSpace->SetContactManager(&contactManager);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsWorld::AddRigidBody(SHRigidBody* rigidBody) noexcept
|
||||
{
|
||||
const bool INSERTED = rigidBodies.emplace(rigidBody->entityID, rigidBody).second;
|
||||
if (!INSERTED)
|
||||
{
|
||||
SHLOG_WARNING_D("Attempting to add duplicate rigid body {} to the Physics World!", rigidBody->entityID)
|
||||
}
|
||||
}
|
||||
|
||||
void SHPhysicsWorld::RemoveRigidBody(SHRigidBody* rigidBody) noexcept
|
||||
{
|
||||
rigidBodies.erase(rigidBody->entityID);
|
||||
|
||||
// Contact manager to remove invalidated contacts
|
||||
contactManager.RemoveInvalidatedManifold(rigidBody->entityID);
|
||||
|
||||
// TODO: Run through the rigid body's contact graph and wake all of its non-static bodies that are asleep
|
||||
}
|
||||
|
||||
|
||||
void SHPhysicsWorld::Step(float dt)
|
||||
{
|
||||
/*
|
||||
* Detect Collisions
|
||||
*/
|
||||
|
||||
if (collisionSpace)
|
||||
collisionSpace->DetectCollisions();
|
||||
|
||||
/*
|
||||
* Integrate Forces
|
||||
*/
|
||||
|
||||
for (auto* rigidBody : rigidBodies | std::views::values)
|
||||
{
|
||||
if (!rigidBody->IsActive())
|
||||
continue;
|
||||
|
||||
rigidBody->ComputeWorldData();
|
||||
integrateForces(*rigidBody, dt);
|
||||
}
|
||||
|
||||
|
||||
/*
|
||||
* Resolve Contacts
|
||||
*/
|
||||
|
||||
contactManager.SolveCollisions(settings.numVelocitySolverIterations, dt);
|
||||
|
||||
/*
|
||||
* Integrate Velocities
|
||||
*/
|
||||
|
||||
for (auto* rigidBody : rigidBodies | std::views::values)
|
||||
{
|
||||
if (!rigidBody->IsActive())
|
||||
continue;
|
||||
|
||||
integrateVelocities(*rigidBody, dt);
|
||||
}
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsWorld::integrateForces(SHRigidBody& rigidBody, float dt) const noexcept
|
||||
{
|
||||
if (rigidBody.bodyType != SHRigidBody::Type::DYNAMIC)
|
||||
return;
|
||||
|
||||
// Integrate forces and gravity into linear velocity
|
||||
const SHVec3 LINEAR_ACCELERATION = rigidBody.accumulatedForce * rigidBody.invMass;
|
||||
const SHVec3 GRAVITATIONAL_ACCELERATION = rigidBody.IsGravityEnabled() ? settings.gravity * rigidBody.gravityScale : SHVec3::Zero;
|
||||
|
||||
rigidBody.linearVelocity += (LINEAR_ACCELERATION + GRAVITATIONAL_ACCELERATION) * dt;
|
||||
|
||||
// Integrate torque into angular velocity
|
||||
rigidBody.angularVelocity += rigidBody.worldInvInertia * rigidBody.accumulatedTorque * dt;
|
||||
|
||||
// Apply drag (exponentially applied)
|
||||
rigidBody.linearVelocity *= 1.0f / (1.0f + dt * rigidBody.linearDrag);
|
||||
rigidBody.angularVelocity *= 1.0f / (1.0f + dt * rigidBody.angularDrag);
|
||||
|
||||
rigidBody.constrainLinearVelocities();
|
||||
rigidBody.constrainAngularVelocities();
|
||||
}
|
||||
|
||||
void SHPhysicsWorld::integrateVelocities(SHRigidBody& rigidBody, float dt) const noexcept
|
||||
{
|
||||
// Always reset movement flag
|
||||
rigidBody.motionState.hasMoved = false;
|
||||
|
||||
// Set all velocities of static bodies to 0
|
||||
if (rigidBody.bodyType == SHRigidBody::Type::STATIC)
|
||||
{
|
||||
rigidBody.linearVelocity = SHVec3::Zero;
|
||||
}
|
||||
// Dynamic & Kinematic bodies
|
||||
// Both dynamic and kinematic can sleep when their velocities are under the thresholds.
|
||||
else if (!rigidBody.IsSleeping())
|
||||
{
|
||||
rigidBody.constrainLinearVelocities();
|
||||
rigidBody.constrainAngularVelocities();
|
||||
|
||||
rigidBody.motionState.IntegratePosition(rigidBody.linearVelocity, dt);
|
||||
rigidBody.motionState.IntegrateOrientation(rigidBody.angularVelocity, dt);
|
||||
|
||||
// Sync with collider transforms if a collider is present
|
||||
if (rigidBody.collider)
|
||||
{
|
||||
rigidBody.collider->SetPosition(rigidBody.motionState.position);
|
||||
rigidBody.collider->SetOrientation(rigidBody.motionState.orientation);
|
||||
|
||||
rigidBody.collider->Update();
|
||||
}
|
||||
}
|
||||
|
||||
// Clear all forces
|
||||
// We clear forces for static bodies as well for redundancy
|
||||
rigidBody.ClearForces();
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,145 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsWorld.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Physics World.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <unordered_map>
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/SHCollisionSpace.h"
|
||||
#include "SHContactManager.h"
|
||||
#include "SHContactSolver.h"
|
||||
#include "SHRigidBody.h"
|
||||
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates the overall simulation of physics. The bulk of dynamics are handled here,
|
||||
* with the collision detection handled by an attached collision space. <br/>
|
||||
* A collision space must be created separately and attached with the world.
|
||||
*/
|
||||
class SH_API SHPhysicsWorld
|
||||
{
|
||||
public:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
struct WorldSettings
|
||||
{
|
||||
public:
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-------------------------------------------------------------------------------*/
|
||||
|
||||
SHVec3 gravity = SHVec3{ 0.0f, -9.81f, 0.0f };
|
||||
uint16_t numVelocitySolverIterations = 10;
|
||||
uint16_t numPositionSolverIterations = 5; // Unused until PGS is implemented
|
||||
bool sleepingEnabled = true;
|
||||
};
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsWorld (const WorldSettings& worldSettings = WorldSettings{}) noexcept;
|
||||
~SHPhysicsWorld () noexcept;
|
||||
|
||||
SHPhysicsWorld (const SHPhysicsWorld&) = delete;
|
||||
SHPhysicsWorld (SHPhysicsWorld&&) = delete;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsWorld& operator=(const SHPhysicsWorld&) = delete;
|
||||
SHPhysicsWorld& operator=(SHPhysicsWorld&&) = delete;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
const SHContactManager::ContactPoints& GetContactPoints () const noexcept;
|
||||
const SHContactManager::TriggerEvents& GetTriggerEvents () const noexcept;
|
||||
const SHContactManager::CollisionEvents& GetCollisionEvents () const noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCollisionSpace(SHCollisionSpace* collisionSpace) noexcept;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a rigid body to the world for it to be simulated using motion dynamics.
|
||||
* @param rigidBody
|
||||
* A rigid body to add. Duplicates will be ignored.
|
||||
*/
|
||||
void AddRigidBody (SHRigidBody* rigidBody) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Removes a rigid body from the world. It's motion will not be affected unless
|
||||
* explicitly modified.
|
||||
* @param rigidBody
|
||||
* A rigid body to add. Duplicates will be ignored.
|
||||
*/
|
||||
void RemoveRigidBody (SHRigidBody* rigidBody) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Performs a single simulation step. <br/>
|
||||
* Detect Collisions -> Integrate Forces -> Resolve Contacts -> Integrate Velocities
|
||||
* @param dt
|
||||
* A discrete time step for the simulation. This should be consistent for deterministic
|
||||
* behaviour.
|
||||
*/
|
||||
void Step (float dt);
|
||||
|
||||
private:
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// EntityIDs are used to map resolved constraints back to bodies
|
||||
using RigidBodies = std::unordered_map<EntityID, SHRigidBody*>;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
WorldSettings settings;
|
||||
SHCollisionSpace* collisionSpace;
|
||||
|
||||
RigidBodies rigidBodies;
|
||||
SHContactManager contactManager;
|
||||
SHContactSolver contactSolver;
|
||||
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
/* Function Members */
|
||||
/*---------------------------------------------------------------------------------*/
|
||||
|
||||
// TODO: Move to island when islands are set up
|
||||
void integrateForces (SHRigidBody& rigidBody, float dt) const noexcept;
|
||||
void integrateVelocities (SHRigidBody& rigidBody, float dt) const noexcept;
|
||||
};
|
||||
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,765 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHRigidBody.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Rigid Body.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHRigidBody.h"
|
||||
|
||||
// Project Headers
|
||||
#include <complex.h>
|
||||
#include <numeric>
|
||||
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
#include "Tools/Logger/SHLogger.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHRigidBody::SHRigidBody(EntityID eid, Type type) noexcept
|
||||
: entityID { eid }
|
||||
, collider { nullptr }
|
||||
, bodyType { type }
|
||||
, gravityScale { 1.0f }
|
||||
, invMass { type == Type::DYNAMIC ? 1.0f : 0.0f }
|
||||
, linearDrag { 0.01f }
|
||||
, angularDrag { 0.01f }
|
||||
, flags { 0U }
|
||||
{
|
||||
// Set default flags
|
||||
flags |= 1U << 0; // Body is active
|
||||
flags |= 1U << 2; // Sleeping is enabled
|
||||
flags |= 1U << 3; // Gravity is enabled
|
||||
|
||||
// TODO: Compute inertia if body is dynamic
|
||||
}
|
||||
|
||||
SHRigidBody::SHRigidBody(const SHRigidBody& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
, collider { nullptr }
|
||||
, bodyType { rhs.bodyType }
|
||||
, gravityScale { rhs.gravityScale }
|
||||
, invMass { rhs.invMass }
|
||||
, linearDrag { rhs.linearDrag }
|
||||
, angularDrag { rhs.angularDrag }
|
||||
, localInvInertia { rhs.localInvInertia }
|
||||
, worldInvInertia { rhs.worldInvInertia }
|
||||
, localCentroid { rhs.localCentroid }
|
||||
, worldCentroid { rhs.worldCentroid }
|
||||
, flags { rhs.flags }
|
||||
, motionState { rhs.motionState }
|
||||
{
|
||||
// All other properties are defaulted to 0 to not carry over any potential errors / invalid values.
|
||||
}
|
||||
|
||||
SHRigidBody::SHRigidBody(SHRigidBody&& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
, collider { nullptr }
|
||||
, bodyType { rhs.bodyType }
|
||||
, gravityScale { rhs.gravityScale }
|
||||
, invMass { rhs.invMass }
|
||||
, linearDrag { rhs.linearDrag }
|
||||
, angularDrag { rhs.angularDrag }
|
||||
, localInvInertia { rhs.localInvInertia }
|
||||
, worldInvInertia { rhs.worldInvInertia }
|
||||
, localCentroid { rhs.localCentroid }
|
||||
, worldCentroid { rhs.worldCentroid }
|
||||
, flags { rhs.flags }
|
||||
, motionState { std::move(rhs.motionState) }
|
||||
{
|
||||
// All other properties are defaulted to 0 to not carry over any potential errors / invalid values.
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHRigidBody& SHRigidBody::operator=(const SHRigidBody& rhs) noexcept
|
||||
{
|
||||
// Handle self assignment
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
entityID = rhs.entityID;
|
||||
|
||||
// Deep copy the collider
|
||||
*collider = *rhs.collider;
|
||||
bodyType = rhs.bodyType;
|
||||
gravityScale = rhs.gravityScale;
|
||||
invMass = rhs.invMass;
|
||||
linearDrag = rhs.linearDrag;
|
||||
angularDrag = rhs.angularDrag;
|
||||
localInvInertia = rhs.localInvInertia;
|
||||
worldInvInertia = rhs.worldInvInertia;
|
||||
localCentroid = rhs.localCentroid;
|
||||
worldCentroid = rhs.worldCentroid;
|
||||
flags = rhs.flags;
|
||||
motionState = rhs.motionState;
|
||||
|
||||
// All other properties are defaulted to 0 to not carry over any potential errors / invalid values.
|
||||
accumulatedForce = SHVec3::Zero;
|
||||
accumulatedTorque = SHVec3::Zero;
|
||||
linearVelocity = SHVec3::Zero;
|
||||
angularVelocity = SHVec3::Zero;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHRigidBody& SHRigidBody::operator=(SHRigidBody&& rhs) noexcept
|
||||
{
|
||||
entityID = rhs.entityID;
|
||||
|
||||
// Deep copy the collider
|
||||
*collider = *rhs.collider;
|
||||
bodyType = rhs.bodyType;
|
||||
gravityScale = rhs.gravityScale;
|
||||
invMass = rhs.invMass;
|
||||
linearDrag = rhs.linearDrag;
|
||||
angularDrag = rhs.angularDrag;
|
||||
localInvInertia = rhs.localInvInertia;
|
||||
worldInvInertia = rhs.worldInvInertia;
|
||||
localCentroid = rhs.localCentroid;
|
||||
worldCentroid = rhs.worldCentroid;
|
||||
flags = rhs.flags;
|
||||
motionState = std::move(rhs.motionState);
|
||||
|
||||
// All other properties are defaulted to 0 to not carry over any potential errors / invalid values.
|
||||
accumulatedForce = SHVec3::Zero;
|
||||
accumulatedTorque = SHVec3::Zero;
|
||||
linearVelocity = SHVec3::Zero;
|
||||
angularVelocity = SHVec3::Zero;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHRigidBody::Type SHRigidBody::GetType() const noexcept
|
||||
{
|
||||
return bodyType;
|
||||
}
|
||||
|
||||
float SHRigidBody::GetGravityScale() const noexcept
|
||||
{
|
||||
return gravityScale;
|
||||
}
|
||||
|
||||
float SHRigidBody::GetMass() const noexcept
|
||||
{
|
||||
return 1.0f/ invMass;
|
||||
}
|
||||
|
||||
float SHRigidBody::GetLinearDrag() const noexcept
|
||||
{
|
||||
return linearDrag;
|
||||
}
|
||||
|
||||
float SHRigidBody::GetAngularDrag() const noexcept
|
||||
{
|
||||
return angularDrag;
|
||||
}
|
||||
|
||||
const SHMatrix& SHRigidBody::GetLocalInvInertia() const noexcept
|
||||
{
|
||||
return localInvInertia;
|
||||
}
|
||||
|
||||
const SHMatrix& SHRigidBody::GetWorldInvInertia() const noexcept
|
||||
{
|
||||
return worldInvInertia;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetLocalCentroid() const noexcept
|
||||
{
|
||||
return localCentroid;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetWorldCentroid() const noexcept
|
||||
{
|
||||
return worldCentroid;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetForce() const noexcept
|
||||
{
|
||||
return accumulatedForce;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetTorque() const noexcept
|
||||
{
|
||||
return accumulatedTorque;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetLinearVelocity() const noexcept
|
||||
{
|
||||
// Check if linear velocity needs to be constrained
|
||||
|
||||
return linearVelocity;
|
||||
}
|
||||
|
||||
const SHVec3& SHRigidBody::GetAngularVelocity() const noexcept
|
||||
{
|
||||
return angularVelocity;
|
||||
}
|
||||
|
||||
// Flags
|
||||
|
||||
bool SHRigidBody::IsActive() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 0;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::IsSleeping() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 1;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::IsSleepingEnabled() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 2;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::IsGravityEnabled() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 3;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::IsAutoMassEnabled() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 4;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::IsTriggerInMassData() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 6;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezePositionX() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 10;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezePositionY() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 11;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezePositionZ() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 12;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezeRotationX() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 13;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezeRotationY() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 14;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
bool SHRigidBody::GetFreezeRotationZ() const noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 15;
|
||||
return flags & (1U << FLAG_POS);
|
||||
}
|
||||
|
||||
SHMotionState& SHRigidBody::GetMotionState() noexcept
|
||||
{
|
||||
return motionState;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Functions Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHRigidBody::SetCollider(SHCollider* c) noexcept
|
||||
{
|
||||
collider = c;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetType(Type newType) noexcept
|
||||
{
|
||||
if (newType == bodyType)
|
||||
return;
|
||||
|
||||
bodyType = newType;
|
||||
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
{
|
||||
invMass = 0.0f;
|
||||
localInvInertia.m[0][0] = localInvInertia.m[1][1] = localInvInertia.m[2][2] = 0.0f;
|
||||
worldInvInertia.m[0][0] = worldInvInertia.m[1][1] = worldInvInertia.m[2][2] = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
invMass = 1.0f;
|
||||
localInvInertia = SHMatrix::Identity;
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetGravityScale(float newGravityScale) noexcept
|
||||
{
|
||||
gravityScale = newGravityScale;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetMass(float newMass) noexcept
|
||||
{
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
{
|
||||
invMass = 0.0f;
|
||||
SHLOG_WARNING("Cannot set mass of a non-Dynamic Body {}", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
if (newMass < 0.0f)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set mass below 0. Object {}'s mass will remain unchanged.", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
invMass = 1.0f / newMass;
|
||||
|
||||
// Turn off automass
|
||||
static constexpr unsigned int AUTO_MASS_FLAG = 4;
|
||||
static constexpr uint16_t VALUE = 1U << AUTO_MASS_FLAG;
|
||||
|
||||
flags &= ~(VALUE);
|
||||
ComputeMassData();
|
||||
}
|
||||
|
||||
void SHRigidBody::SetLinearDrag(float newLinearDrag) noexcept
|
||||
{
|
||||
if (bodyType == Type::STATIC)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set linear drag of a Static Body {}", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
if (newLinearDrag < 0.0f)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set drag below 0. Object {}'s linear drag will remain unchanged.", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
linearDrag = newLinearDrag;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetAngularDrag(float newAngularDrag) noexcept
|
||||
{
|
||||
if (bodyType == Type::STATIC)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set angular drag of a Static Body {}", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
if (newAngularDrag < 0.0f)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set drag below 0. Object {}'s angular drag will remain unchanged.", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
angularDrag = newAngularDrag;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetLinearVelocity(const SHVec3& newLinearVelocity) noexcept
|
||||
{
|
||||
if (bodyType == Type::STATIC)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set linear velocity of a Static Body {}", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
linearVelocity = newLinearVelocity;
|
||||
constrainLinearVelocities();
|
||||
}
|
||||
|
||||
void SHRigidBody::SetAngularVelocity(const SHVec3& newAngularVelocity) noexcept
|
||||
{
|
||||
if (bodyType == Type::STATIC)
|
||||
{
|
||||
SHLOG_WARNING("Cannot set angular velocity of a Static Body {}", entityID)
|
||||
return;
|
||||
}
|
||||
|
||||
angularVelocity = newAngularVelocity;
|
||||
constrainAngularVelocities();
|
||||
}
|
||||
|
||||
void SHRigidBody::SetIsActive(bool isActive) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 0;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
isActive ? flags |= VALUE : flags &= ~VALUE;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetIsSleeping(bool isSleeping) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 1;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (isSleeping)
|
||||
{
|
||||
flags |= VALUE;
|
||||
|
||||
ClearForces();
|
||||
linearVelocity = SHVec3::Zero;
|
||||
angularVelocity = SHVec3::Zero;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetSleepingEnabled(bool enableSleeping) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 2;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (enableSleeping)
|
||||
{
|
||||
flags |= VALUE;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
// Wake the body
|
||||
SetIsSleeping(false);
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetGravityEnabled(bool enableGravity) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 3;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
enableGravity ? flags |= VALUE : flags &= ~VALUE;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetAutoMassEnabled(bool enableAutoMass) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 4;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (enableAutoMass)
|
||||
{
|
||||
flags |= VALUE;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
// Use default mass of 1
|
||||
invMass = 1.0f;
|
||||
}
|
||||
|
||||
ComputeMassData();
|
||||
}
|
||||
|
||||
void SHRigidBody::SetTriggerInMassData(bool triggerInMassData) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 6;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
triggerInMassData ? flags |= VALUE : flags &= ~VALUE;
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezePositionX(bool freezePositionX) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 10;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezePositionX)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset linear velocity along X-axis
|
||||
linearVelocity.x = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezePositionY(bool freezePositionY) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 11;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezePositionY)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset linear velocity along Y-axis
|
||||
linearVelocity.y = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezePositionZ(bool freezePositionZ) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 12;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezePositionZ)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset linear velocity along Z-axis
|
||||
linearVelocity.z = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezeRotationX(bool freezeRotationX) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 13;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezeRotationX)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset angular velocity along X-axis
|
||||
angularVelocity.x = 0.0f;
|
||||
// Set inertia tensor on the x-axis to 0
|
||||
localInvInertia.m[0][0] = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
ComputeMassData();
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezeRotationY(bool freezeRotationY) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 14;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezeRotationY)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset angular velocity along Y-axis
|
||||
angularVelocity.y = 0.0f;
|
||||
// Set inertia tensor on the y-axis to 0
|
||||
localInvInertia.m[1][1] = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
ComputeMassData();
|
||||
}
|
||||
}
|
||||
|
||||
void SHRigidBody::SetFreezeRotationZ(bool freezeRotationZ) noexcept
|
||||
{
|
||||
static constexpr unsigned int FLAG_POS = 15;
|
||||
static constexpr uint16_t VALUE = 1U << FLAG_POS;
|
||||
|
||||
if (freezeRotationZ)
|
||||
{
|
||||
flags |= VALUE;
|
||||
// Reset angular velocity along Z-axis
|
||||
angularVelocity.z = 0.0f;
|
||||
// Set inertia tensor on the z-axis to 0
|
||||
localInvInertia.m[2][2] = 0.0f;
|
||||
}
|
||||
else
|
||||
{
|
||||
flags &= ~VALUE;
|
||||
ComputeMassData();
|
||||
}
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definition */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHRigidBody::AddForce(const SHVec3& force, const SHVec3& pos) noexcept
|
||||
{
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
return;
|
||||
|
||||
accumulatedForce += force;
|
||||
accumulatedTorque += SHVec3::Cross(pos, force);
|
||||
}
|
||||
|
||||
void SHRigidBody::AddImpulse(const SHVec3& impulse, const SHVec3& pos) noexcept
|
||||
{
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
return;
|
||||
|
||||
linearVelocity += impulse * invMass;
|
||||
angularVelocity += worldInvInertia * SHVec3::Cross(pos, impulse);
|
||||
}
|
||||
|
||||
void SHRigidBody::AddTorque(const SHVec3& torque) noexcept
|
||||
{
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
return;
|
||||
|
||||
accumulatedTorque += torque;
|
||||
}
|
||||
|
||||
void SHRigidBody::ClearForces() noexcept
|
||||
{
|
||||
accumulatedForce = SHVec3::Zero;
|
||||
accumulatedTorque = SHVec3::Zero;
|
||||
}
|
||||
|
||||
void SHRigidBody::ComputeWorldData() noexcept
|
||||
{
|
||||
const SHMatrix R = SHMatrix::Rotate(motionState.orientation);
|
||||
const SHMatrix RT = SHMatrix::Transpose(R);
|
||||
|
||||
// Compute world centroid
|
||||
worldCentroid = (R * localCentroid) + motionState.position;
|
||||
|
||||
if (bodyType != Type::DYNAMIC)
|
||||
return;
|
||||
|
||||
// Compute world inertia
|
||||
worldInvInertia = R * (localInvInertia * RT);
|
||||
}
|
||||
|
||||
void SHRigidBody::ComputeMassData() noexcept
|
||||
{
|
||||
// Reset centroid
|
||||
localCentroid = SHVec3::Zero;
|
||||
localInvInertia = SHMatrix::Identity;
|
||||
|
||||
// In the instance the body is a particle
|
||||
if (!collider || collider->GetCollisionShapes().empty())
|
||||
{
|
||||
localInvInertia.m[0][0] = localInvInertia.m[1][1] = localInvInertia.m[2][2] = invMass;
|
||||
return;
|
||||
}
|
||||
|
||||
const float CUSTOM_MASS = 1.0f / invMass;
|
||||
const bool AUTO_MASS = IsAutoMassEnabled();
|
||||
const bool INCLUDE_TRIGGERS = IsTriggerInMassData();
|
||||
|
||||
|
||||
// Compute Total mass and store individual masses if custom mass is being used.
|
||||
// Compute local centroid at the same time
|
||||
|
||||
// Zero matrix;
|
||||
SHMatrix J = SHMatrix::Zero;
|
||||
|
||||
float totalMass = 0.0f;
|
||||
std::vector<float> trueMass; // We store the true masses here for calculating the ratio with custom masses.
|
||||
|
||||
const auto& SHAPES = collider->GetCollisionShapes();
|
||||
for (auto* shape : SHAPES)
|
||||
{
|
||||
// We skip triggers by default
|
||||
if (shape->IsTrigger() && !INCLUDE_TRIGGERS)
|
||||
continue;
|
||||
|
||||
// p = m/v, therefore m = pv. This is the true mass of the shape.
|
||||
const float MASS = shape->GetDensity() * shape->GetVolume();
|
||||
totalMass += MASS;
|
||||
|
||||
trueMass.emplace_back(MASS);
|
||||
|
||||
// Weighted sum of masses contribute to the centroid's location using the collider's local position.
|
||||
localCentroid += MASS * shape->GetRelativeCentroid();
|
||||
}
|
||||
|
||||
if (totalMass > 0.0f)
|
||||
{
|
||||
localCentroid /= totalMass;
|
||||
|
||||
if (AUTO_MASS)
|
||||
invMass = 1.0f / totalMass;
|
||||
}
|
||||
|
||||
const SHMatrix R = SHMatrix::Rotate(motionState.orientation);
|
||||
const SHMatrix RT = SHMatrix::Transpose(R);
|
||||
|
||||
// We need the world centroid to compute the offset of the collider from the body's centroid
|
||||
worldCentroid = (R * localCentroid) + motionState.position;
|
||||
|
||||
for (size_t i = 0; i < SHAPES.size(); ++i)
|
||||
{
|
||||
const auto* SHAPE = SHAPES[i];
|
||||
|
||||
// We skip triggers by default
|
||||
if (SHAPE->IsTrigger() && !INCLUDE_TRIGGERS)
|
||||
continue;
|
||||
|
||||
// If using custom mass, take the ratio of the mass
|
||||
float actualMass = trueMass[i];
|
||||
if (!AUTO_MASS)
|
||||
actualMass *= CUSTOM_MASS / totalMass;
|
||||
|
||||
// Convert inertia tensor into local-space of the body
|
||||
// R * I * RT = R * (I * RT)
|
||||
SHMatrix I = SHAPE->GetInertiaTensor( actualMass ) * RT;
|
||||
I = R * I;
|
||||
|
||||
// Parallel Axis Theorem
|
||||
// https://en.wikipedia.org/wiki/Parallel_axis_theorem
|
||||
// J = I + m((R /dot R)E_3 - R /outerProduct R)
|
||||
const SHVec3 R = SHAPE->GetWorldCentroid() - worldCentroid;
|
||||
const float R_MAG2 = R.LengthSquared();
|
||||
const SHMatrix R_OX_R = SHVec3::OuterProduct(R, R);
|
||||
|
||||
J += I + actualMass * (SHMatrix::Identity * R_MAG2 - R_OX_R);
|
||||
}
|
||||
|
||||
// Set diagonals then invert
|
||||
localInvInertia.m[0][0] = J.m[0][0];
|
||||
localInvInertia.m[1][1] = J.m[1][1];
|
||||
localInvInertia.m[2][2] = J.m[2][2];
|
||||
|
||||
localInvInertia = SHMatrix::Inverse(localInvInertia);
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Function Definition */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHRigidBody::constrainLinearVelocities() noexcept
|
||||
{
|
||||
linearVelocity.x = GetFreezePositionX() ? 0.0f : linearVelocity.x;
|
||||
linearVelocity.y = GetFreezePositionY() ? 0.0f : linearVelocity.y;
|
||||
linearVelocity.z = GetFreezePositionZ() ? 0.0f : linearVelocity.z;
|
||||
}
|
||||
|
||||
void SHRigidBody::constrainAngularVelocities() noexcept
|
||||
{
|
||||
angularVelocity.x = GetFreezeRotationX() ? 0.0f : angularVelocity.x;
|
||||
angularVelocity.y = GetFreezeRotationY() ? 0.0f : angularVelocity.y;
|
||||
angularVelocity.z = GetFreezeRotationZ() ? 0.0f : angularVelocity.z;
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,268 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHRigidBody.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Rigid Body.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "ECS_Base/Entity/SHEntity.h"
|
||||
#include "Math/SHMatrix.h"
|
||||
#include "Math/Vector/SHVec3.h"
|
||||
#include "SHMotionState.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
/* Forward Declarations */
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
|
||||
class SHCollider;
|
||||
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a Rigid Body used in Physics Simulations
|
||||
*/
|
||||
class SH_API SHRigidBody
|
||||
{
|
||||
private:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Friends */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
friend class SHPhysicsWorld;
|
||||
friend class SHContactSolver;
|
||||
|
||||
public:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
enum class Type
|
||||
{
|
||||
STATIC // Immovable body with infinite mass
|
||||
, KINEMATIC // Only movable by setting velocity, unaffected by forces. Has infinite mass.
|
||||
, DYNAMIC // Affected by forces.
|
||||
};
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHRigidBody (EntityID eid, Type type) noexcept;
|
||||
SHRigidBody (const SHRigidBody& rhs) noexcept;
|
||||
SHRigidBody (SHRigidBody&& rhs) noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHRigidBody& operator= (const SHRigidBody& rhs) noexcept;
|
||||
SHRigidBody& operator= (SHRigidBody&& rhs) noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Getter Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
[[nodiscard]] Type GetType () const noexcept;
|
||||
|
||||
[[nodiscard]] float GetGravityScale () const noexcept;
|
||||
|
||||
[[nodiscard]] float GetMass () const noexcept;
|
||||
[[nodiscard]] float GetLinearDrag () const noexcept;
|
||||
[[nodiscard]] float GetAngularDrag () const noexcept;
|
||||
|
||||
[[nodiscard]] const SHMatrix& GetLocalInvInertia () const noexcept;
|
||||
[[nodiscard]] const SHMatrix& GetWorldInvInertia () const noexcept;
|
||||
|
||||
[[nodiscard]] const SHVec3& GetLocalCentroid () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetWorldCentroid () const noexcept;
|
||||
|
||||
[[nodiscard]] const SHVec3& GetForce () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetTorque () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetLinearVelocity () const noexcept;
|
||||
[[nodiscard]] const SHVec3& GetAngularVelocity () const noexcept;
|
||||
|
||||
// Flags
|
||||
|
||||
[[nodiscard]] bool IsActive () const noexcept;
|
||||
[[nodiscard]] bool IsSleeping () const noexcept;
|
||||
[[nodiscard]] bool IsSleepingEnabled () const noexcept;
|
||||
[[nodiscard]] bool IsGravityEnabled () const noexcept;
|
||||
[[nodiscard]] bool IsAutoMassEnabled () const noexcept;
|
||||
[[nodiscard]] bool IsTriggerInMassData () const noexcept;
|
||||
[[nodiscard]] bool GetFreezePositionX () const noexcept;
|
||||
[[nodiscard]] bool GetFreezePositionY () const noexcept;
|
||||
[[nodiscard]] bool GetFreezePositionZ () const noexcept;
|
||||
[[nodiscard]] bool GetFreezeRotationX () const noexcept;
|
||||
[[nodiscard]] bool GetFreezeRotationY () const noexcept;
|
||||
[[nodiscard]] bool GetFreezeRotationZ () const noexcept;
|
||||
|
||||
[[nodiscard]] SHMotionState& GetMotionState () noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Setter Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SetCollider (SHCollider* c) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Changing the type from non-Dynamic to Dynamic will set the default
|
||||
* mass and drag values.
|
||||
*/
|
||||
void SetType (Type newType) noexcept;
|
||||
|
||||
void SetGravityScale (float newGravityScale) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Mass is only modifiable for Dynamic bodies.
|
||||
* @param newMass
|
||||
* The new mass to set. Values below 0 will be ignored.
|
||||
*/
|
||||
void SetMass (float newMass) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Drag is only modifiable for non-Static bodies.
|
||||
* @param newLinearDrag
|
||||
* The new drag to set. Values below 0 will be ignored.
|
||||
*/
|
||||
void SetLinearDrag (float newLinearDrag) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Drag is only modifiable for non-Static bodies.
|
||||
* @param newAngularDrag
|
||||
* The new drag to set. Values below 0 will be ignored.
|
||||
*/
|
||||
void SetAngularDrag (float newAngularDrag) noexcept;
|
||||
|
||||
void SetLinearVelocity (const SHVec3& newLinearVelocity) noexcept;
|
||||
void SetAngularVelocity (const SHVec3& newAngularVelocity)noexcept;
|
||||
|
||||
// Flags
|
||||
|
||||
void SetIsActive (bool isActive) noexcept;
|
||||
void SetIsSleeping (bool isSleeping) noexcept;
|
||||
void SetSleepingEnabled (bool enableSleeping) noexcept;
|
||||
void SetGravityEnabled (bool enableGravity) noexcept;
|
||||
void SetAutoMassEnabled (bool enableAutoMass) noexcept;
|
||||
void SetTriggerInMassData(bool triggerInMassData) noexcept;
|
||||
void SetFreezePositionX (bool freezePositionX) noexcept;
|
||||
void SetFreezePositionY (bool freezePositionY) noexcept;
|
||||
void SetFreezePositionZ (bool freezePositionZ) noexcept;
|
||||
void SetFreezeRotationX (bool freezeRotationX) noexcept;
|
||||
void SetFreezeRotationY (bool freezeRotationY) noexcept;
|
||||
void SetFreezeRotationZ (bool freezeRotationZ) noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds a force to the body with an offset from it's center of mass. <br/>
|
||||
* Non-dynamic bodies will be ignored.
|
||||
* @param force
|
||||
* The force to add to the body.
|
||||
* @param pos
|
||||
* The position from the center of mass to offset the force. Defaults to zero.
|
||||
*/
|
||||
void AddForce (const SHVec3& force, const SHVec3& pos = SHVec3::Zero) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds an impulse to the body with an offset from it's center of mass. <br/>
|
||||
* Non-dynamic bodies will be ignored.
|
||||
* @param impulse
|
||||
* The impulse to add to the body.
|
||||
* @param pos
|
||||
* The position from the center of mass to offset the impulse. Defaults to zero.
|
||||
*/
|
||||
void AddImpulse (const SHVec3& impulse, const SHVec3& pos = SHVec3::Zero) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Adds torque to rotate the body about it's centroid. <br/>
|
||||
* Non-dynamic bodies will be ignored.
|
||||
* @param torque
|
||||
* The torque to add to the body.
|
||||
*/
|
||||
void AddTorque (const SHVec3& torque) noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Removes all the forces from the body.
|
||||
*/
|
||||
void ClearForces () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes the centroid and invInertia in world space.
|
||||
*/
|
||||
void ComputeWorldData () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Computes the centroid and inertia of the object. <br/>
|
||||
* If auto-mass is enabled, computes the mass. <br/>
|
||||
* If auto-mass is disabled, the inertia is computed based on the ratio each shape's volume over the total volume.
|
||||
*
|
||||
*/
|
||||
void ComputeMassData () noexcept;
|
||||
|
||||
private:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
// The entityID here is only meant for linking with the actual component in the engine.
|
||||
EntityID entityID;
|
||||
SHCollider* collider;
|
||||
|
||||
Type bodyType;
|
||||
|
||||
float gravityScale;
|
||||
|
||||
float invMass;
|
||||
float linearDrag;
|
||||
float angularDrag;
|
||||
|
||||
SHMatrix localInvInertia;
|
||||
SHMatrix worldInvInertia;
|
||||
|
||||
SHVec3 localCentroid;
|
||||
SHVec3 worldCentroid;
|
||||
|
||||
SHVec3 accumulatedForce;
|
||||
SHVec3 accumulatedTorque;
|
||||
|
||||
SHVec3 linearVelocity;
|
||||
SHVec3 angularVelocity;
|
||||
|
||||
// aZ aY aX pZ pY pX 0 0 0 addTriggersToMassData inIsland autoMass enableGravity enableSleeping sleeping active
|
||||
uint16_t flags;
|
||||
|
||||
SHMotionState motionState;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void constrainLinearVelocities () noexcept;
|
||||
void constrainAngularVelocities () noexcept;
|
||||
|
||||
};
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,163 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsObject.cpp
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Implementation for a Physics Object.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#include <SHpch.h>
|
||||
|
||||
// Primary Header
|
||||
#include "SHPhysicsObject.h"
|
||||
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
#include "Physics/Collision/SHCompositeCollider.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructor & Destructor Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject::SHPhysicsObject(EntityID eid) noexcept
|
||||
: entityID { eid }
|
||||
{}
|
||||
|
||||
SHPhysicsObject::SHPhysicsObject(const SHPhysicsObject& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
{
|
||||
deepCopyComponents(rhs.rigidBody, rhs.collider);
|
||||
}
|
||||
|
||||
SHPhysicsObject::SHPhysicsObject(SHPhysicsObject&& rhs) noexcept
|
||||
: entityID { rhs.entityID }
|
||||
{
|
||||
deepCopyComponents(rhs.rigidBody, rhs.collider);
|
||||
}
|
||||
|
||||
SHPhysicsObject::~SHPhysicsObject() noexcept
|
||||
{
|
||||
entityID = MAX_EID;
|
||||
|
||||
delete rigidBody;
|
||||
rigidBody = nullptr;
|
||||
|
||||
delete collider;
|
||||
collider = nullptr;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overload Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject& SHPhysicsObject::operator=(const SHPhysicsObject& rhs) noexcept
|
||||
{
|
||||
if (this == &rhs)
|
||||
return *this;
|
||||
|
||||
entityID = rhs.entityID;
|
||||
|
||||
deepCopyComponents(rhs.rigidBody, rhs.collider);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
SHPhysicsObject& SHPhysicsObject::operator=(SHPhysicsObject&& rhs) noexcept
|
||||
{
|
||||
entityID = rhs.entityID;
|
||||
|
||||
deepCopyComponents(rhs.rigidBody, rhs.collider);
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Public Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
bool SHPhysicsObject::IsEmpty() const noexcept
|
||||
{
|
||||
return rigidBody == nullptr && collider == nullptr;
|
||||
}
|
||||
|
||||
SHRigidBody* SHPhysicsObject::CreateRigidBody(SHRigidBody::Type bodyType)
|
||||
{
|
||||
if (rigidBody)
|
||||
{
|
||||
SHLOG_INFO_D("Rigid body for Entity {} has already been created!", entityID)
|
||||
return rigidBody;
|
||||
}
|
||||
|
||||
rigidBody = new SHRigidBody{ entityID, bodyType };
|
||||
|
||||
// Link with collider if it exists
|
||||
if (collider)
|
||||
{
|
||||
collider->SetRigidBody(rigidBody);
|
||||
rigidBody->SetCollider(collider);
|
||||
}
|
||||
|
||||
rigidBody->ComputeMassData();
|
||||
return rigidBody;
|
||||
}
|
||||
|
||||
void SHPhysicsObject::DestroyRigidBody() noexcept
|
||||
{
|
||||
delete rigidBody;
|
||||
rigidBody = nullptr;
|
||||
|
||||
// Unlink with collider
|
||||
if (collider)
|
||||
collider->SetRigidBody(nullptr);
|
||||
}
|
||||
|
||||
SHCollider* SHPhysicsObject::CreateCompositeCollider(const SHTransform& transform)
|
||||
{
|
||||
if (collider)
|
||||
{
|
||||
SHLOG_INFO_D("Collider for Entity {} has already been created!", entityID)
|
||||
return collider;
|
||||
}
|
||||
|
||||
collider = new SHCompositeCollider{ entityID, transform };
|
||||
|
||||
// Link with rigidBody if it exists
|
||||
if (rigidBody)
|
||||
{
|
||||
rigidBody->SetCollider(collider);
|
||||
collider->SetRigidBody(rigidBody);
|
||||
}
|
||||
|
||||
return collider;
|
||||
}
|
||||
|
||||
void SHPhysicsObject::DestroyCollider() noexcept
|
||||
{
|
||||
delete collider;
|
||||
collider = nullptr;
|
||||
|
||||
// Unlink with rigid body
|
||||
if (rigidBody)
|
||||
{
|
||||
rigidBody->SetCollider(nullptr);
|
||||
rigidBody->ComputeMassData();
|
||||
}
|
||||
}
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Private Member Function Definitions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void SHPhysicsObject::deepCopyComponents(const SHRigidBody* rhsRigidBody, const SHCollider* rhsCollider)
|
||||
{
|
||||
if (rhsRigidBody)
|
||||
rigidBody = new SHRigidBody{ *rhsRigidBody };
|
||||
|
||||
if (rhsCollider)
|
||||
collider = new SHCollider { *rhsCollider };
|
||||
}
|
||||
|
||||
} // namespace SHADE
|
|
@ -1,109 +0,0 @@
|
|||
/****************************************************************************************
|
||||
* \file SHPhysicsObject.h
|
||||
* \author Diren D Bharwani, diren.dbharwani, 390002520
|
||||
* \brief Interface for a Physics Object.
|
||||
*
|
||||
* \copyright Copyright (C) 2022 DigiPen Institute of Technology. Reproduction or
|
||||
* disclosure of this file or its contents without the prior written consent
|
||||
* of DigiPen Institute of Technology is prohibited.
|
||||
****************************************************************************************/
|
||||
|
||||
#pragma once
|
||||
|
||||
// Project Headers
|
||||
#include "Physics/Collision/SHCollider.h"
|
||||
#include "Physics/Dynamics/SHRigidBody.h"
|
||||
|
||||
namespace SHADE
|
||||
{
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
/* Type Definitions */
|
||||
/*-------------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Encapsulates a rigid body and a collider tied to an Entity.
|
||||
*/
|
||||
struct SH_API SHPhysicsObject
|
||||
{
|
||||
public:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Data Members */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
EntityID entityID = MAX_EID;
|
||||
SHRigidBody* rigidBody = nullptr;
|
||||
SHCollider* collider = nullptr;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Constructors & Destructor */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject (EntityID eid) noexcept;
|
||||
SHPhysicsObject (const SHPhysicsObject& rhs) noexcept;
|
||||
SHPhysicsObject (SHPhysicsObject&& rhs) noexcept;
|
||||
~SHPhysicsObject () noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Operator Overloads */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
SHPhysicsObject& operator=(const SHPhysicsObject& rhs) noexcept;
|
||||
SHPhysicsObject& operator=(SHPhysicsObject&& rhs) noexcept;
|
||||
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Checks if the physics object has a rigid body or a collider.
|
||||
* @return
|
||||
* True if the physics object has neither a rigid body nor a collider.
|
||||
*/
|
||||
[[nodiscard]] bool IsEmpty () const noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Creates a rigid body for this physics object.
|
||||
* @param bodyType
|
||||
* The rigid body's type. Can be modified after creation.
|
||||
* @return
|
||||
* Pointer to the rigid body that was created. The memory of this rigid body is managed
|
||||
* by the physics object itself.
|
||||
*/
|
||||
SHRigidBody* CreateRigidBody (SHRigidBody::Type bodyType);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Destroys the rigid body of this physics object and frees the memory.
|
||||
*/
|
||||
void DestroyRigidBody () noexcept;
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Creates a collider for this physics object.
|
||||
* @param colliderType
|
||||
* The collider's type. Should not be modified after creation.
|
||||
* @param transform.
|
||||
* The world transform of the collider. Defaults to the identity transform.
|
||||
* @return
|
||||
* Pointer to the collider that was created. The memory of this collider is managed
|
||||
* by the physics object itself.
|
||||
*/
|
||||
SHCollider* CreateCompositeCollider (const SHTransform& transform = SHTransform::Identity);
|
||||
|
||||
/**
|
||||
* @brief
|
||||
* Destroys the collider of this physics object and frees the memory.
|
||||
*/
|
||||
void DestroyCollider () noexcept;
|
||||
|
||||
private:
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
/* Member Functions */
|
||||
/*-----------------------------------------------------------------------------------*/
|
||||
|
||||
void deepCopyComponents(const SHRigidBody* rhsRigidBody, const SHCollider* rhsCollider);
|
||||
};
|
||||
} // namespace SHADE
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue